- Name
- Glycerin
- InChI
- InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2
- InChI Key
- PEDCQBHIVMGVHV-UHFFFAOYSA-N
- Formula
- C3H8O3
- SMILES
- OCC(O)CO
- Mol. Weight (g/mol)
- 92.09
- CAS
- 56-81-5
- Name
- Potassium carbonate
- InChI
- InChI=1S/CH2O3.2K/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2
- InChI Key
- BWHMMNNQKKPAPP-UHFFFAOYSA-L
- Formula
- CK2O3
- SMILES
- O=C(O[K])O[K]
- Mol. Weight (g/mol)
- 138.21
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- σcond - Electrical conductivity, S/m (2)
- n0 - Refractive index (Na D-line) (4)
- ρl - Mass density, kg/m3 (4)
- γ - Surface tension liquid-gas, N/m (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of Glycerin (1) - Liquid | Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
| 4.0 | 293.15 | 28.104 |
| 4.0 | 303.15 | 10.1 |
| 4.0 | 313.15 | 3.33 |
| 4.0 | 323.15 | 1.4 |
| 4.0 | 333.15 | 0.6630 |
| 4.0 | 343.15 | 0.3230 |
| 4.0 | 353.15 | 0.2000 |
| 5.0 | 293.15 | 18.018 |
| 5.0 | 303.15 | 8.899 |
| 5.0 | 313.15 | 3.44 |
| 5.0 | 323.15 | 1.418 |
| 5.0 | 333.15 | 0.6460 |
| 5.0 | 343.15 | 0.3230 |
| 5.0 | 353.15 | 0.1780 |
| 6.0 | 293.15 | 5.5 |
| 6.0 | 303.15 | 3.5 |
| 6.0 | 313.15 | 1.71 |
| 6.0 | 323.15 | 0.7670 |
| 6.0 | 333.15 | 0.3780 |
| 6.0 | 343.15 | 0.2030 |
| 6.0 | 353.15 | 0.1150 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of Glycerin (1) - Liquid | Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
| 4.0 | 293.15 | 28.104 |
| 4.0 | 303.15 | 10.1 |
| 4.0 | 313.15 | 3.33 |
| 4.0 | 323.15 | 1.4 |
| 4.0 | 333.15 | 0.6630 |
| 4.0 | 343.15 | 0.3230 |
| 4.0 | 353.15 | 0.2000 |
| 5.0 | 293.15 | 18.018 |
| 5.0 | 303.15 | 8.899 |
| 5.0 | 313.15 | 3.44 |
| 5.0 | 323.15 | 1.418 |
| 5.0 | 333.15 | 0.6460 |
| 5.0 | 343.15 | 0.3230 |
| 5.0 | 353.15 | 0.1780 |
| 6.0 | 293.15 | 5.5 |
| 6.0 | 303.15 | 3.5 |
| 6.0 | 313.15 | 1.71 |
| 6.0 | 323.15 | 0.7670 |
| 6.0 | 333.15 | 0.3780 |
| 6.0 | 343.15 | 0.2030 |
| 6.0 | 353.15 | 0.1150 |
Electrical conductivity, S/m [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of Glycerin (1) - Liquid | Temperature, K - Liquid | Electrical conductivity, S/m - Liquid |
| 4.0 | 293.15 | 0.0008 |
| 4.0 | 303.15 | 0.0030 |
| 4.0 | 313.15 | 0.0069 |
| 4.0 | 323.15 | 0.0162 |
| 4.0 | 333.15 | 0.0313 |
| 4.0 | 343.15 | 0.0583 |
| 4.0 | 353.15 | 0.2040 |
| 5.0 | 293.15 | 0.0034 |
