- Name
- 1-Propanol
- InChI
- InChI=1S/C3H8O/c1-2-3-4/h4H,2-3H2,1H3
- InChI Key
- BDERNNFJNOPAEC-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CCCO
- Mol. Weight (g/mol)
- 60.09
- CAS
- 71-23-8
- Name
- Dodecanoic acid
- InChI
- InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)
- InChI Key
- POULHZVOKOAJMA-UHFFFAOYSA-N
- Formula
- C12H24O2
- SMILES
- CCCCCCCCCCCC(=O)O
- Mol. Weight (g/mol)
- 200.32
- CAS
- 143-07-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Activity coefficient of 1-Propanol (1) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of 1-Propanol (1) - Liquid |
|---|---|
| 314.10 | 1.758 |
| 314.24 | 1.784 |
| 333.26 | 1.566 |
| 333.38 | 1.605 |
| 353.25 | 1.426 |
| 353.30 | 1.432 |
Activity coefficient of 1-Propanol (1) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of 1-Propanol (1) - Liquid |
|---|---|
| 314.10 | 1.758 |
| 314.24 | 1.784 |
| 333.26 | 1.566 |
| 333.38 | 1.605 |
| 353.25 | 1.426 |
| 353.30 | 1.432 |
Mole fraction of Dodecanoic acid (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Dodecanoic acid (2) - Liquid |
|---|---|
| 276.17 | 0.0540 |
| 279.16 | 0.0685 |
| 282.16 | 0.0859 |
| 285.15 | 0.1083 |
| 288.15 | 0.1352 |
| 291.14 | 0.1685 |
| 294.14 | 0.2103 |
| 297.13 | 0.2611 |
| 300.13 | 0.3189 |
| 303.12 | 0.3992 |
| 306.12 | 0.4882 |
Mole fraction of Dodecanoic acid (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Dodecanoic acid (2) - Liquid |
|---|---|
| 287.10 | 0.1298 |
| 289.60 | 0.1533 |
| 292.80 | 0.1920 |
| 295.10 | 0.2254 |
| 297.90 | 0.2747 |
| 299.90 | 0.3175 |
| 301.50 | 0.3527 |
| 303.50 | 0.4057 |
| 304.70 | 0.4403 |
| 306.50 | 0.5088 |
| 307.40 | 0.5406 |
| 308.70 | 0.5969 |
| 309.90 | 0.6444 |
| 310.70 | 0.6903 |
| 312.10 | 0.7491 |
| 313.40 | 0.8178 |
| 314.20 | 0.8730 |
Mole fraction of Dodecanoic acid (2) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Dodecanoic acid (2) - Liquid |
|---|---|
| 276.17 | 0.0540 |
| 279.16 | 0.0685 |
| 282.16 | 0.0859 |
| 285.15 | 0.1083 |
| 288.15 | 0.1352 |
| 291.14 | 0.1685 |
| 294.14 | 0.2103 |
| 297.13 | 0.2611 |
| 300.13 | 0.3189 |
| 303.12 | 0.3992 |
| 306.12 | 0.4882 |
Mole fraction of Dodecanoic acid (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Dodecanoic acid (2) - Liquid |
|---|---|
| 287.10 | 0.1298 |
| 289.60 | 0.1533 |
| 292.80 | 0.1920 |
| 295.10 | 0.2254 |
| 297.90 | 0.2747 |
| 299.90 | 0.3175 |
| 301.50 | 0.3527 |
| 303.50 | 0.4057 |
| 304.70 | 0.4403 |
| 306.50 | 0.5088 |
| 307.40 | 0.5406 |
| 308.70 | 0.5969 |
| 309.90 | 0.6444 |
| 310.70 | 0.6903 |
| 312.10 | 0.7491 |
| 313.40 | 0.8178 |
| 314.20 | 0.8730 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Mole fraction of Dodecanoic acid (2) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.1299 | 284.96 |
| 0.2256 | 293.48 |
| 0.3172 | 298.68 |
| 0.4070 | 302.61 |
| 0.5276 | 306.97 |
| 0.5973 | 308.84 |
| 0.6950 | 311.20 |
| 0.7492 | 312.65 |
| 0.8724 | 315.61 |
| 1.0000 | 317.71 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Mole fraction of Dodecanoic acid (2) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.1299 | 284.96 |
| 0.2256 | 293.48 |
| 0.3172 | 298.68 |
| 0.4070 | 302.61 |
| 0.5276 | 306.97 |
| 0.5973 | 308.84 |
| 0.6950 | 311.20 |
| 0.7492 | 312.65 |
| 0.8724 | 315.61 |
| 1.0000 | 317.71 |
Sources
- Activity coefficient at infinite dilution measurements for organic solutes (polar and non-polar) in fatty compounds: Saturated fatty acids
- Solubility Measurement of Lauric, Palmitic, and Stearic Acids in Ethanol, n-Propanol, and 2-Propanol Using Differential Scanning Calorimetry
- Determination and Correlation of Solubilities of Lauric Acid in Eight Alcohols
- Solubilities of Lauric Acid in n-Hexane, Acetone, Propanol, 2-Propanol, 1-Bromopropane, and Trichloroethylene from (279.0 to 315.3) K