- Name
- 2-Pentanone
- InChI
- InChI=1S/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3
- InChI Key
- XNLICIUVMPYHGG-UHFFFAOYSA-N
- Formula
- C5H10O
- SMILES
- CCCC(C)=O
- Mol. Weight (g/mol)
- 86.13
- CAS
- 107-87-9
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Activity coefficient (6)
- Henry's Law constant (mole fraction scale), kPa (16)
- Excess molar enthalpy (molar enthalpy (2)
- ρl - Mass density, kg/m3 (2)
Activity coefficient of 2-Pentanone (1) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of 2-Pentanone (1) - Liquid |
|---|---|
| 273.17 | 61.4 |
| 278.15 | 67.2 |
| 288.15 | 78.7 |
| 298.15 | 95.9 |
| 308.15 | 107.3 |
| 318.15 | 120.6 |
| 328.15 | 128.8 |
| 333.15 | 129.9 |
Activity coefficient of 2-Pentanone (1) [ref]
Operational conditions:
- Pressure, kPa = 101.325 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of 2-Pentanone (1) - Liquid |
|---|---|
| 297.85 | 129.0 |
| 298.15 | 148.0 |
Activity coefficient of 2-Pentanone (1) [ref]
Operational conditions:
- Pressure, kPa = 101.325 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of 2-Pentanone (1) - Liquid |
|---|---|
| 303.25 | 105.0 |
| 313.25 | 120.0 |
| 323.25 | 128.0 |
| 333.25 | 135.0 |
Activity coefficient of 2-Pentanone (1) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of 2-Pentanone (1) - Liquid |
|---|---|
| 273.17 | 61.4 |
| 278.15 | 67.2 |
| 288.15 | 78.7 |
| 298.15 | 95.9 |
| 308.15 | 107.3 |
| 318.15 | 120.6 |
| 328.15 | 128.8 |
| 333.15 | 129.9 |
Activity coefficient of 2-Pentanone (1) [ref]
Operational conditions:
- Pressure, kPa = 101.325 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of 2-Pentanone (1) - Liquid |
|---|---|
| 297.85 | 129.0 |
| 298.15 | 148.0 |
Activity coefficient of 2-Pentanone (1) [ref]
Operational conditions:
- Pressure, kPa = 101.325 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of 2-Pentanone (1) - Liquid |
|---|---|
| 303.25 | 105.0 |
| 313.25 | 120.0 |
| 323.25 | 128.0 |
| 333.25 | 135.0 |
Henry's Law constant (mole fraction scale), kPa of 2-Pentanone (1) [ref]
Operational condition: Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Henry's Law constant (mole fraction scale), kPa of 2-Pentanone (1) - Liquid |
|---|---|
| 323.15 | 1834.0 |
| 333.15 | 2877.6 |
| 343.15 | 4407.6 |
| 353.15 | 6474.7 |
Mass fraction of 2-Pentanone (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mass fraction of 2-Pentanone (1) - Liquid mixture 2 |
|---|---|
| 323.15 | 0.9581 |
| 298.15 | 0.9668 |
Mass fraction of 2-Pentanone (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mass fraction of 2-Pentanone (1) - Liquid mixture 1 |
|---|---|
| 323.15 | 0.0420 |
| 298.15 | 0.0547 |
Mass fraction of 2-Pentanone (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mass fraction of 2-Pentanone (1) - Liquid mixture 2 |
|---|---|
| 298.20 | 0.9718 |
| 333.20 | 0.9370 |
| 318.20 | 0.9546 |
Mass fraction of 2-Pentanone (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mass fraction of 2-Pentanone (1) - Liquid mixture 1 |
|---|---|
| 298.20 | 0.0532 |
