- Name
- 1-Hexene
- InChI
- InChI=1S/C6H12/c1-3-5-6-4-2/h3H,1,4-6H2,2H3
- InChI Key
- LIKMAJRDDDTEIG-UHFFFAOYSA-N
- Formula
- C6H12
- SMILES
- C=CCCCC
- Mol. Weight (g/mol)
- 84.16
- CAS
- 592-41-6
- Name
- Isopropyl Alcohol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.09
- CAS
- 67-63-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Pvap - Vapor or sublimation pressure, kPa (2)
- Vapor Liquid Equilibrium at Constant Pressure
- Vapor Liquid Equilibrium at Constant Temperature
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1-Hexene (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 293.18 | 0.0000 | 4.20 |
| 293.18 | 0.0558 | 9.40 |
| 293.18 | 0.1018 | 12.30 |
| 293.18 | 0.1490 | 14.50 |
| 293.18 | 0.2011 | 16.30 |
| 293.18 | 0.2551 | 17.60 |
| 293.18 | 0.3029 | 18.40 |
| 293.18 | 0.3542 | 19.10 |
| 293.18 | 0.4000 | 19.60 |
| 293.18 | 0.4499 | 20.10 |
| 293.18 | 0.4998 | 20.30 |
| 293.18 | 0.5521 | 20.60 |
| 293.18 | 0.5999 | 20.80 |
| 293.18 | 0.6488 | 21.00 |
| 293.18 | 0.7008 | 21.10 |
| 293.18 | 0.7421 | 21.20 |
| 293.18 | 0.8025 | 21.40 |
| 293.18 | 0.8525 | 21.50 |
| 293.18 | 0.9044 | 21.50 |
| 293.18 | 0.9319 | 21.40 |
| 293.18 | 1.0000 | 20.00 |
| 303.16 | 0.0000 | 7.90 |
| 303.16 | 0.0563 | 15.50 |
| 303.16 | 0.1007 | 19.70 |
| 303.16 | 0.1563 | 23.40 |
| 303.16 | 0.2025 | 25.70 |
| 303.16 | 0.2536 | 27.50 |
| 303.16 | 0.3014 | 28.80 |
| 303.16 | 0.3541 | 29.80 |
| 303.16 | 0.4021 | 30.60 |
| 303.17 | 0.4519 | 31.50 |
| 303.16 | 0.5006 | 31.70 |
| 303.17 | 0.5495 | 32.10 |
| 303.17 | 0.5976 | 32.40 |
| 303.17 | 0.6504 | 32.70 |
| 303.17 | 0.7020 | 32.90 |
| 303.17 | 0.7490 | 33.10 |
| 303.17 | 0.7966 | 33.20 |
| 303.17 | 0.8489 | 33.30 |
| 303.17 | 0.9004 | 33.30 |
| 303.17 | 0.9460 | 33.00 |
| 303.17 | 1.0000 | 30.60 |
| 313.16 | 0.0000 | 14.00 |
| 313.16 | 0.0481 | 23.40 |
| 313.16 | 0.1044 | 30.90 |
| 313.16 | 0.1551 | 35.70 |
| 313.16 | 0.1952 | 38.50 |
| 313.16 | 0.2503 | 41.40 |
| 313.16 | 0.3044 | 43.50 |
| 313.16 | 0.3537 | 44.90 |
| 313.16 | 0.4034 | 46.00 |
| 313.16 | 0.4507 | 46.90 |
| 313.16 | 0.4681 | 47.20 |
| 313.16 | 0.5040 | 47.70 |
| 313.16 | 0.5512 | 48.20 |
| 313.16 | 0.5999 | 48.70 |
| 313.16 | 0.6539 | 49.20 |
| 313.16 | 0.6963 | 49.50 |
| 313.16 | 0.7463 | 49.70 |
| 313.16 | 0.7952 | 49.90 |
| 313.16 | 0.8505 | 50.00 |
| 313.16 | 0.8964 | 49.80 |
| 313.16 | 0.9517 | 49.10 |
| 313.16 | 1.0000 | 45.10 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1-Hexene (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 293.18 | 0.0000 | 4.20 |
| 293.18 | 0.0558 | 9.40 |
| 293.18 | 0.1018 | 12.30 |
| 293.18 | 0.1490 | 14.50 |
| 293.18 | 0.2011 | 16.30 |
| 293.18 | 0.2551 | 17.60 |
| 293.18 | 0.3029 | 18.40 |
| 293.18 | 0.3542 | 19.10 |
