- Name
- 2-Butanone, 3-methyl-
- InChI
- InChI=1S/C5H10O/c1-4(2)5(3)6/h4H,1-3H3
- InChI Key
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N
- Formula
- C5H10O
- SMILES
- CC(=O)C(C)C
- Mol. Weight (g/mol)
- 86.13
- CAS
- 563-80-4
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Activity coefficient (2)
- Mass fraction (12)
- Excess molar enthalpy (molar enthalpy (2)
- ρl - Mass density, kg/m3 (2)
Activity coefficient of 2-Butanone, 3-methyl- (1) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of 2-Butanone, 3-methyl- (1) - Liquid |
|---|---|
| 278.15 | 64.4 |
| 288.15 | 72.9 |
| 298.15 | 91.0 |
| 308.15 | 102.2 |
| 318.15 | 112.2 |
| 328.15 | 118.7 |
Activity coefficient of 2-Butanone, 3-methyl- (1) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of 2-Butanone, 3-methyl- (1) - Liquid |
|---|---|
| 278.15 | 64.4 |
| 288.15 | 72.9 |
| 298.15 | 91.0 |
| 308.15 | 102.2 |
| 318.15 | 112.2 |
| 328.15 | 118.7 |
Mass fraction of 2-Butanone, 3-methyl- (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mass fraction of 2-Butanone, 3-methyl- (1) - Liquid mixture 1 |
|---|---|
| 298.20 | 0.9653 |
| 313.20 | 0.9598 |
Mass fraction of 2-Butanone, 3-methyl- (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mass fraction of 2-Butanone, 3-methyl- (1) - Liquid mixture 2 |
|---|---|
| 298.20 | 0.0619 |
| 313.20 | 0.0496 |
Mole fraction of 2-Butanone, 3-methyl- (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mole fraction of 2-Butanone, 3-methyl- (1) - Liquid mixture 2 |
|---|---|
| 333.20 | 0.8307 |
| 343.20 | 0.8115 |
Mole fraction of 2-Butanone, 3-methyl- (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mole fraction of 2-Butanone, 3-methyl- (1) - Liquid mixture 1 |
|---|---|
| 333.20 | 0.0088 |
| 343.20 | 0.0074 |
Mass fraction of 2-Butanone, 3-methyl- (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mass fraction of 2-Butanone, 3-methyl- (1) - Liquid mixture 1 |
|---|---|
| 313.15 | 0.0496 |
| 323.15 | 0.0478 |
| 298.15 | 0.0619 |
Mass fraction of 2-Butanone, 3-methyl- (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mass fraction of 2-Butanone, 3-methyl- (1) - Liquid mixture 2 |
|---|---|
| 313.15 | 0.9598 |
| 323.15 | 0.9559 |
| 298.15 | 0.9653 |
Mass fraction of 2-Butanone, 3-methyl- (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mass fraction of 2-Butanone, 3-methyl- (1) - Liquid mixture 1 |
|---|---|
| 298.20 | 0.9653 |
| 313.20 | 0.9598 |
Mass fraction of 2-Butanone, 3-methyl- (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mass fraction of 2-Butanone, 3-methyl- (1) - Liquid mixture 2 |
|---|---|
| 298.20 | 0.0619 |
| 313.20 | 0.0496 |
Mole fraction of 2-Butanone, 3-methyl- (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mole fraction of 2-Butanone, 3-methyl- (1) - Liquid mixture 2 |
|---|---|
| 333.20 | 0.8307 |
| 343.20 | 0.8115 |
Mole fraction of 2-Butanone, 3-methyl- (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mole fraction of 2-Butanone, 3-methyl- (1) - Liquid mixture 1 |
|---|---|
| 333.20 | 0.0088 |
| 343.20 | 0.0074 |
Mass fraction of 2-Butanone, 3-methyl- (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mass fraction of 2-Butanone, 3-methyl- (1) - Liquid mixture 1 |
|---|---|
| 313.15 | 0.0496 |
| 323.15 | 0.0478 |
| 298.15 | 0.0619 |
Mass fraction of 2-Butanone, 3-methyl- (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Mass fraction of 2-Butanone, 3-methyl- (1) - Liquid mixture 2 |
|---|---|
| 313.15 | 0.9598 |
