- Name
- Tetrachloroethylene
- InChI
- InChI=1S/C2Cl4/c3-1(4)2(5)6
- InChI Key
- CYTYCFOTNPOANT-UHFFFAOYSA-N
- Formula
- C2Cl4
- SMILES
- ClC(Cl)=C(Cl)Cl
- Mol. Weight (g/mol)
- 165.83
- CAS
- 127-18-4
- Name
- Tributylamine
- InChI
- InChI=1S/C12H27N/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3
- InChI Key
- IMFACGCPASFAPR-UHFFFAOYSA-N
- Formula
- C12H27N
- SMILES
- CCCCN(CCCC)CCCC
- Mol. Weight (g/mol)
- 185.35
- CAS
- 102-82-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0009 |
| 298.15 | 0.1040 | 0.0009 |
| 298.15 | 0.2059 | 0.0010 |
| 298.15 | 0.3068 | 0.0010 |
| 298.15 | 0.4073 | 0.0010 |
| 298.15 | 0.4967 | 0.0011 |
| 298.15 | 0.6069 | 0.0011 |
| 298.15 | 0.6990 | 0.0011 |
| 298.15 | 0.8018 | 0.0012 |
| 298.15 | 0.9007 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0008 |
| 303.15 | 0.1040 | 0.0009 |
| 303.15 | 0.2059 | 0.0009 |
| 303.15 | 0.3068 | 0.0009 |
| 303.15 | 0.4073 | 0.0010 |
| 303.15 | 0.4967 | 0.0010 |
| 303.15 | 0.6069 | 0.0010 |
| 303.15 | 0.6990 | 0.0011 |
| 303.15 | 0.8018 | 0.0011 |
| 303.15 | 0.9007 | 0.0011 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0008 |
| 308.15 | 0.1040 | 0.0008 |
| 308.15 | 0.2059 | 0.0008 |
| 308.15 | 0.3068 | 0.0009 |
| 308.15 | 0.4073 | 0.0009 |
| 308.15 | 0.4967 | 0.0009 |
| 308.15 | 0.6069 | 0.0009 |
| 308.15 | 0.6990 | 0.0010 |
| 308.15 | 0.8018 | 0.0010 |
| 308.15 | 0.9007 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0009 |
| 298.15 | 0.1040 | 0.0009 |
| 298.15 | 0.2059 | 0.0010 |
| 298.15 | 0.3068 | 0.0010 |
| 298.15 | 0.4073 | 0.0010 |
| 298.15 | 0.4967 | 0.0011 |
| 298.15 | 0.6069 | 0.0011 |
| 298.15 | 0.6990 | 0.0011 |
| 298.15 | 0.8018 | 0.0012 |
| 298.15 | 0.9007 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0008 |
| 303.15 | 0.1040 | 0.0009 |
| 303.15 | 0.2059 | 0.0009 |
| 303.15 | 0.3068 | 0.0009 |
| 303.15 | 0.4073 | 0.0010 |
| 303.15 | 0.4967 | 0.0010 |
| 303.15 | 0.6069 | 0.0010 |
| 303.15 | 0.6990 | 0.0011 |
| 303.15 | 0.8018 | 0.0011 |
| 303.15 | 0.9007 | 0.0011 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0008 |
| 308.15 | 0.1040 | 0.0008 |
| 308.15 | 0.2059 | 0.0008 |
| 308.15 | 0.3068 | 0.0009 |
| 308.15 | 0.4073 | 0.0009 |
| 308.15 | 0.4967 | 0.0009 |
| 308.15 | 0.6069 | 0.0009 |
| 308.15 | 0.6990 | 0.0010 |
| 308.15 | 0.8018 | 0.0010 |
