- Name
- Benzoic acid
- InChI
- InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)
- InChI Key
- WPYMKLBDIGXBTP-UHFFFAOYSA-N
- Formula
- C7H6O2
- SMILES
- O=C(O)c1ccccc1
- Mol. Weight (g/mol)
- 122.12
- CAS
- 65-85-0
- Name
- Isopropyl Alcohol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.09
- CAS
- 67-63-0
Datasets
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 278.06 | 0.1286 |
| 282.96 | 0.1429 |
| 288.15 | 0.1595 |
| 293.11 | 0.1738 |
| 297.79 | 0.1922 |
| 303.45 | 0.2146 |
| 308.09 | 0.2321 |
| 312.80 | 0.2525 |
| 317.85 | 0.2780 |
| 322.78 | 0.2959 |
| 328.20 | 0.3251 |
| 333.20 | 0.3465 |
| 338.15 | 0.3735 |
| 343.10 | 0.4107 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 94.47 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 288.15 | 0.1600 |
| 293.15 | 0.1740 |
| 298.15 | 0.1930 |
| 303.15 | 0.2160 |
| 308.15 | 0.2380 |
| 313.15 | 0.2650 |
| 318.15 | 0.2900 |
| 323.15 | 0.3130 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 288.15 | 0.1490 |
| 293.15 | 0.1680 |
| 298.15 | 0.1820 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 278.06 | 0.1295 |
| 288.15 | 0.1578 |
| 293.11 | 0.1729 |
| 303.45 | 0.2148 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 278.06 | 0.1286 |
| 282.96 | 0.1429 |
| 288.15 | 0.1595 |
| 293.11 | 0.1738 |
| 297.79 | 0.1922 |
| 303.45 | 0.2146 |
| 308.09 | 0.2321 |
| 312.80 | 0.2525 |
| 317.85 | 0.2780 |
| 322.78 | 0.2959 |
| 328.20 | 0.3251 |
| 333.20 | 0.3465 |
| 338.15 | 0.3735 |
| 343.10 | 0.4107 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 94.47 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 288.15 | 0.1600 |
| 293.15 | 0.1740 |
| 298.15 | 0.1930 |
| 303.15 | 0.2160 |
| 308.15 | 0.2380 |
| 313.15 | 0.2650 |
| 318.15 | 0.2900 |
| 323.15 | 0.3130 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 288.15 | 0.1490 |
| 293.15 | 0.1680 |
| 298.15 | 0.1820 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 278.06 | 0.1295 |
| 288.15 | 0.1578 |
| 293.11 | 0.1729 |
| 303.45 | 0.2148 |
Sources
- Solubility of benzoic acid in acetone, 2-propanol, acetic acid and cyclohexane: Experimental measurement and thermodynamic modeling
- Solubility Measurement and Thermodynamic Modeling of Benzoic Acid in Monosolvents and Binary Mixtures
- Measurement and Correlation of the Solubility of Tetramethylpyrazine in Nine Monosolvents and Two Binary Solvent Systems
- Solubility, Model Correlation, and Solvent Effect of 2-Amino-3-methylbenzoic Acid in 12 Pure Solvents