- Name
- Diisopropyl ether
- InChI
- InChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3
- InChI Key
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N
- Formula
- C6H14O
- SMILES
- CC(C)OC(C)C
- Mol. Weight (g/mol)
- 102.17
- CAS
- 108-20-3
- Name
- m-Chloroaniline
- InChI
- InChI=1S/C6H6ClN/c7-5-2-1-3-6(8)4-5/h1-4H,8H2
- InChI Key
- PNPCRKVUWYDDST-UHFFFAOYSA-N
- Formula
- C6H6ClN
- SMILES
- Nc1cccc(Cl)c1
- Mol. Weight (g/mol)
- 127.57
- CAS
- 108-42-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 1205.3 |
| 303.15 | 0.0619 | 1171.2 |
| 303.15 | 0.1302 | 1134.1 |
| 303.15 | 0.2031 | 1095.7 |
| 303.15 | 0.2827 | 1055.1 |
| 303.15 | 0.3716 | 1011.3 |
| 303.15 | 0.4676 | 965.0 |
| 303.15 | 0.5803 | 911.2 |
| 303.15 | 0.7235 | 842.6 |
| 303.15 | 0.8428 | 785.4 |
| 303.15 | 1.0000 | 712.9 |
| 313.15 | 0.0000 | 1196.1 |
| 313.15 | 0.0619 | 1163.2 |
| 313.15 | 0.1302 | 1126.7 |
| 313.15 | 0.2031 | 1088.2 |
| 313.15 | 0.2827 | 1047.4 |
| 313.15 | 0.3716 | 1003.4 |
| 313.15 | 0.4676 | 957.2 |
| 313.15 | 0.5803 | 903.7 |
| 313.15 | 0.7235 | 835.3 |
| 313.15 | 0.8428 | 777.7 |
| 313.15 | 1.0000 | 702.9 |
| 323.15 | 0.0000 | 1186.6 |
| 323.15 | 0.0619 | 1154.7 |
| 323.15 | 0.1302 | 1118.2 |
| 323.15 | 0.2031 | 1079.3 |
| 323.15 | 0.2827 | 1038.0 |
| 323.15 | 0.3716 | 993.6 |
| 323.15 | 0.4676 | 947.6 |
| 323.15 | 0.5803 | 894.5 |
| 323.15 | 0.7235 | 826.7 |
| 323.15 | 0.8428 | 768.7 |
| 323.15 | 1.0000 | 691.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 1205.3 |
| 303.15 | 0.0619 | 1171.2 |
| 303.15 | 0.1302 | 1134.1 |
| 303.15 | 0.2031 | 1095.7 |
| 303.15 | 0.2827 | 1055.1 |
| 303.15 | 0.3716 | 1011.3 |
| 303.15 | 0.4676 | 965.0 |
| 303.15 | 0.5803 | 911.2 |
| 303.15 | 0.7235 | 842.6 |
| 303.15 | 0.8428 | 785.4 |
| 303.15 | 1.0000 | 712.9 |
| 313.15 | 0.0000 | 1196.1 |
| 313.15 | 0.0619 | 1163.2 |
| 313.15 | 0.1302 | 1126.7 |
| 313.15 | 0.2031 | 1088.2 |
| 313.15 | 0.2827 | 1047.4 |
| 313.15 | 0.3716 | 1003.4 |
| 313.15 | 0.4676 | 957.2 |
| 313.15 | 0.5803 | 903.7 |
| 313.15 | 0.7235 | 835.3 |
| 313.15 | 0.8428 | 777.7 |
| 313.15 | 1.0000 | 702.9 |
| 323.15 | 0.0000 | 1186.6 |
| 323.15 | 0.0619 | 1154.7 |
| 323.15 | 0.1302 | 1118.2 |
| 323.15 | 0.2031 | 1079.3 |
