- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
- Name
- Thiophene, tetrahydro-, 1,1-dioxide
- InChI
- InChI=1S/C4H8O2S/c5-7(6)3-1-2-4-7/h1-4H2
- InChI Key
- HXJUTPCZVOIRIF-UHFFFAOYSA-N
- Formula
- C4H8O2S
- SMILES
- O=S1(=O)CCCC1
- Mol. Weight (g/mol)
- 120.17
- CAS
- 126-33-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Cp,liquid - Molar heat capacity at constant pressure, J/K/mol (4)
- η - Viscosity, Pa*s (2)
- Excess molar enthalpy (molar enthalpy (2)
- Pvap - Vapor or sublimation pressure, kPa (2)
- ρl - Mass density, kg/m3 (2)
- λ - Thermal conductivity, W/m/K (2)
- Vapor Liquid Equilibrium at Constant Temperature (3)
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
| 303.15 | 0.0000 | 75.30 |
| 303.15 | 0.1000 | 87.62 |
| 303.15 | 0.1980 | 99.49 |
| 303.15 | 0.2990 | 112.00 |
| 303.15 | 0.3970 | 123.40 |
| 303.15 | 0.4930 | 133.80 |
| 303.15 | 0.6000 | 144.90 |
| 303.15 | 0.6990 | 154.40 |
| 303.15 | 0.8000 | 163.70 |
| 303.15 | 0.8990 | 172.40 |
| 303.15 | 1.0000 | 181.50 |
| 313.15 | 0.0000 | 75.26 |
| 313.15 | 0.1000 | 88.47 |
| 313.15 | 0.1980 | 100.90 |
| 313.15 | 0.2990 | 113.90 |
| 313.15 | 0.3970 | 125.60 |
| 313.15 | 0.4930 | 136.40 |
| 313.15 | 0.6000 | 148.00 |
| 313.15 | 0.6990 | 157.90 |
| 313.15 | 0.8000 | 167.20 |
| 313.15 | 0.8990 | 176.00 |
| 313.15 | 1.0000 | 185.10 |
| 323.15 | 0.0000 | 75.30 |
| 323.15 | 0.1000 | 89.10 |
| 323.15 | 0.1980 | 102.20 |
| 323.15 | 0.2990 | 115.30 |
| 323.15 | 0.3970 | 127.50 |
| 323.15 | 0.4930 | 138.80 |
| 323.15 | 0.6000 | 150.60 |
| 323.15 | 0.6990 | 160.90 |
| 323.15 | 0.8000 | 170.90 |
| 323.15 | 0.8990 | 179.70 |
| 323.15 | 1.0000 | 188.70 |
| 333.15 | 0.0000 | 75.39 |
| 333.15 | 0.1000 | 89.75 |
| 333.15 | 0.1980 | 103.60 |
| 333.15 | 0.2990 | 117.30 |
| 333.15 | 0.3970 | 129.90 |
| 333.15 | 0.4930 | 141.50 |
| 333.15 | 0.6000 | 153.80 |
| 333.15 | 0.6990 | 164.50 |
| 333.15 | 0.8000 | 174.30 |
| 333.15 | 0.8990 | 183.30 |
| 333.15 | 1.0000 | 192.30 |
| 343.15 | 0.0000 | 75.48 |
| 343.15 | 0.1000 | 90.42 |
| 343.15 | 0.1980 | 104.50 |
| 343.15 | 0.2990 | 118.50 |
| 343.15 | 0.3970 | 131.70 |
| 343.15 | 0.4930 | 143.50 |
| 343.15 | 0.6000 | 155.80 |
| 343.15 | 0.6990 | 166.40 |
| 343.15 | 0.8000 | 176.40 |
| 343.15 | 0.8990 | 185.60 |
| 343.15 | 1.0000 | 194.30 |
| 353.15 | 0.0000 | 75.60 |
| 353.15 | 0.1000 | 91.42 |
| 353.15 | 0.1980 | 106.20 |
| 353.15 | 0.2990 | 120.80 |
| 353.15 | 0.3970 | 134.00 |
| 353.15 | 0.4930 | 146.10 |
| 353.15 | 0.6000 | 158.80 |
| 353.15 | 0.6990 | 169.60 |
| 353.15 | 0.8000 | 179.90 |
| 353.15 | 0.8990 | 189.20 |
| 353.15 | 1.0000 | 197.80 |
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
| 303.15 | 0.0999 | 87.00 |
| 303.15 | 0.1998 | 100.00 |
| 303.15 | 0.2987 | 112.00 |
| 303.15 | 0.3995 | 124.00 |
| 303.15 | 0.4945 | 135.00 |