| 333.20 | 0.0359 |
| 318.20 | 0.0487 |
Mole fraction of 2-Pentanone (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mole fraction of 2-Pentanone (1) - Liquid mixture 1 |
|---|---|
| 333.15 | 0.8122 |
| 343.15 | 0.8089 |
| 353.15 | 0.8061 |
Mole fraction of 2-Pentanone (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mole fraction of 2-Pentanone (1) - Liquid mixture 2 |
|---|---|
| 333.15 | 0.0081 |
| 343.15 | 0.0080 |
| 353.15 | 0.0076 |
Henry's Law constant (mole fraction scale), kPa of 2-Pentanone (1) [ref]
Operational condition: Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Henry's Law constant (mole fraction scale), kPa of 2-Pentanone (1) - Liquid |
|---|---|
| 297.85 | 597.0 |
| 298.15 | 696.0 |
Henry's Law constant (mole fraction scale), kPa of 2-Pentanone (1) [ref]
Operational condition: Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Henry's Law constant (mole fraction scale), kPa of 2-Pentanone (1) - Liquid |
|---|---|
| 323.15 | 1834.0 |
| 333.15 | 2877.6 |
| 343.15 | 4407.6 |
| 353.15 | 6474.7 |
Mass fraction of 2-Pentanone (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mass fraction of 2-Pentanone (1) - Liquid mixture 2 |
|---|---|
| 323.15 | 0.9581 |
| 298.15 | 0.9668 |
Mass fraction of 2-Pentanone (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mass fraction of 2-Pentanone (1) - Liquid mixture 1 |
|---|---|
| 323.15 | 0.0420 |
| 298.15 | 0.0547 |
Mass fraction of 2-Pentanone (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mass fraction of 2-Pentanone (1) - Liquid mixture 2 |
|---|---|
| 298.20 | 0.9718 |
| 333.20 | 0.9370 |
| 318.20 | 0.9546 |
Mass fraction of 2-Pentanone (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mass fraction of 2-Pentanone (1) - Liquid mixture 1 |
|---|---|
| 298.20 | 0.0532 |
| 333.20 | 0.0359 |
| 318.20 | 0.0487 |
Mole fraction of 2-Pentanone (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mole fraction of 2-Pentanone (1) - Liquid mixture 1 |
|---|---|
| 333.15 | 0.8122 |
| 343.15 | 0.8089 |
| 353.15 | 0.8061 |
Mole fraction of 2-Pentanone (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mole fraction of 2-Pentanone (1) - Liquid mixture 2 |
|---|---|
| 333.15 | 0.0081 |
| 343.15 | 0.0080 |
| 353.15 | 0.0076 |
Henry's Law constant (mole fraction scale), kPa of 2-Pentanone (1) [ref]
Operational condition: Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Henry's Law constant (mole fraction scale), kPa of 2-Pentanone (1) - Liquid |
|---|---|
| 297.85 | 597.0 |
| 298.15 | 696.0 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of 2-Pentanone (1) - Liquid | Temperature, K - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 0.0050 | 288.15 | -0.0612 |
| 0.0050 | 288.15 | -0.0613 |
| 0.0042 | 288.15 | -0.0511 |
| 0.0042 | 288.15 | -0.0515 |
| 0.0034 | 288.15 | -0.0413 |
| 0.0034 | 288.15 | -0.0415 |
| 0.0025 | 288.15 | -0.0315 |
| 0.0025 | 288.15 | -0.0314 |
| 0.0017 | 288.15 | -0.0212 |
| 0.0017 | 288.15 | -0.0212 |
| 0.0008 | 288.15 | -0.0106 |
| 0.0008 | 288.15 | -0.0107 |
| 0.0050 | 298.15 | -0.0496 |
