- Name
- Diisopropyl ether
- InChI
- InChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3
- InChI Key
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N
- Formula
- C6H14O
- SMILES
- CC(C)OC(C)C
- Mol. Weight (g/mol)
- 102.17
- CAS
- 108-20-3
- Name
- N,N-Diethylaniline
- InChI
- InChI=1S/C10H15N/c1-3-11(4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3
- InChI Key
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N
- Formula
- C10H15N
- SMILES
- CCN(CC)c1ccccc1
- Mol. Weight (g/mol)
- 149.23
- CAS
- 91-66-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 926.2 |
| 303.15 | 0.0780 | 914.4 |
| 303.15 | 0.1606 | 901.0 |
| 303.15 | 0.2581 | 884.0 |
| 303.15 | 0.3421 | 868.5 |
| 303.15 | 0.4336 | 850.7 |
| 303.15 | 0.5341 | 829.8 |
| 303.15 | 0.6457 | 804.7 |
| 303.15 | 0.7545 | 778.3 |
| 303.15 | 0.8762 | 746.7 |
| 303.15 | 1.0000 | 712.9 |
| 313.15 | 0.0000 | 917.6 |
| 313.15 | 0.0780 | 906.8 |
| 313.15 | 0.1606 | 893.6 |
| 313.15 | 0.2581 | 876.7 |
| 313.15 | 0.3421 | 861.1 |
| 313.15 | 0.4336 | 843.0 |
| 313.15 | 0.5341 | 822.1 |
| 313.15 | 0.6457 | 797.1 |
| 313.15 | 0.7545 | 770.6 |
| 313.15 | 0.8762 | 738.3 |
| 313.15 | 1.0000 | 702.5 |
| 323.15 | 0.0000 | 909.2 |
| 323.15 | 0.0780 | 899.0 |
| 323.15 | 0.1606 | 886.6 |
| 323.15 | 0.2581 | 870.2 |
| 323.15 | 0.3421 | 854.7 |
| 323.15 | 0.4336 | 836.7 |
| 323.15 | 0.5341 | 815.7 |
| 323.15 | 0.6457 | 790.6 |
| 323.15 | 0.7545 | 764.0 |
| 323.15 | 0.8762 | 730.8 |
| 323.15 | 1.0000 | 691.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 926.2 |
| 303.15 | 0.0780 | 914.4 |
| 303.15 | 0.1606 | 901.0 |
| 303.15 | 0.2581 | 884.0 |
| 303.15 | 0.3421 | 868.5 |
| 303.15 | 0.4336 | 850.7 |
| 303.15 | 0.5341 | 829.8 |
| 303.15 | 0.6457 | 804.7 |
| 303.15 | 0.7545 | 778.3 |
| 303.15 | 0.8762 | 746.7 |
| 303.15 | 1.0000 | 712.9 |
| 313.15 | 0.0000 | 917.6 |
| 313.15 | 0.0780 | 906.8 |
| 313.15 | 0.1606 | 893.6 |
| 313.15 | 0.2581 | 876.7 |
| 313.15 | 0.3421 | 861.1 |
| 313.15 | 0.4336 | 843.0 |
| 313.15 | 0.5341 | 822.1 |
| 313.15 | 0.6457 | 797.1 |
| 313.15 | 0.7545 | 770.6 |
| 313.15 | 0.8762 | 738.3 |
| 313.15 | 1.0000 | 702.5 |
| 323.15 | 0.0000 | 909.2 |
| 323.15 | 0.0780 | 899.0 |
| 323.15 | 0.1606 | 886.6 |
| 323.15 | 0.2581 | 870.2 |
| 323.15 | 0.3421 | 854.7 |
| 323.15 | 0.4336 | 836.7 |
| 323.15 | 0.5341 | 815.7 |
| 323.15 | 0.6457 | 790.6 |
| 323.15 | 0.7545 | 764.0 |
| 323.15 | 0.8762 | 730.8 |
| 323.15 | 1.0000 | 691.9 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1434.0 |
| 303.15 | 0.0780 | 1403.0 |
| 303.15 | 0.1606 | 1370.0 |
| 303.15 | 0.2581 | 1330.0 |
| 303.15 | 0.3421 | 1295.0 |
| 303.15 | 0.4336 | 1255.0 |
| 303.15 | 0.5341 | 1209.0 |
| 303.15 | 0.6457 | 1156.0 |
| 303.15 | 0.7545 | 1103.0 |
| 303.15 | 0.8762 | 1042.0 |
| 303.15 | 1.0000 | 976.0 |
| 313.15 | 0.0000 | 1396.0 |
| 313.15 | 0.0780 | 1367.0 |
| 313.15 | 0.1606 | 1336.0 |
| 313.15 | 0.2581 | 1296.0 |
| 313.15 | 0.3421 | 1260.0 |
| 313.15 | 0.4336 | 1218.0 |
| 313.15 | 0.5341 | 1171.0 |
| 313.15 | 0.6457 | 1117.0 |
| 313.15 | 0.7545 | 1063.0 |
| 313.15 | 0.8762 | 1000.0 |
| 313.15 | 1.0000 | 932.0 |
| 323.15 | 0.0000 | 1358.0 |
| 323.15 | 0.0780 | 1332.0 |
| 323.15 | 0.1606 | 1302.0 |
| 323.15 | 0.2581 | 1261.0 |
| 323.15 | 0.3421 | 1224.0 |
| 323.15 | 0.4336 | 1182.0 |
| 323.15 | 0.5341 | 1134.0 |
| 323.15 | 0.6457 | 1080.0 |
| 323.15 | 0.7545 | 1023.0 |
| 323.15 | 0.8762 | 958.0 |
| 323.15 | 1.0000 | 889.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1434.0 |
| 303.15 | 0.0780 | 1403.0 |
| 303.15 | 0.1606 | 1370.0 |
| 303.15 | 0.2581 | 1330.0 |
| 303.15 | 0.3421 | 1295.0 |
| 303.15 | 0.4336 | 1255.0 |
| 303.15 | 0.5341 | 1209.0 |
| 303.15 | 0.6457 | 1156.0 |
| 303.15 | 0.7545 | 1103.0 |
| 303.15 | 0.8762 | 1042.0 |
| 303.15 | 1.0000 | 976.0 |
| 313.15 | 0.0000 | 1396.0 |
| 313.15 | 0.0780 | 1367.0 |
| 313.15 | 0.1606 | 1336.0 |
| 313.15 | 0.2581 | 1296.0 |
| 313.15 | 0.3421 | 1260.0 |
| 313.15 | 0.4336 | 1218.0 |
| 313.15 | 0.5341 | 1171.0 |
| 313.15 | 0.6457 | 1117.0 |
| 313.15 | 0.7545 | 1063.0 |
| 313.15 | 0.8762 | 1000.0 |
| 313.15 | 1.0000 | 932.0 |
| 323.15 | 0.0000 | 1358.0 |
| 323.15 | 0.0780 | 1332.0 |
| 323.15 | 0.1606 | 1302.0 |
| 323.15 | 0.2581 | 1261.0 |
| 323.15 | 0.3421 | 1224.0 |
| 323.15 | 0.4336 | 1182.0 |
| 323.15 | 0.5341 | 1134.0 |
| 323.15 | 0.6457 | 1080.0 |
| 323.15 | 0.7545 | 1023.0 |
| 323.15 | 0.8762 | 958.0 |
| 323.15 | 1.0000 | 889.0 |