- Name
- Diisopropyl ether
- InChI
- InChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3
- InChI Key
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N
- Formula
- C6H14O
- SMILES
- CC(C)OC(C)C
- Mol. Weight (g/mol)
- 102.17
- CAS
- 108-20-3
- Name
- Benzenamine, 3-methyl-
- InChI
- InChI=1S/C7H9N/c1-6-3-2-4-7(8)5-6/h2-5H,8H2,1H3
- InChI Key
- JJYPMNFTHPTTDI-UHFFFAOYSA-N
- Formula
- C7H9N
- SMILES
- Cc1cccc(N)c1
- Mol. Weight (g/mol)
- 107.15
- CAS
- 108-44-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 980.8 |
| 303.15 | 0.0743 | 961.0 |
| 303.15 | 0.1546 | 939.9 |
| 303.15 | 0.2421 | 917.2 |
| 303.15 | 0.3279 | 894.6 |
| 303.15 | 0.4275 | 868.0 |
| 303.15 | 0.5300 | 840.0 |
| 303.15 | 0.6285 | 812.7 |
| 303.15 | 0.7424 | 781.2 |
| 303.15 | 0.8651 | 747.8 |
| 303.15 | 1.0000 | 712.9 |
| 313.15 | 0.0000 | 972.7 |
| 313.15 | 0.0743 | 954.3 |
| 313.15 | 0.1546 | 934.0 |
| 313.15 | 0.2421 | 911.5 |
| 313.15 | 0.3279 | 888.9 |
| 313.15 | 0.4275 | 862.1 |
| 313.15 | 0.5300 | 834.0 |
| 313.15 | 0.6285 | 806.4 |
| 313.15 | 0.7424 | 774.5 |
| 313.15 | 0.8651 | 740.1 |
| 313.15 | 1.0000 | 702.9 |
| 323.15 | 0.0000 | 964.6 |
| 323.15 | 0.0743 | 946.9 |
| 323.15 | 0.1546 | 927.0 |
| 323.15 | 0.2421 | 904.6 |
| 323.15 | 0.3279 | 881.9 |
| 323.15 | 0.4275 | 855.0 |
| 323.15 | 0.5300 | 826.9 |
| 323.15 | 0.6285 | 799.4 |
| 323.15 | 0.7424 | 767.0 |
| 323.15 | 0.8651 | 731.6 |
| 323.15 | 1.0000 | 691.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 980.8 |
| 303.15 | 0.0743 | 961.0 |
| 303.15 | 0.1546 | 939.9 |
| 303.15 | 0.2421 | 917.2 |
| 303.15 | 0.3279 | 894.6 |
| 303.15 | 0.4275 | 868.0 |
| 303.15 | 0.5300 | 840.0 |
| 303.15 | 0.6285 | 812.7 |
| 303.15 | 0.7424 | 781.2 |
| 303.15 | 0.8651 | 747.8 |
| 303.15 | 1.0000 | 712.9 |
| 313.15 | 0.0000 | 972.7 |
| 313.15 | 0.0743 | 954.3 |
| 313.15 | 0.1546 | 934.0 |
| 313.15 | 0.2421 | 911.5 |
| 313.15 | 0.3279 | 888.9 |
| 313.15 | 0.4275 | 862.1 |
| 313.15 | 0.5300 | 834.0 |
| 313.15 | 0.6285 | 806.4 |
| 313.15 | 0.7424 | 774.5 |
| 313.15 | 0.8651 | 740.1 |
| 313.15 | 1.0000 | 702.9 |
| 323.15 | 0.0000 | 964.6 |
| 323.15 | 0.0743 | 946.9 |
| 323.15 | 0.1546 | 927.0 |
| 323.15 | 0.2421 | 904.6 |
| 323.15 | 0.3279 | 881.9 |
| 323.15 | 0.4275 | 855.0 |
| 323.15 | 0.5300 | 826.9 |
| 323.15 | 0.6285 | 799.4 |
| 323.15 | 0.7424 | 767.0 |
| 323.15 | 0.8651 | 731.6 |
| 323.15 | 1.0000 | 691.9 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1567.0 |
| 303.15 | 0.0743 | 1515.0 |
| 303.15 | 0.1546 | 1462.0 |
| 303.15 | 0.2421 | 1404.0 |
| 303.15 | 0.3279 | 1350.0 |
| 303.15 | 0.4275 | 1289.0 |
| 303.15 | 0.5300 | 1230.0 |
| 303.15 | 0.6285 | 1175.0 |
| 303.15 | 0.7424 | 1113.0 |
| 303.15 | 0.8651 | 1048.0 |
| 303.15 | 1.0000 | 976.0 |
| 313.15 | 0.0000 | 1533.0 |
| 313.15 | 0.0743 | 1482.0 |
| 313.15 | 0.1546 | 1429.0 |
| 313.15 | 0.2421 | 1371.0 |
| 313.15 | 0.3279 | 1315.0 |
| 313.15 | 0.4275 | 1254.0 |
| 313.15 | 0.5300 | 1193.0 |
| 313.15 | 0.6285 | 1138.0 |
| 313.15 | 0.7424 | 1075.0 |
| 313.15 | 0.8651 | 1007.0 |
| 313.15 | 1.0000 | 932.0 |
| 323.15 | 0.0000 | 1492.0 |
| 323.15 | 0.0743 | 1443.0 |
| 323.15 | 0.1546 | 1391.0 |
| 323.15 | 0.2421 | 1334.0 |
| 323.15 | 0.3279 | 1280.0 |
| 323.15 | 0.4275 | 1218.0 |
| 323.15 | 0.5300 | 1158.0 |
| 323.15 | 0.6285 | 1101.0 |
| 323.15 | 0.7424 | 1036.0 |
| 323.15 | 0.8651 | 966.0 |
| 323.15 | 1.0000 | 889.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1567.0 |
| 303.15 | 0.0743 | 1515.0 |
| 303.15 | 0.1546 | 1462.0 |
| 303.15 | 0.2421 | 1404.0 |
| 303.15 | 0.3279 | 1350.0 |
| 303.15 | 0.4275 | 1289.0 |
| 303.15 | 0.5300 | 1230.0 |
| 303.15 | 0.6285 | 1175.0 |
| 303.15 | 0.7424 | 1113.0 |
| 303.15 | 0.8651 | 1048.0 |
| 303.15 | 1.0000 | 976.0 |
| 313.15 | 0.0000 | 1533.0 |
| 313.15 | 0.0743 | 1482.0 |
| 313.15 | 0.1546 | 1429.0 |
| 313.15 | 0.2421 | 1371.0 |
| 313.15 | 0.3279 | 1315.0 |
| 313.15 | 0.4275 | 1254.0 |
| 313.15 | 0.5300 | 1193.0 |
| 313.15 | 0.6285 | 1138.0 |
| 313.15 | 0.7424 | 1075.0 |
| 313.15 | 0.8651 | 1007.0 |
| 313.15 | 1.0000 | 932.0 |
| 323.15 | 0.0000 | 1492.0 |
| 323.15 | 0.0743 | 1443.0 |
| 323.15 | 0.1546 | 1391.0 |
| 323.15 | 0.2421 | 1334.0 |
| 323.15 | 0.3279 | 1280.0 |
| 323.15 | 0.4275 | 1218.0 |
| 323.15 | 0.5300 | 1158.0 |
| 323.15 | 0.6285 | 1101.0 |
| 323.15 | 0.7424 | 1036.0 |
| 323.15 | 0.8651 | 966.0 |
| 323.15 | 1.0000 | 889.0 |