- Name
- Dodecane
- InChI
- InChI=1S/C12H26/c1-3-5-7-9-11-12-10-8-6-4-2/h3-12H2,1-2H3
- InChI Key
- SNRUBQQJIBEYMU-UHFFFAOYSA-N
- Formula
- C12H26
- SMILES
- CCCCCCCCCCCC
- Mol. Weight (g/mol)
- 170.33
- CAS
- 112-40-3
- Name
- Decanoic acid, methyl ester
- InChI
- InChI=1S/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3
- InChI Key
- YRHYCMZPEVDGFQ-UHFFFAOYSA-N
- Formula
- C11H22O2
- SMILES
- CCCCCCCCCC(=O)OC
- Mol. Weight (g/mol)
- 186.29
- CAS
- 110-42-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Excess molar enthalpy (molar enthalpy (2)
- ν - Kinematic viscosity, m2/s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (4)
- γ - Surface tension liquid-gas, N/m (2)
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 98.8 (Liquid)
| Mole fraction of Decanoic acid, methyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0000 | 0.0000 |
| 0.0512 | 0.1650 |
| 0.1129 | 0.3180 |
| 0.1513 | 0.4220 |
| 0.2021 | 0.4960 |
| 0.2513 | 0.5910 |
| 0.2990 | 0.6380 |
| 0.3572 | 0.6820 |
| 0.4051 | 0.7090 |
| 0.4473 | 0.7200 |
| 0.5033 | 0.7190 |
| 0.5502 | 0.7080 |
| 0.5952 | 0.6820 |
| 0.6520 | 0.6290 |
| 0.7089 | 0.5530 |
| 0.7524 | 0.4880 |
| 0.8098 | 0.3990 |
| 0.8525 | 0.3060 |
| 0.9019 | 0.2030 |
| 0.9586 | 0.0820 |
| 1.0000 | 0.0000 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 98.8 (Liquid)
| Mole fraction of Decanoic acid, methyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0000 | 0.0000 |
| 0.0512 | 0.1650 |
| 0.1129 | 0.3180 |
| 0.1513 | 0.4220 |
| 0.2021 | 0.4960 |
| 0.2513 | 0.5910 |
| 0.2990 | 0.6380 |
| 0.3572 | 0.6820 |
| 0.4051 | 0.7090 |
| 0.4473 | 0.7200 |
| 0.5033 | 0.7190 |
| 0.5502 | 0.7080 |
| 0.5952 | 0.6820 |
| 0.6520 | 0.6290 |
| 0.7089 | 0.5530 |
| 0.7524 | 0.4880 |
| 0.8098 | 0.3990 |
| 0.8525 | 0.3060 |
| 0.9019 | 0.2030 |
| 0.9586 | 0.0820 |
| 1.0000 | 0.0000 |
Kinematic viscosity, m2/s [ref]
Operational condition: Pressure, kPa = 92 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Decanoic acid, methyl ester (2) - Liquid | Kinematic viscosity, m2/s - Liquid |
| 308.11 | 0.2501 | 1.5129e-06 |
| 323.11 | 0.2501 | 1.2497e-06 |
| 338.11 | 0.2501 | 1.0635e-06 |
| 353.12 | 0.2501 | 9.0480e-07 |
| 368.12 | 0.2501 | 7.7490e-07 |
| 383.10 | 0.2501 | 6.7260e-07 |
| 398.10 | 0.2501 | 5.9500e-07 |
| 413.09 | 0.2501 | 5.3010e-07 |
| 308.11 | 0.5004 | 1.5860e-06 |
| 323.10 | 0.5004 | 1.3138e-06 |
| 338.09 | 0.5004 | 1.0875e-06 |
| 353.10 | 0.5004 | 9.2420e-07 |
| 368.11 | 0.5004 | 7.9870e-07 |
| 383.10 | 0.5004 | 6.9550e-07 |
| 398.09 | 0.5004 | 6.1190e-07 |
| 413.07 | 0.5004 | 5.3480e-07 |
| 308.13 | 0.7501 | 1.6270e-06 |
