- Name
- Acetic acid, chloro-, ethyl ester
- InChI
- InChI=1S/C4H7ClO2/c1-2-7-4(6)3-5/h2-3H2,1H3
- InChI Key
- VEUUMBGHMNQHGO-UHFFFAOYSA-N
- Formula
- C4H7ClO2
- SMILES
- CCOC(=O)CCl
- Mol. Weight (g/mol)
- 122.55
- CAS
- 105-39-5
- Name
- Benzyl alcohol
- InChI
- InChI=1S/C7H8O/c8-6-7-4-2-1-3-5-7/h1-5,8H,6H2
- InChI Key
- WVDDGKGOMKODPV-UHFFFAOYSA-N
- Formula
- C7H8O
- SMILES
- OCc1ccccc1
- Mol. Weight (g/mol)
- 108.14
- CAS
- 100-51-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid, chloro-, ethyl ester (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0053 |
| 298.15 | 0.1072 | 0.0041 |
| 298.15 | 0.2035 | 0.0033 |
| 298.15 | 0.2998 | 0.0027 |
| 298.15 | 0.3950 | 0.0023 |
| 298.15 | 0.5000 | 0.0019 |
| 298.15 | 0.5984 | 0.0017 |
| 298.15 | 0.6981 | 0.0015 |
| 298.15 | 0.7972 | 0.0013 |
| 298.15 | 0.8941 | 0.0012 |
| 298.15 | 1.0000 | 0.0011 |
| 303.15 | 0.0000 | 0.0045 |
| 303.15 | 0.1072 | 0.0036 |
| 303.15 | 0.2035 | 0.0029 |
| 303.15 | 0.2998 | 0.0024 |
| 303.15 | 0.3950 | 0.0020 |
| 303.15 | 0.5000 | 0.0017 |
| 303.15 | 0.5984 | 0.0015 |
| 303.15 | 0.6981 | 0.0013 |
| 303.15 | 0.7972 | 0.0012 |
| 303.15 | 0.8941 | 0.0011 |
| 303.15 | 1.0000 | 0.0010 |
| 308.15 | 0.0000 | 0.0039 |
| 308.15 | 0.1072 | 0.0031 |
| 308.15 | 0.2035 | 0.0025 |
| 308.15 | 0.2998 | 0.0021 |
| 308.15 | 0.3950 | 0.0018 |
| 308.15 | 0.5000 | 0.0016 |
| 308.15 | 0.5984 | 0.0014 |
| 308.15 | 0.6981 | 0.0012 |
| 308.15 | 0.7972 | 0.0011 |
| 308.15 | 0.8941 | 0.0010 |
| 308.15 | 1.0000 | 0.0009 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid, chloro-, ethyl ester (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0053 |
| 298.15 | 0.1072 | 0.0041 |
| 298.15 | 0.2035 | 0.0033 |
| 298.15 | 0.2998 | 0.0027 |
| 298.15 | 0.3950 | 0.0023 |
| 298.15 | 0.5000 | 0.0019 |
| 298.15 | 0.5984 | 0.0017 |
| 298.15 | 0.6981 | 0.0015 |
| 298.15 | 0.7972 | 0.0013 |
| 298.15 | 0.8941 | 0.0012 |
| 298.15 | 1.0000 | 0.0011 |
| 303.15 | 0.0000 | 0.0045 |
| 303.15 | 0.1072 | 0.0036 |
| 303.15 | 0.2035 | 0.0029 |
| 303.15 | 0.2998 | 0.0024 |
| 303.15 | 0.3950 | 0.0020 |
| 303.15 | 0.5000 | 0.0017 |
| 303.15 | 0.5984 | 0.0015 |
| 303.15 | 0.6981 | 0.0013 |
| 303.15 | 0.7972 | 0.0012 |
| 303.15 | 0.8941 | 0.0011 |
| 303.15 | 1.0000 | 0.0010 |
| 308.15 | 0.0000 | 0.0039 |
| 308.15 | 0.1072 | 0.0031 |
| 308.15 | 0.2035 | 0.0025 |
| 308.15 | 0.2998 | 0.0021 |
| 308.15 | 0.3950 | 0.0018 |
| 308.15 | 0.5000 | 0.0016 |
| 308.15 | 0.5984 | 0.0014 |
| 308.15 | 0.6981 | 0.0012 |
