- Name
- Propylene Glycol
- InChI
- InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3
- InChI Key
- DNIAPMSPPWPWGF-UHFFFAOYSA-N
- Formula
- C3H8O2
- SMILES
- CC(O)CO
- Mol. Weight (g/mol)
- 76.09
- CAS
- 57-55-6
- Name
- Acetonitrile
- InChI
- InChI=1S/C2H3N/c1-2-3/h1H3
- InChI Key
- WEVYAHXRMPXWCK-UHFFFAOYSA-N
- Formula
- C2H3N
- SMILES
- CC#N
- Mol. Weight (g/mol)
- 41.05
- CAS
- 75-05-8
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetonitrile (2) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0546 |
| 293.15 | 0.1127 | 0.0314 |
| 293.15 | 0.2000 | 0.0203 |
| 293.15 | 0.3055 | 0.0122 |
| 293.15 | 0.4021 | 0.0075 |
| 293.15 | 0.5008 | 0.0047 |
| 293.15 | 0.5989 | 0.0029 |
| 293.15 | 0.6987 | 0.0018 |
| 293.15 | 0.7958 | 0.0011 |
| 293.15 | 0.8961 | 0.0007 |
| 293.15 | 1.0000 | 0.0004 |
| 298.15 | 0.0000 | 0.0434 |
| 298.15 | 0.1127 | 0.0254 |
| 298.15 | 0.2000 | 0.0169 |
| 298.15 | 0.3055 | 0.0103 |
| 298.15 | 0.4021 | 0.0062 |
| 298.15 | 0.5008 | 0.0040 |
| 298.15 | 0.5989 | 0.0024 |
| 298.15 | 0.6987 | 0.0016 |
| 298.15 | 0.7958 | 0.0010 |
| 298.15 | 0.8961 | 0.0006 |
| 298.15 | 1.0000 | 0.0003 |
| 303.15 | 0.0000 | 0.0338 |
| 303.15 | 0.1127 | 0.0208 |
| 303.15 | 0.2000 | 0.0138 |
| 303.15 | 0.3055 | 0.0087 |
| 303.15 | 0.4021 | 0.0055 |
| 303.15 | 0.5008 | 0.0035 |
| 303.15 | 0.5989 | 0.0022 |
| 303.15 | 0.6987 | 0.0014 |
| 303.15 | 0.7958 | 0.0009 |
| 303.15 | 0.8961 | 0.0005 |
| 303.15 | 1.0000 | 0.0003 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetonitrile (2) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0546 |
| 293.15 | 0.1127 | 0.0314 |
| 293.15 | 0.2000 | 0.0203 |
| 293.15 | 0.3055 | 0.0122 |
| 293.15 | 0.4021 | 0.0075 |
| 293.15 | 0.5008 | 0.0047 |
| 293.15 | 0.5989 | 0.0029 |
| 293.15 | 0.6987 | 0.0018 |
| 293.15 | 0.7958 | 0.0011 |
| 293.15 | 0.8961 | 0.0007 |
| 293.15 | 1.0000 | 0.0004 |
| 298.15 | 0.0000 | 0.0434 |
| 298.15 | 0.1127 | 0.0254 |
| 298.15 | 0.2000 | 0.0169 |
| 298.15 | 0.3055 | 0.0103 |
| 298.15 | 0.4021 | 0.0062 |
| 298.15 | 0.5008 | 0.0040 |
| 298.15 | 0.5989 | 0.0024 |
| 298.15 | 0.6987 | 0.0016 |
| 298.15 | 0.7958 | 0.0010 |
| 298.15 | 0.8961 | 0.0006 |
| 298.15 | 1.0000 | 0.0003 |
| 303.15 | 0.0000 | 0.0338 |
| 303.15 | 0.1127 | 0.0208 |
| 303.15 | 0.2000 | 0.0138 |
| 303.15 | 0.3055 | 0.0087 |
| 303.15 | 0.4021 | 0.0055 |
| 303.15 | 0.5008 | 0.0035 |
| 303.15 | 0.5989 | 0.0022 |
| 303.15 | 0.6987 | 0.0014 |
| 303.15 | 0.7958 | 0.0009 |
| 303.15 | 0.8961 | 0.0005 |
| 303.15 | 1.0000 | 0.0003 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 100 (Liquid)
| Mole fraction of Acetonitrile (2) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0000 | 1.429 |
