- Name
- Pentanoic acid, 4-oxo-
- InChI
- InChI=1S/C5H8O3/c1-4(6)2-3-5(7)8/h2-3H2,1H3,(H,7,8)
- InChI Key
- JOOXCMJARBKPKM-UHFFFAOYSA-N
- Formula
- C5H8O3
- SMILES
- CC(=O)CCC(=O)O
- Mol. Weight (g/mol)
- 116.12
- CAS
- 123-76-2
- Name
- Choline chloride
- InChI
- InChI=1S/C5H14NO.ClH/c1-6(2,3)4-5-7;/h7H,4-5H2,1-3H3;1H/q+1;/p-1
- InChI Key
- SGMZJAMFUVOLNK-UHFFFAOYSA-M
- Formula
- C5H14ClNO
- SMILES
- C[N+](C)(C)CCO.[Cl-]
- Mol. Weight (g/mol)
- 139.62
- CAS
- 67-48-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Amount ratio of solute to solvent = 2 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 293.15 | 0.3653 |
| 298.15 | 0.2558 |
| 303.15 | 0.1855 |
| 308.15 | 0.1365 |
| 313.15 | 0.1037 |
| 318.15 | 0.0815 |
| 323.15 | 0.0648 |
| 328.15 | 0.0517 |
| 333.15 | 0.0430 |
| 338.15 | 0.0341 |
| 343.15 | 0.0286 |
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Amount ratio of solute to solvent = 2 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 293.15 | 0.3653 |
| 298.15 | 0.2558 |
| 303.15 | 0.1855 |
| 308.15 | 0.1365 |
| 313.15 | 0.1037 |
| 318.15 | 0.0815 |
| 323.15 | 0.0648 |
| 328.15 | 0.0517 |
| 333.15 | 0.0430 |
| 338.15 | 0.0341 |
| 343.15 | 0.0286 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Amount ratio of solute to solvent = 2 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 293.15 | 1.4699 |
| 298.15 | 1.4687 |
| 303.15 | 1.4673 |
| 308.15 | 1.466 |
| 313.15 | 1.4646 |
| 318.15 | 1.4632 |
| 323.15 | 1.4618 |
| 328.15 | 1.4604 |
| 333.15 | 1.459 |
| 338.15 | 1.4576 |
| 343.15 | 1.4562 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Amount ratio of solute to solvent = 2 (Liquid)
| Temperature, K - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 293.15 | 1.4699 |
| 298.15 | 1.4687 |
| 303.15 | 1.4673 |
| 308.15 | 1.466 |
| 313.15 | 1.4646 |
| 318.15 | 1.4632 |
| 323.15 | 1.4618 |
| 328.15 | 1.4604 |
| 333.15 | 1.459 |
| 338.15 | 1.4576 |
| 343.15 | 1.4562 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Amount ratio of solute to solvent = 2 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 293.15 | 1141.05 |
| 298.15 | 1137.7 |
| 303.15 | 1134.34 |
| 308.15 | 1130.99 |
| 313.15 | 1127.63 |
| 318.15 | 1124.3 |
| 323.15 | 1120.98 |
| 328.15 | 1117.68 |
| 333.15 | 1114.69 |
| 338.15 | 1111.41 |
| 343.15 | 1108.1 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Amount ratio of solute to solvent = 2 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 293.15 | 1141.05 |
| 298.15 | 1137.7 |
| 303.15 | 1134.34 |
| 308.15 | 1130.99 |
| 313.15 | 1127.63 |
| 318.15 | 1124.3 |
| 323.15 | 1120.98 |
| 328.15 | 1117.68 |
| 333.15 | 1114.69 |
| 338.15 | 1111.41 |
| 343.15 | 1108.1 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Amount ratio of solute to solvent = 2 (Liquid)
| Temperature, K - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 293.15 | 1764.0 |
| 298.15 | 1749.0 |
| 303.15 | 1734.0 |
| 308.15 | 1720.0 |
| 313.15 | 1707.0 |
| 318.15 | 1693.0 |
| 323.15 | 1680.0 |
| 328.15 | 1667.0 |
| 333.15 | 1654.0 |
| 338.15 | 1641.0 |
| 343.15 | 1628.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Amount ratio of solute to solvent = 2 (Liquid)
| Temperature, K - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 293.15 | 1764.0 |
| 298.15 | 1749.0 |
| 303.15 | 1734.0 |
| 308.15 | 1720.0 |
| 313.15 | 1707.0 |
| 318.15 | 1693.0 |
| 323.15 | 1680.0 |
| 328.15 | 1667.0 |
| 333.15 | 1654.0 |
| 338.15 | 1641.0 |
| 343.15 | 1628.0 |