| 303.15 | 0.5987 | 145.00 |
| 303.15 | 0.6984 | 155.00 |
| 303.15 | 0.7904 | 164.00 |
| 303.15 | 0.8865 | 173.00 |
| 303.15 | 1.0000 | 182.00 |
| 308.15 | 0.0999 | 88.00 |
| 308.15 | 0.1998 | 100.00 |
| 308.15 | 0.2987 | 113.00 |
| 308.15 | 0.3995 | 125.00 |
| 308.15 | 0.4945 | 136.00 |
| 308.15 | 0.5987 | 147.00 |
| 308.15 | 0.6984 | 156.00 |
| 308.15 | 0.7904 | 166.00 |
| 308.15 | 0.8865 | 175.00 |
| 308.15 | 1.0000 | 184.00 |
| 313.15 | 0.0999 | 88.00 |
| 313.15 | 0.1998 | 101.00 |
| 313.15 | 0.2987 | 114.00 |
| 313.15 | 0.3995 | 126.00 |
| 313.15 | 0.4945 | 137.00 |
| 313.15 | 0.5987 | 148.00 |
| 313.15 | 0.6984 | 157.00 |
| 313.15 | 0.7904 | 167.00 |
| 313.15 | 0.8865 | 176.00 |
| 313.15 | 1.0000 | 185.00 |
| 318.15 | 0.0999 | 88.00 |
| 318.15 | 0.1998 | 102.00 |
| 318.15 | 0.2987 | 114.00 |
| 318.15 | 0.3995 | 127.00 |
| 318.15 | 0.4945 | 138.00 |
| 318.15 | 0.5987 | 149.00 |
| 318.15 | 0.6984 | 159.00 |
| 318.15 | 0.7904 | 168.00 |
| 318.15 | 0.8865 | 177.00 |
| 318.15 | 1.0000 | 186.00 |
| 323.15 | 0.0999 | 89.00 |
| 323.15 | 0.1998 | 102.00 |
| 323.15 | 0.2987 | 115.00 |
| 323.15 | 0.3995 | 128.00 |
| 323.15 | 0.4945 | 139.00 |
| 323.15 | 0.5987 | 150.00 |
| 323.15 | 0.6984 | 160.00 |
| 323.15 | 0.7904 | 170.00 |
| 323.15 | 0.8865 | 179.00 |
| 323.15 | 1.0000 | 188.00 |
| 328.15 | 0.0999 | 89.00 |
| 328.15 | 0.1998 | 103.00 |
| 328.15 | 0.2987 | 116.00 |
| 328.15 | 0.3995 | 129.00 |
| 328.15 | 0.4945 | 141.00 |
| 328.15 | 0.5987 | 152.00 |
| 328.15 | 0.6984 | 162.00 |
| 328.15 | 0.7904 | 172.00 |
| 328.15 | 0.8865 | 181.00 |
| 328.15 | 1.0000 | 189.00 |
| 333.15 | 0.0999 | 89.00 |
| 333.15 | 0.1998 | 104.00 |
| 333.15 | 0.2987 | 117.00 |
| 333.15 | 0.3995 | 130.00 |
| 333.15 | 0.4945 | 142.00 |
| 333.15 | 0.5987 | 153.00 |
| 333.15 | 0.6984 | 164.00 |
| 333.15 | 0.7904 | 173.00 |
| 333.15 | 0.8865 | 183.00 |
| 333.15 | 1.0000 | 191.00 |
| 338.15 | 0.0999 | 90.00 |
| 338.15 | 0.1998 | 104.00 |
| 338.15 | 0.2987 | 118.00 |
| 338.15 | 0.3995 | 131.00 |
| 338.15 | 0.4945 | 143.00 |
| 338.15 | 0.5987 | 155.00 |
| 338.15 | 0.6984 | 165.00 |
| 338.15 | 0.7904 | 175.00 |
| 338.15 | 0.8865 | 184.00 |
| 338.15 | 1.0000 | 193.00 |
| 343.15 | 0.0999 | 90.00 |
| 343.15 | 0.1998 | 105.00 |
| 343.15 | 0.2987 | 119.00 |
| 343.15 | 0.3995 | 132.00 |
| 343.15 | 0.4945 | 144.00 |
| 343.15 | 0.5987 | 156.00 |
| 343.15 | 0.6984 | 167.00 |
| 343.15 | 0.7904 | 177.00 |
| 343.15 | 0.8865 | 186.00 |
| 343.15 | 1.0000 | 194.00 |
| 348.15 | 0.0999 | 91.00 |
| 348.15 | 0.1998 | 106.00 |
| 348.15 | 0.2987 | 120.00 |
| 348.15 | 0.3995 | 133.00 |
| 348.15 | 0.4945 | 146.00 |
| 348.15 | 0.5987 | 158.00 |
| 348.15 | 0.6984 | 169.00 |
| 348.15 | 0.7904 | 179.00 |
| 348.15 | 0.8865 | 188.00 |
| 348.15 | 1.0000 | 197.00 |
| 353.15 | 0.0999 | 91.00 |
| 353.15 | 0.1998 | 107.00 |
| 353.15 | 0.2987 | 121.00 |
