- Name
- Isopropyl Alcohol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.09
- CAS
- 67-63-0
- Name
- Ethane, 1,1,2,2-tetrachloro-
- InChI
- InChI=1S/C2H2Cl4/c3-1(4)2(5)6/h1-2H
- InChI Key
- QPFMBZIOSGYJDE-UHFFFAOYSA-N
- Formula
- C2H2Cl4
- SMILES
- ClC(Cl)C(Cl)Cl
- Mol. Weight (g/mol)
- 167.85
- CAS
- 79-34-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Isopropyl Alcohol (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 1602.77 |
| 298.15 | 0.0000 | 1587.2 |
| 308.15 | 0.0000 | 1571.63 |
| 318.15 | 0.0000 | 1556.07 |
| 288.15 | 0.0500 | 1572.23 |
| 298.15 | 0.0500 | 1556.86 |
| 308.15 | 0.0500 | 1541.44 |
| 318.15 | 0.0500 | 1525.99 |
| 298.15 | 0.1500 | 1494.38 |
| 288.15 | 0.1500 | 1509.52 |
| 308.15 | 0.1500 | 1479.18 |
| 318.15 | 0.1500 | 1463.92 |
| 298.15 | 0.2500 | 1429.56 |
| 308.15 | 0.2500 | 1414.65 |
| 288.15 | 0.2500 | 1444.36 |
| 318.15 | 0.2500 | 1399.64 |
| 298.15 | 0.3500 | 1360.78 |
| 288.15 | 0.3500 | 1375.15 |
| 308.15 | 0.3500 | 1346.27 |
| 318.15 | 0.3500 | 1331.62 |
| 298.15 | 0.4500 | 1288.16 |
| 308.15 | 0.4500 | 1274.15 |
| 288.15 | 0.4500 | 1302.0 |
| 318.15 | 0.4500 | 1259.96 |
| 288.15 | 0.5000 | 1263.78 |
| 308.15 | 0.5000 | 1236.51 |
| 298.15 | 0.5000 | 1250.24 |
| 318.15 | 0.5000 | 1222.59 |
| 298.15 | 0.5500 | 1210.65 |
| 308.15 | 0.5500 | 1197.24 |
| 288.15 | 0.5500 | 1223.85 |
| 318.15 | 0.5500 | 1183.62 |
| 308.15 | 0.6500 | 1115.3 |
| 288.15 | 0.6500 | 1140.46 |
| 298.15 | 0.6500 | 1127.99 |
| 318.15 | 0.6500 | 1102.37 |
| 298.15 | 0.7500 | 1038.87 |
| 288.15 | 0.7500 | 1050.44 |
| 308.15 | 0.7500 | 1027.06 |
| 318.15 | 0.7500 | 1014.97 |
| 288.15 | 0.8500 | 953.06 |
| 298.15 | 0.8500 | 942.59 |
| 308.15 | 0.8500 | 931.84 |
| 318.15 | 0.8500 | 920.8 |
| 288.15 | 0.9500 | 846.57 |
| 298.15 | 0.9500 | 837.49 |
| 308.15 | 0.9500 | 828.12 |
| 318.15 | 0.9500 | 818.41 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Isopropyl Alcohol (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 1602.77 |
| 298.15 | 0.0000 | 1587.2 |
| 308.15 | 0.0000 | 1571.63 |
| 318.15 | 0.0000 | 1556.07 |
| 288.15 | 0.0500 | 1572.23 |
| 298.15 | 0.0500 | 1556.86 |
| 308.15 | 0.0500 | 1541.44 |
| 318.15 | 0.0500 | 1525.99 |
| 298.15 | 0.1500 | 1494.38 |
| 288.15 | 0.1500 | 1509.52 |
| 308.15 | 0.1500 | 1479.18 |
| 318.15 | 0.1500 | 1463.92 |
| 298.15 | 0.2500 | 1429.56 |
| 308.15 | 0.2500 | 1414.65 |
| 288.15 | 0.2500 | 1444.36 |
| 318.15 | 0.2500 | 1399.64 |
| 298.15 | 0.3500 | 1360.78 |
| 288.15 | 0.3500 | 1375.15 |
| 308.15 | 0.3500 | 1346.27 |
| 318.15 | 0.3500 | 1331.62 |
| 298.15 | 0.4500 | 1288.16 |
| 308.15 | 0.4500 | 1274.15 |
| 288.15 | 0.4500 | 1302.0 |
| 318.15 | 0.4500 | 1259.96 |
| 288.15 | 0.5000 | 1263.78 |
| 308.15 | 0.5000 | 1236.51 |
| 298.15 | 0.5000 | 1250.24 |
| 318.15 | 0.5000 | 1222.59 |
| 298.15 | 0.5500 | 1210.65 |
| 308.15 | 0.5500 | 1197.24 |
| 288.15 | 0.5500 | 1223.85 |
| 318.15 | 0.5500 | 1183.62 |
| 308.15 | 0.6500 | 1115.3 |
| 288.15 | 0.6500 | 1140.46 |
| 298.15 | 0.6500 | 1127.99 |
| 318.15 | 0.6500 | 1102.37 |
| 298.15 | 0.7500 | 1038.87 |
| 288.15 | 0.7500 | 1050.44 |
| 308.15 | 0.7500 | 1027.06 |
| 318.15 | 0.7500 | 1014.97 |
| 288.15 | 0.8500 | 953.06 |
| 298.15 | 0.8500 | 942.59 |
| 308.15 | 0.8500 | 931.84 |
| 318.15 | 0.8500 | 920.8 |
| 288.15 | 0.9500 | 846.57 |
| 298.15 | 0.9500 | 837.49 |
| 308.15 | 0.9500 | 828.12 |
| 318.15 | 0.9500 | 818.41 |