- Name
- Heptanoic acid, methyl ester
- InChI
- InChI=1S/C8H16O2/c1-3-4-5-6-7-8(9)10-2/h3-7H2,1-2H3
- InChI Key
- XNCNNDVCAUWAIT-UHFFFAOYSA-N
- Formula
- C8H16O2
- SMILES
- CCCCCCC(=O)OC
- Mol. Weight (g/mol)
- 144.21
- CAS
- 106-73-0
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Interfacial tension, N/m [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Interfacial tension, N/m - Liquid mixture 1 |
|---|---|
| 288.15 | 0.0160 |
| 298.15 | 0.0167 |
| 308.15 | 0.0173 |
| 318.15 | 0.0175 |
| 328.15 | 0.0176 |
| 338.15 | 0.0175 |
| 348.15 | 0.0169 |
| 358.15 | 0.0159 |
Interfacial tension, N/m [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Interfacial tension, N/m - Liquid mixture 1 |
|---|---|
| 288.15 | 0.0160 |
| 298.15 | 0.0167 |
| 308.15 | 0.0173 |
| 318.15 | 0.0175 |
| 328.15 | 0.0176 |
| 338.15 | 0.0175 |
| 348.15 | 0.0169 |
| 358.15 | 0.0159 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
|---|---|
| 278.15 | 1000.16 |
| 288.15 | 999.1 |
| 298.15 | 996.97 |
| 308.15 | 993.96 |
| 318.15 | 990.25 |
| 328.15 | 985.92 |
| 338.15 | 981.04 |
| 348.15 | 975.73 |
| 358.15 | 969.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
|---|---|
| 278.15 | 894.11 |
| 288.15 | 884.98 |
| 298.15 | 875.91 |
| 308.15 | 866.96 |
| 318.15 | 857.93 |
| 328.15 | 848.79 |
| 338.15 | 839.85 |
| 348.15 | 830.8 |
| 358.15 | 821.7 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
|---|---|
| 278.15 | 1000.16 |
| 288.15 | 999.1 |
| 298.15 | 996.97 |
| 308.15 | 993.96 |
| 318.15 | 990.25 |
| 328.15 | 985.92 |
| 338.15 | 981.04 |
| 348.15 | 975.73 |
| 358.15 | 969.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
|---|---|
| 278.15 | 894.11 |
| 288.15 | 884.98 |
| 298.15 | 875.91 |
| 308.15 | 866.96 |
| 318.15 | 857.93 |
| 328.15 | 848.79 |
| 338.15 | 839.85 |
| 348.15 | 830.8 |
| 358.15 | 821.7 |