| 353.15 | 0.3995 | 135.00 |
| 353.15 | 0.4945 | 148.00 |
| 353.15 | 0.5987 | 160.00 |
| 353.15 | 0.6984 | 171.00 |
| 353.15 | 0.7904 | 181.00 |
| 353.15 | 0.8865 | 191.00 |
| 353.15 | 1.0000 | 199.00 |
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
| 303.15 | 0.0000 | 75.30 |
| 303.15 | 0.1000 | 87.62 |
| 303.15 | 0.1980 | 99.49 |
| 303.15 | 0.2990 | 112.00 |
| 303.15 | 0.3970 | 123.40 |
| 303.15 | 0.4930 | 133.80 |
| 303.15 | 0.6000 | 144.90 |
| 303.15 | 0.6990 | 154.40 |
| 303.15 | 0.8000 | 163.70 |
| 303.15 | 0.8990 | 172.40 |
| 303.15 | 1.0000 | 181.50 |
| 313.15 | 0.0000 | 75.26 |
| 313.15 | 0.1000 | 88.47 |
| 313.15 | 0.1980 | 100.90 |
| 313.15 | 0.2990 | 113.90 |
| 313.15 | 0.3970 | 125.60 |
| 313.15 | 0.4930 | 136.40 |
| 313.15 | 0.6000 | 148.00 |
| 313.15 | 0.6990 | 157.90 |
| 313.15 | 0.8000 | 167.20 |
| 313.15 | 0.8990 | 176.00 |
| 313.15 | 1.0000 | 185.10 |
| 323.15 | 0.0000 | 75.30 |
| 323.15 | 0.1000 | 89.10 |
| 323.15 | 0.1980 | 102.20 |
| 323.15 | 0.2990 | 115.30 |
| 323.15 | 0.3970 | 127.50 |
| 323.15 | 0.4930 | 138.80 |
| 323.15 | 0.6000 | 150.60 |
| 323.15 | 0.6990 | 160.90 |
| 323.15 | 0.8000 | 170.90 |
| 323.15 | 0.8990 | 179.70 |
| 323.15 | 1.0000 | 188.70 |
| 333.15 | 0.0000 | 75.39 |
| 333.15 | 0.1000 | 89.75 |
| 333.15 | 0.1980 | 103.60 |
| 333.15 | 0.2990 | 117.30 |
| 333.15 | 0.3970 | 129.90 |
| 333.15 | 0.4930 | 141.50 |
| 333.15 | 0.6000 | 153.80 |
| 333.15 | 0.6990 | 164.50 |
| 333.15 | 0.8000 | 174.30 |
| 333.15 | 0.8990 | 183.30 |
| 333.15 | 1.0000 | 192.30 |
| 343.15 | 0.0000 | 75.48 |
| 343.15 | 0.1000 | 90.42 |
| 343.15 | 0.1980 | 104.50 |
| 343.15 | 0.2990 | 118.50 |
| 343.15 | 0.3970 | 131.70 |
| 343.15 | 0.4930 | 143.50 |
| 343.15 | 0.6000 | 155.80 |
| 343.15 | 0.6990 | 166.40 |
| 343.15 | 0.8000 | 176.40 |
| 343.15 | 0.8990 | 185.60 |
| 343.15 | 1.0000 | 194.30 |
| 353.15 | 0.0000 | 75.60 |
| 353.15 | 0.1000 | 91.42 |
| 353.15 | 0.1980 | 106.20 |
| 353.15 | 0.2990 | 120.80 |
| 353.15 | 0.3970 | 134.00 |
| 353.15 | 0.4930 | 146.10 |
| 353.15 | 0.6000 | 158.80 |
| 353.15 | 0.6990 | 169.60 |
| 353.15 | 0.8000 | 179.90 |
| 353.15 | 0.8990 | 189.20 |
| 353.15 | 1.0000 | 197.80 |
Molar heat capacity at constant pressure, J/K/mol [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
| 303.15 | 0.0999 | 87.00 |
| 303.15 | 0.1998 | 100.00 |
| 303.15 | 0.2987 | 112.00 |
| 303.15 | 0.3995 | 124.00 |
| 303.15 | 0.4945 | 135.00 |
| 303.15 | 0.5987 | 145.00 |
| 303.15 | 0.6984 | 155.00 |
| 303.15 | 0.7904 | 164.00 |
| 303.15 | 0.8865 | 173.00 |
| 303.15 | 1.0000 | 182.00 |
| 308.15 | 0.0999 | 88.00 |
| 308.15 | 0.1998 | 100.00 |
| 308.15 | 0.2987 | 113.00 |
| 308.15 | 0.3995 | 125.00 |
| 308.15 | 0.4945 | 136.00 |
| 308.15 | 0.5987 | 147.00 |
| 308.15 | 0.6984 | 156.00 |
| 308.15 | 0.7904 | 166.00 |
| 308.15 | 0.8865 | 175.00 |