| 5.0 | 303.15 | 0.0082 |
| 5.0 | 313.15 | 0.0154 |
| 5.0 | 323.15 | 0.0371 |
| 5.0 | 333.15 | 0.0760 |
| 5.0 | 343.15 | 0.1387 |
| 5.0 | 353.15 | 0.3130 |
| 6.0 | 293.15 | 0.0052 |
| 6.0 | 303.15 | 0.0112 |
| 6.0 | 313.15 | 0.0247 |
| 6.0 | 323.15 | 0.0393 |
| 6.0 | 333.15 | 0.1213 |
| 6.0 | 343.15 | 0.1629 |
| 6.0 | 353.15 | 0.3410 |
Electrical conductivity, S/m [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of Glycerin (1) - Liquid | Temperature, K - Liquid | Electrical conductivity, S/m - Liquid |
| 4.0 | 293.15 | 0.0008 |
| 4.0 | 303.15 | 0.0030 |
| 4.0 | 313.15 | 0.0069 |
| 4.0 | 323.15 | 0.0162 |
| 4.0 | 333.15 | 0.0313 |
| 4.0 | 343.15 | 0.0583 |
| 4.0 | 353.15 | 0.2040 |
| 5.0 | 293.15 | 0.0034 |
| 5.0 | 303.15 | 0.0082 |
| 5.0 | 313.15 | 0.0154 |
| 5.0 | 323.15 | 0.0371 |
| 5.0 | 333.15 | 0.0760 |
| 5.0 | 343.15 | 0.1387 |
| 5.0 | 353.15 | 0.3130 |
| 6.0 | 293.15 | 0.0052 |
| 6.0 | 303.15 | 0.0112 |
| 6.0 | 313.15 | 0.0247 |
| 6.0 | 323.15 | 0.0393 |
| 6.0 | 333.15 | 0.1213 |
| 6.0 | 343.15 | 0.1629 |
| 6.0 | 353.15 | 0.3410 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Potassium carbonate (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.1305 | 1.485 |
| 298.15 | 0.1305 | 1.484 |
| 303.15 | 0.1305 | 1.483 |
| 308.15 | 0.1305 | 1.4821 |
| 313.15 | 0.1305 | 1.481 |
| 318.15 | 0.1305 | 1.4802 |
| 323.15 | 0.1305 | 1.4792 |
| 328.15 | 0.1305 | 1.4783 |
| 333.15 | 0.1305 | 1.4771 |
| 338.15 | 0.1305 | 1.4762 |
| 343.15 | 0.1305 | 1.4751 |
| 293.15 | 0.0858 | 1.478 |
| 298.15 | 0.0858 | 1.4769 |
| 303.15 | 0.0858 | 1.4758 |
| 308.15 | 0.0858 | 1.4746 |
| 313.15 | 0.0858 | 1.4735 |
| 318.15 | 0.0858 | 1.4724 |
| 323.15 | 0.0858 | 1.4713 |
| 328.15 | 0.0858 | 1.4702 |
| 333.15 | 0.0858 | 1.469 |
| 338.15 | 0.0858 | 1.4679 |
| 343.15 | 0.0858 | 1.4667 |
| 293.15 | 0.0000 | 1.4733 |
| 298.15 | 0.0000 | 1.4718 |
| 303.15 | 0.0000 | 1.4704 |
| 308.15 | 0.0000 | 1.4689 |
| 313.15 | 0.0000 | 1.4675 |
| 318.15 | 0.0000 | 1.466 |
| 323.15 | 0.0000 | 1.4646 |
| 328.15 | 0.0000 | 1.4631 |
| 333.15 | 0.0000 | 1.4616 |
| 338.15 | 0.0000 | 1.4603 |
| 343.15 | 0.0000 | 1.4587 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of Glycerin (1) - Liquid | Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
| 4.0 | 293.15 | 1.4922 |
| 4.0 | 303.15 | 1.4906 |
| 4.0 | 313.15 | 1.4888 |
| 4.0 | 323.15 | 1.4862 |