| 0.1127 | 1.422 |
| 0.2000 | 1.418 |
| 0.3055 | 1.411 |
| 0.4021 | 1.404 |
| 0.5008 | 1.396 |
| 0.5989 | 1.387 |
| 0.6987 | 1.377 |
| 0.7958 | 1.366 |
| 0.8961 | 1.354 |
| 1.0000 | 1.34 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 100 (Liquid)
| Mole fraction of Acetonitrile (2) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0000 | 1.429 |
| 0.1127 | 1.422 |
| 0.2000 | 1.418 |
| 0.3055 | 1.411 |
| 0.4021 | 1.404 |
| 0.5008 | 1.396 |
| 0.5989 | 1.387 |
| 0.6987 | 1.377 |
| 0.7958 | 1.366 |
| 0.8961 | 1.354 |
| 1.0000 | 1.34 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetonitrile (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 1036.0 |
| 293.15 | 0.1127 | 1018.0 |
| 293.15 | 0.2000 | 1001.0 |
| 293.15 | 0.3055 | 980.0 |
| 293.15 | 0.4021 | 958.0 |
| 293.15 | 0.5008 | 934.0 |
| 293.15 | 0.5989 | 909.0 |
| 293.15 | 0.6987 | 881.0 |
| 293.15 | 0.7958 | 852.0 |
| 293.15 | 0.8961 | 820.0 |
| 293.15 | 1.0000 | 782.0 |
| 298.15 | 0.0000 | 1033.0 |
| 298.15 | 0.1127 | 1014.0 |
| 298.15 | 0.2000 | 997.0 |
| 298.15 | 0.3055 | 975.0 |
| 298.15 | 0.4021 | 954.0 |
| 298.15 | 0.5008 | 930.0 |
| 298.15 | 0.5989 | 904.0 |
| 298.15 | 0.6987 | 876.0 |
| 298.15 | 0.7958 | 847.0 |
| 298.15 | 0.8961 | 814.0 |
| 298.15 | 1.0000 | 776.0 |
| 303.15 | 0.0000 | 1029.0 |
| 303.15 | 0.1127 | 1010.0 |
| 303.15 | 0.2000 | 993.0 |
| 303.15 | 0.3055 | 971.0 |
| 303.15 | 0.4021 | 949.0 |
| 303.15 | 0.5008 | 925.0 |
| 303.15 | 0.5989 | 900.0 |
| 303.15 | 0.6987 | 872.0 |
| 303.15 | 0.7958 | 842.0 |
| 303.15 | 0.8961 | 809.0 |
| 303.15 | 1.0000 | 771.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetonitrile (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 1036.0 |
| 293.15 | 0.1127 | 1018.0 |
| 293.15 | 0.2000 | 1001.0 |
| 293.15 | 0.3055 | 980.0 |
| 293.15 | 0.4021 | 958.0 |
| 293.15 | 0.5008 | 934.0 |
| 293.15 | 0.5989 | 909.0 |
| 293.15 | 0.6987 | 881.0 |
| 293.15 | 0.7958 | 852.0 |
| 293.15 | 0.8961 | 820.0 |
| 293.15 | 1.0000 | 782.0 |
| 298.15 | 0.0000 | 1033.0 |
| 298.15 | 0.1127 | 1014.0 |
| 298.15 | 0.2000 | 997.0 |
| 298.15 | 0.3055 | 975.0 |
| 298.15 | 0.4021 | 954.0 |
| 298.15 | 0.5008 | 930.0 |
| 298.15 | 0.5989 | 904.0 |
| 298.15 | 0.6987 | 876.0 |
| 298.15 | 0.7958 | 847.0 |
| 298.15 | 0.8961 | 814.0 |
| 298.15 | 1.0000 | 776.0 |
| 303.15 | 0.0000 | 1029.0 |
| 303.15 | 0.1127 | 1010.0 |
| 303.15 | 0.2000 | 993.0 |
| 303.15 | 0.3055 | 971.0 |
| 303.15 | 0.4021 | 949.0 |
| 303.15 | 0.5008 | 925.0 |
| 303.15 | 0.5989 | 900.0 |
| 303.15 | 0.6987 | 872.0 |
| 303.15 | 0.7958 | 842.0 |
| 303.15 | 0.8961 | 809.0 |
| 303.15 | 1.0000 | 771.0 |