- Name
- Tributylamine
- InChI
- InChI=1S/C12H27N/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3
- InChI Key
- IMFACGCPASFAPR-UHFFFAOYSA-N
- Formula
- C12H27N
- SMILES
- CCCCN(CCCC)CCCC
- Mol. Weight (g/mol)
- 185.35
- CAS
- 102-82-9
- Name
- 1,4-Dioxane
- InChI
- InChI=1S/C4H8O2/c1-2-6-4-3-5-1/h1-4H2
- InChI Key
- RYHBNJHYFVUHQT-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- C1COCCO1
- Mol. Weight (g/mol)
- 88.11
- CAS
- 123-91-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (4)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of Tributylamine (1) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.1229 | 0.0011 |
| 0.2173 | 0.0010 |
| 0.3227 | 0.0010 |
| 0.4476 | 0.0010 |
| 0.5768 | 0.0010 |
| 0.7655 | 0.0010 |
| 0.8789 | 0.0010 |
| 1.0282 | 0.0010 |
| 1.1794 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0014 |
| 298.15 | 0.1201 | 0.0012 |
| 298.15 | 0.2122 | 0.0012 |
| 298.15 | 0.3072 | 0.0012 |
| 298.15 | 0.4085 | 0.0011 |
| 298.15 | 0.5014 | 0.0011 |
| 298.15 | 0.5972 | 0.0011 |
| 298.15 | 0.6998 | 0.0011 |
| 298.15 | 0.7999 | 0.0011 |
| 298.15 | 0.8947 | 0.0011 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0012 |
| 303.15 | 0.1201 | 0.0011 |
| 303.15 | 0.2122 | 0.0011 |
| 303.15 | 0.3072 | 0.0011 |
| 303.15 | 0.4085 | 0.0010 |
| 303.15 | 0.5014 | 0.0010 |
| 303.15 | 0.5972 | 0.0010 |
| 303.15 | 0.6998 | 0.0010 |
| 303.15 | 0.7999 | 0.0010 |
| 303.15 | 0.8947 | 0.0010 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0011 |
| 308.15 | 0.1201 | 0.0010 |
| 308.15 | 0.2122 | 0.0010 |
| 308.15 | 0.3072 | 0.0010 |
| 308.15 | 0.4085 | 0.0009 |
| 308.15 | 0.5014 | 0.0009 |
| 308.15 | 0.5972 | 0.0009 |
| 308.15 | 0.6998 | 0.0009 |
| 308.15 | 0.7999 | 0.0009 |
| 308.15 | 0.8947 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of Tributylamine (1) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.1229 | 0.0011 |
| 0.2173 | 0.0010 |
| 0.3227 | 0.0010 |
| 0.4476 | 0.0010 |
| 0.5768 | 0.0010 |
| 0.7655 | 0.0010 |
| 0.8789 | 0.0010 |
| 1.0282 | 0.0010 |
| 1.1794 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0014 |
| 298.15 | 0.1201 | 0.0012 |
| 298.15 | 0.2122 | 0.0012 |
| 298.15 | 0.3072 | 0.0012 |
| 298.15 | 0.4085 | 0.0011 |
| 298.15 | 0.5014 | 0.0011 |
| 298.15 | 0.5972 | 0.0011 |
| 298.15 | 0.6998 | 0.0011 |
| 298.15 | 0.7999 | 0.0011 |
| 298.15 | 0.8947 | 0.0011 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0012 |
| 303.15 | 0.1201 | 0.0011 |
| 303.15 | 0.2122 | 0.0011 |
| 303.15 | 0.3072 | 0.0011 |
| 303.15 | 0.4085 | 0.0010 |
| 303.15 | 0.5014 | 0.0010 |
