- Name
- 1,2-Ethanediol
- InChI
- InChI=1S/C2H6O2/c3-1-2-4/h3-4H,1-2H2
- InChI Key
- LYCAIKOWRPUZTN-UHFFFAOYSA-N
- Formula
- C2H6O2
- SMILES
- OCCO
- Mol. Weight (g/mol)
- 62.07
- CAS
- 107-21-1
- Name
- Potassium carbonate
- InChI
- InChI=1S/CH2O3.2K/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2
- InChI Key
- BWHMMNNQKKPAPP-UHFFFAOYSA-L
- Formula
- CK2O3
- SMILES
- O=C(O[K])O[K]
- Mol. Weight (g/mol)
- 138.21
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- σcond - Electrical conductivity, S/m (2)
- n0 - Refractive index (Na D-line) (4)
- ρl - Mass density, kg/m3 (4)
- γ - Surface tension liquid-gas, N/m (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of 1,2-Ethanediol (1) - Liquid | Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
| 6.0 | 293.15 | 0.2270 |
| 6.0 | 303.15 | 0.1200 |
| 6.0 | 313.15 | 0.0690 |
| 6.0 | 323.15 | 0.0420 |
| 6.0 | 333.15 | 0.0280 |
| 6.0 | 343.15 | 0.0200 |
| 7.0 | 293.15 | 0.1490 |
| 7.0 | 303.15 | 0.0810 |
| 7.0 | 313.15 | 0.0490 |
| 7.0 | 323.15 | 0.0310 |
| 7.0 | 333.15 | 0.0210 |
| 7.0 | 343.15 | 0.0150 |
| 8.0 | 293.15 | 0.1170 |
| 8.0 | 303.15 | 0.0660 |
| 8.0 | 313.15 | 0.0400 |
| 8.0 | 323.15 | 0.0260 |
| 8.0 | 333.15 | 0.0180 |
| 8.0 | 343.15 | 0.0130 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of 1,2-Ethanediol (1) - Liquid | Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
| 6.0 | 293.15 | 0.2270 |
| 6.0 | 303.15 | 0.1200 |
| 6.0 | 313.15 | 0.0690 |
| 6.0 | 323.15 | 0.0420 |
| 6.0 | 333.15 | 0.0280 |
| 6.0 | 343.15 | 0.0200 |
| 7.0 | 293.15 | 0.1490 |
| 7.0 | 303.15 | 0.0810 |
| 7.0 | 313.15 | 0.0490 |
| 7.0 | 323.15 | 0.0310 |
| 7.0 | 333.15 | 0.0210 |
| 7.0 | 343.15 | 0.0150 |
| 8.0 | 293.15 | 0.1170 |
| 8.0 | 303.15 | 0.0660 |
| 8.0 | 313.15 | 0.0400 |
| 8.0 | 323.15 | 0.0260 |
| 8.0 | 333.15 | 0.0180 |
| 8.0 | 343.15 | 0.0130 |
Electrical conductivity, S/m [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of 1,2-Ethanediol (1) - Liquid | Temperature, K - Liquid | Electrical conductivity, S/m - Liquid |
| 6.0 | 293.15 | 0.2200 |
| 6.0 | 303.15 | 0.3400 |
| 6.0 | 313.15 | 0.5100 |
| 6.0 | 323.15 | 0.7800 |
| 6.0 | 333.15 | 1.171 |
| 6.0 | 343.15 | 1.51 |
| 7.0 | 293.15 | 0.2380 |
| 7.0 | 303.15 | 0.4250 |
| 7.0 | 313.15 | 0.5370 |
| 7.0 | 323.15 | 0.8010 |
| 7.0 | 333.15 | 1.183 |
| 7.0 | 343.15 | 1.53 |
| 8.0 | 293.15 | 0.2310 |
| 8.0 | 303.15 | 0.3650 |
| 8.0 | 313.15 | 0.5310 |
| 8.0 | 323.15 | 0.7300 |
| 8.0 | 333.15 | 1.042 |
| 8.0 | 343.15 | 1.402 |
Electrical conductivity, S/m [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of 1,2-Ethanediol (1) - Liquid | Temperature, K - Liquid | Electrical conductivity, S/m - Liquid |
| 6.0 | 293.15 | 0.2200 |
| 6.0 | 303.15 | 0.3400 |
| 6.0 | 313.15 | 0.5100 |
| 6.0 | 323.15 | 0.7800 |