| 323.15 | 0.9559 |
| 298.15 | 0.9653 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of 2-Butanone, 3-methyl- (1) - Liquid | Temperature, K - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 0.0050 | 288.15 | -0.0605 |
| 0.0050 | 288.15 | -0.0602 |
| 0.0042 | 288.15 | -0.0505 |
| 0.0042 | 288.15 | -0.0507 |
| 0.0033 | 288.15 | -0.0408 |
| 0.0033 | 288.15 | -0.0408 |
| 0.0025 | 288.15 | -0.0309 |
| 0.0025 | 288.15 | -0.0310 |
| 0.0017 | 288.15 | -0.0207 |
| 0.0017 | 288.15 | -0.0208 |
| 0.0008 | 288.15 | -0.0105 |
| 0.0008 | 288.15 | -0.0105 |
| 0.0050 | 298.15 | -0.0495 |
| 0.0050 | 298.15 | -0.0492 |
| 0.0042 | 298.15 | -0.0416 |
| 0.0042 | 298.15 | -0.0414 |
| 0.0033 | 298.15 | -0.0336 |
| 0.0033 | 298.15 | -0.0334 |
| 0.0025 | 298.15 | -0.0256 |
| 0.0025 | 298.15 | -0.0253 |
| 0.0017 | 298.15 | -0.0172 |
| 0.0017 | 298.15 | -0.0172 |
| 0.0008 | 298.15 | -0.0087 |
| 0.0008 | 298.15 | -0.0087 |
| 0.0050 | 308.15 | -0.0387 |
| 0.0042 | 308.15 | -0.0328 |
| 0.0042 | 308.15 | -0.0327 |
| 0.0033 | 308.15 | -0.0264 |
| 0.0033 | 308.15 | -0.0265 |
| 0.0025 | 308.15 | -0.0200 |
| 0.0025 | 308.15 | -0.0202 |
| 0.0017 | 308.15 | -0.0135 |
| 0.0017 | 308.15 | -0.0135 |
| 0.0008 | 308.15 | -0.0069 |
| 0.0008 | 308.15 | -0.0068 |
| 0.0050 | 318.15 | -0.0283 |
| 0.0050 | 318.15 | -0.0283 |
| 0.0042 | 318.15 | -0.0240 |
| 0.0042 | 318.15 | -0.0239 |
| 0.0033 | 318.15 | -0.0195 |
| 0.0033 | 318.15 | -0.0194 |
| 0.0025 | 318.15 | -0.0148 |
| 0.0023 | 318.15 | -0.0138 |
| 0.0017 | 318.15 | -0.0100 |
| 0.0017 | 318.15 | -0.0100 |
| 0.0008 | 318.15 | -0.0051 |
| 0.0008 | 318.15 | -0.0050 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of 2-Butanone, 3-methyl- (1) - Liquid | Temperature, K - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 0.0050 | 288.15 | -0.0605 |
| 0.0050 | 288.15 | -0.0602 |
| 0.0042 | 288.15 | -0.0505 |
| 0.0042 | 288.15 | -0.0507 |
| 0.0033 | 288.15 | -0.0408 |
| 0.0033 | 288.15 | -0.0408 |
| 0.0025 | 288.15 | -0.0309 |
| 0.0025 | 288.15 | -0.0310 |
| 0.0017 | 288.15 | -0.0207 |
| 0.0017 | 288.15 | -0.0208 |
| 0.0008 | 288.15 | -0.0105 |
| 0.0008 | 288.15 | -0.0105 |
| 0.0050 | 298.15 | -0.0495 |
| 0.0050 | 298.15 | -0.0492 |
| 0.0042 | 298.15 | -0.0416 |
| 0.0042 | 298.15 | -0.0414 |
| 0.0033 | 298.15 | -0.0336 |
| 0.0033 | 298.15 | -0.0334 |
| 0.0025 | 298.15 | -0.0256 |
| 0.0025 | 298.15 | -0.0253 |
| 0.0017 | 298.15 | -0.0172 |
| 0.0017 | 298.15 | -0.0172 |
| 0.0008 | 298.15 | -0.0087 |
| 0.0008 | 298.15 | -0.0087 |
| 0.0050 | 308.15 | -0.0387 |
| 0.0042 | 308.15 | -0.0328 |
| 0.0042 | 308.15 | -0.0327 |
| 0.0033 | 308.15 | -0.0264 |
| 0.0033 | 308.15 | -0.0265 |
| 0.0025 | 308.15 | -0.0200 |
| 0.0025 | 308.15 | -0.0202 |
| 0.0017 | 308.15 | -0.0135 |
| 0.0017 | 308.15 | -0.0135 |
| 0.0008 | 308.15 | -0.0069 |
| 0.0008 | 308.15 | -0.0068 |
| 0.0050 | 318.15 | -0.0283 |
| 0.0050 | 318.15 | -0.0283 |
| 0.0042 | 318.15 | -0.0240 |
| 0.0042 | 318.15 | -0.0239 |
| 0.0033 | 318.15 | -0.0195 |
| 0.0033 | 318.15 | -0.0194 |
| 0.0025 | 318.15 | -0.0148 |
| 0.0023 | 318.15 | -0.0138 |
| 0.0017 | 318.15 | -0.0100 |
| 0.0017 | 318.15 | -0.0100 |
| 0.0008 | 318.15 | -0.0051 |
| 0.0008 | 318.15 | -0.0050 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of 2-Butanone, 3-methyl- (1) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 0.0050 | 288.15 | 995.988 |
| 0.0050 | 288.15 | 996.0 |
| 0.0042 | 288.15 | 996.494 |
| 0.0042 | 288.15 | 996.488 |
| 0.0033 | 288.15 | 996.996 |