| 323.15 | 0.2827 | 1038.0 |
| 323.15 | 0.3716 | 993.6 |
| 323.15 | 0.4676 | 947.6 |
| 323.15 | 0.5803 | 894.5 |
| 323.15 | 0.7235 | 826.7 |
| 323.15 | 0.8428 | 768.7 |
| 323.15 | 1.0000 | 691.9 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1517.0 |
| 303.15 | 0.0619 | 1484.0 |
| 303.15 | 0.1302 | 1448.0 |
| 303.15 | 0.2031 | 1410.0 |
| 303.15 | 0.2827 | 1368.0 |
| 303.15 | 0.3716 | 1321.0 |
| 303.15 | 0.4676 | 1270.0 |
| 303.15 | 0.5803 | 1209.0 |
| 303.15 | 0.7235 | 1132.0 |
| 303.15 | 0.8428 | 1066.0 |
| 303.15 | 1.0000 | 976.0 |
| 313.15 | 0.0000 | 1484.0 |
| 313.15 | 0.0619 | 1451.0 |
| 313.15 | 0.1302 | 1414.0 |
| 313.15 | 0.2031 | 1374.0 |
| 313.15 | 0.2827 | 1331.0 |
| 313.15 | 0.3716 | 1283.0 |
| 313.15 | 0.4676 | 1230.0 |
| 313.15 | 0.5803 | 1168.0 |
| 313.15 | 0.7235 | 1089.0 |
| 313.15 | 0.8428 | 1023.0 |
| 313.15 | 1.0000 | 932.0 |
| 323.15 | 0.0000 | 1452.0 |
| 323.15 | 0.0619 | 1418.0 |
| 323.15 | 0.1302 | 1380.0 |
| 323.15 | 0.2031 | 1340.0 |
| 323.15 | 0.2827 | 1295.0 |
| 323.15 | 0.3716 | 1246.0 |
| 323.15 | 0.4676 | 1192.0 |
| 323.15 | 0.5803 | 1129.0 |
| 323.15 | 0.7235 | 1048.0 |
| 323.15 | 0.8428 | 981.0 |
| 323.15 | 1.0000 | 889.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (1) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1517.0 |
| 303.15 | 0.0619 | 1484.0 |
| 303.15 | 0.1302 | 1448.0 |
| 303.15 | 0.2031 | 1410.0 |
| 303.15 | 0.2827 | 1368.0 |
| 303.15 | 0.3716 | 1321.0 |
| 303.15 | 0.4676 | 1270.0 |
| 303.15 | 0.5803 | 1209.0 |
| 303.15 | 0.7235 | 1132.0 |
| 303.15 | 0.8428 | 1066.0 |
| 303.15 | 1.0000 | 976.0 |
| 313.15 | 0.0000 | 1484.0 |
| 313.15 | 0.0619 | 1451.0 |
| 313.15 | 0.1302 | 1414.0 |
| 313.15 | 0.2031 | 1374.0 |
| 313.15 | 0.2827 | 1331.0 |
| 313.15 | 0.3716 | 1283.0 |
| 313.15 | 0.4676 | 1230.0 |
| 313.15 | 0.5803 | 1168.0 |
| 313.15 | 0.7235 | 1089.0 |
| 313.15 | 0.8428 | 1023.0 |
| 313.15 | 1.0000 | 932.0 |
| 323.15 | 0.0000 | 1452.0 |
| 323.15 | 0.0619 | 1418.0 |
| 323.15 | 0.1302 | 1380.0 |
| 323.15 | 0.2031 | 1340.0 |
| 323.15 | 0.2827 | 1295.0 |
| 323.15 | 0.3716 | 1246.0 |
| 323.15 | 0.4676 | 1192.0 |
| 323.15 | 0.5803 | 1129.0 |
| 323.15 | 0.7235 | 1048.0 |
| 323.15 | 0.8428 | 981.0 |
| 323.15 | 1.0000 | 889.0 |