| 6.0 | 333.15 | 1.171 |
| 6.0 | 343.15 | 1.51 |
| 7.0 | 293.15 | 0.2380 |
| 7.0 | 303.15 | 0.4250 |
| 7.0 | 313.15 | 0.5370 |
| 7.0 | 323.15 | 0.8010 |
| 7.0 | 333.15 | 1.183 |
| 7.0 | 343.15 | 1.53 |
| 8.0 | 293.15 | 0.2310 |
| 8.0 | 303.15 | 0.3650 |
| 8.0 | 313.15 | 0.5310 |
| 8.0 | 323.15 | 0.7300 |
| 8.0 | 333.15 | 1.042 |
| 8.0 | 343.15 | 1.402 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Potassium carbonate (2) - Liquid | Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
| 0.1821 | 293.15 | 1.4479 |
| 0.1821 | 298.15 | 1.4467 |
| 0.1821 | 303.15 | 1.4455 |
| 0.1821 | 308.15 | 1.4443 |
| 0.1821 | 313.15 | 1.4431 |
| 0.1821 | 318.15 | 1.4418 |
| 0.1821 | 323.15 | 1.4405 |
| 0.1821 | 328.15 | 1.4393 |
| 0.1821 | 333.15 | 1.438 |
| 0.1821 | 338.15 | 1.4368 |
| 0.1821 | 343.15 | 1.4356 |
| 0.1222 | 293.15 | 1.443 |
| 0.1222 | 298.15 | 1.4417 |
| 0.1222 | 303.15 | 1.4405 |
| 0.1222 | 308.15 | 1.4389 |
| 0.1222 | 313.15 | 1.4377 |
| 0.1222 | 318.15 | 1.4364 |
| 0.1222 | 323.15 | 1.435 |
| 0.1222 | 328.15 | 1.4338 |
| 0.1222 | 333.15 | 1.4324 |
| 0.1222 | 338.15 | 1.4312 |
| 0.1222 | 343.15 | 1.4299 |
| 0.0000 | 293.15 | 1.4315 |
| 0.0000 | 298.15 | 1.43 |
| 0.0000 | 303.15 | 1.4285 |
| 0.0000 | 308.15 | 1.4271 |
| 0.0000 | 313.15 | 1.4257 |
| 0.0000 | 318.15 | 1.4244 |
| 0.0000 | 323.15 | 1.4231 |
| 0.0000 | 328.15 | 1.4216 |
| 0.0000 | 333.15 | 1.4201 |
| 0.0000 | 338.15 | 1.4187 |
| 0.0000 | 343.15 | 1.4173 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of 1,2-Ethanediol (1) - Liquid | Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
| 6.0 | 293.15 | 1.4598 |
| 6.0 | 303.15 | 1.4576 |
| 6.0 | 313.15 | 1.455 |
| 6.0 | 323.15 | 1.4533 |
| 6.0 | 333.15 | 1.4519 |
| 6.0 | 343.15 | 1.4485 |
| 7.0 | 293.15 | 1.4565 |
| 7.0 | 303.15 | 1.4548 |
| 7.0 | 313.15 | 1.4525 |
| 7.0 | 323.15 | 1.4507 |
| 7.0 | 333.15 | 1.449 |
| 7.0 | 343.15 | 1.4459 |
| 8.0 | 293.15 | 1.457 |
| 8.0 | 303.15 | 1.4556 |
| 8.0 | 313.15 | 1.4536 |
| 8.0 | 323.15 | 1.4513 |
| 8.0 | 333.15 | 1.4496 |
| 8.0 | 343.15 | 1.4469 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Potassium carbonate (2) - Liquid | Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
| 0.1821 | 293.15 | 1.4479 |
| 0.1821 | 298.15 | 1.4467 |
| 0.1821 | 303.15 | 1.4455 |
| 0.1821 | 308.15 | 1.4443 |
| 0.1821 | 313.15 | 1.4431 |
| 0.1821 | 318.15 | 1.4418 |
| 0.1821 | 323.15 | 1.4405 |
| 0.1821 | 328.15 | 1.4393 |
| 0.1821 | 333.15 | 1.438 |
| 0.1821 | 338.15 | 1.4368 |
| 0.1821 | 343.15 | 1.4356 |
| 0.1222 | 293.15 | 1.443 |
| 0.1222 | 298.15 | 1.4417 |
| 0.1222 | 303.15 | 1.4405 |
| 0.1222 | 308.15 | 1.4389 |
| 0.1222 | 313.15 | 1.4377 |
| 0.1222 | 318.15 | 1.4364 |
| 0.1222 | 323.15 | 1.435 |
| 0.1222 | 328.15 | 1.4338 |
| 0.1222 | 333.15 | 1.4324 |