| 323.13 | 0.7501 | 1.3794e-06 |
| 338.14 | 0.7501 | 1.1776e-06 |
| 353.16 | 0.7501 | 9.9640e-07 |
| 368.16 | 0.7501 | 8.5880e-07 |
| 383.16 | 0.7501 | 7.3800e-07 |
| 398.15 | 0.7501 | 6.4990e-07 |
| 413.15 | 0.7501 | 5.6840e-07 |
Kinematic viscosity, m2/s [ref]
Operational condition: Pressure, kPa = 92 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Decanoic acid, methyl ester (2) - Liquid | Kinematic viscosity, m2/s - Liquid |
| 308.11 | 0.2501 | 1.5129e-06 |
| 323.11 | 0.2501 | 1.2497e-06 |
| 338.11 | 0.2501 | 1.0635e-06 |
| 353.12 | 0.2501 | 9.0480e-07 |
| 368.12 | 0.2501 | 7.7490e-07 |
| 383.10 | 0.2501 | 6.7260e-07 |
| 398.10 | 0.2501 | 5.9500e-07 |
| 413.09 | 0.2501 | 5.3010e-07 |
| 308.11 | 0.5004 | 1.5860e-06 |
| 323.10 | 0.5004 | 1.3138e-06 |
| 338.09 | 0.5004 | 1.0875e-06 |
| 353.10 | 0.5004 | 9.2420e-07 |
| 368.11 | 0.5004 | 7.9870e-07 |
| 383.10 | 0.5004 | 6.9550e-07 |
| 398.09 | 0.5004 | 6.1190e-07 |
| 413.07 | 0.5004 | 5.3480e-07 |
| 308.13 | 0.7501 | 1.6270e-06 |
| 323.13 | 0.7501 | 1.3794e-06 |
| 338.14 | 0.7501 | 1.1776e-06 |
| 353.16 | 0.7501 | 9.9640e-07 |
| 368.16 | 0.7501 | 8.5880e-07 |
| 383.16 | 0.7501 | 7.3800e-07 |
| 398.15 | 0.7501 | 6.4990e-07 |
| 413.15 | 0.7501 | 5.6840e-07 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 92 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Decanoic acid, methyl ester (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 278.15 | 0.2501 | 1.4294 |
| 283.15 | 0.2501 | 1.4272 |
| 288.15 | 0.2501 | 1.425 |
| 293.15 | 0.2501 | 1.4228 |
| 298.15 | 0.2501 | 1.4206 |
| 303.15 | 0.2501 | 1.4184 |
| 308.15 | 0.2501 | 1.4162 |
| 313.15 | 0.2501 | 1.4139 |
| 318.15 | 0.2501 | 1.4117 |
| 323.15 | 0.2501 | 1.4095 |
| 328.15 | 0.2501 | 1.4072 |
| 333.15 | 0.2501 | 1.405 |
| 338.15 | 0.2501 | 1.4028 |
| 343.15 | 0.2501 | 1.4005 |
| 348.15 | 0.2501 | 1.3983 |
| 353.15 | 0.2501 | 1.3962 |
| 358.15 | 0.2501 | 1.394 |
| 278.15 | 0.5004 | 1.4301 |
| 283.15 | 0.5004 | 1.428 |
| 288.15 | 0.5004 | 1.4258 |
| 293.15 | 0.5004 | 1.4236 |
| 298.15 | 0.5004 | 1.4214 |
| 303.15 | 0.5004 | 1.4193 |
| 308.15 | 0.5004 | 1.417 |
| 313.15 | 0.5004 | 1.4148 |
| 318.15 | 0.5004 | 1.4126 |
| 323.15 | 0.5004 | 1.4104 |
| 328.15 | 0.5004 | 1.4082 |
| 333.15 | 0.5004 | 1.406 |
| 338.15 | 0.5004 | 1.4038 |
| 343.15 | 0.5004 | 1.4016 |
| 348.15 | 0.5004 | 1.3994 |
| 353.15 | 0.5004 | 1.3973 |
| 358.15 | 0.5004 | 1.3951 |
| 278.15 | 0.7501 | 1.4317 |
| 283.15 | 0.7501 | 1.4295 |
| 288.15 | 0.7501 | 1.4273 |
| 293.15 | 0.7501 | 1.4251 |
| 298.15 | 0.7501 | 1.423 |
| 303.15 | 0.7501 | 1.4208 |
| 308.15 | 0.7501 | 1.4185 |
| 313.15 | 0.7501 | 1.4163 |
