- Name
- 2H-Pyran-2-one, tetrahydro-6-methyl-
- InChI
- InChI=1S/C6H10O2/c1-5-3-2-4-6(7)8-5/h5H,2-4H2,1H3
- InChI Key
- RZTOWFMDBDPERY-UHFFFAOYSA-N
- Formula
- C6H10O2
- SMILES
- CC1CCCC(=O)O1
- Mol. Weight (g/mol)
- 114.14
- CAS
- 823-22-3
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2H-Pyran-2-one, tetrahydro-6-methyl- (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 288.15 | 0.0049 | -0.0407 |
| 288.15 | 0.0041 | -0.0342 |
| 288.15 | 0.0033 | -0.0276 |
| 288.15 | 0.0033 | -0.0279 |
| 288.15 | 0.0026 | -0.0224 |
| 288.15 | 0.0025 | -0.0211 |
| 288.15 | 0.0021 | -0.0183 |
| 288.15 | 0.0017 | -0.0143 |
| 298.15 | 0.0050 | -0.0327 |
| 298.15 | 0.0050 | -0.0329 |
| 298.15 | 0.0049 | -0.0331 |
| 298.15 | 0.0041 | -0.0278 |
| 298.15 | 0.0041 | -0.0280 |
| 298.15 | 0.0041 | -0.0277 |
| 298.15 | 0.0033 | -0.0224 |
| 298.15 | 0.0033 | -0.0226 |
| 298.15 | 0.0033 | -0.0223 |
| 298.15 | 0.0026 | -0.0180 |
| 298.15 | 0.0021 | -0.0147 |
| 298.15 | 0.0017 | -0.0114 |
| 298.15 | 0.0012 | -0.0081 |
| 308.15 | 0.0050 | -0.0252 |
| 308.15 | 0.0050 | -0.0252 |
| 308.15 | 0.0041 | -0.0212 |
| 308.15 | 0.0041 | -0.0214 |
| 308.15 | 0.0033 | -0.0171 |
| 308.15 | 0.0033 | -0.0174 |
| 308.15 | 0.0025 | -0.0132 |
| 308.15 | 0.0017 | -0.0091 |
| 318.15 | 0.0049 | -0.0180 |
| 318.15 | 0.0050 | -0.0181 |
| 318.15 | 0.0041 | -0.0151 |
| 318.15 | 0.0041 | -0.0152 |
| 318.15 | 0.0033 | -0.0121 |
| 318.15 | 0.0033 | -0.0123 |
| 318.15 | 0.0025 | -0.0092 |
| 318.15 | 0.0025 | -0.0092 |
| 318.15 | 0.0017 | -0.0062 |
| 318.15 | 0.0017 | -0.0062 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2H-Pyran-2-one, tetrahydro-6-methyl- (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 288.15 | 0.0049 | -0.0407 |
| 288.15 | 0.0041 | -0.0342 |
| 288.15 | 0.0033 | -0.0276 |
| 288.15 | 0.0033 | -0.0279 |
| 288.15 | 0.0026 | -0.0224 |
| 288.15 | 0.0025 | -0.0211 |
| 288.15 | 0.0021 | -0.0183 |
| 288.15 | 0.0017 | -0.0143 |
| 298.15 | 0.0050 | -0.0327 |
| 298.15 | 0.0050 | -0.0329 |
| 298.15 | 0.0049 | -0.0331 |
| 298.15 | 0.0041 | -0.0278 |
| 298.15 | 0.0041 | -0.0280 |
| 298.15 | 0.0041 | -0.0277 |
| 298.15 | 0.0033 | -0.0224 |
| 298.15 | 0.0033 | -0.0226 |
| 298.15 | 0.0033 | -0.0223 |
| 298.15 | 0.0026 | -0.0180 |
| 298.15 | 0.0021 | -0.0147 |
| 298.15 | 0.0017 | -0.0114 |
| 298.15 | 0.0012 | -0.0081 |
| 308.15 | 0.0050 | -0.0252 |
| 308.15 | 0.0050 | -0.0252 |
| 308.15 | 0.0041 | -0.0212 |
| 308.15 | 0.0041 | -0.0214 |
| 308.15 | 0.0033 | -0.0171 |
| 308.15 | 0.0033 | -0.0174 |
| 308.15 | 0.0025 | -0.0132 |
| 308.15 | 0.0017 | -0.0091 |
| 318.15 | 0.0049 | -0.0180 |
| 318.15 | 0.0050 | -0.0181 |
| 318.15 | 0.0041 | -0.0151 |
| 318.15 | 0.0041 | -0.0152 |
| 318.15 | 0.0033 | -0.0121 |
