- Name
- 1-Octanol
- InChI
- InChI=1S/C8H18O/c1-2-3-4-5-6-7-8-9/h9H,2-8H2,1H3
- InChI Key
- KBPLFHHGFOOTCA-UHFFFAOYSA-N
- Formula
- C8H18O
- SMILES
- CCCCCCCCO
- Mol. Weight (g/mol)
- 130.23
- CAS
- 111-87-5
- Name
- Dimethyl Sulfoxide
- InChI
- InChI=1S/C2H6OS/c1-4(2)3/h1-2H3
- InChI Key
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N
- Formula
- C2H6OS
- SMILES
- CS(C)=O
- Mol. Weight (g/mol)
- 78.13
- CAS
- 67-68-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Cp,liquid - Molar heat capacity at constant pressure, J/K/mol (2)
- Excess molar enthalpy (molar enthalpy (2)
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (2) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 0.0953 | 296.50 |
| 0.1847 | 284.20 |
| 0.3137 | 264.70 |
| 0.3478 | 256.20 |
| 0.4629 | 241.90 |
| 0.5855 | 221.60 |
| 0.6299 | 215.10 |
| 0.7302 | 200.60 |
| 0.7656 | 193.20 |
| 0.8420 | 182.10 |
| 0.8956 | 173.10 |
| 0.9603 | 162.40 |
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (2) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
|---|---|
| 0.0953 | 296.50 |
| 0.1847 | 284.20 |
| 0.3137 | 264.70 |
| 0.3478 | 256.20 |
| 0.4629 | 241.90 |
| 0.5855 | 221.60 |
| 0.6299 | 215.10 |
| 0.7302 | 200.60 |
| 0.7656 | 193.20 |
| 0.8420 | 182.10 |
| 0.8956 | 173.10 |
| 0.9603 | 162.40 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0847 | 0.4700 |
| 0.1562 | 0.8150 |
| 0.2173 | 1.074 |
| 0.2702 | 1.212 |
| 0.3571 | 1.386 |
| 0.4254 | 1.466 |
| 0.5262 | 1.48 |
| 0.5968 | 1.468 |
| 0.6896 | 1.391 |
| 0.7692 | 1.271 |
| 0.8163 | 1.143 |
| 0.8696 | 0.9560 |
| 0.8988 | 0.8140 |
| 0.9302 | 0.6260 |
| 0.9467 | 0.5070 |
| 0.9638 | 0.3630 |
| 0.9816 | 0.1960 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0847 | 0.4700 |
| 0.1562 | 0.8150 |
| 0.2173 | 1.074 |
| 0.2702 | 1.212 |
| 0.3571 | 1.386 |
| 0.4254 | 1.466 |
| 0.5262 | 1.48 |
| 0.5968 | 1.468 |
| 0.6896 | 1.391 |
| 0.7692 | 1.271 |
| 0.8163 | 1.143 |
| 0.8696 | 0.9560 |
| 0.8988 | 0.8140 |
| 0.9302 | 0.6260 |
| 0.9467 | 0.5070 |
| 0.9638 | 0.3630 |
| 0.9816 | 0.1960 |