- Name
- 2-Propanol, 2-methyl-
- InChI
- InChI=1S/C4H10O/c1-4(2,3)5/h5H,1-3H3
- InChI Key
- DKGAVHZHDRPRBM-UHFFFAOYSA-N
- Formula
- C4H10O
- SMILES
- CC(C)(C)O
- Mol. Weight (g/mol)
- 74.12
- CAS
- 75-65-0
- Name
- Propanoic acid, ethyl ester
- InChI
- InChI=1S/C5H10O2/c1-3-5(6)7-4-2/h3-4H2,1-2H3
- InChI Key
- FKRCODPIKNYEAC-UHFFFAOYSA-N
- Formula
- C5H10O2
- SMILES
- CCOC(=O)CC
- Mol. Weight (g/mol)
- 102.13
- CAS
- 105-37-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- Excess molar enthalpy (molar enthalpy (2)
- Tboil - Boiling temperature at pressure P, K (2)
- Excess molar volume, m3/mol (2)
Mole fraction of Propanoic acid, ethyl ester (2) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Propanoic acid, ethyl ester (2) - Liquid | Mole fraction of Propanoic acid, ethyl ester (2) - Gas |
|---|---|
| 0.0261 | 0.0218 |
| 0.0458 | 0.0378 |
| 0.0784 | 0.0641 |
| 0.1102 | 0.0896 |
| 0.1423 | 0.1147 |
| 0.1865 | 0.1485 |
| 0.2279 | 0.1786 |
| 0.2791 | 0.2170 |
| 0.3259 | 0.2517 |
| 0.3552 | 0.2710 |
| 0.4088 | 0.3082 |
| 0.4565 | 0.3424 |
| 0.4845 | 0.3645 |
| 0.5141 | 0.3871 |
| 0.5212 | 0.3926 |
| 0.5421 | 0.4091 |
| 0.5598 | 0.4239 |
| 0.5739 | 0.4357 |
| 0.6005 | 0.4573 |
| 0.6033 | 0.4604 |
| 0.6289 | 0.4832 |
| 0.6597 | 0.5112 |
| 0.6885 | 0.5394 |
| 0.7081 | 0.5592 |
| 0.7285 | 0.5811 |
| 0.7628 | 0.6200 |
| 0.8056 | 0.6711 |
| 0.8115 | 0.6790 |
| 0.8316 | 0.7055 |
| 0.8600 | 0.7456 |
| 0.8910 | 0.7921 |
| 0.9220 | 0.8444 |
| 0.9522 | 0.8996 |
| 0.9797 | 0.9552 |
Mole fraction of Propanoic acid, ethyl ester (2) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Propanoic acid, ethyl ester (2) - Liquid | Mole fraction of Propanoic acid, ethyl ester (2) - Gas |
|---|---|
| 0.0261 | 0.0218 |
| 0.0458 | 0.0378 |
| 0.0784 | 0.0641 |
| 0.1102 | 0.0896 |
| 0.1423 | 0.1147 |
| 0.1865 | 0.1485 |
| 0.2279 | 0.1786 |
| 0.2791 | 0.2170 |
| 0.3259 | 0.2517 |
| 0.3552 | 0.2710 |
| 0.4088 | 0.3082 |
| 0.4565 | 0.3424 |
| 0.4845 | 0.3645 |
| 0.5141 | 0.3871 |
| 0.5212 | 0.3926 |
| 0.5421 | 0.4091 |
| 0.5598 | 0.4239 |
| 0.5739 | 0.4357 |
| 0.6005 | 0.4573 |
| 0.6033 | 0.4604 |
| 0.6289 | 0.4832 |
| 0.6597 | 0.5112 |
| 0.6885 | 0.5394 |
| 0.7081 | 0.5592 |
| 0.7285 | 0.5811 |
| 0.7628 | 0.6200 |
| 0.8056 | 0.6711 |
| 0.8115 | 0.6790 |
| 0.8316 | 0.7055 |
| 0.8600 | 0.7456 |
| 0.8910 | 0.7921 |
| 0.9220 | 0.8444 |
| 0.9522 | 0.8996 |
| 0.9797 | 0.9552 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Propanoic acid, ethyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 299.15 | 0.0555 | 0.3352 |
| 299.15 | 0.1332 | 0.7669 |
| 299.15 | 0.2151 | 1.1348 |
| 299.15 | 0.2979 | 1.4491 |
| 299.15 | 0.3767 | 1.6629 |
| 299.15 | 0.4164 | 1.7441 |
| 299.15 | 0.4497 | 1.7895 |
| 299.15 | 0.4770 | 1.8085 |
| 299.15 | 0.5513 | 1.7993 |
| 299.15 | 0.6351 | 1.7229 |
| 299.15 | 0.7300 | 1.4817 |
| 299.15 | 0.8294 | 1.076 |
| 299.15 | 0.9242 | 0.5511 |
| 318.15 | 0.0510 | 0.2926 |
| 318.15 | 0.1094 | 0.5853 |
| 318.15 | 0.1681 | 0.8751 |
