- Name
- Benzene, (1-methylethyl)-
- InChI
- InChI=1S/C9H12/c1-8(2)9-6-4-3-5-7-9/h3-8H,1-2H3
- InChI Key
- RWGFKTVRMDUZSP-UHFFFAOYSA-N
- Formula
- C9H12
- SMILES
- CC(C)c1ccccc1
- Mol. Weight (g/mol)
- 120.19
- CAS
- 98-82-8
- Name
- Phenol
- InChI
- InChI=1S/C6H6O/c7-6-4-2-1-3-5-6/h1-5,7H
- InChI Key
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N
- Formula
- C6H6O
- SMILES
- Oc1ccccc1
- Mol. Weight (g/mol)
- 94.11
- CAS
- 108-95-2
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass fraction of Phenol (2) [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Phenol (2) - Liquid mixture 1 |
| 293.20 | 0.9998 | 0.0000 |
| 293.20 | 0.9892 | 0.0099 |
| 293.20 | 0.9790 | 0.0199 |
| 293.20 | 0.9686 | 0.0299 |
| 293.20 | 0.9580 | 0.0399 |
| 293.20 | 0.9477 | 0.0498 |
| 293.20 | 0.9371 | 0.0612 |
| 293.20 | 0.9270 | 0.0697 |
| 293.20 | 0.9168 | 0.0797 |
| 293.20 | 0.0006 | 0.0000 |
| 293.20 | 0.0017 | 0.0099 |
| 293.20 | 0.0035 | 0.0199 |
| 293.20 | 0.0045 | 0.0298 |
| 293.20 | 0.0063 | 0.0397 |
| 293.20 | 0.0081 | 0.0495 |
| 293.20 | 0.0095 | 0.0594 |
| 293.20 | 0.0104 | 0.0692 |
| 293.20 | 0.0116 | 0.0790 |
| 293.20 | 0.0128 | 0.0987 |
| 293.20 | 0.0143 | 0.1182 |
| 293.20 | 0.0167 | 0.1376 |
| 293.20 | 0.0215 | 0.1761 |
| 298.20 | 0.9996 | 0.0000 |
| 298.20 | 0.9890 | 0.0099 |
| 298.20 | 0.9784 | 0.0199 |
| 298.20 | 0.9682 | 0.0299 |
| 298.20 | 0.9578 | 0.0399 |
| 298.20 | 0.9475 | 0.0498 |
| 298.20 | 0.9370 | 0.0612 |
| 298.20 | 0.9268 | 0.0697 |
| 298.20 | 0.9167 | 0.0797 |
| 298.20 | 0.0009 | 0.0000 |
| 298.20 | 0.0029 | 0.0099 |
| 298.20 | 0.0045 | 0.0199 |
| 298.20 | 0.0075 | 0.0297 |
| 298.20 | 0.0091 | 0.0396 |
| 298.20 | 0.0104 | 0.0494 |
| 298.20 | 0.0134 | 0.0591 |
| 298.20 | 0.0161 | 0.0688 |
| 298.20 | 0.0192 | 0.0784 |
| 298.20 | 0.0163 | 0.0983 |
| 298.20 | 0.0180 | 0.1178 |
| 298.20 | 0.0215 | 0.1369 |
| 298.20 | 0.0242 | 0.1756 |
| 308.20 | 0.9994 | 0.0000 |
| 308.20 | 0.9886 | 0.0099 |
| 308.20 | 0.9782 | 0.0199 |
| 308.20 | 0.9678 | 0.0299 |
| 308.20 | 0.9577 | 0.0399 |
| 308.20 | 0.9471 | 0.0498 |
| 308.20 | 0.9368 | 0.0611 |
| 308.20 | 0.9262 | 0.0697 |
| 308.20 | 0.9161 | 0.0796 |
| 308.20 | 0.0011 | 0.0000 |
| 308.20 | 0.0047 | 0.0099 |
| 308.20 | 0.0061 | 0.0198 |
| 308.20 | 0.0089 | 0.0297 |
| 308.20 | 0.0100 | 0.0395 |
| 308.20 | 0.0122 | 0.0493 |
| 308.20 | 0.0157 | 0.0590 |
| 308.20 | 0.0198 | 0.0686 |