| 308.15 | 1.0000 | 184.00 |
| 313.15 | 0.0999 | 88.00 |
| 313.15 | 0.1998 | 101.00 |
| 313.15 | 0.2987 | 114.00 |
| 313.15 | 0.3995 | 126.00 |
| 313.15 | 0.4945 | 137.00 |
| 313.15 | 0.5987 | 148.00 |
| 313.15 | 0.6984 | 157.00 |
| 313.15 | 0.7904 | 167.00 |
| 313.15 | 0.8865 | 176.00 |
| 313.15 | 1.0000 | 185.00 |
| 318.15 | 0.0999 | 88.00 |
| 318.15 | 0.1998 | 102.00 |
| 318.15 | 0.2987 | 114.00 |
| 318.15 | 0.3995 | 127.00 |
| 318.15 | 0.4945 | 138.00 |
| 318.15 | 0.5987 | 149.00 |
| 318.15 | 0.6984 | 159.00 |
| 318.15 | 0.7904 | 168.00 |
| 318.15 | 0.8865 | 177.00 |
| 318.15 | 1.0000 | 186.00 |
| 323.15 | 0.0999 | 89.00 |
| 323.15 | 0.1998 | 102.00 |
| 323.15 | 0.2987 | 115.00 |
| 323.15 | 0.3995 | 128.00 |
| 323.15 | 0.4945 | 139.00 |
| 323.15 | 0.5987 | 150.00 |
| 323.15 | 0.6984 | 160.00 |
| 323.15 | 0.7904 | 170.00 |
| 323.15 | 0.8865 | 179.00 |
| 323.15 | 1.0000 | 188.00 |
| 328.15 | 0.0999 | 89.00 |
| 328.15 | 0.1998 | 103.00 |
| 328.15 | 0.2987 | 116.00 |
| 328.15 | 0.3995 | 129.00 |
| 328.15 | 0.4945 | 141.00 |
| 328.15 | 0.5987 | 152.00 |
| 328.15 | 0.6984 | 162.00 |
| 328.15 | 0.7904 | 172.00 |
| 328.15 | 0.8865 | 181.00 |
| 328.15 | 1.0000 | 189.00 |
| 333.15 | 0.0999 | 89.00 |
| 333.15 | 0.1998 | 104.00 |
| 333.15 | 0.2987 | 117.00 |
| 333.15 | 0.3995 | 130.00 |
| 333.15 | 0.4945 | 142.00 |
| 333.15 | 0.5987 | 153.00 |
| 333.15 | 0.6984 | 164.00 |
| 333.15 | 0.7904 | 173.00 |
| 333.15 | 0.8865 | 183.00 |
| 333.15 | 1.0000 | 191.00 |
| 338.15 | 0.0999 | 90.00 |
| 338.15 | 0.1998 | 104.00 |
| 338.15 | 0.2987 | 118.00 |
| 338.15 | 0.3995 | 131.00 |
| 338.15 | 0.4945 | 143.00 |
| 338.15 | 0.5987 | 155.00 |
| 338.15 | 0.6984 | 165.00 |
| 338.15 | 0.7904 | 175.00 |
| 338.15 | 0.8865 | 184.00 |
| 338.15 | 1.0000 | 193.00 |
| 343.15 | 0.0999 | 90.00 |
| 343.15 | 0.1998 | 105.00 |
| 343.15 | 0.2987 | 119.00 |
| 343.15 | 0.3995 | 132.00 |
| 343.15 | 0.4945 | 144.00 |
| 343.15 | 0.5987 | 156.00 |
| 343.15 | 0.6984 | 167.00 |
| 343.15 | 0.7904 | 177.00 |
| 343.15 | 0.8865 | 186.00 |
| 343.15 | 1.0000 | 194.00 |
| 348.15 | 0.0999 | 91.00 |
| 348.15 | 0.1998 | 106.00 |
| 348.15 | 0.2987 | 120.00 |
| 348.15 | 0.3995 | 133.00 |
| 348.15 | 0.4945 | 146.00 |
| 348.15 | 0.5987 | 158.00 |
| 348.15 | 0.6984 | 169.00 |
| 348.15 | 0.7904 | 179.00 |
| 348.15 | 0.8865 | 188.00 |
| 348.15 | 1.0000 | 197.00 |
| 353.15 | 0.0999 | 91.00 |
| 353.15 | 0.1998 | 107.00 |
| 353.15 | 0.2987 | 121.00 |
| 353.15 | 0.3995 | 135.00 |
| 353.15 | 0.4945 | 148.00 |
| 353.15 | 0.5987 | 160.00 |
| 353.15 | 0.6984 | 171.00 |
| 353.15 | 0.7904 | 181.00 |
| 353.15 | 0.8865 | 191.00 |
| 353.15 | 1.0000 | 199.00 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0346 | 0.0008 |
| 303.15 | 0.0487 | 0.0008 |
| 303.15 | 0.0721 | 0.0009 |
| 303.15 | 0.1022 | 0.0009 |