| 308.15 | 0.7972 | 0.0011 |
| 308.15 | 0.8941 | 0.0010 |
| 308.15 | 1.0000 | 0.0009 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid, chloro-, ethyl ester (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5378 |
| 298.15 | 0.1072 | 1.5258 |
| 298.15 | 0.2035 | 1.5142 |
| 298.15 | 0.2998 | 1.503 |
| 298.15 | 0.3950 | 1.4918 |
| 298.15 | 0.5000 | 1.4794 |
| 298.15 | 0.5984 | 1.4675 |
| 298.15 | 0.6981 | 1.4556 |
| 298.15 | 0.7972 | 1.4437 |
| 298.15 | 0.8941 | 1.432 |
| 298.15 | 1.0000 | 1.42 |
| 303.15 | 0.0000 | 1.5354 |
| 303.15 | 0.1072 | 1.5233 |
| 303.15 | 0.2035 | 1.5114 |
| 303.15 | 0.2998 | 1.5 |
| 303.15 | 0.3950 | 1.489 |
| 303.15 | 0.5000 | 1.4765 |
| 303.15 | 0.6981 | 1.4528 |
| 303.15 | 0.7972 | 1.441 |
| 303.15 | 0.8941 | 1.4295 |
| 303.15 | 1.0000 | 1.4173 |
| 308.15 | 0.0000 | 1.5318 |
| 308.15 | 0.1072 | 1.5208 |
| 308.15 | 0.2035 | 1.5097 |
| 308.15 | 0.2998 | 1.4982 |
| 308.15 | 0.3950 | 1.4866 |
| 308.15 | 0.5000 | 1.4738 |
| 308.15 | 0.5984 | 1.462 |
| 308.15 | 0.6981 | 1.4501 |
| 308.15 | 0.7972 | 1.4384 |
| 308.15 | 0.8941 | 1.427 |
| 308.15 | 1.0000 | 1.4148 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid, chloro-, ethyl ester (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5378 |
| 298.15 | 0.1072 | 1.5258 |
| 298.15 | 0.2035 | 1.5142 |
| 298.15 | 0.2998 | 1.503 |
| 298.15 | 0.3950 | 1.4918 |
| 298.15 | 0.5000 | 1.4794 |
| 298.15 | 0.5984 | 1.4675 |
| 298.15 | 0.6981 | 1.4556 |
| 298.15 | 0.7972 | 1.4437 |
| 298.15 | 0.8941 | 1.432 |
| 298.15 | 1.0000 | 1.42 |
| 303.15 | 0.0000 | 1.5354 |
| 303.15 | 0.1072 | 1.5233 |
| 303.15 | 0.2035 | 1.5114 |
| 303.15 | 0.2998 | 1.5 |
| 303.15 | 0.3950 | 1.489 |
| 303.15 | 0.5000 | 1.4765 |
| 303.15 | 0.6981 | 1.4528 |
| 303.15 | 0.7972 | 1.441 |
| 303.15 | 0.8941 | 1.4295 |
| 303.15 | 1.0000 | 1.4173 |
| 308.15 | 0.0000 | 1.5318 |
| 308.15 | 0.1072 | 1.5208 |
| 308.15 | 0.2035 | 1.5097 |
| 308.15 | 0.2998 | 1.4982 |
| 308.15 | 0.3950 | 1.4866 |
| 308.15 | 0.5000 | 1.4738 |
| 308.15 | 0.5984 | 1.462 |
| 308.15 | 0.6981 | 1.4501 |
| 308.15 | 0.7972 | 1.4384 |
| 308.15 | 0.8941 | 1.427 |
| 308.15 | 1.0000 | 1.4148 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid, chloro-, ethyl ester (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1041.0 |
| 298.15 | 0.1072 | 1053.0 |
| 298.15 | 0.2035 | 1064.0 |
| 298.15 | 0.2998 | 1075.0 |
| 298.15 | 0.3950 | 1085.0 |
| 298.15 | 0.5000 | 1096.0 |
| 298.15 | 0.5984 | 1106.0 |
| 298.15 | 0.6981 | 1116.0 |