| 308.20 | 0.0230 | 0.0976 |
| 308.20 | 0.0242 | 0.1170 |
| 308.20 | 0.0249 | 0.1365 |
| 308.20 | 0.0268 | 0.1751 |
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 2 | Mass fraction of Phenol (2) - Liquid mixture 1 | Mass fraction of Benzene, (1-methylethyl)- (1) - Liquid mixture 1 | Mass fraction of Benzene, (1-methylethyl)- (1) - Liquid mixture 2 | Mass fraction of Phenol (2) - Liquid mixture 2 |
| 293.20 | 0.0342 | 0.9598 | 0.0009 | 0.0191 |
| 293.20 | 0.0516 | 0.9405 | 0.0011 | 0.0251 |
| 293.20 | 0.0826 | 0.9061 | 0.0014 | 0.0324 |
| 293.20 | 0.1194 | 0.8652 | 0.0017 | 0.0403 |
| 293.20 | 0.1474 | 0.8340 | 0.0018 | 0.0438 |
| 293.20 | 0.1581 | 0.8222 | 0.0019 | 0.0463 |
| 293.20 | 0.1610 | 0.8190 | 0.0020 | 0.0492 |
| 293.20 | 0.1652 | 0.8142 | 0.0022 | 0.0528 |
| 293.20 | 0.1774 | 0.8007 | 0.0023 | 0.0549 |
| 298.20 | 0.0299 | 0.9624 | 0.0008 | 0.0160 |
| 298.20 | 0.0558 | 0.9331 | 0.0013 | 0.0283 |
| 298.20 | 0.0862 | 0.8985 | 0.0015 | 0.0339 |
| 298.20 | 0.1140 | 0.8671 | 0.0018 | 0.0427 |
| 298.20 | 0.1445 | 0.8326 | 0.0021 | 0.0509 |
| 298.20 | 0.1583 | 0.8169 | 0.0023 | 0.0562 |
| 298.20 | 0.1685 | 0.8054 | 0.0023 | 0.0568 |
| 298.20 | 0.1768 | 0.7960 | 0.0026 | 0.0639 |
| 298.20 | 0.1777 | 0.7949 | 0.0027 | 0.0650 |
| 308.20 | 0.0241 | 0.9673 | 0.0013 | 0.0162 |
| 308.20 | 0.0397 | 0.9493 | 0.0016 | 0.0245 |
| 308.20 | 0.0710 | 0.9133 | 0.0020 | 0.0342 |
| 308.20 | 0.0906 | 0.8908 | 0.0023 | 0.0408 |
| 308.20 | 0.1101 | 0.8683 | 0.0025 | 0.0463 |
| 308.20 | 0.1242 | 0.8521 | 0.0027 | 0.0494 |
| 308.20 | 0.1461 | 0.8269 | 0.0028 | 0.0527 |
| 308.20 | 0.1658 | 0.8042 | 0.0030 | 0.0574 |
| 308.20 | 0.1751 | 0.7936 | 0.0033 | 0.0637 |
Mass fraction [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid mixture 1)
- Pressure, kPa = 81.5 (Liquid mixture 2)
| Fixed | Measured | ||
|---|---|---|---|
| Mass fraction of Phenol (2) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 2 | Mass fraction of Phenol (2) - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 |
| 0.0558 | 0.0110 | 0.0283 | 0.9703 |
| 0.0862 | 0.0151 | 0.0339 | 0.9646 |
| 0.1140 | 0.0188 | 0.0427 | 0.9554 |
| 0.1445 | 0.0228 | 0.0509 | 0.9469 |
| 0.1583 | 0.0246 | 0.0562 | 0.9414 |
| 0.1685 | 0.0260 | 0.0568 | 0.9408 |
| 0.1768 | 0.0271 | 0.0639 | 0.9335 |
| 0.1777 | 0.0272 | 0.0650 | 0.9323 |
Mass fraction of Phenol (2) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid mixture 1)
