- Name
- Methyl valerate
- InChI
- InChI=1S/C6H12O2/c1-3-4-5-6(7)8-2/h3-5H2,1-2H3
- InChI Key
- HNBDRPTVWVGKBR-UHFFFAOYSA-N
- Formula
- C6H12O2
- SMILES
- CCCCC(=O)OC
- Mol. Weight (g/mol)
- 116.16
- CAS
- 624-24-8
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Interfacial tension, N/m [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Interfacial tension, N/m - Liquid mixture 1 |
|---|---|
| 278.15 | 0.0136 |
| 288.15 | 0.0140 |
| 298.15 | 0.0141 |
| 308.15 | 0.0140 |
| 318.15 | 0.0139 |
| 328.15 | 0.0137 |
| 338.15 | 0.0135 |
| 348.15 | 0.0132 |
| 358.15 | 0.0129 |
Interfacial tension, N/m [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Interfacial tension, N/m - Liquid mixture 1 |
|---|---|
| 278.15 | 0.0136 |
| 288.15 | 0.0140 |
| 298.15 | 0.0141 |
| 308.15 | 0.0140 |
| 318.15 | 0.0139 |
| 328.15 | 0.0137 |
| 338.15 | 0.0135 |
| 348.15 | 0.0132 |
| 358.15 | 0.0129 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
|---|---|
| 278.15 | 1000.13 |
| 288.15 | 999.0 |
| 298.15 | 996.8 |
| 308.15 | 993.77 |
| 318.15 | 990.06 |
| 328.15 | 985.66 |
| 338.15 | 980.77 |
| 348.15 | 975.38 |
| 358.15 | 969.51 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
|---|---|
| 278.15 | 906.84 |
| 288.15 | 896.02 |
| 298.15 | 886.03 |
| 308.15 | 876.04 |
| 318.15 | 866.09 |
| 328.15 | 856.0 |
| 338.15 | 845.91 |
| 348.15 | 835.78 |
| 358.15 | 825.63 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
|---|---|
| 278.15 | 1000.13 |
| 288.15 | 999.0 |
| 298.15 | 996.8 |
| 308.15 | 993.77 |
| 318.15 | 990.06 |
| 328.15 | 985.66 |
| 338.15 | 980.77 |
| 348.15 | 975.38 |
| 358.15 | 969.51 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
|---|---|
| 278.15 | 906.84 |
| 288.15 | 896.02 |
| 298.15 | 886.03 |
| 308.15 | 876.04 |
| 318.15 | 866.09 |
| 328.15 | 856.0 |
| 338.15 | 845.91 |
| 348.15 | 835.78 |
| 358.15 | 825.63 |