- Name
- 2-(Acetylamino)-N-methylethanamide
- InChI
- InChI=1S/C5H10N2O2/c1-4(8)7-3-5(9)6-2/h3H2,1-2H3,(H,6,9)(H,7,8)
- InChI Key
- FJMAXCRRCJSCIE-UHFFFAOYSA-N
- Formula
- C5H10N2O2
- SMILES
- CNC(=O)CNC(C)=O
- Mol. Weight (g/mol)
- 130.15
- CAS
- 7606-79-3
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Initial molality of solute, mol/kg - Liquid | Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
| 0.3963 | 0.0159 | -0.2270 |
| 0.3963 | 0.1399 | -0.1487 |
| 0.3963 | 0.1473 | -0.1461 |
| 0.4933 | 0.0259 | -0.2681 |
| 0.4933 | 0.0316 | -0.2745 |
| 0.4933 | 0.0480 | -0.2565 |
| 0.4933 | 0.0574 | -0.2661 |
| 0.5871 | 0.0297 | -0.3651 |
| 0.5871 | 0.0386 | -0.3407 |
| 0.7804 | 0.5277 | -0.1408 |
| 1.5617 | 0.1530 | -0.7403 |
| 1.5617 | 0.9011 | -0.3481 |
| 1.5617 | 1.138 | -0.2191 |
Apparent molar heat capacity, J/K/mol [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 2-(Acetylamino)-N-methylethanamide (1) - Liquid | Apparent molar heat capacity, J/K/mol - Liquid |
| 298.15 | 0.0479 | 328.9 |
| 298.15 | 0.0715 | 328.6 |
| 298.15 | 0.0958 | 327.8 |
| 298.15 | 0.1439 | 326.0 |
| 298.15 | 0.1912 | 324.0 |
| 303.15 | 0.0479 | 334.9 |
| 303.15 | 0.0715 | 336.1 |
| 303.15 | 0.0958 | 334.3 |
| 303.15 | 0.1439 | 333.6 |
| 303.15 | 0.1912 | 330.6 |
| 308.15 | 0.0479 | 343.0 |
| 308.15 | 0.0715 | 343.3 |
| 308.15 | 0.0958 | 342.7 |
| 308.15 | 0.1439 | 343.1 |
| 308.15 | 0.1912 | 342.7 |
| 313.15 | 0.0479 | 349.6 |
| 313.15 | 0.0715 | 350.0 |
| 313.15 | 0.0958 | 349.6 |
| 313.15 | 0.1439 | 350.6 |
| 313.15 | 0.1912 | 350.9 |
| 318.15 | 0.0479 | 357.0 |
| 318.15 | 0.0715 | 358.4 |
| 318.15 | 0.0958 | 359.1 |
| 318.15 | 0.1439 | 358.2 |
| 318.15 | 0.1912 | 360.0 |
| 323.15 | 0.0479 | 360.1 |
| 323.15 | 0.0715 | 361.7 |
| 323.15 | 0.0958 | 361.6 |
| 323.15 | 0.1439 | 361.4 |
| 323.15 | 0.1912 | 363.0 |
| 328.15 | 0.0479 | 365.8 |
| 328.15 | 0.0715 | 366.7 |
| 328.15 | 0.0958 | 367.2 |
| 328.15 | 0.1439 | 369.7 |
| 328.15 | 0.1912 | 369.1 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Initial molality of solute, mol/kg - Liquid | Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
| 0.3963 | 0.0159 | -0.2270 |
| 0.3963 | 0.1399 | -0.1487 |
| 0.3963 | 0.1473 | -0.1461 |
| 0.4933 | 0.0259 | -0.2681 |
| 0.4933 | 0.0316 | -0.2745 |
| 0.4933 | 0.0480 | -0.2565 |
| 0.4933 | 0.0574 | -0.2661 |
| 0.5871 | 0.0297 | -0.3651 |
| 0.5871 | 0.0386 | -0.3407 |
| 0.7804 | 0.5277 | -0.1408 |
| 1.5617 | 0.1530 | -0.7403 |
| 1.5617 | 0.9011 | -0.3481 |
| 1.5617 | 1.138 | -0.2191 |
Apparent molar heat capacity, J/K/mol [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 2-(Acetylamino)-N-methylethanamide (1) - Liquid | Apparent molar heat capacity, J/K/mol - Liquid |
| 298.15 | 0.0479 | 328.9 |
| 298.15 | 0.0715 | 328.6 |
| 298.15 | 0.0958 | 327.8 |
| 298.15 | 0.1439 | 326.0 |
| 298.15 | 0.1912 | 324.0 |
| 303.15 | 0.0479 | 334.9 |
| 303.15 | 0.0715 | 336.1 |
| 303.15 | 0.0958 | 334.3 |
| 303.15 | 0.1439 | 333.6 |
| 303.15 | 0.1912 | 330.6 |
| 308.15 | 0.0479 | 343.0 |
| 308.15 | 0.0715 | 343.3 |
| 308.15 | 0.0958 | 342.7 |
| 308.15 | 0.1439 | 343.1 |
| 308.15 | 0.1912 | 342.7 |
| 313.15 | 0.0479 | 349.6 |
| 313.15 | 0.0715 | 350.0 |
| 313.15 | 0.0958 | 349.6 |
| 313.15 | 0.1439 | 350.6 |
| 313.15 | 0.1912 | 350.9 |
| 318.15 | 0.0479 | 357.0 |
| 318.15 | 0.0715 | 358.4 |
| 318.15 | 0.0958 | 359.1 |
| 318.15 | 0.1439 | 358.2 |
| 318.15 | 0.1912 | 360.0 |
| 323.15 | 0.0479 | 360.1 |
| 323.15 | 0.0715 | 361.7 |
| 323.15 | 0.0958 | 361.6 |
| 323.15 | 0.1439 | 361.4 |
| 323.15 | 0.1912 | 363.0 |
| 328.15 | 0.0479 | 365.8 |
| 328.15 | 0.0715 | 366.7 |
| 328.15 | 0.0958 | 367.2 |
| 328.15 | 0.1439 | 369.7 |
| 328.15 | 0.1912 | 369.1 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of 2-(Acetylamino)-N-methylethanamide (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0457 | 998.056 |
| 0.0592 | 998.352 |
| 0.0780 | 998.754 |
| 0.0929 | 999.062 |
| 0.0987 | 999.177 |
| 0.1530 | 1000.32 |
| 0.1615 | 1000.495 |
| 0.1766 | 1000.791 |
| 0.1889 | 1001.043 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of 2-(Acetylamino)-N-methylethanamide (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0457 | 998.056 |
| 0.0592 | 998.352 |
| 0.0780 | 998.754 |
| 0.0929 | 999.062 |
| 0.0987 | 999.177 |
| 0.1530 | 1000.32 |
| 0.1615 | 1000.495 |
| 0.1766 | 1000.791 |
| 0.1889 | 1001.043 |