| 308.15 | 0.9007 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5036 |
| 298.15 | 0.1040 | 1.4872 |
| 298.15 | 0.2059 | 1.4748 |
| 298.15 | 0.3068 | 1.4659 |
| 298.15 | 0.4073 | 1.4566 |
| 298.15 | 0.4967 | 1.4506 |
| 298.15 | 0.6069 | 1.4437 |
| 298.15 | 0.6990 | 1.4396 |
| 298.15 | 0.8018 | 1.435 |
| 298.15 | 0.9007 | 1.4316 |
| 298.15 | 1.0000 | 1.4276 |
| 303.15 | 0.0000 | 1.5005 |
| 303.15 | 0.1040 | 1.4842 |
| 303.15 | 0.2059 | 1.4721 |
| 303.15 | 0.3068 | 1.4656 |
| 303.15 | 0.4073 | 1.4539 |
| 303.15 | 0.4967 | 1.4479 |
| 303.15 | 0.6069 | 1.4415 |
| 303.15 | 0.6990 | 1.4367 |
| 303.15 | 0.8018 | 1.4325 |
| 303.15 | 0.9007 | 1.4289 |
| 303.15 | 1.0000 | 1.4255 |
| 308.15 | 0.0000 | 1.4978 |
| 308.15 | 0.1040 | 1.481 |
| 308.15 | 0.2059 | 1.4692 |
| 308.15 | 0.3068 | 1.4594 |
| 308.15 | 0.4073 | 1.451 |
| 308.15 | 0.4967 | 1.445 |
| 308.15 | 0.6069 | 1.4392 |
| 308.15 | 0.6990 | 1.434 |
| 308.15 | 0.8018 | 1.4298 |
| 308.15 | 0.9007 | 1.4263 |
| 308.15 | 1.0000 | 1.4228 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5036 |
| 298.15 | 0.1040 | 1.4872 |
| 298.15 | 0.2059 | 1.4748 |
| 298.15 | 0.3068 | 1.4659 |
| 298.15 | 0.4073 | 1.4566 |
| 298.15 | 0.4967 | 1.4506 |
| 298.15 | 0.6069 | 1.4437 |
| 298.15 | 0.6990 | 1.4396 |
| 298.15 | 0.8018 | 1.435 |
| 298.15 | 0.9007 | 1.4316 |
| 298.15 | 1.0000 | 1.4276 |
| 303.15 | 0.0000 | 1.5005 |
| 303.15 | 0.1040 | 1.4842 |
| 303.15 | 0.2059 | 1.4721 |
| 303.15 | 0.3068 | 1.4656 |
| 303.15 | 0.4073 | 1.4539 |
| 303.15 | 0.4967 | 1.4479 |
| 303.15 | 0.6069 | 1.4415 |
| 303.15 | 0.6990 | 1.4367 |
| 303.15 | 0.8018 | 1.4325 |
| 303.15 | 0.9007 | 1.4289 |
| 303.15 | 1.0000 | 1.4255 |
| 308.15 | 0.0000 | 1.4978 |
| 308.15 | 0.1040 | 1.481 |
| 308.15 | 0.2059 | 1.4692 |
| 308.15 | 0.3068 | 1.4594 |
| 308.15 | 0.4073 | 1.451 |
| 308.15 | 0.4967 | 1.445 |
| 308.15 | 0.6069 | 1.4392 |
| 308.15 | 0.6990 | 1.434 |
| 308.15 | 0.8018 | 1.4298 |
| 308.15 | 0.9007 | 1.4263 |
| 308.15 | 1.0000 | 1.4228 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1616.0 |
| 298.15 | 0.1040 | 1433.8 |
| 298.15 | 0.2059 | 1295.5 |
| 298.15 | 0.3068 | 1185.4 |
| 298.15 | 0.4073 | 1095.0 |
| 298.15 | 0.4967 | 1026.9 |
| 298.15 | 0.6069 | 955.4 |
| 298.15 | 0.6990 | 904.2 |
| 298.15 | 0.8018 | 854.3 |
| 298.15 | 0.9007 | 812.0 |