| 293.18 | 0.4000 | 19.60 |
| 293.18 | 0.4499 | 20.10 |
| 293.18 | 0.4998 | 20.30 |
| 293.18 | 0.5521 | 20.60 |
| 293.18 | 0.5999 | 20.80 |
| 293.18 | 0.6488 | 21.00 |
| 293.18 | 0.7008 | 21.10 |
| 293.18 | 0.7421 | 21.20 |
| 293.18 | 0.8025 | 21.40 |
| 293.18 | 0.8525 | 21.50 |
| 293.18 | 0.9044 | 21.50 |
| 293.18 | 0.9319 | 21.40 |
| 293.18 | 1.0000 | 20.00 |
| 303.16 | 0.0000 | 7.90 |
| 303.16 | 0.0563 | 15.50 |
| 303.16 | 0.1007 | 19.70 |
| 303.16 | 0.1563 | 23.40 |
| 303.16 | 0.2025 | 25.70 |
| 303.16 | 0.2536 | 27.50 |
| 303.16 | 0.3014 | 28.80 |
| 303.16 | 0.3541 | 29.80 |
| 303.16 | 0.4021 | 30.60 |
| 303.17 | 0.4519 | 31.50 |
| 303.16 | 0.5006 | 31.70 |
| 303.17 | 0.5495 | 32.10 |
| 303.17 | 0.5976 | 32.40 |
| 303.17 | 0.6504 | 32.70 |
| 303.17 | 0.7020 | 32.90 |
| 303.17 | 0.7490 | 33.10 |
| 303.17 | 0.7966 | 33.20 |
| 303.17 | 0.8489 | 33.30 |
| 303.17 | 0.9004 | 33.30 |
| 303.17 | 0.9460 | 33.00 |
| 303.17 | 1.0000 | 30.60 |
| 313.16 | 0.0000 | 14.00 |
| 313.16 | 0.0481 | 23.40 |
| 313.16 | 0.1044 | 30.90 |
| 313.16 | 0.1551 | 35.70 |
| 313.16 | 0.1952 | 38.50 |
| 313.16 | 0.2503 | 41.40 |
| 313.16 | 0.3044 | 43.50 |
| 313.16 | 0.3537 | 44.90 |
| 313.16 | 0.4034 | 46.00 |
| 313.16 | 0.4507 | 46.90 |
| 313.16 | 0.4681 | 47.20 |
| 313.16 | 0.5040 | 47.70 |
| 313.16 | 0.5512 | 48.20 |
| 313.16 | 0.5999 | 48.70 |
| 313.16 | 0.6539 | 49.20 |
| 313.16 | 0.6963 | 49.50 |
| 313.16 | 0.7463 | 49.70 |
| 313.16 | 0.7952 | 49.90 |
| 313.16 | 0.8505 | 50.00 |
| 313.16 | 0.8964 | 49.80 |
| 313.16 | 0.9517 | 49.10 |
| 313.16 | 1.0000 | 45.10 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 101.3 (VLE)
| Fixed | Measured | |
|---|---|---|
| T [K] - VLE | x1[mol/mol] of 1-Hexene (1) - Liquid | y1[mol/mol] of 1-Hexene (1) - Vapour |
| 355.51 | 0.0000 | 0.0000 |
| 350.95 | 0.0240 | 0.1260 |
| 345.7 | 0.0770 | 0.3210 |
| 344.39 | 0.0920 | 0.3640 |
| 343.92 | 0.1050 | 0.3780 |
| 339.71 | 0.1820 | 0.5130 |
| 338.32 | 0.2090 | 0.5490 |
| 337.09 | 0.2610 | 0.5780 |
| 335.71 | 0.3100 | 0.6190 |
| 335.0 | 0.3610 | 0.6430 |
| 334.41 | 0.4100 | 0.6670 |
| 333.96 | 0.4450 | 0.6890 |
| 333.28 | 0.5060 | 0.6910 |
| 332.76 | 0.5940 | 0.7270 |
| 332.56 | 0.6530 | 0.7480 |
| 332.53 | 0.6570 | 0.7370 |
| 332.51 | 0.7460 | 0.7690 |
| 332.38 | 0.7520 | 0.7750 |
| 331.77 | 0.7760 | 0.7850 |
| 331.58 | 0.7980 | 0.7930 |
| 332.44 | 0.8390 | 0.8150 |
| 332.49 | 0.8730 | 0.8430 |
| 336.65 | 1.0000 | 1.0000 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 328.15 (VLE)
| x1[mol/mol] of 1-Hexene (1) - Liquid | y1[mol/mol] of 1-Hexene (1) - Vapour |
|---|---|
| 0.1000 | 0.5130 |
| 0.2010 | 0.6070 |
| 0.3430 | 0.6600 |
| 0.4000 | 0.6730 |
| 0.5980 | 0.7440 |
| 0.8000 | 0.8170 |
| 0.9000 | 0.8660 |