- Name
- Benzenamine, N,N-dimethyl-
- InChI
- InChI=1S/C8H11N/c1-9(2)8-6-4-3-5-7-8/h3-7H,1-2H3
- InChI Key
- JLTDJTHDQAWBAV-UHFFFAOYSA-N
- Formula
- C8H11N
- SMILES
- CN(C)c1ccccc1
- Mol. Weight (g/mol)
- 121.18
- CAS
- 121-69-7
- Name
- Tetrahydrofuran
- InChI
- InChI=1S/C4H8O/c1-2-4-5-3-1/h1-4H2
- InChI Key
- WYURNTSHIVDZCO-UHFFFAOYSA-N
- Formula
- C4H8O
- SMILES
- C1CCOC1
- Mol. Weight (g/mol)
- 72.11
- CAS
- 109-99-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrahydrofuran (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 948.4 |
| 303.15 | 0.0683 | 945.8 |
| 303.15 | 0.1883 | 940.8 |
| 303.15 | 0.2797 | 936.7 |
| 303.15 | 0.3890 | 931.0 |
| 303.15 | 0.4723 | 926.2 |
| 303.15 | 0.5757 | 919.3 |
| 303.15 | 0.6813 | 910.9 |
| 303.15 | 0.7866 | 901.1 |
| 303.15 | 0.8909 | 890.1 |
| 303.15 | 1.0000 | 876.9 |
| 313.15 | 0.0000 | 939.8 |
| 313.15 | 0.0683 | 937.5 |
| 313.15 | 0.1883 | 932.9 |
| 313.15 | 0.2797 | 928.6 |
| 313.15 | 0.3890 | 922.9 |
| 313.15 | 0.4723 | 918.0 |
| 313.15 | 0.5757 | 911.1 |
| 313.15 | 0.6813 | 902.8 |
| 313.15 | 0.7866 | 893.2 |
| 313.15 | 0.8909 | 881.4 |
| 313.15 | 1.0000 | 865.7 |
| 323.15 | 0.0000 | 931.5 |
| 323.15 | 0.0683 | 929.5 |
| 323.15 | 0.1883 | 925.2 |
| 323.15 | 0.2797 | 921.1 |
| 323.15 | 0.3890 | 915.3 |
| 323.15 | 0.4723 | 910.2 |
| 323.15 | 0.5757 | 903.0 |
| 323.15 | 0.6813 | 894.4 |
| 323.15 | 0.7866 | 884.2 |
| 323.15 | 0.8909 | 871.7 |
| 323.15 | 1.0000 | 854.8 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrahydrofuran (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 948.4 |
| 303.15 | 0.0683 | 945.8 |
| 303.15 | 0.1883 | 940.8 |
| 303.15 | 0.2797 | 936.7 |
| 303.15 | 0.3890 | 931.0 |
| 303.15 | 0.4723 | 926.2 |
| 303.15 | 0.5757 | 919.3 |
| 303.15 | 0.6813 | 910.9 |
| 303.15 | 0.7866 | 901.1 |
| 303.15 | 0.8909 | 890.1 |
| 303.15 | 1.0000 | 876.9 |
| 313.15 | 0.0000 | 939.8 |
| 313.15 | 0.0683 | 937.5 |
| 313.15 | 0.1883 | 932.9 |
| 313.15 | 0.2797 | 928.6 |
| 313.15 | 0.3890 | 922.9 |
| 313.15 | 0.4723 | 918.0 |
| 313.15 | 0.5757 | 911.1 |
| 313.15 | 0.6813 | 902.8 |
| 313.15 | 0.7866 | 893.2 |
| 313.15 | 0.8909 | 881.4 |
| 313.15 | 1.0000 | 865.7 |
| 323.15 | 0.0000 | 931.5 |
| 323.15 | 0.0683 | 929.5 |
| 323.15 | 0.1883 | 925.2 |
| 323.15 | 0.2797 | 921.1 |
| 323.15 | 0.3890 | 915.3 |