| 4.0 | 333.15 | 1.4857 |
| 4.0 | 343.15 | 1.4846 |
| 4.0 | 353.15 | 1.4839 |
| 5.0 | 293.15 | 1.491 |
| 5.0 | 303.15 | 1.4894 |
| 5.0 | 313.15 | 1.488 |
| 5.0 | 323.15 | 1.4853 |
| 5.0 | 333.15 | 1.4839 |
| 5.0 | 343.15 | 1.4818 |
| 5.0 | 353.15 | 1.4783 |
| 6.0 | 293.15 | 1.4897 |
| 6.0 | 303.15 | 1.4882 |
| 6.0 | 313.15 | 1.4866 |
| 6.0 | 323.15 | 1.4845 |
| 6.0 | 333.15 | 1.4827 |
| 6.0 | 343.15 | 1.4808 |
| 6.0 | 353.15 | 1.4789 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Potassium carbonate (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.1305 | 1.485 |
| 298.15 | 0.1305 | 1.484 |
| 303.15 | 0.1305 | 1.483 |
| 308.15 | 0.1305 | 1.4821 |
| 313.15 | 0.1305 | 1.481 |
| 318.15 | 0.1305 | 1.4802 |
| 323.15 | 0.1305 | 1.4792 |
| 328.15 | 0.1305 | 1.4783 |
| 333.15 | 0.1305 | 1.4771 |
| 338.15 | 0.1305 | 1.4762 |
| 343.15 | 0.1305 | 1.4751 |
| 293.15 | 0.0858 | 1.478 |
| 298.15 | 0.0858 | 1.4769 |
| 303.15 | 0.0858 | 1.4758 |
| 308.15 | 0.0858 | 1.4746 |
| 313.15 | 0.0858 | 1.4735 |
| 318.15 | 0.0858 | 1.4724 |
| 323.15 | 0.0858 | 1.4713 |
| 328.15 | 0.0858 | 1.4702 |
| 333.15 | 0.0858 | 1.469 |
| 338.15 | 0.0858 | 1.4679 |
| 343.15 | 0.0858 | 1.4667 |
| 293.15 | 0.0000 | 1.4733 |
| 298.15 | 0.0000 | 1.4718 |
| 303.15 | 0.0000 | 1.4704 |
| 308.15 | 0.0000 | 1.4689 |
| 313.15 | 0.0000 | 1.4675 |
| 318.15 | 0.0000 | 1.466 |
| 323.15 | 0.0000 | 1.4646 |
| 328.15 | 0.0000 | 1.4631 |
| 333.15 | 0.0000 | 1.4616 |
| 338.15 | 0.0000 | 1.4603 |
| 343.15 | 0.0000 | 1.4587 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of Glycerin (1) - Liquid | Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
| 4.0 | 293.15 | 1.4922 |
| 4.0 | 303.15 | 1.4906 |
| 4.0 | 313.15 | 1.4888 |
| 4.0 | 323.15 | 1.4862 |
| 4.0 | 333.15 | 1.4857 |
| 4.0 | 343.15 | 1.4846 |
| 4.0 | 353.15 | 1.4839 |
| 5.0 | 293.15 | 1.491 |
| 5.0 | 303.15 | 1.4894 |
| 5.0 | 313.15 | 1.488 |
| 5.0 | 323.15 | 1.4853 |
| 5.0 | 333.15 | 1.4839 |
| 5.0 | 343.15 | 1.4818 |
| 5.0 | 353.15 | 1.4783 |
| 6.0 | 293.15 | 1.4897 |
| 6.0 | 303.15 | 1.4882 |
| 6.0 | 313.15 | 1.4866 |
| 6.0 | 323.15 | 1.4845 |
| 6.0 | 333.15 | 1.4827 |
| 6.0 | 343.15 | 1.4808 |
| 6.0 | 353.15 | 1.4789 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Potassium carbonate (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.1305 | 1370.2 |
| 298.15 | 0.1305 | 1367.3 |