| 298.15 | 1.0000 | 773.9 |
| 303.15 | 0.0000 | 1607.5 |
| 303.15 | 0.1040 | 1425.9 |
| 303.15 | 0.2059 | 1288.1 |
| 303.15 | 0.3068 | 1181.4 |
| 303.15 | 0.4073 | 1089.1 |
| 303.15 | 0.4967 | 1021.5 |
| 303.15 | 0.6069 | 949.9 |
| 303.15 | 0.6990 | 899.4 |
| 303.15 | 0.8018 | 849.4 |
| 303.15 | 0.9007 | 808.0 |
| 303.15 | 1.0000 | 769.2 |
| 308.15 | 0.0000 | 1597.5 |
| 308.15 | 0.1040 | 1418.2 |
| 308.15 | 0.2059 | 1281.3 |
| 308.15 | 0.3068 | 1172.5 |
| 308.15 | 0.4073 | 1083.2 |
| 308.15 | 0.4967 | 1015.9 |
| 308.15 | 0.6069 | 945.2 |
| 308.15 | 0.6990 | 894.7 |
| 308.15 | 0.8018 | 845.3 |
| 308.15 | 0.9007 | 803.4 |
| 308.15 | 1.0000 | 765.7 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1616.0 |
| 298.15 | 0.1040 | 1433.8 |
| 298.15 | 0.2059 | 1295.5 |
| 298.15 | 0.3068 | 1185.4 |
| 298.15 | 0.4073 | 1095.0 |
| 298.15 | 0.4967 | 1026.9 |
| 298.15 | 0.6069 | 955.4 |
| 298.15 | 0.6990 | 904.2 |
| 298.15 | 0.8018 | 854.3 |
| 298.15 | 0.9007 | 812.0 |
| 298.15 | 1.0000 | 773.9 |
| 303.15 | 0.0000 | 1607.5 |
| 303.15 | 0.1040 | 1425.9 |
| 303.15 | 0.2059 | 1288.1 |
| 303.15 | 0.3068 | 1181.4 |
| 303.15 | 0.4073 | 1089.1 |
| 303.15 | 0.4967 | 1021.5 |
| 303.15 | 0.6069 | 949.9 |
| 303.15 | 0.6990 | 899.4 |
| 303.15 | 0.8018 | 849.4 |
| 303.15 | 0.9007 | 808.0 |
| 303.15 | 1.0000 | 769.2 |
| 308.15 | 0.0000 | 1597.5 |
| 308.15 | 0.1040 | 1418.2 |
| 308.15 | 0.2059 | 1281.3 |
| 308.15 | 0.3068 | 1172.5 |
| 308.15 | 0.4073 | 1083.2 |
| 308.15 | 0.4967 | 1015.9 |
| 308.15 | 0.6069 | 945.2 |
| 308.15 | 0.6990 | 894.7 |
| 308.15 | 0.8018 | 845.3 |
| 308.15 | 0.9007 | 803.4 |
| 308.15 | 1.0000 | 765.7 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Tributylamine (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1033.0 |
| 0.1040 | 1052.0 |
| 0.2059 | 1073.0 |
| 0.3068 | 1094.0 |
| 0.4073 | 1116.0 |
| 0.4967 | 1136.0 |
| 0.6069 | 1162.0 |
| 0.6990 | 1184.0 |
| 0.8018 | 1209.0 |
| 0.9007 | 1235.0 |
| 1.0000 | 1262.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Tributylamine (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1033.0 |
| 0.1040 | 1052.0 |
| 0.2059 | 1073.0 |
| 0.3068 | 1094.0 |
| 0.4073 | 1116.0 |
| 0.4967 | 1136.0 |
| 0.6069 | 1162.0 |
| 0.6990 | 1184.0 |
| 0.8018 | 1209.0 |
| 0.9007 | 1235.0 |
| 1.0000 | 1262.0 |