| 298.15 | 0.7972 | 1126.0 |
| 298.15 | 0.8941 | 1135.0 |
| 298.15 | 1.0000 | 1145.0 |
| 303.15 | 0.0000 | 1037.0 |
| 303.15 | 0.1072 | 1050.0 |
| 303.15 | 0.2035 | 1060.0 |
| 303.15 | 0.2998 | 1070.0 |
| 303.15 | 0.3950 | 1080.0 |
| 303.15 | 0.5000 | 1091.0 |
| 303.15 | 0.5984 | 1100.0 |
| 303.15 | 0.6981 | 1113.0 |
| 303.15 | 0.7972 | 1119.0 |
| 303.15 | 0.8941 | 1128.0 |
| 303.15 | 1.0000 | 1139.0 |
| 308.15 | 0.0000 | 1033.0 |
| 308.15 | 0.1072 | 1045.0 |
| 308.15 | 0.2035 | 1055.0 |
| 308.15 | 0.2998 | 1065.0 |
| 308.15 | 0.3950 | 1075.0 |
| 308.15 | 0.5000 | 1085.0 |
| 308.15 | 0.5984 | 1095.0 |
| 308.15 | 0.6981 | 1104.0 |
| 308.15 | 0.7972 | 1114.0 |
| 308.15 | 0.8941 | 1122.0 |
| 308.15 | 1.0000 | 1132.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid, chloro-, ethyl ester (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1041.0 |
| 298.15 | 0.1072 | 1053.0 |
| 298.15 | 0.2035 | 1064.0 |
| 298.15 | 0.2998 | 1075.0 |
| 298.15 | 0.3950 | 1085.0 |
| 298.15 | 0.5000 | 1096.0 |
| 298.15 | 0.5984 | 1106.0 |
| 298.15 | 0.6981 | 1116.0 |
| 298.15 | 0.7972 | 1126.0 |
| 298.15 | 0.8941 | 1135.0 |
| 298.15 | 1.0000 | 1145.0 |
| 303.15 | 0.0000 | 1037.0 |
| 303.15 | 0.1072 | 1050.0 |
| 303.15 | 0.2035 | 1060.0 |
| 303.15 | 0.2998 | 1070.0 |
| 303.15 | 0.3950 | 1080.0 |
| 303.15 | 0.5000 | 1091.0 |
| 303.15 | 0.5984 | 1100.0 |
| 303.15 | 0.6981 | 1113.0 |
| 303.15 | 0.7972 | 1119.0 |
| 303.15 | 0.8941 | 1128.0 |
| 303.15 | 1.0000 | 1139.0 |
| 308.15 | 0.0000 | 1033.0 |
| 308.15 | 0.1072 | 1045.0 |
| 308.15 | 0.2035 | 1055.0 |
| 308.15 | 0.2998 | 1065.0 |
| 308.15 | 0.3950 | 1075.0 |
| 308.15 | 0.5000 | 1085.0 |
| 308.15 | 0.5984 | 1095.0 |
| 308.15 | 0.6981 | 1104.0 |
| 308.15 | 0.7972 | 1114.0 |
| 308.15 | 0.8941 | 1122.0 |
| 308.15 | 1.0000 | 1132.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Acetic acid, chloro-, ethyl ester (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1541.0 |
| 0.1072 | 1503.0 |
| 0.2035 | 1472.0 |
| 0.2998 | 1442.0 |
| 0.3950 | 1412.0 |
| 0.5000 | 1380.0 |
| 0.5984 | 1352.0 |
| 0.6981 | 1325.0 |
| 0.7972 | 1299.0 |
| 0.8941 | 1275.0 |
| 1.0000 | 1250.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Acetic acid, chloro-, ethyl ester (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1541.0 |
| 0.1072 | 1503.0 |
| 0.2035 | 1472.0 |
| 0.2998 | 1442.0 |
| 0.3950 | 1412.0 |
| 0.5000 | 1380.0 |
| 0.5984 | 1352.0 |
| 0.6981 | 1325.0 |
| 0.7972 | 1299.0 |
| 0.8941 | 1275.0 |
| 1.0000 | 1250.0 |