| 303.15 | 0.1305 | 1364.3 |
| 308.15 | 0.1305 | 1361.4 |
| 313.15 | 0.1305 | 1358.4 |
| 318.15 | 0.1305 | 1355.4 |
| 323.15 | 0.1305 | 1352.4 |
| 328.15 | 0.1305 | 1349.3 |
| 333.15 | 0.1305 | 1346.2 |
| 338.15 | 0.1305 | 1343.2 |
| 343.15 | 0.1305 | 1340.0 |
| 293.15 | 0.0858 | 1312.5 |
| 298.15 | 0.0858 | 1308.9 |
| 303.15 | 0.0858 | 1305.3 |
| 308.15 | 0.0858 | 1302.0 |
| 313.15 | 0.0858 | 1298.1 |
| 318.15 | 0.0858 | 1294.6 |
| 323.15 | 0.0858 | 1290.6 |
| 328.15 | 0.0858 | 1286.8 |
| 333.15 | 0.0858 | 1282.9 |
| 338.15 | 0.0858 | 1279.1 |
| 343.15 | 0.0858 | 1275.2 |
| 293.15 | 0.0000 | 1262.0 |
| 298.15 | 0.0000 | 1259.0 |
| 303.15 | 0.0000 | 1255.8 |
| 308.15 | 0.0000 | 1252.7 |
| 313.15 | 0.0000 | 1249.6 |
| 318.15 | 0.0000 | 1246.4 |
| 323.15 | 0.0000 | 1243.2 |
| 328.15 | 0.0000 | 1240.0 |
| 333.15 | 0.0000 | 1236.7 |
| 338.15 | 0.0000 | 1233.4 |
| 343.15 | 0.0000 | 1230.1 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of Glycerin (1) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 4.0 | 293.15 | 1477.9 |
| 4.0 | 303.15 | 1472.0 |
| 4.0 | 313.15 | 1466.1 |
| 4.0 | 323.15 | 1460.2 |
| 4.0 | 333.15 | 1454.1 |
| 4.0 | 343.15 | 1448.1 |
| 4.0 | 353.15 | 1442.2 |
| 5.0 | 293.15 | 1447.2 |
| 5.0 | 303.15 | 1441.4 |
| 5.0 | 313.15 | 1435.5 |
| 5.0 | 323.15 | 1429.6 |
| 5.0 | 333.15 | 1423.4 |
| 5.0 | 343.15 | 1417.5 |
| 5.0 | 353.15 | 1411.4 |
| 6.0 | 293.15 | 1423.6 |
| 6.0 | 303.15 | 1417.8 |
| 6.0 | 313.15 | 1411.9 |
| 6.0 | 323.15 | 1405.9 |
| 6.0 | 333.15 | 1399.8 |
| 6.0 | 343.15 | 1393.8 |
| 6.0 | 353.15 | 1387.7 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Potassium carbonate (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.1305 | 1370.2 |
| 298.15 | 0.1305 | 1367.3 |
| 303.15 | 0.1305 | 1364.3 |
| 308.15 | 0.1305 | 1361.4 |
| 313.15 | 0.1305 | 1358.4 |
| 318.15 | 0.1305 | 1355.4 |
| 323.15 | 0.1305 | 1352.4 |
| 328.15 | 0.1305 | 1349.3 |
| 333.15 | 0.1305 | 1346.2 |
| 338.15 | 0.1305 | 1343.2 |
| 343.15 | 0.1305 | 1340.0 |
| 293.15 | 0.0858 | 1312.5 |
| 298.15 | 0.0858 | 1308.9 |
| 303.15 | 0.0858 | 1305.3 |
| 308.15 | 0.0858 | 1302.0 |
| 313.15 | 0.0858 | 1298.1 |
| 318.15 | 0.0858 | 1294.6 |
| 323.15 | 0.0858 | 1290.6 |
| 328.15 | 0.0858 | 1286.8 |
| 333.15 | 0.0858 | 1282.9 |
| 338.15 | 0.0858 | 1279.1 |
| 343.15 | 0.0858 | 1275.2 |
| 293.15 | 0.0000 | 1262.0 |
| 298.15 | 0.0000 | 1259.0 |