- Pressure, kPa = 81.5 (Liquid mixture 1)
| Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Phenol (2) - Liquid mixture 1 |
|---|---|
| 0.9996 | 0.0000 |
| 0.9890 | 0.0099 |
| 0.9784 | 0.0199 |
| 0.9682 | 0.0299 |
| 0.9578 | 0.0399 |
| 0.9475 | 0.0498 |
| 0.9370 | 0.0612 |
| 0.9268 | 0.0697 |
| 0.9167 | 0.0797 |
| 0.0009 | 0.0000 |
| 0.0029 | 0.0099 |
| 0.0045 | 0.0199 |
| 0.0075 | 0.0297 |
| 0.0091 | 0.0396 |
| 0.0104 | 0.0494 |
| 0.0134 | 0.0591 |
| 0.0161 | 0.0688 |
| 0.0192 | 0.0784 |
| 0.0163 | 0.0983 |
| 0.0180 | 0.1178 |
| 0.0215 | 0.1369 |
| 0.0242 | 0.1756 |
Mass fraction of Phenol (2) [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Phenol (2) - Liquid mixture 1 |
| 293.20 | 0.9998 | 0.0000 |
| 293.20 | 0.9892 | 0.0099 |
| 293.20 | 0.9790 | 0.0199 |
| 293.20 | 0.9686 | 0.0299 |
| 293.20 | 0.9580 | 0.0399 |
| 293.20 | 0.9477 | 0.0498 |
| 293.20 | 0.9371 | 0.0612 |
| 293.20 | 0.9270 | 0.0697 |
| 293.20 | 0.9168 | 0.0797 |
| 293.20 | 0.0006 | 0.0000 |
| 293.20 | 0.0017 | 0.0099 |
| 293.20 | 0.0035 | 0.0199 |
| 293.20 | 0.0045 | 0.0298 |
| 293.20 | 0.0063 | 0.0397 |
| 293.20 | 0.0081 | 0.0495 |
| 293.20 | 0.0095 | 0.0594 |
| 293.20 | 0.0104 | 0.0692 |
| 293.20 | 0.0116 | 0.0790 |
| 293.20 | 0.0128 | 0.0987 |
| 293.20 | 0.0143 | 0.1182 |
| 293.20 | 0.0167 | 0.1376 |
| 293.20 | 0.0215 | 0.1761 |
| 298.20 | 0.9996 | 0.0000 |
| 298.20 | 0.9890 | 0.0099 |
| 298.20 | 0.9784 | 0.0199 |
| 298.20 | 0.9682 | 0.0299 |
| 298.20 | 0.9578 | 0.0399 |
| 298.20 | 0.9475 | 0.0498 |
| 298.20 | 0.9370 | 0.0612 |
| 298.20 | 0.9268 | 0.0697 |
| 298.20 | 0.9167 | 0.0797 |
| 298.20 | 0.0009 | 0.0000 |
| 298.20 | 0.0029 | 0.0099 |
| 298.20 | 0.0045 | 0.0199 |
| 298.20 | 0.0075 | 0.0297 |
| 298.20 | 0.0091 | 0.0396 |
| 298.20 | 0.0104 | 0.0494 |
| 298.20 | 0.0134 | 0.0591 |
| 298.20 | 0.0161 | 0.0688 |
| 298.20 | 0.0192 | 0.0784 |
| 298.20 | 0.0163 | 0.0983 |
| 298.20 | 0.0180 | 0.1178 |
| 298.20 | 0.0215 | 0.1369 |
| 298.20 | 0.0242 | 0.1756 |
| 308.20 | 0.9994 | 0.0000 |
| 308.20 | 0.9886 | 0.0099 |
| 308.20 | 0.9782 | 0.0199 |
| 308.20 | 0.9678 | 0.0299 |
| 308.20 | 0.9577 | 0.0399 |
| 308.20 | 0.9471 | 0.0498 |
| 308.20 | 0.9368 | 0.0611 |
| 308.20 | 0.9262 | 0.0697 |
| 308.20 | 0.9161 | 0.0796 |
| 308.20 | 0.0011 | 0.0000 |
| 308.20 | 0.0047 | 0.0099 |
| 308.20 | 0.0061 | 0.0198 |
| 308.20 | 0.0089 | 0.0297 |
| 308.20 | 0.0100 | 0.0395 |