| 318.15 | 0.7501 | 1.4141 |
| 323.15 | 0.7501 | 1.4119 |
| 328.15 | 0.7501 | 1.4097 |
| 333.15 | 0.7501 | 1.4075 |
| 338.15 | 0.7501 | 1.4053 |
| 343.15 | 0.7501 | 1.4031 |
| 348.15 | 0.7501 | 1.4009 |
| 353.15 | 0.7501 | 1.3987 |
| 358.15 | 0.7501 | 1.3966 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 92 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Decanoic acid, methyl ester (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 278.15 | 0.2501 | 1.4294 |
| 283.15 | 0.2501 | 1.4272 |
| 288.15 | 0.2501 | 1.425 |
| 293.15 | 0.2501 | 1.4228 |
| 298.15 | 0.2501 | 1.4206 |
| 303.15 | 0.2501 | 1.4184 |
| 308.15 | 0.2501 | 1.4162 |
| 313.15 | 0.2501 | 1.4139 |
| 318.15 | 0.2501 | 1.4117 |
| 323.15 | 0.2501 | 1.4095 |
| 328.15 | 0.2501 | 1.4072 |
| 333.15 | 0.2501 | 1.405 |
| 338.15 | 0.2501 | 1.4028 |
| 343.15 | 0.2501 | 1.4005 |
| 348.15 | 0.2501 | 1.3983 |
| 353.15 | 0.2501 | 1.3962 |
| 358.15 | 0.2501 | 1.394 |
| 278.15 | 0.5004 | 1.4301 |
| 283.15 | 0.5004 | 1.428 |
| 288.15 | 0.5004 | 1.4258 |
| 293.15 | 0.5004 | 1.4236 |
| 298.15 | 0.5004 | 1.4214 |
| 303.15 | 0.5004 | 1.4193 |
| 308.15 | 0.5004 | 1.417 |
| 313.15 | 0.5004 | 1.4148 |
| 318.15 | 0.5004 | 1.4126 |
| 323.15 | 0.5004 | 1.4104 |
| 328.15 | 0.5004 | 1.4082 |
| 333.15 | 0.5004 | 1.406 |
| 338.15 | 0.5004 | 1.4038 |
| 343.15 | 0.5004 | 1.4016 |
| 348.15 | 0.5004 | 1.3994 |
| 353.15 | 0.5004 | 1.3973 |
| 358.15 | 0.5004 | 1.3951 |
| 278.15 | 0.7501 | 1.4317 |
| 283.15 | 0.7501 | 1.4295 |
| 288.15 | 0.7501 | 1.4273 |
| 293.15 | 0.7501 | 1.4251 |
| 298.15 | 0.7501 | 1.423 |
| 303.15 | 0.7501 | 1.4208 |
| 308.15 | 0.7501 | 1.4185 |
| 313.15 | 0.7501 | 1.4163 |
| 318.15 | 0.7501 | 1.4141 |
| 323.15 | 0.7501 | 1.4119 |
| 328.15 | 0.7501 | 1.4097 |
| 333.15 | 0.7501 | 1.4075 |
| 338.15 | 0.7501 | 1.4053 |
| 343.15 | 0.7501 | 1.4031 |
| 348.15 | 0.7501 | 1.4009 |
| 353.15 | 0.7501 | 1.3987 |
| 358.15 | 0.7501 | 1.3966 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 98.8 (Liquid)
| Mole fraction of Decanoic acid, methyl ester (2) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 745.2 |
| 0.0500 | 750.68 |
| 0.1000 | 756.24 |
| 0.1503 | 761.93 |
| 0.1998 | 767.59 |
| 0.2500 | 773.38 |
| 0.3001 | 779.28 |
| 0.3506 | 785.27 |
| 0.3996 | 791.16 |
| 0.4497 | 797.22 |
| 0.5002 | 803.37 |
| 0.5500 | 809.54 |
| 0.5998 | 815.74 |
| 0.6499 | 822.04 |
| 0.6994 | 828.35 |
| 0.7495 | 834.79 |
| 0.7996 | 841.3 |
| 0.8493 | 847.78 |
| 0.8997 | 854.45 |
| 0.9496 | 861.18 |
| 1.0000 | 868.02 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 92 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Decanoic acid, methyl ester (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.2501 | 777.43 |