| 318.15 | 0.2276 | 1.1325 |
| 318.15 | 0.2892 | 1.3715 |
| 318.15 | 0.3477 | 1.5368 |
| 318.15 | 0.4028 | 1.6543 |
| 318.15 | 0.4347 | 1.7148 |
| 318.15 | 0.4528 | 1.7382 |
| 318.15 | 0.4786 | 1.7739 |
| 318.15 | 0.5297 | 1.7801 |
| 318.15 | 0.5872 | 1.7525 |
| 318.15 | 0.6499 | 1.6659 |
| 318.15 | 0.7164 | 1.5067 |
| 318.15 | 0.7897 | 1.2553 |
| 318.15 | 0.8641 | 0.9084 |
| 318.15 | 0.9381 | 0.4790 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Propanoic acid, ethyl ester (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 299.15 | 0.0555 | 0.3352 |
| 299.15 | 0.1332 | 0.7669 |
| 299.15 | 0.2151 | 1.1348 |
| 299.15 | 0.2979 | 1.4491 |
| 299.15 | 0.3767 | 1.6629 |
| 299.15 | 0.4164 | 1.7441 |
| 299.15 | 0.4497 | 1.7895 |
| 299.15 | 0.4770 | 1.8085 |
| 299.15 | 0.5513 | 1.7993 |
| 299.15 | 0.6351 | 1.7229 |
| 299.15 | 0.7300 | 1.4817 |
| 299.15 | 0.8294 | 1.076 |
| 299.15 | 0.9242 | 0.5511 |
| 318.15 | 0.0510 | 0.2926 |
| 318.15 | 0.1094 | 0.5853 |
| 318.15 | 0.1681 | 0.8751 |
| 318.15 | 0.2276 | 1.1325 |
| 318.15 | 0.2892 | 1.3715 |
| 318.15 | 0.3477 | 1.5368 |
| 318.15 | 0.4028 | 1.6543 |
| 318.15 | 0.4347 | 1.7148 |
| 318.15 | 0.4528 | 1.7382 |
| 318.15 | 0.4786 | 1.7739 |
| 318.15 | 0.5297 | 1.7801 |
| 318.15 | 0.5872 | 1.7525 |
| 318.15 | 0.6499 | 1.6659 |
| 318.15 | 0.7164 | 1.5067 |
| 318.15 | 0.7897 | 1.2553 |
| 318.15 | 0.8641 | 0.9084 |
| 318.15 | 0.9381 | 0.4790 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Propanoic acid, ethyl ester (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0261 | 355.80 |
| 0.0458 | 355.88 |
| 0.0784 | 355.96 |
| 0.1102 | 356.19 |
| 0.1423 | 356.38 |
| 0.1865 | 356.63 |
| 0.2279 | 356.89 |
| 0.2791 | 357.31 |
| 0.3259 | 357.75 |
| 0.3552 | 357.99 |
| 0.4088 | 358.46 |
| 0.4565 | 358.94 |
| 0.4845 | 359.27 |
| 0.5141 | 359.64 |
| 0.5212 | 359.73 |
| 0.5421 | 360.01 |
| 0.5598 | 360.28 |
| 0.5739 | 360.49 |
| 0.6005 | 360.91 |
| 0.6033 | 360.97 |
| 0.6289 | 361.39 |
| 0.6597 | 361.96 |
| 0.6885 | 362.51 |
| 0.7081 | 362.93 |
| 0.7285 | 363.36 |
| 0.7628 | 364.11 |
| 0.8056 | 365.24 |
| 0.8115 | 365.38 |
| 0.8316 | 365.91 |
| 0.8600 | 366.79 |
| 0.8910 | 367.73 |
| 0.9220 | 368.72 |
| 0.9522 | 369.94 |
| 0.9797 | 371.05 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Propanoic acid, ethyl ester (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0261 | 355.80 |
| 0.0458 | 355.88 |
| 0.0784 | 355.96 |
| 0.1102 | 356.19 |
| 0.1423 | 356.38 |
| 0.1865 | 356.63 |
| 0.2279 | 356.89 |
| 0.2791 | 357.31 |
| 0.3259 | 357.75 |
| 0.3552 | 357.99 |
| 0.4088 | 358.46 |
| 0.4565 | 358.94 |
| 0.4845 | 359.27 |
| 0.5141 | 359.64 |
| 0.5212 | 359.73 |
| 0.5421 | 360.01 |
| 0.5598 | 360.28 |
| 0.5739 | 360.49 |
| 0.6005 | 360.91 |
| 0.6033 | 360.97 |
| 0.6289 | 361.39 |
| 0.6597 | 361.96 |
| 0.6885 | 362.51 |
| 0.7081 | 362.93 |
| 0.7285 | 363.36 |
| 0.7628 | 364.11 |
| 0.8056 | 365.24 |
| 0.8115 | 365.38 |
| 0.8316 | 365.91 |
| 0.8600 | 366.79 |
| 0.8910 | 367.73 |
| 0.9220 | 368.72 |
| 0.9522 | 369.94 |