| 308.20 | 0.0122 | 0.0493 |
| 308.20 | 0.0157 | 0.0590 |
| 308.20 | 0.0198 | 0.0686 |
| 308.20 | 0.0230 | 0.0976 |
| 308.20 | 0.0242 | 0.1170 |
| 308.20 | 0.0249 | 0.1365 |
| 308.20 | 0.0268 | 0.1751 |
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 2 | Mass fraction of Phenol (2) - Liquid mixture 1 | Mass fraction of Benzene, (1-methylethyl)- (1) - Liquid mixture 1 | Mass fraction of Benzene, (1-methylethyl)- (1) - Liquid mixture 2 | Mass fraction of Phenol (2) - Liquid mixture 2 |
| 293.20 | 0.0342 | 0.9598 | 0.0009 | 0.0191 |
| 293.20 | 0.0516 | 0.9405 | 0.0011 | 0.0251 |
| 293.20 | 0.0826 | 0.9061 | 0.0014 | 0.0324 |
| 293.20 | 0.1194 | 0.8652 | 0.0017 | 0.0403 |
| 293.20 | 0.1474 | 0.8340 | 0.0018 | 0.0438 |
| 293.20 | 0.1581 | 0.8222 | 0.0019 | 0.0463 |
| 293.20 | 0.1610 | 0.8190 | 0.0020 | 0.0492 |
| 293.20 | 0.1652 | 0.8142 | 0.0022 | 0.0528 |
| 293.20 | 0.1774 | 0.8007 | 0.0023 | 0.0549 |
| 298.20 | 0.0299 | 0.9624 | 0.0008 | 0.0160 |
| 298.20 | 0.0558 | 0.9331 | 0.0013 | 0.0283 |
| 298.20 | 0.0862 | 0.8985 | 0.0015 | 0.0339 |
| 298.20 | 0.1140 | 0.8671 | 0.0018 | 0.0427 |
| 298.20 | 0.1445 | 0.8326 | 0.0021 | 0.0509 |
| 298.20 | 0.1583 | 0.8169 | 0.0023 | 0.0562 |
| 298.20 | 0.1685 | 0.8054 | 0.0023 | 0.0568 |
| 298.20 | 0.1768 | 0.7960 | 0.0026 | 0.0639 |
| 298.20 | 0.1777 | 0.7949 | 0.0027 | 0.0650 |
| 308.20 | 0.0241 | 0.9673 | 0.0013 | 0.0162 |
| 308.20 | 0.0397 | 0.9493 | 0.0016 | 0.0245 |
| 308.20 | 0.0710 | 0.9133 | 0.0020 | 0.0342 |
| 308.20 | 0.0906 | 0.8908 | 0.0023 | 0.0408 |
| 308.20 | 0.1101 | 0.8683 | 0.0025 | 0.0463 |
| 308.20 | 0.1242 | 0.8521 | 0.0027 | 0.0494 |
| 308.20 | 0.1461 | 0.8269 | 0.0028 | 0.0527 |
| 308.20 | 0.1658 | 0.8042 | 0.0030 | 0.0574 |
| 308.20 | 0.1751 | 0.7936 | 0.0033 | 0.0637 |
Mass fraction [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid mixture 1)
- Pressure, kPa = 81.5 (Liquid mixture 2)
| Fixed | Measured | ||
|---|---|---|---|
| Mass fraction of Phenol (2) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 2 | Mass fraction of Phenol (2) - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 |
| 0.0558 | 0.0110 | 0.0283 | 0.9703 |
| 0.0862 | 0.0151 | 0.0339 | 0.9646 |
| 0.1140 | 0.0188 | 0.0427 | 0.9554 |
| 0.1445 | 0.0228 | 0.0509 | 0.9469 |
| 0.1583 | 0.0246 | 0.0562 | 0.9414 |
| 0.1685 | 0.0260 | 0.0568 | 0.9408 |
| 0.1768 | 0.0271 | 0.0639 | 0.9335 |
| 0.1777 | 0.0272 | 0.0650 | 0.9323 |
