- Name
- Diisopropyl ether
- InChI
- InChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3
- InChI Key
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N
- Formula
- C6H14O
- SMILES
- CC(C)OC(C)C
- Mol. Weight (g/mol)
- 102.17
- CAS
- 108-20-3
- Name
- Naphthalene, 1,2,3,4-tetrahydro-
- InChI
- InChI=1S/C10H12/c1-2-6-10-8-4-3-7-9(10)5-1/h1-2,5-6H,3-4,7-8H2
- InChI Key
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N
- Formula
- C10H12
- SMILES
- c1ccc2c(c1)CCCC2
- Mol. Weight (g/mol)
- 132.20
- CAS
- 119-64-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (1) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.0000 | 0.0017 |
| 0.1358 | 0.0014 |
| 0.2509 | 0.0012 |
| 0.3997 | 0.0010 |
| 0.4474 | 0.0009 |
| 0.5718 | 0.0007 |
| 0.7163 | 0.0006 |
| 0.8473 | 0.0005 |
| 1.0000 | 0.0003 |
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (1) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.0000 | 0.0017 |
| 0.1358 | 0.0014 |
| 0.2509 | 0.0012 |
| 0.3997 | 0.0010 |
| 0.4474 | 0.0009 |
| 0.5718 | 0.0007 |
| 0.7163 | 0.0006 |
| 0.8473 | 0.0005 |
| 1.0000 | 0.0003 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1477.0 |
| 0.1358 | 1396.1 |
| 0.2509 | 1342.5 |
| 0.3997 | 1276.3 |
| 0.4474 | 1253.0 |
| 0.5718 | 1191.8 |
| 0.7163 | 1119.7 |
| 0.8473 | 1054.2 |
| 1.0000 | 974.9 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1477.0 |
| 0.1358 | 1396.1 |
| 0.2509 | 1342.5 |
| 0.3997 | 1276.3 |
| 0.4474 | 1253.0 |
| 0.5718 | 1191.8 |
| 0.7163 | 1119.7 |
| 0.8473 | 1054.2 |
| 1.0000 | 974.9 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (1) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.1358 | -7.0800e-07 |
| 0.2509 | -1.1350e-06 |
| 0.3997 | -1.4590e-06 |
| 0.4474 | -1.5050e-06 |
| 0.5718 | -1.5030e-06 |
| 0.7163 | -1.2610e-06 |
| 0.8473 | -8.1300e-07 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (1) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.1358 | -7.0800e-07 |
| 0.2509 | -1.1350e-06 |
| 0.3997 | -1.4590e-06 |
| 0.4474 | -1.5050e-06 |
| 0.5718 | -1.5030e-06 |
| 0.7163 | -1.2610e-06 |
| 0.8473 | -8.1300e-07 |