| 0.0050 | 298.15 | -0.0497 |
| 0.0042 | 298.15 | -0.0418 |
| 0.0042 | 298.15 | -0.0416 |
| 0.0034 | 298.15 | -0.0335 |
| 0.0034 | 298.15 | -0.0338 |
| 0.0025 | 298.15 | -0.0258 |
| 0.0025 | 298.15 | -0.0257 |
| 0.0017 | 298.15 | -0.0172 |
| 0.0017 | 298.15 | -0.0172 |
| 0.0008 | 298.15 | -0.0087 |
| 0.0008 | 298.15 | -0.0087 |
| 0.0050 | 308.15 | -0.0383 |
| 0.0050 | 308.15 | -0.0384 |
| 0.0042 | 308.15 | -0.0324 |
| 0.0042 | 308.15 | -0.0324 |
| 0.0034 | 308.15 | -0.0261 |
| 0.0034 | 308.15 | -0.0262 |
| 0.0025 | 308.15 | -0.0198 |
| 0.0025 | 308.15 | -0.0199 |
| 0.0017 | 308.15 | -0.0135 |
| 0.0017 | 308.15 | -0.0135 |
| 0.0008 | 308.15 | -0.0069 |
| 0.0008 | 308.15 | -0.0068 |
| 0.0050 | 318.15 | -0.0272 |
| 0.0042 | 318.15 | -0.0231 |
| 0.0034 | 318.15 | -0.0188 |
| 0.0025 | 318.15 | -0.0143 |
| 0.0017 | 318.15 | -0.0097 |
| 0.0008 | 318.15 | -0.0049 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of 2-Pentanone (1) - Liquid | Temperature, K - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 0.0050 | 288.15 | -0.0612 |
| 0.0050 | 288.15 | -0.0613 |
| 0.0042 | 288.15 | -0.0511 |
| 0.0042 | 288.15 | -0.0515 |
| 0.0034 | 288.15 | -0.0413 |
| 0.0034 | 288.15 | -0.0415 |
| 0.0025 | 288.15 | -0.0315 |
| 0.0025 | 288.15 | -0.0314 |
| 0.0017 | 288.15 | -0.0212 |
| 0.0017 | 288.15 | -0.0212 |
| 0.0008 | 288.15 | -0.0106 |
| 0.0008 | 288.15 | -0.0107 |
| 0.0050 | 298.15 | -0.0496 |
| 0.0050 | 298.15 | -0.0497 |
| 0.0042 | 298.15 | -0.0418 |
| 0.0042 | 298.15 | -0.0416 |
| 0.0034 | 298.15 | -0.0335 |
| 0.0034 | 298.15 | -0.0338 |
| 0.0025 | 298.15 | -0.0258 |
| 0.0025 | 298.15 | -0.0257 |
| 0.0017 | 298.15 | -0.0172 |
| 0.0017 | 298.15 | -0.0172 |
| 0.0008 | 298.15 | -0.0087 |
| 0.0008 | 298.15 | -0.0087 |
| 0.0050 | 308.15 | -0.0383 |
| 0.0050 | 308.15 | -0.0384 |
| 0.0042 | 308.15 | -0.0324 |
| 0.0042 | 308.15 | -0.0324 |
| 0.0034 | 308.15 | -0.0261 |
| 0.0034 | 308.15 | -0.0262 |
| 0.0025 | 308.15 | -0.0198 |
| 0.0025 | 308.15 | -0.0199 |
| 0.0017 | 308.15 | -0.0135 |
| 0.0017 | 308.15 | -0.0135 |
| 0.0008 | 308.15 | -0.0069 |
| 0.0008 | 308.15 | -0.0068 |
| 0.0050 | 318.15 | -0.0272 |
| 0.0042 | 318.15 | -0.0231 |
| 0.0034 | 318.15 | -0.0188 |
| 0.0025 | 318.15 | -0.0143 |
| 0.0017 | 318.15 | -0.0097 |
| 0.0008 | 318.15 | -0.0049 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of 2-Pentanone (1) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 0.0050 | 288.15 | 996.016 |
| 0.0050 | 288.15 | 996.015 |
| 0.0042 | 288.15 | 996.522 |
| 0.0042 | 288.15 | 996.499 |
| 0.0034 | 288.15 | 997.021 |
| 0.0034 | 288.15 | 997.002 |
| 0.0025 | 288.15 | 997.512 |
| 0.0025 | 288.15 | 997.513 |
| 0.0017 | 288.15 | 998.027 |
| 0.0017 | 288.15 | 998.026 |
| 0.0008 | 288.15 | 998.562 |
| 0.0008 | 288.15 | 998.56 |
| 0.0050 | 298.15 | 993.716 |
| 0.0050 | 298.15 | 993.707 |
| 0.0042 | 298.15 | 994.25 |
| 0.0042 | 298.15 | 994.26 |
| 0.0034 | 298.15 | 994.811 |
| 0.0034 | 298.15 | 994.797 |
| 0.0025 | 298.15 | 995.334 |
| 0.0025 | 298.15 | 995.346 |
| 0.0017 | 298.15 | 995.902 |