Mass fraction of Phenol (2) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid mixture 1)
- Pressure, kPa = 81.5 (Liquid mixture 1)
| Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Phenol (2) - Liquid mixture 1 |
|---|---|
| 0.9996 | 0.0000 |
| 0.9890 | 0.0099 |
| 0.9784 | 0.0199 |
| 0.9682 | 0.0299 |
| 0.9578 | 0.0399 |
| 0.9475 | 0.0498 |
| 0.9370 | 0.0612 |
| 0.9268 | 0.0697 |
| 0.9167 | 0.0797 |
| 0.0009 | 0.0000 |
| 0.0029 | 0.0099 |
| 0.0045 | 0.0199 |
| 0.0075 | 0.0297 |
| 0.0091 | 0.0396 |
| 0.0104 | 0.0494 |
| 0.0134 | 0.0591 |
| 0.0161 | 0.0688 |
| 0.0192 | 0.0784 |
| 0.0163 | 0.0983 |
| 0.0180 | 0.1178 |
| 0.0215 | 0.1369 |
| 0.0242 | 0.1756 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Phenol (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.20 | 0.9998 | 0.0000 | 1.3335 |
| 293.20 | 0.9892 | 0.0099 | 1.335 |
| 293.20 | 0.9790 | 0.0199 | 1.3368 |
| 293.20 | 0.9686 | 0.0299 | 1.3391 |
| 293.20 | 0.9580 | 0.0399 | 1.3413 |
| 293.20 | 0.9477 | 0.0498 | 1.3431 |
| 293.20 | 0.9371 | 0.0612 | 1.345 |
| 293.20 | 0.9270 | 0.0697 | 1.3462 |
| 293.20 | 0.9168 | 0.0797 | 1.3475 |
| 293.20 | 0.0006 | 0.0000 | 1.4915 |
| 293.20 | 0.0017 | 0.0099 | 1.492 |
| 293.20 | 0.0035 | 0.0199 | 1.4925 |
| 293.20 | 0.0045 | 0.0298 | 1.493 |
| 293.20 | 0.0063 | 0.0397 | 1.4934 |
| 293.20 | 0.0081 | 0.0495 | 1.4936 |
| 293.20 | 0.0095 | 0.0594 | 1.4941 |
| 293.20 | 0.0104 | 0.0692 | 1.4946 |
| 293.20 | 0.0116 | 0.0790 | 1.4951 |
| 293.20 | 0.0128 | 0.0987 | 1.4966 |
| 293.20 | 0.0143 | 0.1182 | 1.4975 |
| 293.20 | 0.0167 | 0.1376 | 1.4986 |
| 293.20 | 0.0215 | 0.1761 | 1.5005 |
| 298.20 | 0.9996 | 0.0000 | 1.333 |
| 298.20 | 0.9890 | 0.0099 | 1.335 |
| 298.20 | 0.9784 | 0.0199 | 1.3367 |
| 298.20 | 0.9682 | 0.0299 | 1.339 |
| 298.20 | 0.9578 | 0.0399 | 1.3404 |
| 298.20 | 0.9475 | 0.0498 | 1.3424 |
| 298.20 | 0.9370 | 0.0612 | 1.3435 |
| 298.20 | 0.9268 | 0.0697 | 1.3452 |
| 298.20 | 0.9167 | 0.0797 | 1.3466 |
| 298.20 | 0.0009 | 0.0000 | 1.49 |
| 298.20 | 0.0029 | 0.0099 | 1.4911 |
| 298.20 | 0.0045 | 0.0199 | 1.4915 |
| 298.20 | 0.0075 | 0.0297 | 1.492 |
| 298.20 | 0.0091 | 0.0396 | 1.4925 |
| 298.20 | 0.0104 | 0.0494 | 1.493 |
| 298.20 | 0.0134 | 0.0591 | 1.4934 |
| 298.20 | 0.0161 | 0.0688 | 1.4943 |
| 298.20 | 0.0192 | 0.0784 | 1.4948 |
| 298.20 | 0.0163 | 0.0983 | 1.4954 |
| 298.20 | 0.0180 | 0.1178 | 1.4968 |
