- Name
- Hexanedioic acid
- InChI
- InChI=1S/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H,7,8)(H,9,10)
- InChI Key
- WNLRTRBMVRJNCN-UHFFFAOYSA-N
- Formula
- C6H10O4
- SMILES
- O=C(O)CCCCC(=O)O
- Mol. Weight (g/mol)
- 146.14
- CAS
- 124-04-9
- Name
- Cyclohexanone
- InChI
- InChI=1S/C6H10O/c7-6-4-2-1-3-5-6/h1-5H2
- InChI Key
- JHIVVAPYMSGYDF-UHFFFAOYSA-N
- Formula
- C6H10O
- SMILES
- O=C1CCCCC1
- Mol. Weight (g/mol)
- 98.14
- CAS
- 108-94-1
Datasets
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 303.00 | 0.0130 |
| 313.00 | 0.0190 |
| 323.00 | 0.0320 |
| 333.00 | 0.0490 |
| 343.00 | 0.0740 |
| 353.00 | 0.1000 |
| 363.00 | 0.1360 |
| 373.00 | 0.1780 |
| 383.00 | 0.2140 |
| 393.00 | 0.2520 |
Mass ratio of solute to solvent of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent of Hexanedioic acid (1) - Liquid |
|---|---|
| 305.05 | 0.0325 |
| 309.35 | 0.0388 |
| 313.35 | 0.0451 |
| 316.85 | 0.0515 |
| 321.95 | 0.0625 |
| 326.35 | 0.0739 |
| 330.85 | 0.0873 |
| 334.65 | 0.1014 |
| 338.90 | 0.1213 |
| 343.15 | 0.1414 |
| 346.95 | 0.1616 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 303.50 | 0.0187 |
| 313.00 | 0.0256 |
| 323.00 | 0.0375 |
| 333.00 | 0.0574 |
| 338.00 | 0.0667 |
| 343.00 | 0.0775 |
| 348.00 | 0.0944 |
| 353.30 | 0.1217 |
| 356.50 | 0.1331 |
| 361.00 | 0.1550 |
| 366.00 | 0.1790 |
| 371.00 | 0.2142 |
| 376.00 | 0.2535 |
| 381.00 | 0.2850 |
| 386.00 | 0.3331 |
| 388.80 | 0.3655 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 301.25 | 0.0147 |
| 305.45 | 0.0188 |
| 309.95 | 0.0230 |
| 314.45 | 0.0274 |
| 318.25 | 0.0321 |
| 321.15 | 0.0369 |
| 324.35 | 0.0422 |
| 327.65 | 0.0478 |
| 331.65 | 0.0542 |
| 334.75 | 0.0616 |
| 338.55 | 0.0690 |
| 341.35 | 0.0764 |
| 342.85 | 0.0837 |
| 344.95 | 0.0910 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 301.25 | 0.0147 |
| 305.45 | 0.0185 |
| 309.95 | 0.0227 |
| 314.45 | 0.0274 |
| 318.25 | 0.0321 |
| 321.15 | 0.0369 |
| 324.35 | 0.0422 |
| 327.65 | 0.0478 |
| 331.65 | 0.0542 |
| 334.75 | 0.0616 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 303.00 | 0.0130 |
| 313.00 | 0.0190 |
| 323.00 | 0.0320 |
| 333.00 | 0.0490 |
| 343.00 | 0.0740 |
| 353.00 | 0.1000 |
| 363.00 | 0.1360 |
| 373.00 | 0.1780 |
| 383.00 | 0.2140 |
| 393.00 | 0.2520 |
Mass ratio of solute to solvent of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent of Hexanedioic acid (1) - Liquid |
|---|---|
| 305.05 | 0.0325 |
| 309.35 | 0.0388 |
| 313.35 | 0.0451 |
| 316.85 | 0.0515 |
| 321.95 | 0.0625 |
| 326.35 | 0.0739 |
| 330.85 | 0.0873 |
| 334.65 | 0.1014 |
| 338.90 | 0.1213 |
| 343.15 | 0.1414 |
| 346.95 | 0.1616 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 303.50 | 0.0187 |
| 313.00 | 0.0256 |
| 323.00 | 0.0375 |
| 333.00 | 0.0574 |
| 338.00 | 0.0667 |
| 343.00 | 0.0775 |
| 348.00 | 0.0944 |
| 353.30 | 0.1217 |
| 356.50 | 0.1331 |
| 361.00 | 0.1550 |
| 366.00 | 0.1790 |
| 371.00 | 0.2142 |
| 376.00 | 0.2535 |
| 381.00 | 0.2850 |
| 386.00 | 0.3331 |
| 388.80 | 0.3655 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 301.25 | 0.0147 |
| 305.45 | 0.0188 |
| 309.95 | 0.0230 |
| 314.45 | 0.0274 |
| 318.25 | 0.0321 |
| 321.15 | 0.0369 |
| 324.35 | 0.0422 |
| 327.65 | 0.0478 |
| 331.65 | 0.0542 |
| 334.75 | 0.0616 |
| 338.55 | 0.0690 |
| 341.35 | 0.0764 |
| 342.85 | 0.0837 |
| 344.95 | 0.0910 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 301.25 | 0.0147 |
| 305.45 | 0.0185 |
| 309.95 | 0.0227 |
| 314.45 | 0.0274 |
| 318.25 | 0.0321 |
| 321.15 | 0.0369 |
| 324.35 | 0.0422 |
| 327.65 | 0.0478 |
| 331.65 | 0.0542 |
| 334.75 | 0.0616 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Hexanedioic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0152 | 300.25 |
| 0.0190 | 305.45 |
| 0.0230 | 309.75 |
| 0.0274 | 313.95 |
| 0.0321 | 317.85 |
| 0.0369 | 321.15 |
| 0.0468 | 327.65 |
| 0.0542 | 331.65 |
| 0.0633 | 335.75 |
| 0.0742 | 340.45 |
| 0.0188 | 305.45 |
| 0.0422 | 324.35 |
| 0.0478 | 327.65 |
| 0.0609 | 334.75 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Hexanedioic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0152 | 300.25 |
| 0.0190 | 305.45 |
| 0.0230 | 309.75 |
| 0.0274 | 313.95 |
| 0.0321 | 317.85 |
| 0.0369 | 321.15 |
| 0.0468 | 327.65 |
| 0.0542 | 331.65 |
| 0.0633 | 335.75 |
| 0.0742 | 340.45 |
| 0.0188 | 305.45 |
| 0.0422 | 324.35 |
| 0.0478 | 327.65 |
| 0.0609 | 334.75 |
Sources
- Measurement on the solubility of adipic acid in various solvents at high temperature and its thermodynamics parameters.
- Solubilities of adipic acid in binary cyclohexanone + cyclohexanol, cyclohexane + cyclohexanol, and cyclohexane + cyclohexanone solvent mixtures
- Solubilities of Adipic Acid in Cyclohexanol + Cyclohexanone Mixtures and Cyclohexanone + Cyclohexane Mixtures
- Measurement and Correlation for Solubilities of Adipic Acid in Acetic Acid + e-Caprolactone Mixtures and Cyclohexanone + e-Caprolactone Mixtures
- Measurement and Correlation for Solubilities of Adipic Acid, Glutaric Acid, and Succinic Acid in Dimethyl Adipate + Methanol Mixtures
- Measurement and Correlation for the Solubility of Adipic Acid and Succinic Acid in Glutaric Acid + Cyclohexanone and Glutaric Acid + Acetic Acid Mixtures