- Name
- Dimethyl Sulfoxide
- InChI
- InChI=1S/C2H6OS/c1-4(2)3/h1-2H3
- InChI Key
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N
- Formula
- C2H6OS
- SMILES
- CS(C)=O
- Mol. Weight (g/mol)
- 78.13
- CAS
- 67-68-5
- Name
- 1,4-Dioxane
- InChI
- InChI=1S/C4H8O2/c1-2-6-4-3-5-1/h1-4H2
- InChI Key
- RYHBNJHYFVUHQT-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- C1COCCO1
- Mol. Weight (g/mol)
- 88.11
- CAS
- 123-91-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Cp,liquid - Molar heat capacity at constant pressure, J/K/mol (2)
- Excess molar enthalpy (molar enthalpy (2)
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (1) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 0.0749 | 154.80 |
| 0.1148 | 155.10 |
| 0.2112 | 155.50 |
| 0.3130 | 155.40 |
| 0.4096 | 155.10 |
| 0.5185 | 154.60 |
| 0.6108 | 153.90 |
| 0.6637 | 153.50 |
| 0.7064 | 153.20 |
| 0.8128 | 152.50 |
| 0.8952 | 152.70 |
| 0.9586 | 153.50 |
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (1) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 0.0749 | 154.80 |
| 0.1148 | 155.10 |
| 0.2112 | 155.50 |
| 0.3130 | 155.40 |
| 0.4096 | 155.10 |
| 0.5185 | 154.60 |
| 0.6108 | 153.90 |
| 0.6637 | 153.50 |
| 0.7064 | 153.20 |
| 0.8128 | 152.50 |
| 0.8952 | 152.70 |
| 0.9586 | 153.50 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0478 | 0.1330 |
| 0.0911 | 0.2220 |
| 0.1308 | 0.2810 |
| 0.1671 | 0.3200 |
| 0.2313 | 0.3650 |
| 0.2863 | 0.3860 |
| 0.3757 | 0.4090 |
| 0.4451 | 0.4170 |
| 0.5462 | 0.4040 |
| 0.6437 | 0.3830 |
| 0.7066 | 0.3560 |
| 0.7831 | 0.3100 |
| 0.8280 | 0.2720 |
| 0.8784 | 0.2070 |
| 0.9059 | 0.1670 |
| 0.9353 | 0.1160 |
| 0.9665 | 0.0660 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0478 | 0.1330 |
| 0.0911 | 0.2220 |
| 0.1308 | 0.2810 |
| 0.1671 | 0.3200 |
| 0.2313 | 0.3650 |
| 0.2863 | 0.3860 |
| 0.3757 | 0.4090 |
| 0.4451 | 0.4170 |
| 0.5462 | 0.4040 |
| 0.6437 | 0.3830 |
| 0.7066 | 0.3560 |
| 0.7831 | 0.3100 |
| 0.8280 | 0.2720 |
| 0.8784 | 0.2070 |
| 0.9059 | 0.1670 |
| 0.9353 | 0.1160 |
| 0.9665 | 0.0660 |