| 303.15 | 0.1635 | 0.0010 |
| 313.15 | 0.0346 | 0.0007 |
| 313.15 | 0.0487 | 0.0007 |
| 313.15 | 0.0721 | 0.0007 |
| 313.15 | 0.1022 | 0.0008 |
| 313.15 | 0.1635 | 0.0008 |
| 323.15 | 0.0346 | 0.0006 |
| 323.15 | 0.0487 | 0.0006 |
| 323.15 | 0.0721 | 0.0006 |
| 323.15 | 0.1022 | 0.0006 |
| 323.15 | 0.1635 | 0.0007 |
| 333.15 | 0.0346 | 0.0005 |
| 333.15 | 0.0487 | 0.0005 |
| 333.15 | 0.0721 | 0.0005 |
| 333.15 | 0.1022 | 0.0006 |
| 333.15 | 0.1635 | 0.0006 |
| 343.15 | 0.0346 | 0.0004 |
| 343.15 | 0.0487 | 0.0004 |
| 343.15 | 0.0721 | 0.0004 |
| 343.15 | 0.1022 | 0.0005 |
| 343.15 | 0.1635 | 0.0005 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0346 | 0.0008 |
| 303.15 | 0.0487 | 0.0008 |
| 303.15 | 0.0721 | 0.0009 |
| 303.15 | 0.1022 | 0.0009 |
| 303.15 | 0.1635 | 0.0010 |
| 313.15 | 0.0346 | 0.0007 |
| 313.15 | 0.0487 | 0.0007 |
| 313.15 | 0.0721 | 0.0007 |
| 313.15 | 0.1022 | 0.0008 |
| 313.15 | 0.1635 | 0.0008 |
| 323.15 | 0.0346 | 0.0006 |
| 323.15 | 0.0487 | 0.0006 |
| 323.15 | 0.0721 | 0.0006 |
| 323.15 | 0.1022 | 0.0006 |
| 323.15 | 0.1635 | 0.0007 |
| 333.15 | 0.0346 | 0.0005 |
| 333.15 | 0.0487 | 0.0005 |
| 333.15 | 0.0721 | 0.0005 |
| 333.15 | 0.1022 | 0.0006 |
| 333.15 | 0.1635 | 0.0006 |
| 343.15 | 0.0346 | 0.0004 |
| 343.15 | 0.0487 | 0.0004 |
| 343.15 | 0.0721 | 0.0004 |
| 343.15 | 0.1022 | 0.0005 |
| 343.15 | 0.1635 | 0.0005 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 413.15 (Liquid)
- Pressure, kPa = 1820 (Liquid)
| Mole fraction of Water (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0621 | 0.4050 |
| 0.1183 | 0.7120 |
| 0.2159 | 1.188 |
| 0.3676 | 1.696 |
| 0.4800 | 1.855 |
| 0.5667 | 1.861 |
| 0.6355 | 1.789 |
| 0.6915 | 1.676 |
| 0.7380 | 1.546 |
| 0.7772 | 1.409 |
| 0.8395 | 1.14 |
| 0.8648 | 1.01 |
| 0.8870 | 0.8830 |
| 0.9067 | 0.7580 |
| 0.9243 | 0.6380 |
| 0.9401 | 0.5240 |
| 0.9544 | 0.4120 |
| 0.9674 | 0.3040 |
| 0.9792 | 0.1990 |
| 0.9900 | 0.0970 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 413.15 (Liquid)
- Pressure, kPa = 1820 (Liquid)
| Mole fraction of Water (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0621 | 0.4050 |
| 0.1183 | 0.7120 |
| 0.2159 | 1.188 |
| 0.3676 | 1.696 |
| 0.4800 | 1.855 |
| 0.5667 | 1.861 |
| 0.6355 | 1.789 |
| 0.6915 | 1.676 |
| 0.7380 | 1.546 |
| 0.7772 | 1.409 |
| 0.8395 | 1.14 |
| 0.8648 | 1.01 |
| 0.8870 | 0.8830 |
| 0.9067 | 0.7580 |
| 0.9243 | 0.6380 |
| 0.9401 | 0.5240 |
| 0.9544 | 0.4120 |
| 0.9674 | 0.3040 |
| 0.9792 | 0.1990 |
| 0.9900 | 0.0970 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Temperature, K = 413.18 (Liquid)
| Mole fraction of Water (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
|---|---|
| 0.0000 | 1.35 |
| 0.0490 | 32.24 |
| 0.1152 | 71.05 |
| 0.1315 | 81.07 |
| 0.2266 | 131.91 |
| 0.2334 | 135.56 |
| 0.2866 | 161.86 |
| 0.3347 | 183.89 |