| 0.1222 | 338.15 | 1.4312 |
| 0.1222 | 343.15 | 1.4299 |
| 0.0000 | 293.15 | 1.4315 |
| 0.0000 | 298.15 | 1.43 |
| 0.0000 | 303.15 | 1.4285 |
| 0.0000 | 308.15 | 1.4271 |
| 0.0000 | 313.15 | 1.4257 |
| 0.0000 | 318.15 | 1.4244 |
| 0.0000 | 323.15 | 1.4231 |
| 0.0000 | 328.15 | 1.4216 |
| 0.0000 | 333.15 | 1.4201 |
| 0.0000 | 338.15 | 1.4187 |
| 0.0000 | 343.15 | 1.4173 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of 1,2-Ethanediol (1) - Liquid | Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
| 6.0 | 293.15 | 1.4598 |
| 6.0 | 303.15 | 1.4576 |
| 6.0 | 313.15 | 1.455 |
| 6.0 | 323.15 | 1.4533 |
| 6.0 | 333.15 | 1.4519 |
| 6.0 | 343.15 | 1.4485 |
| 7.0 | 293.15 | 1.4565 |
| 7.0 | 303.15 | 1.4548 |
| 7.0 | 313.15 | 1.4525 |
| 7.0 | 323.15 | 1.4507 |
| 7.0 | 333.15 | 1.449 |
| 7.0 | 343.15 | 1.4459 |
| 8.0 | 293.15 | 1.457 |
| 8.0 | 303.15 | 1.4556 |
| 8.0 | 313.15 | 1.4536 |
| 8.0 | 323.15 | 1.4513 |
| 8.0 | 333.15 | 1.4496 |
| 8.0 | 343.15 | 1.4469 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Potassium carbonate (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.1821 | 1259.3 |
| 298.15 | 0.1821 | 1256.1 |
| 303.15 | 0.1821 | 1252.8 |
| 308.15 | 0.1821 | 1249.5 |
| 313.15 | 0.1821 | 1246.2 |
| 318.15 | 0.1821 | 1242.9 |
| 323.15 | 0.1821 | 1239.5 |
| 328.15 | 0.1821 | 1236.2 |
| 333.15 | 0.1821 | 1232.8 |
| 338.15 | 0.1821 | 1229.5 |
| 343.15 | 0.1821 | 1226.1 |
| 293.15 | 0.1222 | 1212.8 |
| 298.15 | 0.1222 | 1209.6 |
| 303.15 | 0.1222 | 1206.2 |
| 308.15 | 0.1222 | 1203.1 |
| 313.15 | 0.1222 | 1199.5 |
| 318.15 | 0.1222 | 1196.0 |
| 323.15 | 0.1222 | 1192.7 |
| 328.15 | 0.1222 | 1189.1 |
| 333.15 | 0.1222 | 1185.9 |
| 338.15 | 0.1222 | 1182.4 |
| 343.15 | 0.1222 | 1179.0 |
| 293.15 | 0.0000 | 1113.3 |
| 298.15 | 0.0000 | 1109.8 |
| 303.15 | 0.0000 | 1106.3 |
| 308.15 | 0.0000 | 1102.8 |
| 313.15 | 0.0000 | 1099.2 |
| 318.15 | 0.0000 | 1095.7 |
| 323.15 | 0.0000 | 1092.1 |
| 328.15 | 0.0000 | 1088.5 |
| 333.15 | 0.0000 | 1084.9 |
| 338.15 | 0.0000 | 1081.2 |
| 343.15 | 0.0000 | 1077.5 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of 1,2-Ethanediol (1) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 6.0 | 293.15 | 1338.8 |
| 6.0 | 303.15 | 1332.1 |
| 6.0 | 313.15 | 1325.3 |
| 6.0 | 323.15 | 1318.5 |
| 6.0 | 333.15 | 1311.7 |
| 6.0 | 343.15 | 1304.9 |
| 7.0 | 293.15 | 1314.0 |
| 7.0 | 303.15 | 1307.3 |
| 7.0 | 313.15 | 1300.6 |
| 7.0 | 323.15 | 1293.8 |
| 7.0 | 333.15 | 1287.0 |
| 7.0 | 343.15 | 1280.1 |
| 8.0 | 293.15 | 1295.5 |
| 8.0 | 303.15 | 1288.8 |
| 8.0 | 313.15 | 1282.1 |
| 8.0 | 323.15 | 1275.3 |
| 8.0 | 333.15 | 1268.5 |
| 8.0 | 343.15 | 1261.7 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Potassium carbonate (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.1821 | 1259.3 |