| 0.0033 | 288.15 | 996.993 |
| 0.0025 | 288.15 | 997.502 |
| 0.0025 | 288.15 | 997.502 |
| 0.0017 | 288.15 | 998.026 |
| 0.0017 | 288.15 | 998.025 |
| 0.0008 | 288.15 | 998.559 |
| 0.0008 | 288.15 | 998.558 |
| 0.0050 | 298.15 | 993.722 |
| 0.0050 | 298.15 | 993.729 |
| 0.0042 | 298.15 | 994.254 |
| 0.0042 | 298.15 | 994.261 |
| 0.0033 | 298.15 | 994.799 |
| 0.0033 | 298.15 | 994.805 |
| 0.0025 | 298.15 | 995.337 |
| 0.0025 | 298.15 | 995.348 |
| 0.0017 | 298.15 | 995.897 |
| 0.0017 | 298.15 | 995.899 |
| 0.0008 | 298.15 | 996.47 |
| 0.0008 | 298.15 | 996.47 |
| 0.0050 | 308.15 | 990.494 |
| 0.0042 | 308.15 | 991.064 |
| 0.0042 | 308.15 | 991.067 |
| 0.0033 | 308.15 | 991.647 |
| 0.0033 | 308.15 | 991.646 |
| 0.0025 | 308.15 | 992.235 |
| 0.0025 | 308.15 | 992.224 |
| 0.0017 | 308.15 | 992.827 |
| 0.0017 | 308.15 | 992.824 |
| 0.0008 | 308.15 | 993.424 |
| 0.0008 | 308.15 | 993.426 |
| 0.0050 | 318.15 | 986.481 |
| 0.0050 | 318.15 | 986.477 |
| 0.0042 | 318.15 | 987.083 |
| 0.0042 | 318.15 | 987.091 |
| 0.0033 | 318.15 | 987.696 |
| 0.0033 | 318.15 | 987.702 |
| 0.0025 | 318.15 | 988.318 |
| 0.0023 | 318.15 | 988.447 |
| 0.0017 | 318.15 | 988.945 |
| 0.0017 | 318.15 | 988.947 |
| 0.0008 | 318.15 | 989.576 |
| 0.0008 | 318.15 | 989.578 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of 2-Butanone, 3-methyl- (1) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 0.0050 | 288.15 | 995.988 |
| 0.0050 | 288.15 | 996.0 |
| 0.0042 | 288.15 | 996.494 |
| 0.0042 | 288.15 | 996.488 |
| 0.0033 | 288.15 | 996.996 |
| 0.0033 | 288.15 | 996.993 |
| 0.0025 | 288.15 | 997.502 |
| 0.0025 | 288.15 | 997.502 |
| 0.0017 | 288.15 | 998.026 |
| 0.0017 | 288.15 | 998.025 |
| 0.0008 | 288.15 | 998.559 |
| 0.0008 | 288.15 | 998.558 |
| 0.0050 | 298.15 | 993.722 |
| 0.0050 | 298.15 | 993.729 |
| 0.0042 | 298.15 | 994.254 |
| 0.0042 | 298.15 | 994.261 |
| 0.0033 | 298.15 | 994.799 |
| 0.0033 | 298.15 | 994.805 |
| 0.0025 | 298.15 | 995.337 |
| 0.0025 | 298.15 | 995.348 |
| 0.0017 | 298.15 | 995.897 |
| 0.0017 | 298.15 | 995.899 |
| 0.0008 | 298.15 | 996.47 |
| 0.0008 | 298.15 | 996.47 |
| 0.0050 | 308.15 | 990.494 |
| 0.0042 | 308.15 | 991.064 |
| 0.0042 | 308.15 | 991.067 |
| 0.0033 | 308.15 | 991.647 |
| 0.0033 | 308.15 | 991.646 |
| 0.0025 | 308.15 | 992.235 |
| 0.0025 | 308.15 | 992.224 |
| 0.0017 | 308.15 | 992.827 |
| 0.0017 | 308.15 | 992.824 |
| 0.0008 | 308.15 | 993.424 |
| 0.0008 | 308.15 | 993.426 |
| 0.0050 | 318.15 | 986.481 |
| 0.0050 | 318.15 | 986.477 |
| 0.0042 | 318.15 | 987.083 |
| 0.0042 | 318.15 | 987.091 |
| 0.0033 | 318.15 | 987.696 |
| 0.0033 | 318.15 | 987.702 |
| 0.0025 | 318.15 | 988.318 |
| 0.0023 | 318.15 | 988.447 |
| 0.0017 | 318.15 | 988.945 |
| 0.0017 | 318.15 | 988.947 |
| 0.0008 | 318.15 | 989.576 |
| 0.0008 | 318.15 | 989.578 |
Sources
- Determination and modeling of liquid-liquid equilibrium for ternary mixtures of methyl isopropyl ketone, cresol isomers and water
- Extraction of o-, m- and p-cresol from aqueous solution with methyl isopropyl ketone: Equilibrium, correlations, and COSMO-RS predictions
- Experimental Determination and Correlation of Liquid Liquid Equilibria for Methyl Isopropyl Ketone + Phenol + Water Mixtures at 298.15, 313.15, and 323.15 K
- Thermal and Volumetric Properties of Some C5 and C6 Alkanones at Infinite Dilution in Water
- Air-Water Partitioning of C5 and C6 Alkanones: Measurement, Critical Compilation, Correlation, and Recommended Data