| 323.15 | 0.4723 | 910.2 |
| 323.15 | 0.5757 | 903.0 |
| 323.15 | 0.6813 | 894.4 |
| 323.15 | 0.7866 | 884.2 |
| 323.15 | 0.8909 | 871.7 |
| 323.15 | 1.0000 | 854.8 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrahydrofuran (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1468.0 |
| 303.15 | 0.0683 | 1459.0 |
| 303.15 | 0.1883 | 1439.0 |
| 303.15 | 0.2797 | 1423.0 |
| 303.15 | 0.3890 | 1403.0 |
| 303.15 | 0.4723 | 1387.0 |
| 303.15 | 0.5757 | 1365.0 |
| 303.15 | 0.6813 | 1340.0 |
| 303.15 | 0.7866 | 1314.0 |
| 303.15 | 0.8909 | 1287.0 |
| 303.15 | 1.0000 | 1254.0 |
| 313.15 | 0.0000 | 1431.0 |
| 313.15 | 0.0683 | 1424.0 |
| 313.15 | 0.1883 | 1408.0 |
| 313.15 | 0.2797 | 1391.0 |
| 313.15 | 0.3890 | 1370.0 |
| 313.15 | 0.4723 | 1354.0 |
| 313.15 | 0.5757 | 1331.0 |
| 313.15 | 0.6813 | 1304.0 |
| 313.15 | 0.7866 | 1276.0 |
| 313.15 | 0.8909 | 1246.0 |
| 313.15 | 1.0000 | 1207.0 |
| 323.15 | 0.0000 | 1393.0 |
| 323.15 | 0.0683 | 1391.0 |
| 323.15 | 0.1883 | 1376.0 |
| 323.15 | 0.2797 | 1359.0 |
| 323.15 | 0.3890 | 1337.0 |
| 323.15 | 0.4723 | 1319.0 |
| 323.15 | 0.5757 | 1294.0 |
| 323.15 | 0.6813 | 1267.0 |
| 323.15 | 0.7866 | 1238.0 |
| 323.15 | 0.8909 | 1206.0 |
| 323.15 | 1.0000 | 1165.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetrahydrofuran (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1468.0 |
| 303.15 | 0.0683 | 1459.0 |
| 303.15 | 0.1883 | 1439.0 |
| 303.15 | 0.2797 | 1423.0 |
| 303.15 | 0.3890 | 1403.0 |
| 303.15 | 0.4723 | 1387.0 |
| 303.15 | 0.5757 | 1365.0 |
| 303.15 | 0.6813 | 1340.0 |
| 303.15 | 0.7866 | 1314.0 |
| 303.15 | 0.8909 | 1287.0 |
| 303.15 | 1.0000 | 1254.0 |
| 313.15 | 0.0000 | 1431.0 |
| 313.15 | 0.0683 | 1424.0 |
| 313.15 | 0.1883 | 1408.0 |
| 313.15 | 0.2797 | 1391.0 |
| 313.15 | 0.3890 | 1370.0 |
| 313.15 | 0.4723 | 1354.0 |
| 313.15 | 0.5757 | 1331.0 |
| 313.15 | 0.6813 | 1304.0 |
| 313.15 | 0.7866 | 1276.0 |
| 313.15 | 0.8909 | 1246.0 |
| 313.15 | 1.0000 | 1207.0 |
| 323.15 | 0.0000 | 1393.0 |
| 323.15 | 0.0683 | 1391.0 |
| 323.15 | 0.1883 | 1376.0 |
| 323.15 | 0.2797 | 1359.0 |
| 323.15 | 0.3890 | 1337.0 |
| 323.15 | 0.4723 | 1319.0 |
| 323.15 | 0.5757 | 1294.0 |
| 323.15 | 0.6813 | 1267.0 |
| 323.15 | 0.7866 | 1238.0 |
| 323.15 | 0.8909 | 1206.0 |
| 323.15 | 1.0000 | 1165.0 |