| 0.3459 | 188.23 |
| 0.4509 | 230.22 |
| 0.4586 | 233.03 |
| 0.5333 | 258.05 |
| 0.5557 | 264.72 |
| 0.5961 | 276.62 |
| 0.6307 | 285.51 |
| 0.6457 | 289.53 |
| 0.7003 | 302.14 |
| 0.7613 | 314.66 |
| 0.8087 | 323.47 |
| 0.8148 | 324.62 |
| 0.8503 | 330.64 |
| 0.8621 | 332.60 |
| 0.9029 | 339.46 |
| 0.9346 | 345.25 |
| 0.9583 | 349.95 |
| 0.9744 | 353.81 |
| 0.9852 | 356.71 |
| 0.9925 | 358.93 |
| 0.9966 | 360.16 |
| 0.9981 | 360.72 |
| 0.9993 | 361.40 |
| 1.0000 | 361.75 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Temperature, K = 413.18 (Liquid)
| Mole fraction of Water (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
|---|---|
| 0.0000 | 1.35 |
| 0.0490 | 32.24 |
| 0.1152 | 71.05 |
| 0.1315 | 81.07 |
| 0.2266 | 131.91 |
| 0.2334 | 135.56 |
| 0.2866 | 161.86 |
| 0.3347 | 183.89 |
| 0.3459 | 188.23 |
| 0.4509 | 230.22 |
| 0.4586 | 233.03 |
| 0.5333 | 258.05 |
| 0.5557 | 264.72 |
| 0.5961 | 276.62 |
| 0.6307 | 285.51 |
| 0.6457 | 289.53 |
| 0.7003 | 302.14 |
| 0.7613 | 314.66 |
| 0.8087 | 323.47 |
| 0.8148 | 324.62 |
| 0.8503 | 330.64 |
| 0.8621 | 332.60 |
| 0.9029 | 339.46 |
| 0.9346 | 345.25 |
| 0.9583 | 349.95 |
| 0.9744 | 353.81 |
| 0.9852 | 356.71 |
| 0.9925 | 358.93 |
| 0.9966 | 360.16 |
| 0.9981 | 360.72 |
| 0.9993 | 361.40 |
| 1.0000 | 361.75 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0346 | 1003.0 |
| 303.15 | 0.0487 | 1007.0 |
| 303.15 | 0.0721 | 1012.0 |
| 303.15 | 0.1022 | 1020.0 |
| 303.15 | 0.1635 | 1038.0 |
| 313.15 | 0.0346 | 999.7 |
| 313.15 | 0.0487 | 1003.0 |
| 313.15 | 0.0721 | 1007.0 |
| 313.15 | 0.1022 | 1016.0 |
| 313.15 | 0.1635 | 1032.0 |
| 323.15 | 0.0346 | 995.2 |
| 323.15 | 0.0487 | 998.2 |
| 323.15 | 0.0721 | 1003.0 |
| 323.15 | 0.1022 | 1010.0 |
| 323.15 | 0.1635 | 1026.0 |
| 333.15 | 0.0346 | 990.1 |
| 333.15 | 0.0487 | 993.0 |
| 333.15 | 0.0721 | 998.9 |
| 333.15 | 0.1022 | 1005.0 |
| 333.15 | 0.1635 | 1020.0 |
| 343.15 | 0.0346 | 984.3 |
| 343.15 | 0.0487 | 987.0 |
| 343.15 | 0.0721 | 991.7 |
| 343.15 | 0.1022 | 998.0 |
| 343.15 | 0.1635 | 1012.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0346 | 1003.0 |
| 303.15 | 0.0487 | 1007.0 |
| 303.15 | 0.0721 | 1012.0 |
| 303.15 | 0.1022 | 1020.0 |
| 303.15 | 0.1635 | 1038.0 |
| 313.15 | 0.0346 | 999.7 |
| 313.15 | 0.0487 | 1003.0 |
| 313.15 | 0.0721 | 1007.0 |
| 313.15 | 0.1022 | 1016.0 |
| 313.15 | 0.1635 | 1032.0 |
| 323.15 | 0.0346 | 995.2 |
| 323.15 | 0.0487 | 998.2 |
| 323.15 | 0.0721 | 1003.0 |
| 323.15 | 0.1022 | 1010.0 |
| 323.15 | 0.1635 | 1026.0 |
| 333.15 | 0.0346 | 990.1 |
| 333.15 | 0.0487 | 993.0 |
| 333.15 | 0.0721 | 998.9 |
| 333.15 | 0.1022 | 1005.0 |
| 333.15 | 0.1635 | 1020.0 |
| 343.15 | 0.0346 | 984.3 |
| 343.15 | 0.0487 | 987.0 |
| 343.15 | 0.0721 | 991.7 |
| 343.15 | 0.1022 | 998.0 |
| 343.15 | 0.1635 | 1012.0 |
