- Name
- Diisopropyl ether
- InChI
- InChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3
- InChI Key
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N
- Formula
- C6H14O
- SMILES
- CC(C)OC(C)C
- Mol. Weight (g/mol)
- 102.17
- CAS
- 108-20-3
- Name
- Benzenamine, N,N-dimethyl-
- InChI
- InChI=1S/C8H11N/c1-9(2)8-6-4-3-5-7-8/h3-7H,1-2H3
- InChI Key
- JLTDJTHDQAWBAV-UHFFFAOYSA-N
- Formula
- C8H11N
- SMILES
- CN(C)c1ccccc1
- Mol. Weight (g/mol)
- 121.18
- CAS
- 121-69-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 948.4 |
| 303.15 | 0.0741 | 932.6 |
| 303.15 | 0.1589 | 914.0 |
| 303.15 | 0.2428 | 895.3 |
| 303.15 | 0.3355 | 874.3 |
| 303.15 | 0.4294 | 852.6 |
| 303.15 | 0.5338 | 827.8 |
| 303.15 | 0.6362 | 802.8 |
| 303.15 | 0.7466 | 775.2 |
| 303.15 | 0.8676 | 744.8 |
| 303.15 | 1.0000 | 712.9 |
| 313.15 | 0.0000 | 939.8 |
| 313.15 | 0.0741 | 924.8 |
| 313.15 | 0.1589 | 906.5 |
| 313.15 | 0.2428 | 887.5 |
| 313.15 | 0.3355 | 866.2 |
| 313.15 | 0.4294 | 844.2 |
| 313.15 | 0.5338 | 819.2 |
| 313.15 | 0.6362 | 794.1 |
| 313.15 | 0.7466 | 766.4 |
| 313.15 | 0.8676 | 735.7 |
| 313.15 | 1.0000 | 702.5 |
| 323.15 | 0.0000 | 931.5 |
| 323.15 | 0.0741 | 916.9 |
| 323.15 | 0.1589 | 898.6 |
| 323.15 | 0.2428 | 879.6 |
| 323.15 | 0.3355 | 858.3 |
| 323.15 | 0.4294 | 836.3 |
| 323.15 | 0.5338 | 811.5 |
| 323.15 | 0.6362 | 786.4 |
| 323.15 | 0.7466 | 758.5 |
| 323.15 | 0.8676 | 726.9 |
| 323.15 | 1.0000 | 691.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 948.4 |
| 303.15 | 0.0741 | 932.6 |
| 303.15 | 0.1589 | 914.0 |
| 303.15 | 0.2428 | 895.3 |
| 303.15 | 0.3355 | 874.3 |
| 303.15 | 0.4294 | 852.6 |
| 303.15 | 0.5338 | 827.8 |
| 303.15 | 0.6362 | 802.8 |
| 303.15 | 0.7466 | 775.2 |
| 303.15 | 0.8676 | 744.8 |
| 303.15 | 1.0000 | 712.9 |
| 313.15 | 0.0000 | 939.8 |
| 313.15 | 0.0741 | 924.8 |
| 313.15 | 0.1589 | 906.5 |
| 313.15 | 0.2428 | 887.5 |
| 313.15 | 0.3355 | 866.2 |
| 313.15 | 0.4294 | 844.2 |
| 313.15 | 0.5338 | 819.2 |
| 313.15 | 0.6362 | 794.1 |
| 313.15 | 0.7466 | 766.4 |
| 313.15 | 0.8676 | 735.7 |
| 313.15 | 1.0000 | 702.5 |
| 323.15 | 0.0000 | 931.5 |
| 323.15 | 0.0741 | 916.9 |
| 323.15 | 0.1589 | 898.6 |
| 323.15 | 0.2428 | 879.6 |
| 323.15 | 0.3355 | 858.3 |
| 323.15 | 0.4294 | 836.3 |
| 323.15 | 0.5338 | 811.5 |
| 323.15 | 0.6362 | 786.4 |
| 323.15 | 0.7466 | 758.5 |
| 323.15 | 0.8676 | 726.9 |
| 323.15 | 1.0000 | 691.9 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1468.0 |
| 303.15 | 0.0741 | 1430.0 |
| 303.15 | 0.1589 | 1385.0 |
| 303.15 | 0.2428 | 1342.0 |
| 303.15 | 0.3355 | 1296.0 |
| 303.15 | 0.4294 | 1250.0 |
| 303.15 | 0.5338 | 1199.0 |
| 303.15 | 0.6362 | 1149.0 |
| 303.15 | 0.7466 | 1096.0 |
| 303.15 | 0.8676 | 1038.0 |
| 303.15 | 1.0000 | 976.0 |
| 313.15 | 0.0000 | 1431.0 |
| 313.15 | 0.0741 | 1396.0 |
| 313.15 | 0.1589 | 1353.0 |
| 313.15 | 0.2428 | 1311.0 |
| 313.15 | 0.3355 | 1262.0 |
| 313.15 | 0.4294 | 1214.0 |
| 313.15 | 0.5338 | 1161.0 |
| 313.15 | 0.6362 | 1112.0 |
| 313.15 | 0.7466 | 1059.0 |
| 313.15 | 0.8676 | 1000.0 |
| 313.15 | 1.0000 | 932.0 |
| 323.15 | 0.0000 | 1393.0 |
| 323.15 | 0.0741 | 1360.0 |
| 323.15 | 0.1589 | 1318.0 |
| 323.15 | 0.2428 | 1277.0 |
| 323.15 | 0.3355 | 1229.0 |
| 323.15 | 0.4294 | 1182.0 |
| 323.15 | 0.5338 | 1128.0 |
| 323.15 | 0.6362 | 1078.0 |
| 323.15 | 0.7466 | 1024.0 |
| 323.15 | 0.8676 | 961.0 |
| 323.15 | 1.0000 | 889.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1468.0 |
| 303.15 | 0.0741 | 1430.0 |
| 303.15 | 0.1589 | 1385.0 |
| 303.15 | 0.2428 | 1342.0 |
| 303.15 | 0.3355 | 1296.0 |
| 303.15 | 0.4294 | 1250.0 |
| 303.15 | 0.5338 | 1199.0 |
| 303.15 | 0.6362 | 1149.0 |
| 303.15 | 0.7466 | 1096.0 |
| 303.15 | 0.8676 | 1038.0 |
| 303.15 | 1.0000 | 976.0 |
| 313.15 | 0.0000 | 1431.0 |
| 313.15 | 0.0741 | 1396.0 |
| 313.15 | 0.1589 | 1353.0 |
| 313.15 | 0.2428 | 1311.0 |
| 313.15 | 0.3355 | 1262.0 |
| 313.15 | 0.4294 | 1214.0 |
| 313.15 | 0.5338 | 1161.0 |
| 313.15 | 0.6362 | 1112.0 |
| 313.15 | 0.7466 | 1059.0 |
| 313.15 | 0.8676 | 1000.0 |
| 313.15 | 1.0000 | 932.0 |
| 323.15 | 0.0000 | 1393.0 |
| 323.15 | 0.0741 | 1360.0 |
| 323.15 | 0.1589 | 1318.0 |
| 323.15 | 0.2428 | 1277.0 |
| 323.15 | 0.3355 | 1229.0 |
| 323.15 | 0.4294 | 1182.0 |
| 323.15 | 0.5338 | 1128.0 |
| 323.15 | 0.6362 | 1078.0 |
| 323.15 | 0.7466 | 1024.0 |
| 323.15 | 0.8676 | 961.0 |
| 323.15 | 1.0000 | 889.0 |