- Name
- Butanedioic acid
- InChI
- InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8)
- InChI Key
- KDYFGRWQOYBRFD-UHFFFAOYSA-N
- Formula
- C4H6O4
- SMILES
- O=C(O)CCC(=O)O
- Mol. Weight (g/mol)
- 118.09
- CAS
- 110-15-6
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Datasets
- Mole fraction (8)
- ρl - Mass density, kg/m3 (4)
- γ - Surface tension liquid-gas, N/m (4)
- Tfus - Solid-liquid equilibrium temperature, K (2)
Mole fraction of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Butanedioic acid (1) - Liquid |
|---|---|
| 283.65 | 0.0066 |
| 289.00 | 0.0084 |
| 293.75 | 0.0104 |
| 298.25 | 0.0126 |
| 303.15 | 0.0156 |
| 308.06 | 0.0187 |
| 312.85 | 0.0228 |
| 317.77 | 0.0277 |
| 322.55 | 0.0338 |
| 327.45 | 0.0406 |
| 333.15 | 0.0481 |
| 337.50 | 0.0590 |
| 342.25 | 0.0689 |
Mass ratio of solute to solvent of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent of Butanedioic acid (1) - Liquid |
|---|---|
| 303.20 | 0.1047 |
| 313.20 | 0.1655 |
| 323.20 | 0.2444 |
| 333.20 | 0.3412 |
Mass fraction of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass fraction of Butanedioic acid (1) - Liquid |
|---|---|
| 298.15 | 0.0783 |
| 303.15 | 0.0914 |
| 308.15 | 0.1170 |
Mole fraction of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Butanedioic acid (1) - Liquid |
|---|---|
| 283.15 | 0.0065 |
| 288.25 | 0.0088 |
| 292.65 | 0.0098 |
| 298.05 | 0.0131 |
| 302.05 | 0.0147 |
| 302.05 | 0.0147 |
| 308.45 | 0.0196 |
| 308.45 | 0.0196 |
| 311.95 | 0.0223 |
| 319.15 | 0.0294 |
| 322.75 | 0.0360 |
| 328.15 | 0.0409 |
Mole fraction of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Butanedioic acid (1) - Liquid |
|---|---|
| 283.65 | 0.0066 |
| 289.00 | 0.0084 |
| 293.75 | 0.0104 |
| 298.25 | 0.0126 |
| 303.15 | 0.0156 |
| 308.06 | 0.0187 |
| 312.85 | 0.0228 |
| 317.77 | 0.0277 |
| 322.55 | 0.0338 |
| 327.45 | 0.0406 |
| 333.15 | 0.0481 |
| 337.50 | 0.0590 |
| 342.25 | 0.0689 |
Mass ratio of solute to solvent of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent of Butanedioic acid (1) - Liquid |
|---|---|
| 303.20 | 0.1047 |
| 313.20 | 0.1655 |
| 323.20 | 0.2444 |
| 333.20 | 0.3412 |
Mass fraction of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass fraction of Butanedioic acid (1) - Liquid |
|---|---|
| 298.15 | 0.0783 |
| 303.15 | 0.0914 |
| 308.15 | 0.1170 |
Mole fraction of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Butanedioic acid (1) - Liquid |
|---|---|
| 283.15 | 0.0065 |
| 288.25 | 0.0088 |
| 292.65 | 0.0098 |
| 298.05 | 0.0131 |
| 302.05 | 0.0147 |
| 302.05 | 0.0147 |
| 308.45 | 0.0196 |
| 308.45 | 0.0196 |
| 311.95 | 0.0223 |
| 319.15 | 0.0294 |
| 322.75 | 0.0360 |
| 328.15 | 0.0409 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298 (Liquid)
- Pressure, kPa = 100 (Liquid)
| Mole fraction of Butanedioic acid (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0011 | 991.0 |
| 0.0012 | 997.0 |
| 0.0022 | 993.0 |
| 0.0022 | 1003.0 |
| 0.0028 | 996.0 |
| 0.0033 | 997.0 |
| 0.0037 | 1001.0 |
| 0.0045 | 998.0 |
| 0.0047 | 1002.0 |
| 0.0056 | 1001.0 |
| 0.0067 | 1002.0 |
| 0.0068 | 1008.0 |
| 0.0078 | 1005.0 |
| 0.0089 | 1007.0 |
| 0.0100 | 1009.0 |
| 0.0110 | 1010.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 298.15 | 1027.4 |
| 303.15 | 1032.5 |
| 308.15 | 1042.5 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298 (Liquid)
- Pressure, kPa = 100 (Liquid)
| Mole fraction of Butanedioic acid (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0011 | 991.0 |
| 0.0012 | 997.0 |
| 0.0022 | 993.0 |
| 0.0022 | 1003.0 |
| 0.0028 | 996.0 |
| 0.0033 | 997.0 |
| 0.0037 | 1001.0 |
| 0.0045 | 998.0 |
| 0.0047 | 1002.0 |
| 0.0056 | 1001.0 |
| 0.0067 | 1002.0 |
| 0.0068 | 1008.0 |
| 0.0078 | 1005.0 |
| 0.0089 | 1007.0 |
| 0.0100 | 1009.0 |
| 0.0110 | 1010.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 298.15 | 1027.4 |