Thermal conductivity, W/m/K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Thermal conductivity, W/m/K - Liquid |
| 303.15 | 0.0000 | 0.6137 |
| 303.15 | 0.1000 | 0.3861 |
| 303.15 | 0.1980 | 0.2960 |
| 303.15 | 0.2990 | 0.2563 |
| 303.15 | 0.3970 | 0.2358 |
| 303.15 | 0.4930 | 0.2206 |
| 303.15 | 0.6000 | 0.2028 |
| 303.15 | 0.6990 | 0.1911 |
| 303.15 | 0.8000 | 0.1809 |
| 303.15 | 0.8990 | 0.1739 |
| 303.15 | 1.0000 | 0.1678 |
| 313.15 | 0.0000 | 0.6307 |
| 313.15 | 0.1000 | 0.3969 |
| 313.15 | 0.1980 | 0.2979 |
| 313.15 | 0.2990 | 0.2583 |
| 313.15 | 0.3970 | 0.2334 |
| 313.15 | 0.4930 | 0.2200 |
| 313.15 | 0.6000 | 0.2012 |
| 313.15 | 0.6990 | 0.1896 |
| 313.15 | 0.8000 | 0.1797 |
| 313.15 | 0.8990 | 0.1719 |
| 313.15 | 1.0000 | 0.1656 |
| 323.15 | 0.0000 | 0.6437 |
| 323.15 | 0.1000 | 0.4026 |
| 323.15 | 0.1980 | 0.2965 |
| 323.15 | 0.2990 | 0.2558 |
| 323.15 | 0.3970 | 0.2316 |
| 323.15 | 0.4930 | 0.2167 |
| 323.15 | 0.6000 | 0.1993 |
| 323.15 | 0.6990 | 0.1883 |
| 323.15 | 0.8000 | 0.1788 |
| 323.15 | 0.8990 | 0.1715 |
| 323.15 | 1.0000 | 0.1634 |
| 333.15 | 0.0000 | 0.6548 |
| 333.15 | 0.1000 | 0.4084 |
| 333.15 | 0.1980 | 0.2950 |
| 333.15 | 0.2990 | 0.2507 |
| 333.15 | 0.3970 | 0.2304 |
| 333.15 | 0.4930 | 0.2133 |
| 333.15 | 0.6000 | 0.1986 |
| 333.15 | 0.6990 | 0.1876 |
| 333.15 | 0.8000 | 0.1779 |
| 333.15 | 0.8990 | 0.1699 |
| 333.15 | 1.0000 | 0.1616 |
| 343.15 | 0.0000 | 0.6632 |
| 343.15 | 0.1000 | 0.4085 |
| 343.15 | 0.1980 | 0.2893 |
| 343.15 | 0.2990 | 0.2417 |
| 343.15 | 0.3970 | 0.2229 |
| 343.15 | 0.4930 | 0.2092 |
| 343.15 | 0.6000 | 0.1966 |
| 343.15 | 0.6990 | 0.1852 |
| 343.15 | 0.8000 | 0.1765 |
| 343.15 | 0.8990 | 0.1676 |
| 343.15 | 1.0000 | 0.1593 |
| 353.15 | 0.0000 | 0.6700 |
| 353.15 | 0.1000 | 0.4058 |
| 353.15 | 0.1980 | 0.2870 |
| 353.15 | 0.2990 | 0.2399 |
| 353.15 | 0.3970 | 0.2185 |
| 353.15 | 0.4930 | 0.2040 |
| 353.15 | 0.6000 | 0.1921 |
| 353.15 | 0.6990 | 0.1817 |
| 353.15 | 0.8000 | 0.1730 |
| 353.15 | 0.8990 | 0.1657 |
| 353.15 | 1.0000 | 0.1581 |
Thermal conductivity, W/m/K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Thermal conductivity, W/m/K - Liquid |
| 303.15 | 0.0000 | 0.6137 |
| 303.15 | 0.1000 | 0.3861 |
| 303.15 | 0.1980 | 0.2960 |
| 303.15 | 0.2990 | 0.2563 |
| 303.15 | 0.3970 | 0.2358 |
| 303.15 | 0.4930 | 0.2206 |
| 303.15 | 0.6000 | 0.2028 |
| 303.15 | 0.6990 | 0.1911 |
| 303.15 | 0.8000 | 0.1809 |
| 303.15 | 0.8990 | 0.1739 |
| 303.15 | 1.0000 | 0.1678 |
| 313.15 | 0.0000 | 0.6307 |
| 313.15 | 0.1000 | 0.3969 |
| 313.15 | 0.1980 | 0.2979 |
| 313.15 | 0.2990 | 0.2583 |
| 313.15 | 0.3970 | 0.2334 |
| 313.15 | 0.4930 | 0.2200 |
| 313.15 | 0.6000 | 0.2012 |
| 313.15 | 0.6990 | 0.1896 |
| 313.15 | 0.8000 | 0.1797 |
| 313.15 | 0.8990 | 0.1719 |
| 313.15 | 1.0000 | 0.1656 |
| 323.15 | 0.0000 | 0.6437 |