| 303.15 | 0.0000 | 1255.8 |
| 308.15 | 0.0000 | 1252.7 |
| 313.15 | 0.0000 | 1249.6 |
| 318.15 | 0.0000 | 1246.4 |
| 323.15 | 0.0000 | 1243.2 |
| 328.15 | 0.0000 | 1240.0 |
| 333.15 | 0.0000 | 1236.7 |
| 338.15 | 0.0000 | 1233.4 |
| 343.15 | 0.0000 | 1230.1 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of Glycerin (1) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 4.0 | 293.15 | 1477.9 |
| 4.0 | 303.15 | 1472.0 |
| 4.0 | 313.15 | 1466.1 |
| 4.0 | 323.15 | 1460.2 |
| 4.0 | 333.15 | 1454.1 |
| 4.0 | 343.15 | 1448.1 |
| 4.0 | 353.15 | 1442.2 |
| 5.0 | 293.15 | 1447.2 |
| 5.0 | 303.15 | 1441.4 |
| 5.0 | 313.15 | 1435.5 |
| 5.0 | 323.15 | 1429.6 |
| 5.0 | 333.15 | 1423.4 |
| 5.0 | 343.15 | 1417.5 |
| 5.0 | 353.15 | 1411.4 |
| 6.0 | 293.15 | 1423.6 |
| 6.0 | 303.15 | 1417.8 |
| 6.0 | 313.15 | 1411.9 |
| 6.0 | 323.15 | 1405.9 |
| 6.0 | 333.15 | 1399.8 |
| 6.0 | 343.15 | 1393.8 |
| 6.0 | 353.15 | 1387.7 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of Glycerin (1) - Liquid | Temperature, K - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 4.0 | 293.15 | 0.0506 |
| 4.0 | 303.15 | 0.0461 |
| 4.0 | 313.15 | 0.0452 |
| 4.0 | 323.15 | 0.0444 |
| 4.0 | 333.15 | 0.0434 |
| 4.0 | 343.15 | 0.0426 |
| 4.0 | 353.15 | 0.0416 |
| 5.0 | 293.15 | 0.0644 |
| 5.0 | 303.15 | 0.0591 |
| 5.0 | 313.15 | 0.0567 |
| 5.0 | 323.15 | 0.0553 |
| 5.0 | 333.15 | 0.0547 |
| 5.0 | 343.15 | 0.0537 |
| 5.0 | 353.15 | 0.0513 |
| 6.0 | 293.15 | 0.0695 |
| 6.0 | 303.15 | 0.0668 |
| 6.0 | 313.15 | 0.0656 |
| 6.0 | 323.15 | 0.0640 |
| 6.0 | 333.15 | 0.0630 |
| 6.0 | 343.15 | 0.0622 |
| 6.0 | 353.15 | 0.0615 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Amount ratio of solute to solvent of Glycerin (1) - Liquid | Temperature, K - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 4.0 | 293.15 | 0.0506 |
| 4.0 | 303.15 | 0.0461 |
| 4.0 | 313.15 | 0.0452 |
| 4.0 | 323.15 | 0.0444 |
| 4.0 | 333.15 | 0.0434 |
| 4.0 | 343.15 | 0.0426 |
| 4.0 | 353.15 | 0.0416 |
| 5.0 | 293.15 | 0.0644 |
| 5.0 | 303.15 | 0.0591 |
| 5.0 | 313.15 | 0.0567 |
| 5.0 | 323.15 | 0.0553 |
| 5.0 | 333.15 | 0.0547 |
| 5.0 | 343.15 | 0.0537 |
| 5.0 | 353.15 | 0.0513 |
| 6.0 | 293.15 | 0.0695 |
| 6.0 | 303.15 | 0.0668 |
| 6.0 | 313.15 | 0.0656 |
| 6.0 | 323.15 | 0.0640 |
| 6.0 | 333.15 | 0.0630 |
| 6.0 | 343.15 | 0.0622 |
| 6.0 | 353.15 | 0.0615 |