- Name
- 2-Amino-2-methyl-1,3-propanediol
- InChI
- InChI=1S/C4H11NO2/c1-4(5,2-6)3-7/h6-7H,2-3,5H2,1H3
- InChI Key
- UXFQFBNBSPQBJW-UHFFFAOYSA-N
- Formula
- C4H11NO2
- SMILES
- CC(N)(CO)CO
- Mol. Weight (g/mol)
- 105.14
- CAS
- 115-69-5
- Name
- 1,2-Ethanediol
- InChI
- InChI=1S/C2H6O2/c3-1-2-4/h3-4H,1-2H2
- InChI Key
- LYCAIKOWRPUZTN-UHFFFAOYSA-N
- Formula
- C2H6O2
- SMILES
- OCCO
- Mol. Weight (g/mol)
- 62.07
- CAS
- 107-21-1
- Name
- Potassium carbonate
- InChI
- InChI=1S/CH2O3.2K/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2
- InChI Key
- BWHMMNNQKKPAPP-UHFFFAOYSA-L
- Formula
- CK2O3
- SMILES
- O=C(O[K])O[K]
- Mol. Weight (g/mol)
- 138.21
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mass fraction = 0.1599 (Liquid)
- Mass fraction = 0.7184 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 293.15 | 1.4529 |
| 298.15 | 1.4517 |
| 303.15 | 1.4504 |
| 308.15 | 1.4491 |
| 313.15 | 1.4479 |
| 318.15 | 1.4466 |
| 323.15 | 1.4453 |
| 328.15 | 1.444 |
| 333.15 | 1.4426 |
| 338.15 | 1.4413 |
| 343.15 | 1.4399 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mass fraction = 0.1599 (Liquid)
- Mass fraction = 0.7184 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 293.15 | 1.4529 |
| 298.15 | 1.4517 |
| 303.15 | 1.4504 |
| 308.15 | 1.4491 |
| 313.15 | 1.4479 |
| 318.15 | 1.4466 |
| 323.15 | 1.4453 |
| 328.15 | 1.444 |
| 333.15 | 1.4426 |
| 338.15 | 1.4413 |
| 343.15 | 1.4399 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mass fraction = 0.1599 (Liquid)
- Mass fraction = 0.7184 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 293.15 | 1240.9 |
| 298.15 | 1237.6 |
| 303.15 | 1234.3 |
| 308.15 | 1231.0 |
| 313.15 | 1227.7 |
| 318.15 | 1224.3 |
| 323.15 | 1221.0 |
| 328.15 | 1217.6 |
| 333.15 | 1214.2 |
| 338.15 | 1210.8 |
| 343.15 | 1207.4 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mass fraction = 0.1599 (Liquid)
- Mass fraction = 0.7184 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 293.15 | 1240.9 |
| 298.15 | 1237.6 |
| 303.15 | 1234.3 |
| 308.15 | 1231.0 |
| 313.15 | 1227.7 |
| 318.15 | 1224.3 |
| 323.15 | 1221.0 |
| 328.15 | 1217.6 |
| 333.15 | 1214.2 |
| 338.15 | 1210.8 |
| 343.15 | 1207.4 |