| 298.20 | 0.0215 | 0.1369 | 1.4974 |
| 298.20 | 0.0242 | 0.1756 | 1.4999 |
| 308.20 | 0.9994 | 0.0000 | 1.3319 |
| 308.20 | 0.9886 | 0.0099 | 1.3337 |
| 308.20 | 0.9782 | 0.0199 | 1.3352 |
| 308.20 | 0.9678 | 0.0299 | 1.337 |
| 308.20 | 0.9577 | 0.0399 | 1.3395 |
| 308.20 | 0.9471 | 0.0498 | 1.341 |
| 308.20 | 0.9368 | 0.0611 | 1.3428 |
| 308.20 | 0.9262 | 0.0697 | 1.3441 |
| 308.20 | 0.9161 | 0.0796 | 1.346 |
| 308.20 | 0.0011 | 0.0000 | 1.4859 |
| 308.20 | 0.0047 | 0.0099 | 1.4864 |
| 308.20 | 0.0061 | 0.0198 | 1.4867 |
| 308.20 | 0.0089 | 0.0297 | 1.4871 |
| 308.20 | 0.0100 | 0.0395 | 1.4878 |
| 308.20 | 0.0122 | 0.0493 | 1.4884 |
| 308.20 | 0.0157 | 0.0590 | 1.4887 |
| 308.20 | 0.0198 | 0.0686 | 1.4894 |
| 308.20 | 0.0230 | 0.0976 | 1.492 |
| 308.20 | 0.0242 | 0.1170 | 1.4931 |
| 308.20 | 0.0249 | 0.1365 | 1.4941 |
| 308.20 | 0.0268 | 0.1751 | 1.4967 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid)
- Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Water (3) - Liquid | Mass fraction of Phenol (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 0.9996 | 0.0000 | 1.333 |
| 0.9890 | 0.0099 | 1.335 |
| 0.9784 | 0.0199 | 1.3367 |
| 0.9682 | 0.0299 | 1.339 |
| 0.9578 | 0.0399 | 1.3404 |
| 0.9475 | 0.0498 | 1.3424 |
| 0.9370 | 0.0612 | 1.3435 |
| 0.9268 | 0.0697 | 1.3452 |
| 0.9167 | 0.0797 | 1.3466 |
| 0.0009 | 0.0000 | 1.49 |
| 0.0029 | 0.0099 | 1.4911 |
| 0.0045 | 0.0199 | 1.4915 |
| 0.0075 | 0.0297 | 1.492 |
| 0.0091 | 0.0396 | 1.4925 |
| 0.0104 | 0.0494 | 1.493 |
| 0.0134 | 0.0591 | 1.4934 |
| 0.0161 | 0.0688 | 1.4943 |
| 0.0192 | 0.0784 | 1.4948 |
| 0.0163 | 0.0983 | 1.4954 |
| 0.0180 | 0.1178 | 1.4968 |
| 0.0215 | 0.1369 | 1.4974 |
| 0.0242 | 0.1756 | 1.4999 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Mass fraction = 0 (Liquid)
- Temperature, K = 298.2 (Liquid)
- Pressure, kPa = 81.5 (Liquid)
| Mass fraction of Water (3) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0016 | 1.4886 |
| 0.0010 | 1.4885 |
| 0.0008 | 1.4888 |
| 0.0010 | 1.4885 |
| 0.0008 | 1.4886 |
| 0.0006 | 1.4885 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid)
- Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Water (3) - Liquid | Mass fraction of Phenol (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 0.9703 | 0.0283 | 1.3386 |
| 0.9646 | 0.0339 | 1.3396 |
| 0.9554 | 0.0427 | 1.3411 |
| 0.9469 | 0.0509 | 1.3424 |
| 0.9414 | 0.0562 | 1.3434 |