| 303.15 | 1032.5 |
| 308.15 | 1042.5 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Temperature, K = 298 (Liquid)
| Mole fraction of Butanedioic acid (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 0.0011 | 0.0709 |
| 0.0022 | 0.0700 |
| 0.0028 | 0.0698 |
| 0.0033 | 0.0694 |
| 0.0045 | 0.0689 |
| 0.0056 | 0.0685 |
| 0.0067 | 0.0681 |
| 0.0071 | 0.0677 |
| 0.0078 | 0.0676 |
| 0.0089 | 0.0673 |
| 0.0100 | 0.0666 |
| 0.0107 | 0.0669 |
| 0.0111 | 0.0664 |
| 0.0117 | 0.0667 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Mole fraction = 0.00716 (Liquid)
| Temperature, K - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 279.90 | 0.0700 |
| 280.10 | 0.0692 |
| 280.20 | 0.0703 |
| 280.60 | 0.0700 |
| 284.00 | 0.0690 |
| 284.30 | 0.0697 |
| 284.70 | 0.0693 |
| 284.80 | 0.0695 |
| 285.00 | 0.0696 |
| 288.40 | 0.0686 |
| 288.90 | 0.0690 |
| 288.90 | 0.0690 |
| 288.90 | 0.0688 |
| 288.90 | 0.0687 |
| 292.60 | 0.0678 |
| 293.10 | 0.0685 |
| 293.30 | 0.0682 |
| 293.40 | 0.0682 |
| 293.60 | 0.0684 |
| 296.80 | 0.0672 |
| 297.40 | 0.0677 |
| 297.60 | 0.0680 |
| 297.80 | 0.0678 |
| 297.80 | 0.0678 |
| 297.90 | 0.0678 |
| 301.70 | 0.0675 |
| 301.80 | 0.0671 |
| 302.30 | 0.0673 |
| 302.90 | 0.0671 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Temperature, K = 298 (Liquid)
| Mole fraction of Butanedioic acid (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 0.0011 | 0.0709 |
| 0.0022 | 0.0700 |
| 0.0028 | 0.0698 |
| 0.0033 | 0.0694 |
| 0.0045 | 0.0689 |
| 0.0056 | 0.0685 |
| 0.0067 | 0.0681 |
| 0.0071 | 0.0677 |
| 0.0078 | 0.0676 |
| 0.0089 | 0.0673 |
| 0.0100 | 0.0666 |
| 0.0107 | 0.0669 |
| 0.0111 | 0.0664 |
| 0.0117 | 0.0667 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Mole fraction = 0.00716 (Liquid)
| Temperature, K - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 279.90 | 0.0700 |
| 280.10 | 0.0692 |
| 280.20 | 0.0703 |
| 280.60 | 0.0700 |
| 284.00 | 0.0690 |
| 284.30 | 0.0697 |
| 284.70 | 0.0693 |
| 284.80 | 0.0695 |
| 285.00 | 0.0696 |
| 288.40 | 0.0686 |
| 288.90 | 0.0690 |
| 288.90 | 0.0690 |
| 288.90 | 0.0688 |
| 288.90 | 0.0687 |
| 292.60 | 0.0678 |
| 293.10 | 0.0685 |
| 293.30 | 0.0682 |
| 293.40 | 0.0682 |
| 293.60 | 0.0684 |
| 296.80 | 0.0672 |
| 297.40 | 0.0677 |
| 297.60 | 0.0680 |
| 297.80 | 0.0678 |
| 297.80 | 0.0678 |
| 297.90 | 0.0678 |
| 301.70 | 0.0675 |
| 301.80 | 0.0671 |
| 302.30 | 0.0673 |
| 302.90 | 0.0671 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Butanedioic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0091 | 295.95 |
| 0.0106 | 299.85 |
| 0.0129 | 305.45 |
| 0.0155 | 310.05 |
| 0.0185 | 315.35 |
| 0.0218 | 319.45 |
| 0.0260 | 324.65 |
| 0.0300 | 328.75 |
| 0.0336 | 331.95 |
| 0.0392 | 336.85 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Butanedioic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0091 | 295.95 |
| 0.0106 | 299.85 |
| 0.0129 | 305.45 |
| 0.0155 | 310.05 |
| 0.0185 | 315.35 |
| 0.0218 | 319.45 |
| 0.0260 | 324.65 |
| 0.0300 | 328.75 |
| 0.0336 | 331.95 |
| 0.0392 | 336.85 |
Sources
- Solubility of succinic acid, glutaric acid and adipic acid in propionic acid + epsilon-caprolactone + water mixtures: Experimental measurement and thermodynamic modeling
- Synthesis and Solubility of 5,5-Dimethyl-2-(phenyl(phenylamino)methyl)-1,3,2-dioxaphosphinane 2-oxide in Selected Solvents between 278.15 K and 347.15 K
- Surface Tensions and Densities of Oxalic, Malonic, Succinic, Maleic, Malic, and cis-Pinonic Acids
- Solubilities of Succinic Acid in Acetic Acid + Water Mixtures and Acetic Acid + Cyclohexane Mixtures
- Solid Liquid Equilibrium and Phase Diagram for the Ternary Succinic Acid + Glutaric Acid + Water System
- Solubility of Butanedioic Acid in Different Solvents at Temperatures between 283 K and 333 K