| 303.15 | 0.2501 | 768.91 |
| 313.15 | 0.2501 | 762.24 |
| 323.15 | 0.2501 | 754.69 |
| 333.15 | 0.2501 | 747.08 |
| 343.15 | 0.2501 | 739.5 |
| 353.15 | 0.2501 | 730.89 |
| 363.15 | 0.2501 | 724.23 |
| 373.15 | 0.2501 | 716.55 |
| 383.15 | 0.2501 | 708.81 |
| 393.15 | 0.2501 | 701.02 |
| 403.15 | 0.2501 | 693.17 |
| 413.15 | 0.2501 | 685.23 |
| 423.15 | 0.2501 | 677.24 |
| 293.15 | 0.5004 | 807.28 |
| 303.15 | 0.5004 | 799.42 |
| 313.15 | 0.5004 | 791.61 |
| 323.15 | 0.5004 | 783.79 |
| 333.15 | 0.5004 | 775.97 |
| 343.15 | 0.5004 | 767.21 |
| 353.15 | 0.5004 | 759.43 |
| 363.15 | 0.5004 | 752.43 |
| 373.15 | 0.5004 | 744.52 |
| 383.15 | 0.5004 | 736.57 |
| 393.15 | 0.5004 | 728.56 |
| 403.15 | 0.5004 | 720.49 |
| 413.15 | 0.5004 | 712.34 |
| 423.15 | 0.5004 | 704.1 |
| 293.15 | 0.7501 | 838.86 |
| 303.15 | 0.7501 | 830.78 |
| 313.15 | 0.7501 | 822.74 |
| 323.15 | 0.7501 | 814.69 |
| 333.15 | 0.7501 | 806.64 |
| 343.15 | 0.7501 | 798.6 |
| 353.15 | 0.7501 | 790.53 |
| 363.15 | 0.7501 | 782.44 |
| 373.15 | 0.7501 | 774.33 |
| 383.15 | 0.7501 | 766.16 |
| 393.15 | 0.7501 | 757.92 |
| 403.15 | 0.7501 | 749.68 |
| 413.15 | 0.7501 | 741.33 |
| 423.15 | 0.7501 | 732.9 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 98.8 (Liquid)
| Mole fraction of Decanoic acid, methyl ester (2) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 745.2 |
| 0.0500 | 750.68 |
| 0.1000 | 756.24 |
| 0.1503 | 761.93 |
| 0.1998 | 767.59 |
| 0.2500 | 773.38 |
| 0.3001 | 779.28 |
| 0.3506 | 785.27 |
| 0.3996 | 791.16 |
| 0.4497 | 797.22 |
| 0.5002 | 803.37 |
| 0.5500 | 809.54 |
| 0.5998 | 815.74 |
| 0.6499 | 822.04 |
| 0.6994 | 828.35 |
| 0.7495 | 834.79 |
| 0.7996 | 841.3 |
| 0.8493 | 847.78 |
| 0.8997 | 854.45 |
| 0.9496 | 861.18 |
| 1.0000 | 868.02 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 92 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Decanoic acid, methyl ester (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.2501 | 777.43 |
| 303.15 | 0.2501 | 768.91 |
| 313.15 | 0.2501 | 762.24 |
| 323.15 | 0.2501 | 754.69 |
| 333.15 | 0.2501 | 747.08 |
| 343.15 | 0.2501 | 739.5 |
| 353.15 | 0.2501 | 730.89 |
| 363.15 | 0.2501 | 724.23 |
| 373.15 | 0.2501 | 716.55 |
| 383.15 | 0.2501 | 708.81 |
| 393.15 | 0.2501 | 701.02 |
| 403.15 | 0.2501 | 693.17 |
| 413.15 | 0.2501 | 685.23 |
| 423.15 | 0.2501 | 677.24 |
| 293.15 | 0.5004 | 807.28 |
| 303.15 | 0.5004 | 799.42 |
| 313.15 | 0.5004 | 791.61 |
| 323.15 | 0.5004 | 783.79 |
| 333.15 | 0.5004 | 775.97 |
| 343.15 | 0.5004 | 767.21 |