| 0.9408 | 0.0568 | 1.3435 |
| 0.9335 | 0.0639 | 1.3446 |
| 0.9323 | 0.0650 | 1.3449 |
| 0.0110 | 0.0558 | 1.4933 |
| 0.0151 | 0.0862 | 1.495 |
| 0.0188 | 0.1140 | 1.4965 |
| 0.0228 | 0.1445 | 1.4982 |
| 0.0246 | 0.1583 | 1.4989 |
| 0.0260 | 0.1685 | 1.4994 |
| 0.0271 | 0.1768 | 1.4999 |
| 0.0272 | 0.1777 | 1.4999 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (3) - Liquid | Mass fraction of Phenol (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.20 | 0.9998 | 0.0000 | 1.3335 |
| 293.20 | 0.9892 | 0.0099 | 1.335 |
| 293.20 | 0.9790 | 0.0199 | 1.3368 |
| 293.20 | 0.9686 | 0.0299 | 1.3391 |
| 293.20 | 0.9580 | 0.0399 | 1.3413 |
| 293.20 | 0.9477 | 0.0498 | 1.3431 |
| 293.20 | 0.9371 | 0.0612 | 1.345 |
| 293.20 | 0.9270 | 0.0697 | 1.3462 |
| 293.20 | 0.9168 | 0.0797 | 1.3475 |
| 293.20 | 0.0006 | 0.0000 | 1.4915 |
| 293.20 | 0.0017 | 0.0099 | 1.492 |
| 293.20 | 0.0035 | 0.0199 | 1.4925 |
| 293.20 | 0.0045 | 0.0298 | 1.493 |
| 293.20 | 0.0063 | 0.0397 | 1.4934 |
| 293.20 | 0.0081 | 0.0495 | 1.4936 |
| 293.20 | 0.0095 | 0.0594 | 1.4941 |
| 293.20 | 0.0104 | 0.0692 | 1.4946 |
| 293.20 | 0.0116 | 0.0790 | 1.4951 |
| 293.20 | 0.0128 | 0.0987 | 1.4966 |
| 293.20 | 0.0143 | 0.1182 | 1.4975 |
| 293.20 | 0.0167 | 0.1376 | 1.4986 |
| 293.20 | 0.0215 | 0.1761 | 1.5005 |
| 298.20 | 0.9996 | 0.0000 | 1.333 |
| 298.20 | 0.9890 | 0.0099 | 1.335 |
| 298.20 | 0.9784 | 0.0199 | 1.3367 |
| 298.20 | 0.9682 | 0.0299 | 1.339 |
| 298.20 | 0.9578 | 0.0399 | 1.3404 |
| 298.20 | 0.9475 | 0.0498 | 1.3424 |
| 298.20 | 0.9370 | 0.0612 | 1.3435 |
| 298.20 | 0.9268 | 0.0697 | 1.3452 |
| 298.20 | 0.9167 | 0.0797 | 1.3466 |
| 298.20 | 0.0009 | 0.0000 | 1.49 |
| 298.20 | 0.0029 | 0.0099 | 1.4911 |
| 298.20 | 0.0045 | 0.0199 | 1.4915 |
| 298.20 | 0.0075 | 0.0297 | 1.492 |
| 298.20 | 0.0091 | 0.0396 | 1.4925 |
| 298.20 | 0.0104 | 0.0494 | 1.493 |
| 298.20 | 0.0134 | 0.0591 | 1.4934 |
| 298.20 | 0.0161 | 0.0688 | 1.4943 |
| 298.20 | 0.0192 | 0.0784 | 1.4948 |
| 298.20 | 0.0163 | 0.0983 | 1.4954 |
| 298.20 | 0.0180 | 0.1178 | 1.4968 |
| 298.20 | 0.0215 | 0.1369 | 1.4974 |
| 298.20 | 0.0242 | 0.1756 | 1.4999 |
| 308.20 | 0.9994 | 0.0000 | 1.3319 |
| 308.20 | 0.9886 | 0.0099 | 1.3337 |
| 308.20 | 0.9782 | 0.0199 | 1.3352 |
| 308.20 | 0.9678 | 0.0299 | 1.337 |
| 308.20 | 0.9577 | 0.0399 | 1.3395 |
| 308.20 | 0.9471 | 0.0498 | 1.341 |
| 308.20 | 0.9368 | 0.0611 | 1.3428 |