| 318.15 | 0.0033 | -0.0123 |
| 318.15 | 0.0025 | -0.0092 |
| 318.15 | 0.0025 | -0.0092 |
| 318.15 | 0.0017 | -0.0062 |
| 318.15 | 0.0017 | -0.0062 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2H-Pyran-2-one, tetrahydro-6-methyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0049 | 1001.545 |
| 288.15 | 0.0041 | 1001.148 |
| 288.15 | 0.0033 | 1000.736 |
| 288.15 | 0.0033 | 1000.76 |
| 288.15 | 0.0026 | 1000.418 |
| 288.15 | 0.0025 | 1000.351 |
| 288.15 | 0.0021 | 1000.175 |
| 288.15 | 0.0017 | 999.935 |
| 298.15 | 0.0050 | 999.206 |
| 298.15 | 0.0050 | 999.209 |
| 298.15 | 0.0049 | 999.23 |
| 298.15 | 0.0041 | 998.861 |
| 298.15 | 0.0041 | 998.875 |
| 298.15 | 0.0041 | 998.876 |
| 298.15 | 0.0033 | 998.507 |
| 298.15 | 0.0033 | 998.52 |
| 298.15 | 0.0033 | 998.509 |
| 298.15 | 0.0026 | 998.225 |
| 298.15 | 0.0021 | 998.009 |
| 298.15 | 0.0017 | 997.788 |
| 298.15 | 0.0012 | 997.57 |
| 308.15 | 0.0050 | 996.02 |
| 308.15 | 0.0050 | 995.986 |
| 308.15 | 0.0041 | 995.714 |
| 308.15 | 0.0041 | 995.684 |
| 308.15 | 0.0033 | 995.379 |
| 308.15 | 0.0033 | 995.363 |
| 308.15 | 0.0025 | 995.04 |
| 308.15 | 0.0017 | 994.712 |
| 318.15 | 0.0049 | 992.021 |
| 318.15 | 0.0050 | 992.018 |
| 318.15 | 0.0041 | 991.726 |
| 318.15 | 0.0041 | 991.723 |
| 318.15 | 0.0033 | 991.433 |
| 318.15 | 0.0033 | 991.423 |
| 318.15 | 0.0025 | 991.131 |
| 318.15 | 0.0025 | 991.124 |
| 318.15 | 0.0017 | 990.83 |
| 318.15 | 0.0017 | 990.824 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2H-Pyran-2-one, tetrahydro-6-methyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0049 | 1001.545 |
| 288.15 | 0.0041 | 1001.148 |
| 288.15 | 0.0033 | 1000.736 |
| 288.15 | 0.0033 | 1000.76 |
| 288.15 | 0.0026 | 1000.418 |
| 288.15 | 0.0025 | 1000.351 |
| 288.15 | 0.0021 | 1000.175 |
| 288.15 | 0.0017 | 999.935 |
| 298.15 | 0.0050 | 999.206 |
| 298.15 | 0.0050 | 999.209 |
| 298.15 | 0.0049 | 999.23 |
| 298.15 | 0.0041 | 998.861 |
| 298.15 | 0.0041 | 998.875 |
| 298.15 | 0.0041 | 998.876 |
| 298.15 | 0.0033 | 998.507 |
| 298.15 | 0.0033 | 998.52 |
| 298.15 | 0.0033 | 998.509 |
| 298.15 | 0.0026 | 998.225 |
| 298.15 | 0.0021 | 998.009 |
| 298.15 | 0.0017 | 997.788 |
| 298.15 | 0.0012 | 997.57 |
| 308.15 | 0.0050 | 996.02 |
| 308.15 | 0.0050 | 995.986 |
| 308.15 | 0.0041 | 995.714 |
| 308.15 | 0.0041 | 995.684 |
| 308.15 | 0.0033 | 995.379 |
| 308.15 | 0.0033 | 995.363 |
| 308.15 | 0.0025 | 995.04 |
| 308.15 | 0.0017 | 994.712 |
| 318.15 | 0.0049 | 992.021 |
| 318.15 | 0.0050 | 992.018 |
| 318.15 | 0.0041 | 991.726 |
| 318.15 | 0.0041 | 991.723 |
| 318.15 | 0.0033 | 991.433 |
| 318.15 | 0.0033 | 991.423 |
| 318.15 | 0.0025 | 991.131 |
| 318.15 | 0.0025 | 991.124 |
| 318.15 | 0.0017 | 990.83 |
| 318.15 | 0.0017 | 990.824 |