| 0.0017 | 298.15 | 995.903 |
| 0.0008 | 298.15 | 996.472 |
| 0.0008 | 298.15 | 996.472 |
| 0.0050 | 308.15 | 990.474 |
| 0.0050 | 308.15 | 990.475 |
| 0.0042 | 308.15 | 991.045 |
| 0.0042 | 308.15 | 991.052 |
| 0.0034 | 308.15 | 991.643 |
| 0.0034 | 308.15 | 991.617 |
| 0.0025 | 308.15 | 992.228 |
| 0.0025 | 308.15 | 992.226 |
| 0.0017 | 308.15 | 992.818 |
| 0.0017 | 308.15 | 992.814 |
| 0.0008 | 308.15 | 993.42 |
| 0.0050 | 318.15 | 986.447 |
| 0.0042 | 318.15 | 987.058 |
| 0.0034 | 318.15 | 987.666 |
| 0.0025 | 318.15 | 988.307 |
| 0.0017 | 318.15 | 988.929 |
| 0.0008 | 318.15 | 989.57 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of 2-Pentanone (1) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 0.0050 | 288.15 | 996.016 |
| 0.0050 | 288.15 | 996.015 |
| 0.0042 | 288.15 | 996.522 |
| 0.0042 | 288.15 | 996.499 |
| 0.0034 | 288.15 | 997.021 |
| 0.0034 | 288.15 | 997.002 |
| 0.0025 | 288.15 | 997.512 |
| 0.0025 | 288.15 | 997.513 |
| 0.0017 | 288.15 | 998.027 |
| 0.0017 | 288.15 | 998.026 |
| 0.0008 | 288.15 | 998.562 |
| 0.0008 | 288.15 | 998.56 |
| 0.0050 | 298.15 | 993.716 |
| 0.0050 | 298.15 | 993.707 |
| 0.0042 | 298.15 | 994.25 |
| 0.0042 | 298.15 | 994.26 |
| 0.0034 | 298.15 | 994.811 |
| 0.0034 | 298.15 | 994.797 |
| 0.0025 | 298.15 | 995.334 |
| 0.0025 | 298.15 | 995.346 |
| 0.0017 | 298.15 | 995.902 |
| 0.0017 | 298.15 | 995.903 |
| 0.0008 | 298.15 | 996.472 |
| 0.0008 | 298.15 | 996.472 |
| 0.0050 | 308.15 | 990.474 |
| 0.0050 | 308.15 | 990.475 |
| 0.0042 | 308.15 | 991.045 |
| 0.0042 | 308.15 | 991.052 |
| 0.0034 | 308.15 | 991.643 |
| 0.0034 | 308.15 | 991.617 |
| 0.0025 | 308.15 | 992.228 |
| 0.0025 | 308.15 | 992.226 |
| 0.0017 | 308.15 | 992.818 |
| 0.0017 | 308.15 | 992.814 |
| 0.0008 | 308.15 | 993.42 |
| 0.0050 | 318.15 | 986.447 |
| 0.0042 | 318.15 | 987.058 |
| 0.0034 | 318.15 | 987.666 |
| 0.0025 | 318.15 | 988.307 |
| 0.0017 | 318.15 | 988.929 |
| 0.0008 | 318.15 | 989.57 |
Sources
- A relative headspace method for Henry s constants of volatile organic compounds
- Measurement and thermodynamic modeling of ternary (liquid + liquid) equilibrium for extraction of o-cresol, m-cresol or p-cresol from aqueous solution with 2-pentanone
- Thermal and Volumetric Properties of Some C5 and C6 Alkanones at Infinite Dilution in Water
- Liquid-Liquid Equilibrium for Ternary Systems of 2-Pentanone/Mesityl Oxide + Catechol + Water at 298.2, 318.2, and 333.2 K
- Measurements and Thermodynamic Modeling of Liquid-Liquid Equilibria Data for the Ternary (Methyl Propyl Ketone + Catechol/Resorcinol/Hydroquinone + Water) Systems
- Air-Water Partitioning of C5 and C6 Alkanones: Measurement, Critical Compilation, Correlation, and Recommended Data
- Determination of Henry s Law Constants and Activity Coefficients at Infinite Dilution of Flavor Compounds in Water at 298 K with a Gas-Chromatographic Method
- Measurement of Activity Coefficients at Infinite Dilution of Benzene, Toluene, Ethanol, Esters, Ketones, and Ethers at Various Temperatures in Water Using the Dilutor Technique