- Name
- N-L-alanyl-L-valine
- InChI
- InChI=1S/C8H16N2O3/c1-4(2)6(8(12)13)10-7(11)5(3)9/h4-6H,9H2,1-3H3,(H,10,11)(H,12,13)/t5-,6-/m0/s1
- InChI Key
- LIWMQSWFLXEGMA-WDSKDSINSA-N
- Formula
- C8H16N2O3
- SMILES
- CC(N)C(=O)NC(C(=O)O)C(C)C
- Mol. Weight (g/mol)
- 188.22
- CAS
- 3303-45-5
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of N-L-alanyl-L-valine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 305.15 | 0.0020 | 995.187 |
| 305.15 | 0.0041 | 995.289 |
| 305.15 | 0.0060 | 995.381 |
| 305.15 | 0.0079 | 995.471 |
| 305.15 | 0.0102 | 995.58 |
| 305.15 | 0.0118 | 995.657 |
| 305.15 | 0.0140 | 995.761 |
| 305.15 | 0.0155 | 995.835 |
| 305.15 | 0.0181 | 995.957 |
| 305.15 | 0.0197 | 996.037 |
| 310.15 | 0.0020 | 993.499 |
| 310.15 | 0.0041 | 993.601 |
| 310.15 | 0.0060 | 993.692 |
| 310.15 | 0.0079 | 993.781 |
| 310.15 | 0.0102 | 993.89 |
| 310.15 | 0.0118 | 993.966 |
| 310.15 | 0.0140 | 994.07 |
| 310.15 | 0.0155 | 994.143 |
| 310.15 | 0.0181 | 994.264 |
| 310.15 | 0.0197 | 994.343 |
| 315.15 | 0.0020 | 991.606 |
| 315.15 | 0.0041 | 991.707 |
| 315.15 | 0.0060 | 991.798 |
| 315.15 | 0.0079 | 991.886 |
| 315.15 | 0.0102 | 991.994 |
| 315.15 | 0.0118 | 992.07 |
| 315.15 | 0.0140 | 992.173 |
| 315.15 | 0.0155 | 992.246 |
| 315.15 | 0.0181 | 992.366 |
| 315.15 | 0.0197 | 992.445 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of N-L-alanyl-L-valine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 305.15 | 0.0020 | 995.187 |
| 305.15 | 0.0041 | 995.289 |
| 305.15 | 0.0060 | 995.381 |
| 305.15 | 0.0079 | 995.471 |
| 305.15 | 0.0102 | 995.58 |
| 305.15 | 0.0118 | 995.657 |
| 305.15 | 0.0140 | 995.761 |
| 305.15 | 0.0155 | 995.835 |
| 305.15 | 0.0181 | 995.957 |
| 305.15 | 0.0197 | 996.037 |
| 310.15 | 0.0020 | 993.499 |
| 310.15 | 0.0041 | 993.601 |
| 310.15 | 0.0060 | 993.692 |
| 310.15 | 0.0079 | 993.781 |
| 310.15 | 0.0102 | 993.89 |
| 310.15 | 0.0118 | 993.966 |
| 310.15 | 0.0140 | 994.07 |
| 310.15 | 0.0155 | 994.143 |
| 310.15 | 0.0181 | 994.264 |
| 310.15 | 0.0197 | 994.343 |
| 315.15 | 0.0020 | 991.606 |
| 315.15 | 0.0041 | 991.707 |
| 315.15 | 0.0060 | 991.798 |
| 315.15 | 0.0079 | 991.886 |
| 315.15 | 0.0102 | 991.994 |
| 315.15 | 0.0118 | 992.07 |
| 315.15 | 0.0140 | 992.173 |
| 315.15 | 0.0155 | 992.246 |
| 315.15 | 0.0181 | 992.366 |
| 315.15 | 0.0197 | 992.445 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of N-L-alanyl-L-valine (1) - Liquid | Speed of sound, m/s - Liquid |
| 305.15 | 0.0020 | 1514.31 |
| 305.15 | 0.0041 | 1514.52 |
| 305.15 | 0.0060 | 1514.63 |
| 305.15 | 0.0079 | 1514.81 |
| 305.15 | 0.0102 | 1514.99 |
| 305.15 | 0.0118 | 1515.15 |
| 305.15 | 0.0140 | 1515.36 |
| 305.15 | 0.0155 | 1515.58 |
| 305.15 | 0.0181 | 1515.75 |
| 305.15 | 0.0197 | 1515.93 |
| 310.15 | 0.0020 | 1524.81 |
| 310.15 | 0.0041 | 1525.01 |
| 310.15 | 0.0060 | 1525.25 |
| 310.15 | 0.0079 | 1525.49 |
| 310.15 | 0.0102 | 1525.72 |
| 310.15 | 0.0118 | 1525.92 |
| 310.15 | 0.0140 | 1526.12 |
| 310.15 | 0.0155 | 1526.38 |
| 310.15 | 0.0181 | 1526.69 |
| 310.15 | 0.0197 | 1526.92 |
| 315.15 | 0.0020 | 1533.51 |
| 315.15 | 0.0041 | 1533.74 |
| 315.15 | 0.0060 | 1533.96 |
| 315.15 | 0.0079 | 1534.14 |
| 315.15 | 0.0102 | 1534.29 |
| 315.15 | 0.0118 | 1534.41 |
| 315.15 | 0.0140 | 1534.58 |
| 315.15 | 0.0155 | 1534.75 |
| 315.15 | 0.0181 | 1534.97 |
| 315.15 | 0.0197 | 1535.18 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of N-L-alanyl-L-valine (1) - Liquid | Speed of sound, m/s - Liquid |
| 305.15 | 0.0020 | 1514.31 |
| 305.15 | 0.0041 | 1514.52 |
| 305.15 | 0.0060 | 1514.63 |
| 305.15 | 0.0079 | 1514.81 |
| 305.15 | 0.0102 | 1514.99 |
| 305.15 | 0.0118 | 1515.15 |
| 305.15 | 0.0140 | 1515.36 |
| 305.15 | 0.0155 | 1515.58 |
| 305.15 | 0.0181 | 1515.75 |
| 305.15 | 0.0197 | 1515.93 |
| 310.15 | 0.0020 | 1524.81 |
| 310.15 | 0.0041 | 1525.01 |
| 310.15 | 0.0060 | 1525.25 |
| 310.15 | 0.0079 | 1525.49 |
| 310.15 | 0.0102 | 1525.72 |
| 310.15 | 0.0118 | 1525.92 |
| 310.15 | 0.0140 | 1526.12 |
| 310.15 | 0.0155 | 1526.38 |
| 310.15 | 0.0181 | 1526.69 |
| 310.15 | 0.0197 | 1526.92 |
| 315.15 | 0.0020 | 1533.51 |
| 315.15 | 0.0041 | 1533.74 |
| 315.15 | 0.0060 | 1533.96 |
| 315.15 | 0.0079 | 1534.14 |
| 315.15 | 0.0102 | 1534.29 |
| 315.15 | 0.0118 | 1534.41 |
| 315.15 | 0.0140 | 1534.58 |
| 315.15 | 0.0155 | 1534.75 |
| 315.15 | 0.0181 | 1534.97 |
| 315.15 | 0.0197 | 1535.18 |