| 0.9797 | 371.05 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Propanoic acid, ethyl ester (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 303.15 | 0.0345 | 7.6000e-07 |
| 303.15 | 0.0905 | 2.1200e-06 |
| 303.15 | 0.1495 | 3.3100e-06 |
| 303.15 | 0.1943 | 4.0200e-06 |
| 303.15 | 0.2497 | 4.8200e-06 |
| 303.15 | 0.2987 | 5.3900e-06 |
| 303.15 | 0.3496 | 5.7700e-06 |
| 303.15 | 0.3997 | 6.1900e-06 |
| 303.15 | 0.4466 | 6.3900e-06 |
| 303.15 | 0.4486 | 6.4500e-06 |
| 303.15 | 0.4998 | 6.4800e-06 |
| 303.15 | 0.5006 | 6.5300e-06 |
| 303.15 | 0.5163 | 6.5200e-06 |
| 303.15 | 0.5188 | 6.5100e-06 |
| 303.15 | 0.5569 | 6.4700e-06 |
| 303.15 | 0.5646 | 6.4200e-06 |
| 303.15 | 0.5964 | 6.3100e-06 |
| 303.15 | 0.6368 | 6.0700e-06 |
| 303.15 | 0.6458 | 6.0000e-06 |
| 303.15 | 0.7044 | 5.4500e-06 |
| 303.15 | 0.7533 | 4.8700e-06 |
| 303.15 | 0.8103 | 4.0400e-06 |
| 303.15 | 0.8580 | 3.2500e-06 |
| 303.15 | 0.9096 | 2.2400e-06 |
| 303.15 | 0.9432 | 1.5400e-06 |
| 318.15 | 0.0694 | 1.8500e-06 |
| 318.15 | 0.1223 | 2.9900e-06 |
| 318.15 | 0.1759 | 3.8700e-06 |
| 318.15 | 0.2144 | 4.5100e-06 |
| 318.15 | 0.2746 | 5.2900e-06 |
| 318.15 | 0.3188 | 5.7900e-06 |
| 318.15 | 0.3648 | 6.1600e-06 |
| 318.15 | 0.4303 | 6.4300e-06 |
| 318.15 | 0.4669 | 6.5000e-06 |
| 318.15 | 0.5429 | 6.5300e-06 |
| 318.15 | 0.5960 | 6.4300e-06 |
| 318.15 | 0.6662 | 6.0500e-06 |
| 318.15 | 0.7319 | 5.4300e-06 |
| 318.15 | 0.8088 | 4.4500e-06 |
| 318.15 | 0.8557 | 3.7500e-06 |
| 318.15 | 0.9183 | 2.2800e-06 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Propanoic acid, ethyl ester (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 303.15 | 0.0345 | 7.6000e-07 |
| 303.15 | 0.0905 | 2.1200e-06 |
| 303.15 | 0.1495 | 3.3100e-06 |
| 303.15 | 0.1943 | 4.0200e-06 |
| 303.15 | 0.2497 | 4.8200e-06 |
| 303.15 | 0.2987 | 5.3900e-06 |
| 303.15 | 0.3496 | 5.7700e-06 |
| 303.15 | 0.3997 | 6.1900e-06 |
| 303.15 | 0.4466 | 6.3900e-06 |
| 303.15 | 0.4486 | 6.4500e-06 |
| 303.15 | 0.4998 | 6.4800e-06 |
| 303.15 | 0.5006 | 6.5300e-06 |
| 303.15 | 0.5163 | 6.5200e-06 |
| 303.15 | 0.5188 | 6.5100e-06 |
| 303.15 | 0.5569 | 6.4700e-06 |
| 303.15 | 0.5646 | 6.4200e-06 |
| 303.15 | 0.5964 | 6.3100e-06 |
| 303.15 | 0.6368 | 6.0700e-06 |
| 303.15 | 0.6458 | 6.0000e-06 |
| 303.15 | 0.7044 | 5.4500e-06 |
| 303.15 | 0.7533 | 4.8700e-06 |
| 303.15 | 0.8103 | 4.0400e-06 |
| 303.15 | 0.8580 | 3.2500e-06 |
| 303.15 | 0.9096 | 2.2400e-06 |
| 303.15 | 0.9432 | 1.5400e-06 |
| 318.15 | 0.0694 | 1.8500e-06 |
| 318.15 | 0.1223 | 2.9900e-06 |
| 318.15 | 0.1759 | 3.8700e-06 |
| 318.15 | 0.2144 | 4.5100e-06 |
| 318.15 | 0.2746 | 5.2900e-06 |
| 318.15 | 0.3188 | 5.7900e-06 |
| 318.15 | 0.3648 | 6.1600e-06 |
| 318.15 | 0.4303 | 6.4300e-06 |
| 318.15 | 0.4669 | 6.5000e-06 |
| 318.15 | 0.5429 | 6.5300e-06 |
| 318.15 | 0.5960 | 6.4300e-06 |
| 318.15 | 0.6662 | 6.0500e-06 |
| 318.15 | 0.7319 | 5.4300e-06 |
| 318.15 | 0.8088 | 4.4500e-06 |
| 318.15 | 0.8557 | 3.7500e-06 |
| 318.15 | 0.9183 | 2.2800e-06 |