| 303.15 | 0.5972 | 0.0010 |
| 303.15 | 0.6998 | 0.0010 |
| 303.15 | 0.7999 | 0.0010 |
| 303.15 | 0.8947 | 0.0010 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0011 |
| 308.15 | 0.1201 | 0.0010 |
| 308.15 | 0.2122 | 0.0010 |
| 308.15 | 0.3072 | 0.0010 |
| 308.15 | 0.4085 | 0.0009 |
| 308.15 | 0.5014 | 0.0009 |
| 308.15 | 0.5972 | 0.0009 |
| 308.15 | 0.6998 | 0.0009 |
| 308.15 | 0.7999 | 0.0009 |
| 308.15 | 0.8947 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4274 |
| 298.15 | 0.1201 | 1.4266 |
| 298.15 | 0.2122 | 1.4259 |
| 298.15 | 0.3072 | 1.425 |
| 298.15 | 0.4085 | 1.4244 |
| 298.15 | 0.5014 | 1.4234 |
| 298.15 | 0.5972 | 1.4226 |
| 298.15 | 0.6998 | 1.4217 |
| 298.15 | 0.7999 | 1.421 |
| 298.15 | 0.8947 | 1.4205 |
| 298.15 | 1.0000 | 1.4201 |
| 303.15 | 0.0000 | 1.4251 |
| 303.15 | 0.1201 | 1.424 |
| 303.15 | 0.2122 | 1.4236 |
| 303.15 | 0.3072 | 1.4226 |
| 303.15 | 0.4085 | 1.4218 |
| 303.15 | 0.5014 | 1.4209 |
| 303.15 | 0.5972 | 1.4201 |
| 303.15 | 0.6998 | 1.4192 |
| 303.15 | 0.7999 | 1.4185 |
| 303.15 | 0.8947 | 1.418 |
| 303.15 | 1.0000 | 1.417 |
| 308.15 | 0.0000 | 1.4226 |
| 308.15 | 0.1201 | 1.4215 |
| 308.15 | 0.2122 | 1.421 |
| 308.15 | 0.3072 | 1.4201 |
| 308.15 | 0.4085 | 1.4196 |
| 308.15 | 0.5014 | 1.4184 |
| 308.15 | 0.5972 | 1.4174 |
| 308.15 | 0.6998 | 1.4168 |
| 308.15 | 0.7999 | 1.416 |
| 308.15 | 0.8947 | 1.4154 |
| 308.15 | 1.0000 | 1.4143 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4274 |
| 298.15 | 0.1201 | 1.4266 |
| 298.15 | 0.2122 | 1.4259 |
| 298.15 | 0.3072 | 1.425 |
| 298.15 | 0.4085 | 1.4244 |
| 298.15 | 0.5014 | 1.4234 |
| 298.15 | 0.5972 | 1.4226 |
| 298.15 | 0.6998 | 1.4217 |
| 298.15 | 0.7999 | 1.421 |
| 298.15 | 0.8947 | 1.4205 |
| 298.15 | 1.0000 | 1.4201 |
| 303.15 | 0.0000 | 1.4251 |
| 303.15 | 0.1201 | 1.424 |
| 303.15 | 0.2122 | 1.4236 |
| 303.15 | 0.3072 | 1.4226 |
| 303.15 | 0.4085 | 1.4218 |
| 303.15 | 0.5014 | 1.4209 |
| 303.15 | 0.5972 | 1.4201 |
| 303.15 | 0.6998 | 1.4192 |
| 303.15 | 0.7999 | 1.4185 |
| 303.15 | 0.8947 | 1.418 |
| 303.15 | 1.0000 | 1.417 |
| 308.15 | 0.0000 | 1.4226 |
| 308.15 | 0.1201 | 1.4215 |
| 308.15 | 0.2122 | 1.421 |
| 308.15 | 0.3072 | 1.4201 |
| 308.15 | 0.4085 | 1.4196 |
| 308.15 | 0.5014 | 1.4184 |
| 308.15 | 0.5972 | 1.4174 |
| 308.15 | 0.6998 | 1.4168 |
| 308.15 | 0.7999 | 1.416 |
| 308.15 | 0.8947 | 1.4154 |
| 308.15 | 1.0000 | 1.4143 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 774.4 |
| 298.15 | 0.1201 | 785.1 |
| 298.15 | 0.2122 | 794.7 |
| 298.15 | 0.3072 | 806.0 |
| 298.15 | 0.4085 | 820.5 |
| 298.15 | 0.5014 | 836.6 |