| 323.15 | 0.1000 | 0.4026 |
| 323.15 | 0.1980 | 0.2965 |
| 323.15 | 0.2990 | 0.2558 |
| 323.15 | 0.3970 | 0.2316 |
| 323.15 | 0.4930 | 0.2167 |
| 323.15 | 0.6000 | 0.1993 |
| 323.15 | 0.6990 | 0.1883 |
| 323.15 | 0.8000 | 0.1788 |
| 323.15 | 0.8990 | 0.1715 |
| 323.15 | 1.0000 | 0.1634 |
| 333.15 | 0.0000 | 0.6548 |
| 333.15 | 0.1000 | 0.4084 |
| 333.15 | 0.1980 | 0.2950 |
| 333.15 | 0.2990 | 0.2507 |
| 333.15 | 0.3970 | 0.2304 |
| 333.15 | 0.4930 | 0.2133 |
| 333.15 | 0.6000 | 0.1986 |
| 333.15 | 0.6990 | 0.1876 |
| 333.15 | 0.8000 | 0.1779 |
| 333.15 | 0.8990 | 0.1699 |
| 333.15 | 1.0000 | 0.1616 |
| 343.15 | 0.0000 | 0.6632 |
| 343.15 | 0.1000 | 0.4085 |
| 343.15 | 0.1980 | 0.2893 |
| 343.15 | 0.2990 | 0.2417 |
| 343.15 | 0.3970 | 0.2229 |
| 343.15 | 0.4930 | 0.2092 |
| 343.15 | 0.6000 | 0.1966 |
| 343.15 | 0.6990 | 0.1852 |
| 343.15 | 0.8000 | 0.1765 |
| 343.15 | 0.8990 | 0.1676 |
| 343.15 | 1.0000 | 0.1593 |
| 353.15 | 0.0000 | 0.6700 |
| 353.15 | 0.1000 | 0.4058 |
| 353.15 | 0.1980 | 0.2870 |
| 353.15 | 0.2990 | 0.2399 |
| 353.15 | 0.3970 | 0.2185 |
| 353.15 | 0.4930 | 0.2040 |
| 353.15 | 0.6000 | 0.1921 |
| 353.15 | 0.6990 | 0.1817 |
| 353.15 | 0.8000 | 0.1730 |
| 353.15 | 0.8990 | 0.1657 |
| 353.15 | 1.0000 | 0.1581 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 313.15 (VLE)
| P [kPa] - VLE | x1[mol/mol] of Water (1) - Liquid |
|---|---|
| 0.0053 | 0.0000 |
| 2.493 | 0.1000 |
| 3.873 | 0.2000 |
| 4.762 | 0.3000 |
| 5.441 | 0.4000 |
| 5.953 | 0.5000 |
| 6.306 | 0.6000 |
| 6.546 | 0.7000 |
| 6.769 | 0.8000 |
| 6.989 | 0.9000 |
| 7.375 | 1.0000 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 323.15 (VLE)
| P [kPa] - VLE | x1[mol/mol] of Water (1) - Liquid |
|---|---|
| 0.0107 | 0.0000 |
| 4.142 | 0.1000 |
| 6.073 | 0.2000 |
| 7.686 | 0.3000 |
| 8.799 | 0.4000 |
| 9.663 | 0.5000 |
| 10.363 | 0.6000 |
| 10.856 | 0.7000 |
| 11.228 | 0.8000 |
| 11.66 | 0.9000 |
| 12.328 | 1.0000 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 288.15 (VLE)
| P [kPa] - VLE | x1[mol/mol] of Water (1) - Liquid |
|---|---|
| 0.7866 | 0.1200 |
| 0.9253 | 0.1600 |
| 1.1066 | 0.2650 |
| 1.2732 | 0.3975 |
| 1.4625 | 0.5900 |
| 1.636 | 0.8140 |
| 1.6545 | 0.9091 |
| 1.6825 | 0.9637 |
Sources
- Dortmund Data Bank Vapor-Liquid Equilibrium Data
- Heat Capacity, Thermal Conductivity and Thermal Diffusivity of Aqueous Sulfolane Solutions
- Isothermal Vapor-Liquid Equilibrium and Excess Enthalpy Data for the Binary Systems Water + Sulfolane and Methanol + N-Methyl-2-pyrrolidone (NMP)
- Densities, Viscosities, and Surface Tensions of Aqueous Mixtures of Sulfolane + Triethanolamine and Sulfolane + Diisopropanolamine
- Molar Heat Capacity of Aqueous Sulfolane, 4-Formylmorpholine, 1-Methyl-2-pyrrolidinone, and Triethylene Glycol Dimethyl Ether Solutions from (303.15 to 353.15) K