| 353.15 | 0.5004 | 759.43 |
| 363.15 | 0.5004 | 752.43 |
| 373.15 | 0.5004 | 744.52 |
| 383.15 | 0.5004 | 736.57 |
| 393.15 | 0.5004 | 728.56 |
| 403.15 | 0.5004 | 720.49 |
| 413.15 | 0.5004 | 712.34 |
| 423.15 | 0.5004 | 704.1 |
| 293.15 | 0.7501 | 838.86 |
| 303.15 | 0.7501 | 830.78 |
| 313.15 | 0.7501 | 822.74 |
| 323.15 | 0.7501 | 814.69 |
| 333.15 | 0.7501 | 806.64 |
| 343.15 | 0.7501 | 798.6 |
| 353.15 | 0.7501 | 790.53 |
| 363.15 | 0.7501 | 782.44 |
| 373.15 | 0.7501 | 774.33 |
| 383.15 | 0.7501 | 766.16 |
| 393.15 | 0.7501 | 757.92 |
| 403.15 | 0.7501 | 749.68 |
| 413.15 | 0.7501 | 741.33 |
| 423.15 | 0.7501 | 732.9 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Decanoic acid, methyl ester (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 308.11 | 0.2501 | 0.0227 |
| 323.11 | 0.2501 | 0.0220 |
| 338.11 | 0.2501 | 0.0212 |
| 353.12 | 0.2501 | 0.0201 |
| 368.12 | 0.2501 | 0.0190 |
| 383.10 | 0.2501 | 0.0178 |
| 398.10 | 0.2501 | 0.0166 |
| 413.09 | 0.2501 | 0.0155 |
| 308.11 | 0.5004 | 0.0231 |
| 323.10 | 0.5004 | 0.0225 |
| 338.09 | 0.5004 | 0.0215 |
| 353.10 | 0.5004 | 0.0206 |
| 368.11 | 0.5004 | 0.0195 |
| 383.10 | 0.5004 | 0.0183 |
| 398.09 | 0.5004 | 0.0173 |
| 413.07 | 0.5004 | 0.0158 |
| 308.13 | 0.7501 | 0.0233 |
| 323.13 | 0.7501 | 0.0226 |
| 338.14 | 0.7501 | 0.0221 |
| 353.16 | 0.7501 | 0.0212 |
| 368.16 | 0.7501 | 0.0201 |
| 383.16 | 0.7501 | 0.0189 |
| 398.15 | 0.7501 | 0.0178 |
| 413.15 | 0.7501 | 0.0167 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Decanoic acid, methyl ester (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 308.11 | 0.2501 | 0.0227 |
| 323.11 | 0.2501 | 0.0220 |
| 338.11 | 0.2501 | 0.0212 |
| 353.12 | 0.2501 | 0.0201 |
| 368.12 | 0.2501 | 0.0190 |
| 383.10 | 0.2501 | 0.0178 |
| 398.10 | 0.2501 | 0.0166 |
| 413.09 | 0.2501 | 0.0155 |
| 308.11 | 0.5004 | 0.0231 |
| 323.10 | 0.5004 | 0.0225 |
| 338.09 | 0.5004 | 0.0215 |
| 353.10 | 0.5004 | 0.0206 |
| 368.11 | 0.5004 | 0.0195 |
| 383.10 | 0.5004 | 0.0183 |
| 398.09 | 0.5004 | 0.0173 |
| 413.07 | 0.5004 | 0.0158 |
| 308.13 | 0.7501 | 0.0233 |
| 323.13 | 0.7501 | 0.0226 |
| 338.14 | 0.7501 | 0.0221 |
| 353.16 | 0.7501 | 0.0212 |
| 368.16 | 0.7501 | 0.0201 |
| 383.16 | 0.7501 | 0.0189 |
| 398.15 | 0.7501 | 0.0178 |
| 413.15 | 0.7501 | 0.0167 |
Sources
- Measurement and Prediction of Excess Properties of Binary Mixtures Methyl Decanoate + an Even-Numbered n-Alkane (C6-C16) at 298.15 K
- Experimental Investigation of the Thermophysical Properties of the Bio-Aviation Fuel Surrogates: Binary and Ternary Mixtures of n-Dodecane, Methyl Butyrate, and Methyl Decanoate