| 298.15 | 0.1821 | 1256.1 |
| 303.15 | 0.1821 | 1252.8 |
| 308.15 | 0.1821 | 1249.5 |
| 313.15 | 0.1821 | 1246.2 |
| 318.15 | 0.1821 | 1242.9 |
| 323.15 | 0.1821 | 1239.5 |
| 328.15 | 0.1821 | 1236.2 |
| 333.15 | 0.1821 | 1232.8 |
| 338.15 | 0.1821 | 1229.5 |
| 343.15 | 0.1821 | 1226.1 |
| 293.15 | 0.1222 | 1212.8 |
| 298.15 | 0.1222 | 1209.6 |
| 303.15 | 0.1222 | 1206.2 |
| 308.15 | 0.1222 | 1203.1 |
| 313.15 | 0.1222 | 1199.5 |
| 318.15 | 0.1222 | 1196.0 |
| 323.15 | 0.1222 | 1192.7 |
| 328.15 | 0.1222 | 1189.1 |
| 333.15 | 0.1222 | 1185.9 |
| 338.15 | 0.1222 | 1182.4 |
| 343.15 | 0.1222 | 1179.0 |
| 293.15 | 0.0000 | 1113.3 |
| 298.15 | 0.0000 | 1109.8 |
| 303.15 | 0.0000 | 1106.3 |
| 308.15 | 0.0000 | 1102.8 |
| 313.15 | 0.0000 | 1099.2 |
| 318.15 | 0.0000 | 1095.7 |
| 323.15 | 0.0000 | 1092.1 |
| 328.15 | 0.0000 | 1088.5 |
| 333.15 | 0.0000 | 1084.9 |
| 338.15 | 0.0000 | 1081.2 |
| 343.15 | 0.0000 | 1077.5 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of 1,2-Ethanediol (1) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 6.0 | 293.15 | 1338.8 |
| 6.0 | 303.15 | 1332.1 |
| 6.0 | 313.15 | 1325.3 |
| 6.0 | 323.15 | 1318.5 |
| 6.0 | 333.15 | 1311.7 |
| 6.0 | 343.15 | 1304.9 |
| 7.0 | 293.15 | 1314.0 |
| 7.0 | 303.15 | 1307.3 |
| 7.0 | 313.15 | 1300.6 |
| 7.0 | 323.15 | 1293.8 |
| 7.0 | 333.15 | 1287.0 |
| 7.0 | 343.15 | 1280.1 |
| 8.0 | 293.15 | 1295.5 |
| 8.0 | 303.15 | 1288.8 |
| 8.0 | 313.15 | 1282.1 |
| 8.0 | 323.15 | 1275.3 |
| 8.0 | 333.15 | 1268.5 |
| 8.0 | 343.15 | 1261.7 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of 1,2-Ethanediol (1) - Liquid | Temperature, K - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 6.0 | 293.15 | 0.0284 |
| 6.0 | 303.15 | 0.0278 |
| 6.0 | 313.15 | 0.0273 |
| 6.0 | 323.15 | 0.0268 |
| 6.0 | 333.15 | 0.0261 |
| 6.0 | 343.15 | 0.0255 |
| 7.0 | 293.15 | 0.0283 |
| 7.0 | 303.15 | 0.0277 |
| 7.0 | 313.15 | 0.0272 |
| 7.0 | 323.15 | 0.0267 |
| 7.0 | 333.15 | 0.0260 |
| 7.0 | 343.15 | 0.0253 |
| 8.0 | 293.15 | 0.0278 |
| 8.0 | 303.15 | 0.0273 |
| 8.0 | 313.15 | 0.0267 |
| 8.0 | 323.15 | 0.0261 |
| 8.0 | 333.15 | 0.0255 |
| 8.0 | 343.15 | 0.0248 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of 1,2-Ethanediol (1) - Liquid | Temperature, K - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 6.0 | 293.15 | 0.0284 |
| 6.0 | 303.15 | 0.0278 |
| 6.0 | 313.15 | 0.0273 |
| 6.0 | 323.15 | 0.0268 |
| 6.0 | 333.15 | 0.0261 |
| 6.0 | 343.15 | 0.0255 |
| 7.0 | 293.15 | 0.0283 |
| 7.0 | 303.15 | 0.0277 |
| 7.0 | 313.15 | 0.0272 |
| 7.0 | 323.15 | 0.0267 |
| 7.0 | 333.15 | 0.0260 |
| 7.0 | 343.15 | 0.0253 |
| 8.0 | 293.15 | 0.0278 |
| 8.0 | 303.15 | 0.0273 |
| 8.0 | 313.15 | 0.0267 |
| 8.0 | 323.15 | 0.0261 |
| 8.0 | 333.15 | 0.0255 |
| 8.0 | 343.15 | 0.0248 |