- Name
- Ethane, 1,2-diethoxy-
- InChI
- InChI=1S/C6H14O2/c1-3-7-5-6-8-4-2/h3-6H2,1-2H3
- InChI Key
- LZDKZFUFMNSQCJ-UHFFFAOYSA-N
- Formula
- C6H14O2
- SMILES
- CCOCCOCC
- Mol. Weight (g/mol)
- 118.17
- CAS
- 629-14-1
- Name
- Dimethyl Sulfoxide
- InChI
- InChI=1S/C2H6OS/c1-4(2)3/h1-2H3
- InChI Key
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N
- Formula
- C2H6OS
- SMILES
- CS(C)=O
- Mol. Weight (g/mol)
- 78.13
- CAS
- 67-68-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Cp,liquid - Molar heat capacity at constant pressure, J/K/mol (2)
- Excess molar enthalpy (molar enthalpy (2)
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (2) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 0.0627 | 252.80 |
| 0.1317 | 246.00 |
| 0.1895 | 240.70 |
| 0.3500 | 225.00 |
| 0.4563 | 214.40 |
| 0.5642 | 203.20 |
| 0.6350 | 195.80 |
| 0.6718 | 191.90 |
| 0.7514 | 183.10 |
| 0.8274 | 174.70 |
| 0.8881 | 167.70 |
| 0.9410 | 161.60 |
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (2) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 0.0627 | 252.80 |
| 0.1317 | 246.00 |
| 0.1895 | 240.70 |
| 0.3500 | 225.00 |
| 0.4563 | 214.40 |
| 0.5642 | 203.20 |
| 0.6350 | 195.80 |
| 0.6718 | 191.90 |
| 0.7514 | 183.10 |
| 0.8274 | 174.70 |
| 0.8881 | 167.70 |
| 0.9410 | 161.60 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0765 | 0.3420 |
| 0.1421 | 0.5320 |
| 0.1990 | 0.6480 |
| 0.2488 | 0.7200 |
| 0.3320 | 0.8030 |
| 0.3986 | 0.8430 |
| 0.4985 | 0.8930 |
| 0.5698 | 0.8830 |
| 0.6653 | 0.8350 |
| 0.7489 | 0.7260 |
| 0.7990 | 0.6380 |
| 0.8564 | 0.5020 |
| 0.8883 | 0.3970 |
| 0.9227 | 0.2930 |
| 0.9408 | 0.2450 |
| 0.9598 | 0.1600 |
| 0.9795 | 0.0830 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 308.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0765 | 0.3420 |
| 0.1421 | 0.5320 |
| 0.1990 | 0.6480 |
| 0.2488 | 0.7200 |
| 0.3320 | 0.8030 |
| 0.3986 | 0.8430 |
| 0.4985 | 0.8930 |
| 0.5698 | 0.8830 |
| 0.6653 | 0.8350 |
| 0.7489 | 0.7260 |
| 0.7990 | 0.6380 |
| 0.8564 | 0.5020 |
| 0.8883 | 0.3970 |
| 0.9227 | 0.2930 |
| 0.9408 | 0.2450 |
| 0.9598 | 0.1600 |
| 0.9795 | 0.0830 |