- Name
- Hexanedioic acid
- InChI
- InChI=1S/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H,7,8)(H,9,10)
- InChI Key
- WNLRTRBMVRJNCN-UHFFFAOYSA-N
- Formula
- C6H10O4
- SMILES
- O=C(O)CCCCC(=O)O
- Mol. Weight (g/mol)
- 146.14
- CAS
- 124-04-9
- Name
- Acetic acid
- InChI
- InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
- InChI Key
- QTBSBXVTEAMEQO-UHFFFAOYSA-N
- Formula
- C2H4O2
- SMILES
- CC(=O)O
- Mol. Weight (g/mol)
- 60.05
- CAS
- 64-19-7
Datasets
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 303.00 | 0.0260 |
| 313.00 | 0.0370 |
| 323.00 | 0.0590 |
| 333.00 | 0.0850 |
| 343.00 | 0.1160 |
| 353.00 | 0.1470 |
| 363.00 | 0.2070 |
| 373.00 | 0.2630 |
| 383.00 | 0.3220 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 288.15 | 0.0156 |
| 293.15 | 0.0192 |
| 298.15 | 0.0229 |
| 303.15 | 0.0267 |
| 308.15 | 0.0324 |
| 315.15 | 0.0391 |
| 318.15 | 0.0462 |
| 323.15 | 0.0545 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 301.85 | 0.0238 |
| 306.25 | 0.0278 |
| 308.85 | 0.0315 |
| 312.35 | 0.0364 |
| 315.85 | 0.0419 |
| 319.75 | 0.0480 |
| 322.95 | 0.0549 |
| 328.55 | 0.0672 |
| 333.55 | 0.0804 |
| 338.25 | 0.0958 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 301.85 | 0.0230 |
| 305.25 | 0.0265 |
| 308.85 | 0.0300 |
| 311.45 | 0.0331 |
| 314.65 | 0.0379 |
| 318.15 | 0.0426 |
| 321.05 | 0.0479 |
| 325.65 | 0.0563 |
| 330.55 | 0.0663 |
| 334.05 | 0.0760 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 302.15 | 0.0242 |
| 306.75 | 0.0283 |
| 311.95 | 0.0340 |
| 315.34 | 0.0393 |
| 320.03 | 0.0463 |
| 324.13 | 0.0520 |
Mass fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 303.20 | 0.0580 |
| 313.20 | 0.0841 |
| 323.20 | 0.1189 |
| 333.20 | 0.1710 |
| 343.20 | 0.2301 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 303.00 | 0.0260 |
| 313.00 | 0.0370 |
| 323.00 | 0.0590 |
| 333.00 | 0.0850 |
| 343.00 | 0.1160 |
| 353.00 | 0.1470 |
| 363.00 | 0.2070 |
| 373.00 | 0.2630 |
| 383.00 | 0.3220 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 288.15 | 0.0156 |
| 293.15 | 0.0192 |
| 298.15 | 0.0229 |
| 303.15 | 0.0267 |
| 308.15 | 0.0324 |
| 315.15 | 0.0391 |
| 318.15 | 0.0462 |
| 323.15 | 0.0545 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 301.85 | 0.0238 |
| 306.25 | 0.0278 |
| 308.85 | 0.0315 |
| 312.35 | 0.0364 |
| 315.85 | 0.0419 |
| 319.75 | 0.0480 |
| 322.95 | 0.0549 |
| 328.55 | 0.0672 |
| 333.55 | 0.0804 |
| 338.25 | 0.0958 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 301.85 | 0.0230 |
| 305.25 | 0.0265 |
| 308.85 | 0.0300 |
| 311.45 | 0.0331 |
| 314.65 | 0.0379 |
| 318.15 | 0.0426 |
| 321.05 | 0.0479 |
| 325.65 | 0.0563 |
| 330.55 | 0.0663 |
| 334.05 | 0.0760 |
Mole fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 302.15 | 0.0242 |
| 306.75 | 0.0283 |
| 311.95 | 0.0340 |
| 315.34 | 0.0393 |
| 320.03 | 0.0463 |
| 324.13 | 0.0520 |
Mass fraction of Hexanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass fraction of Hexanedioic acid (1) - Liquid |
|---|---|
| 303.20 | 0.0580 |
| 313.20 | 0.0841 |
| 323.20 | 0.1189 |
| 333.20 | 0.1710 |
| 343.20 | 0.2301 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Hexanedioic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0256 | 302.35 |
| 0.0311 | 307.15 |
| 0.0349 | 311.25 |
| 0.0415 | 315.35 |
| 0.0476 | 319.25 |
| 0.0508 | 323.65 |
| 0.0660 | 328.45 |
| 0.0781 | 333.15 |
| 0.0929 | 337.85 |
| 0.1099 | 342.75 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Hexanedioic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0241 | 301.75 |
| 0.0276 | 305.55 |
| 0.0342 | 311.45 |
| 0.0382 | 314.65 |
| 0.0428 | 318.15 |
| 0.0474 | 321.05 |
| 0.0562 | 325.65 |
| 0.0677 | 330.55 |
| 0.0763 | 334.05 |
| 0.0923 | 340.05 |
| 0.0315 | 308.85 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Hexanedioic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0256 | 302.35 |
| 0.0311 | 307.15 |
| 0.0349 | 311.25 |
| 0.0415 | 315.35 |
| 0.0476 | 319.25 |
| 0.0508 | 323.65 |
| 0.0660 | 328.45 |
| 0.0781 | 333.15 |
| 0.0929 | 337.85 |
| 0.1099 | 342.75 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mole fraction of Hexanedioic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0241 | 301.75 |
| 0.0276 | 305.55 |
| 0.0342 | 311.45 |
| 0.0382 | 314.65 |
| 0.0428 | 318.15 |
| 0.0474 | 321.05 |
| 0.0562 | 325.65 |
| 0.0677 | 330.55 |
| 0.0763 | 334.05 |
| 0.0923 | 340.05 |
| 0.0315 | 308.85 |
Sources
- Measurement on the solubility of adipic acid in various solvents at high temperature and its thermodynamics parameters.
- An odd-even effect on solubility of dicarboxylic acids in organic solvents
- Solubility of succinic acid, glutaric acid and adipic acid in propionic acid + epsilon-caprolactone + water mixtures: Experimental measurement and thermodynamic modeling
- Measurement and Correlation for Solubilities of Adipic Acid in Acetic Acid + e-Caprolactone Mixtures and Cyclohexanone + e-Caprolactone Mixtures
- Measurement and Correlation for Solubilities of Adipic Acid, Glutaric Acid and Succinic Acid in Acetic Acid + Cyclohexanone Mixtures
- Measurement and Correlation for the Solubility of Adipic Acid and Succinic Acid in Glutaric Acid + Cyclohexanone and Glutaric Acid + Acetic Acid Mixtures
- Determination and Thermodynamic Modeling of Solid-Liquid Phase Equilibrium for Succinic Acid in the Glutaric Acid + Adipic Acid + Ethyl Acetate Mixture and Adipic Acid in the Succinic Acid + Glutaric Acid + Ethyl Acetate Mixture
- Solubilities of Adipic Acid in Acetic Acid + Water Mixtures and Acetic Acid + Cyclohexane Mixtures