| 298.15 | 0.5972 | 856.9 |
| 298.15 | 0.6998 | 884.0 |
| 298.15 | 0.7999 | 917.9 |
| 298.15 | 0.8947 | 960.6 |
| 298.15 | 1.0000 | 1027.6 |
| 303.15 | 0.0000 | 770.1 |
| 303.15 | 0.1201 | 780.9 |
| 303.15 | 0.2122 | 790.2 |
| 303.15 | 0.3072 | 801.6 |
| 303.15 | 0.4085 | 815.9 |
| 303.15 | 0.5014 | 832.1 |
| 303.15 | 0.5972 | 852.1 |
| 303.15 | 0.6998 | 879.2 |
| 303.15 | 0.7999 | 912.6 |
| 303.15 | 0.8947 | 955.2 |
| 303.15 | 1.0000 | 1021.9 |
| 308.15 | 0.0000 | 766.2 |
| 308.15 | 0.1201 | 776.8 |
| 308.15 | 0.2122 | 785.9 |
| 308.15 | 0.3072 | 797.1 |
| 308.15 | 0.4085 | 811.4 |
| 308.15 | 0.5014 | 827.5 |
| 308.15 | 0.5972 | 847.4 |
| 308.15 | 0.6998 | 874.1 |
| 308.15 | 0.7999 | 907.4 |
| 308.15 | 0.8947 | 949.9 |
| 308.15 | 1.0000 | 1016.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 774.4 |
| 298.15 | 0.1201 | 785.1 |
| 298.15 | 0.2122 | 794.7 |
| 298.15 | 0.3072 | 806.0 |
| 298.15 | 0.4085 | 820.5 |
| 298.15 | 0.5014 | 836.6 |
| 298.15 | 0.5972 | 856.9 |
| 298.15 | 0.6998 | 884.0 |
| 298.15 | 0.7999 | 917.9 |
| 298.15 | 0.8947 | 960.6 |
| 298.15 | 1.0000 | 1027.6 |
| 303.15 | 0.0000 | 770.1 |
| 303.15 | 0.1201 | 780.9 |
| 303.15 | 0.2122 | 790.2 |
| 303.15 | 0.3072 | 801.6 |
| 303.15 | 0.4085 | 815.9 |
| 303.15 | 0.5014 | 832.1 |
| 303.15 | 0.5972 | 852.1 |
| 303.15 | 0.6998 | 879.2 |
| 303.15 | 0.7999 | 912.6 |
| 303.15 | 0.8947 | 955.2 |
| 303.15 | 1.0000 | 1021.9 |
| 308.15 | 0.0000 | 766.2 |
| 308.15 | 0.1201 | 776.8 |
| 308.15 | 0.2122 | 785.9 |
| 308.15 | 0.3072 | 797.1 |
| 308.15 | 0.4085 | 811.4 |
| 308.15 | 0.5014 | 827.5 |
| 308.15 | 0.5972 | 847.4 |
| 308.15 | 0.6998 | 874.1 |
| 308.15 | 0.7999 | 907.4 |
| 308.15 | 0.8947 | 949.9 |
| 308.15 | 1.0000 | 1016.2 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1261.0 |
| 0.1201 | 1253.0 |
| 0.2122 | 1254.0 |
| 0.3072 | 1257.0 |
| 0.4085 | 1264.0 |
| 0.5014 | 1272.0 |
| 0.5972 | 1281.0 |
| 0.6998 | 1292.0 |
| 0.7999 | 1305.0 |
| 0.8947 | 1320.0 |
| 1.0000 | 1343.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1261.0 |
| 0.1201 | 1253.0 |
| 0.2122 | 1254.0 |
| 0.3072 | 1257.0 |
| 0.4085 | 1264.0 |
| 0.5014 | 1272.0 |
| 0.5972 | 1281.0 |
| 0.6998 | 1292.0 |
| 0.7999 | 1305.0 |
| 0.8947 | 1320.0 |
| 1.0000 | 1343.0 |
Sources
- Studies of viscosities of dilute solutions of alkylamines in non-electrolyte solvents: IV. Alkylamines in 1,4-dioxane and oxolane at 303.15K
- Density, Viscosity, Refractive Index, and Speed of Sound in the Binary Mixtures of 1,4-Dioxane + Ethanediol, + Hexane, + Tributylamine, or + Triethylamine at (298.15, 303.15, and 308.15) K