- Name
- 2-Amino-2-methyl-1,3-propanediol
- InChI
- InChI=1S/C4H11NO2/c1-4(5,2-6)3-7/h6-7H,2-3,5H2,1H3
- InChI Key
- UXFQFBNBSPQBJW-UHFFFAOYSA-N
- Formula
- C4H11NO2
- SMILES
- CC(N)(CO)CO
- Mol. Weight (g/mol)
- 105.14
- CAS
- 115-69-5
- Name
- Glycerin
- InChI
- InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2
- InChI Key
- PEDCQBHIVMGVHV-UHFFFAOYSA-N
- Formula
- C3H8O3
- SMILES
- OCC(O)CO
- Mol. Weight (g/mol)
- 92.09
- CAS
- 56-81-5
- Name
- Potassium carbonate
- InChI
- InChI=1S/CH2O3.2K/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2
- InChI Key
- BWHMMNNQKKPAPP-UHFFFAOYSA-L
- Formula
- CK2O3
- SMILES
- O=C(O[K])O[K]
- Mol. Weight (g/mol)
- 138.21
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mass fraction = 0.0805 (Liquid)
- Mass fraction = 0.8583 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 293.15 | 1.4784 |
| 298.15 | 1.4773 |
| 303.15 | 1.4762 |
| 308.15 | 1.4752 |
| 313.15 | 1.4741 |
| 318.15 | 1.4731 |
| 323.15 | 1.4721 |
| 328.15 | 1.471 |
| 333.15 | 1.4699 |
| 338.15 | 1.4687 |
| 343.15 | 1.4676 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mass fraction = 0.0805 (Liquid)
- Mass fraction = 0.8583 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 293.15 | 1.4784 |
| 298.15 | 1.4773 |
| 303.15 | 1.4762 |
| 308.15 | 1.4752 |
| 313.15 | 1.4741 |
| 318.15 | 1.4731 |
| 323.15 | 1.4721 |
| 328.15 | 1.471 |
| 333.15 | 1.4699 |
| 338.15 | 1.4687 |
| 343.15 | 1.4676 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mass fraction = 0.0805 (Liquid)
- Mass fraction = 0.8583 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 293.15 | 1311.3 |
| 298.15 | 1308.4 |
| 303.15 | 1305.4 |
| 308.15 | 1302.3 |
| 313.15 | 1299.3 |
| 318.15 | 1296.1 |
| 323.15 | 1293.0 |
| 328.15 | 1289.9 |
| 333.15 | 1286.8 |
| 338.15 | 1283.6 |
| 343.15 | 1280.5 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mass fraction = 0.0805 (Liquid)
- Mass fraction = 0.8583 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 293.15 | 1311.3 |
| 298.15 | 1308.4 |
| 303.15 | 1305.4 |
| 308.15 | 1302.3 |
| 313.15 | 1299.3 |
| 318.15 | 1296.1 |
| 323.15 | 1293.0 |
| 328.15 | 1289.9 |
| 333.15 | 1286.8 |
| 338.15 | 1283.6 |
| 343.15 | 1280.5 |