- Name
- Diisopropyl ether
- InChI
- InChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3
- InChI Key
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N
- Formula
- C6H14O
- SMILES
- CC(C)OC(C)C
- Mol. Weight (g/mol)
- 102.17
- CAS
- 108-20-3
- Name
- o-Toluidine
- InChI
- InChI=1S/C7H9N/c1-6-4-2-3-5-7(6)8/h2-5H,8H2,1H3
- InChI Key
- RNVCVTLRINQCPJ-UHFFFAOYSA-N
- Formula
- C7H9N
- SMILES
- Cc1ccccc1N
- Mol. Weight (g/mol)
- 107.15
- CAS
- 95-53-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 990.1 |
| 303.15 | 0.0717 | 968.9 |
| 303.15 | 0.1513 | 946.3 |
| 303.15 | 0.2389 | 922.0 |
| 303.15 | 0.3255 | 898.8 |
| 303.15 | 0.4206 | 873.5 |
| 303.15 | 0.5248 | 845.6 |
| 303.15 | 0.6250 | 817.9 |
| 303.15 | 0.7415 | 784.9 |
| 303.15 | 0.8660 | 749.3 |
| 303.15 | 1.0000 | 712.9 |
| 313.15 | 0.0000 | 981.7 |
| 313.15 | 0.0717 | 962.3 |
| 313.15 | 0.1513 | 940.3 |
| 313.15 | 0.2389 | 916.1 |
| 313.15 | 0.3255 | 892.6 |
| 313.15 | 0.4206 | 866.9 |
| 313.15 | 0.5248 | 838.8 |
| 313.15 | 0.6250 | 811.0 |
| 313.15 | 0.7415 | 777.6 |
| 313.15 | 0.8660 | 741.0 |
| 313.15 | 1.0000 | 702.5 |
| 323.15 | 0.0000 | 973.3 |
| 323.15 | 0.0717 | 955.7 |
| 323.15 | 0.1513 | 934.4 |
| 323.15 | 0.2389 | 910.4 |
| 323.15 | 0.3255 | 886.4 |
| 323.15 | 0.4206 | 860.2 |
| 323.15 | 0.5248 | 831.6 |
| 323.15 | 0.6250 | 803.6 |
| 323.15 | 0.7415 | 770.0 |
| 323.15 | 0.8660 | 732.8 |
| 323.15 | 1.0000 | 691.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 990.1 |
| 303.15 | 0.0717 | 968.9 |
| 303.15 | 0.1513 | 946.3 |
| 303.15 | 0.2389 | 922.0 |
| 303.15 | 0.3255 | 898.8 |
| 303.15 | 0.4206 | 873.5 |
| 303.15 | 0.5248 | 845.6 |
| 303.15 | 0.6250 | 817.9 |
| 303.15 | 0.7415 | 784.9 |
| 303.15 | 0.8660 | 749.3 |
| 303.15 | 1.0000 | 712.9 |
| 313.15 | 0.0000 | 981.7 |
| 313.15 | 0.0717 | 962.3 |
| 313.15 | 0.1513 | 940.3 |
| 313.15 | 0.2389 | 916.1 |
| 313.15 | 0.3255 | 892.6 |
| 313.15 | 0.4206 | 866.9 |
| 313.15 | 0.5248 | 838.8 |
| 313.15 | 0.6250 | 811.0 |
| 313.15 | 0.7415 | 777.6 |
| 313.15 | 0.8660 | 741.0 |
| 313.15 | 1.0000 | 702.5 |
| 323.15 | 0.0000 | 973.3 |
| 323.15 | 0.0717 | 955.7 |
| 323.15 | 0.1513 | 934.4 |
| 323.15 | 0.2389 | 910.4 |
| 323.15 | 0.3255 | 886.4 |
| 323.15 | 0.4206 | 860.2 |
| 323.15 | 0.5248 | 831.6 |
| 323.15 | 0.6250 | 803.6 |
| 323.15 | 0.7415 | 770.0 |
| 323.15 | 0.8660 | 732.8 |
| 323.15 | 1.0000 | 691.9 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1579.0 |
| 303.15 | 0.0717 | 1530.0 |
| 303.15 | 0.1513 | 1475.0 |
| 303.15 | 0.2389 | 1415.0 |
| 303.15 | 0.3255 | 1359.0 |
| 303.15 | 0.4206 | 1299.0 |
| 303.15 | 0.5248 | 1237.0 |
| 303.15 | 0.6250 | 1180.0 |
| 303.15 | 0.7415 | 1116.0 |
| 303.15 | 0.8660 | 1049.0 |
| 303.15 | 1.0000 | 976.0 |
| 313.15 | 0.0000 | 1539.0 |
| 313.15 | 0.0717 | 1491.0 |
| 313.15 | 0.1513 | 1437.0 |
| 313.15 | 0.2389 | 1378.0 |
| 313.15 | 0.3255 | 1320.0 |
| 313.15 | 0.4206 | 1259.0 |
| 313.15 | 0.5248 | 1197.0 |
| 313.15 | 0.6250 | 1139.0 |
| 313.15 | 0.7415 | 1074.0 |
| 313.15 | 0.8660 | 1007.0 |
| 313.15 | 1.0000 | 932.0 |
| 323.15 | 0.0000 | 1501.0 |
| 323.15 | 0.0717 | 1457.0 |
| 323.15 | 0.1513 | 1404.0 |
| 323.15 | 0.2389 | 1343.0 |
| 323.15 | 0.3255 | 1284.0 |
| 323.15 | 0.4206 | 1224.0 |
| 323.15 | 0.5248 | 1160.0 |
| 323.15 | 0.6250 | 1103.0 |
| 323.15 | 0.7415 | 1038.0 |
| 323.15 | 0.8660 | 968.0 |
| 323.15 | 1.0000 | 889.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1579.0 |
| 303.15 | 0.0717 | 1530.0 |
| 303.15 | 0.1513 | 1475.0 |
| 303.15 | 0.2389 | 1415.0 |
| 303.15 | 0.3255 | 1359.0 |
| 303.15 | 0.4206 | 1299.0 |
| 303.15 | 0.5248 | 1237.0 |
| 303.15 | 0.6250 | 1180.0 |
| 303.15 | 0.7415 | 1116.0 |
| 303.15 | 0.8660 | 1049.0 |
| 303.15 | 1.0000 | 976.0 |
| 313.15 | 0.0000 | 1539.0 |
| 313.15 | 0.0717 | 1491.0 |
| 313.15 | 0.1513 | 1437.0 |
| 313.15 | 0.2389 | 1378.0 |
| 313.15 | 0.3255 | 1320.0 |
| 313.15 | 0.4206 | 1259.0 |
| 313.15 | 0.5248 | 1197.0 |
| 313.15 | 0.6250 | 1139.0 |
| 313.15 | 0.7415 | 1074.0 |
| 313.15 | 0.8660 | 1007.0 |
| 313.15 | 1.0000 | 932.0 |
| 323.15 | 0.0000 | 1501.0 |
| 323.15 | 0.0717 | 1457.0 |
| 323.15 | 0.1513 | 1404.0 |
| 323.15 | 0.2389 | 1343.0 |
| 323.15 | 0.3255 | 1284.0 |
| 323.15 | 0.4206 | 1224.0 |
| 323.15 | 0.5248 | 1160.0 |
| 323.15 | 0.6250 | 1103.0 |
| 323.15 | 0.7415 | 1038.0 |
| 323.15 | 0.8660 | 968.0 |
| 323.15 | 1.0000 | 889.0 |