| 308.20 | 0.9262 | 0.0697 | 1.3441 |
| 308.20 | 0.9161 | 0.0796 | 1.346 |
| 308.20 | 0.0011 | 0.0000 | 1.4859 |
| 308.20 | 0.0047 | 0.0099 | 1.4864 |
| 308.20 | 0.0061 | 0.0198 | 1.4867 |
| 308.20 | 0.0089 | 0.0297 | 1.4871 |
| 308.20 | 0.0100 | 0.0395 | 1.4878 |
| 308.20 | 0.0122 | 0.0493 | 1.4884 |
| 308.20 | 0.0157 | 0.0590 | 1.4887 |
| 308.20 | 0.0198 | 0.0686 | 1.4894 |
| 308.20 | 0.0230 | 0.0976 | 1.492 |
| 308.20 | 0.0242 | 0.1170 | 1.4931 |
| 308.20 | 0.0249 | 0.1365 | 1.4941 |
| 308.20 | 0.0268 | 0.1751 | 1.4967 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid)
- Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Water (3) - Liquid | Mass fraction of Phenol (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 0.9996 | 0.0000 | 1.333 |
| 0.9890 | 0.0099 | 1.335 |
| 0.9784 | 0.0199 | 1.3367 |
| 0.9682 | 0.0299 | 1.339 |
| 0.9578 | 0.0399 | 1.3404 |
| 0.9475 | 0.0498 | 1.3424 |
| 0.9370 | 0.0612 | 1.3435 |
| 0.9268 | 0.0697 | 1.3452 |
| 0.9167 | 0.0797 | 1.3466 |
| 0.0009 | 0.0000 | 1.49 |
| 0.0029 | 0.0099 | 1.4911 |
| 0.0045 | 0.0199 | 1.4915 |
| 0.0075 | 0.0297 | 1.492 |
| 0.0091 | 0.0396 | 1.4925 |
| 0.0104 | 0.0494 | 1.493 |
| 0.0134 | 0.0591 | 1.4934 |
| 0.0161 | 0.0688 | 1.4943 |
| 0.0192 | 0.0784 | 1.4948 |
| 0.0163 | 0.0983 | 1.4954 |
| 0.0180 | 0.1178 | 1.4968 |
| 0.0215 | 0.1369 | 1.4974 |
| 0.0242 | 0.1756 | 1.4999 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Mass fraction = 0 (Liquid)
- Temperature, K = 298.2 (Liquid)
- Pressure, kPa = 81.5 (Liquid)
| Mass fraction of Water (3) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0016 | 1.4886 |
| 0.0010 | 1.4885 |
| 0.0008 | 1.4888 |
| 0.0010 | 1.4885 |
| 0.0008 | 1.4886 |
| 0.0006 | 1.4885 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid)
- Pressure, kPa = 81.5 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Water (3) - Liquid | Mass fraction of Phenol (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 0.9703 | 0.0283 | 1.3386 |
| 0.9646 | 0.0339 | 1.3396 |
| 0.9554 | 0.0427 | 1.3411 |
| 0.9469 | 0.0509 | 1.3424 |
| 0.9414 | 0.0562 | 1.3434 |
| 0.9408 | 0.0568 | 1.3435 |
| 0.9335 | 0.0639 | 1.3446 |
| 0.9323 | 0.0650 | 1.3449 |
| 0.0110 | 0.0558 | 1.4933 |
| 0.0151 | 0.0862 | 1.495 |
| 0.0188 | 0.1140 | 1.4965 |
| 0.0228 | 0.1445 | 1.4982 |
| 0.0246 | 0.1583 | 1.4989 |
| 0.0260 | 0.1685 | 1.4994 |
| 0.0271 | 0.1768 | 1.4999 |
| 0.0272 | 0.1777 | 1.4999 |