- Name
- Hexanoic acid, methyl ester
- InChI
- InChI=1S/C7H14O2/c1-3-4-5-6-7(8)9-2/h3-6H2,1-2H3
- InChI Key
- NUKZAGXMHTUAFE-UHFFFAOYSA-N
- Formula
- C7H14O2
- SMILES
- CCCCCC(=O)OC
- Mol. Weight (g/mol)
- 130.18
- CAS
- 106-70-7
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Interfacial tension, N/m [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Interfacial tension, N/m - Liquid mixture 1 |
|---|---|
| 278.15 | 0.0146 |
| 288.15 | 0.0150 |
| 298.15 | 0.0155 |
| 308.15 | 0.0157 |
| 318.15 | 0.0158 |
| 328.15 | 0.0157 |
| 338.15 | 0.0155 |
| 348.15 | 0.0151 |
| 358.15 | 0.0146 |
Interfacial tension, N/m [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Interfacial tension, N/m - Liquid mixture 1 |
|---|---|
| 278.15 | 0.0146 |
| 288.15 | 0.0150 |
| 298.15 | 0.0155 |
| 308.15 | 0.0157 |
| 318.15 | 0.0158 |
| 328.15 | 0.0157 |
| 338.15 | 0.0155 |
| 348.15 | 0.0151 |
| 358.15 | 0.0146 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
|---|---|
| 278.15 | 1000.13 |
| 288.15 | 999.06 |
| 298.15 | 996.96 |
| 308.15 | 993.89 |
| 318.15 | 990.17 |
| 328.15 | 985.84 |
| 338.15 | 980.98 |
| 348.15 | 975.64 |
| 358.15 | 969.87 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
|---|---|
| 278.15 | 899.3 |
| 288.15 | 889.78 |
| 298.15 | 880.34 |
| 308.15 | 870.9 |
| 318.15 | 861.46 |
| 328.15 | 851.92 |
| 338.15 | 842.39 |
| 348.15 | 832.8 |
| 358.15 | 823.16 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
|---|---|
| 278.15 | 1000.13 |
| 288.15 | 999.06 |
| 298.15 | 996.96 |
| 308.15 | 993.89 |
| 318.15 | 990.17 |
| 328.15 | 985.84 |
| 338.15 | 980.98 |
| 348.15 | 975.64 |
| 358.15 | 969.87 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
|---|---|
| 278.15 | 899.3 |
| 288.15 | 889.78 |
| 298.15 | 880.34 |
| 308.15 | 870.9 |
| 318.15 | 861.46 |
| 328.15 | 851.92 |
| 338.15 | 842.39 |
| 348.15 | 832.8 |
| 358.15 | 823.16 |