- Name
- Pyridine
- InChI
- InChI=1S/C5H5N/c1-2-4-6-5-3-1/h1-5H
- InChI Key
- JUJWROOIHBZHMG-UHFFFAOYSA-N
- Formula
- C5H5N
- SMILES
- c1ccncc1
- Mol. Weight (g/mol)
- 79.10
- CAS
- 110-86-1
- Name
- Tributylamine
- InChI
- InChI=1S/C12H27N/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3
- InChI Key
- IMFACGCPASFAPR-UHFFFAOYSA-N
- Formula
- C12H27N
- SMILES
- CCCCN(CCCC)CCCC
- Mol. Weight (g/mol)
- 185.35
- CAS
- 102-82-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0009 |
| 298.15 | 0.0977 | 0.0009 |
| 298.15 | 0.1951 | 0.0009 |
| 298.15 | 0.2949 | 0.0009 |
| 298.15 | 0.3938 | 0.0010 |
| 298.15 | 0.4898 | 0.0010 |
| 298.15 | 0.5884 | 0.0010 |
| 298.15 | 0.6899 | 0.0011 |
| 298.15 | 0.7846 | 0.0011 |
| 298.15 | 0.8869 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0008 |
| 303.15 | 0.0977 | 0.0008 |
| 303.15 | 0.1951 | 0.0008 |
| 303.15 | 0.2949 | 0.0009 |
| 303.15 | 0.3938 | 0.0009 |
| 303.15 | 0.4898 | 0.0009 |
| 303.15 | 0.5884 | 0.0010 |
| 303.15 | 0.6899 | 0.0010 |
| 303.15 | 0.7846 | 0.0010 |
| 303.15 | 0.8869 | 0.0011 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0008 |
| 308.15 | 0.0977 | 0.0008 |
| 308.15 | 0.1951 | 0.0008 |
| 308.15 | 0.2949 | 0.0008 |
| 308.15 | 0.3938 | 0.0008 |
| 308.15 | 0.4898 | 0.0008 |
| 308.15 | 0.5884 | 0.0009 |
| 308.15 | 0.6899 | 0.0009 |
| 308.15 | 0.7846 | 0.0009 |
| 308.15 | 0.8869 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0009 |
| 298.15 | 0.0977 | 0.0009 |
| 298.15 | 0.1951 | 0.0009 |
| 298.15 | 0.2949 | 0.0009 |
| 298.15 | 0.3938 | 0.0010 |
| 298.15 | 0.4898 | 0.0010 |
| 298.15 | 0.5884 | 0.0010 |
| 298.15 | 0.6899 | 0.0011 |
| 298.15 | 0.7846 | 0.0011 |
| 298.15 | 0.8869 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0008 |
| 303.15 | 0.0977 | 0.0008 |
| 303.15 | 0.1951 | 0.0008 |
| 303.15 | 0.2949 | 0.0009 |
| 303.15 | 0.3938 | 0.0009 |
| 303.15 | 0.4898 | 0.0009 |
| 303.15 | 0.5884 | 0.0010 |
| 303.15 | 0.6899 | 0.0010 |
| 303.15 | 0.7846 | 0.0010 |
| 303.15 | 0.8869 | 0.0011 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0008 |
| 308.15 | 0.0977 | 0.0008 |
| 308.15 | 0.1951 | 0.0008 |
| 308.15 | 0.2949 | 0.0008 |
| 308.15 | 0.3938 | 0.0008 |
| 308.15 | 0.4898 | 0.0008 |
| 308.15 | 0.5884 | 0.0009 |
| 308.15 | 0.6899 | 0.0009 |
| 308.15 | 0.7846 | 0.0009 |
| 308.15 | 0.8869 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5062 |
| 298.15 | 0.0977 | 1.4866 |
| 298.15 | 0.1951 | 1.4708 |
| 298.15 | 0.2949 | 1.4606 |
| 298.15 | 0.3938 | 1.4513 |
| 298.15 | 0.4898 | 1.4464 |
| 298.15 | 0.5884 | 1.4403 |
| 298.15 | 0.6899 | 1.4359 |
| 298.15 | 0.7846 | 1.4333 |
| 298.15 | 0.8869 | 1.4303 |
| 298.15 | 1.0000 | 1.4276 |
| 303.15 | 0.0000 | 1.5025 |
| 303.15 | 0.0977 | 1.483 |
| 303.15 | 0.1951 | 1.4685 |
| 303.15 | 0.2949 | 1.4574 |
| 303.15 | 0.3938 | 1.4491 |
| 303.15 | 0.4898 | 1.4428 |
| 303.15 | 0.5884 | 1.4376 |
| 303.15 | 0.6899 | 1.4335 |
| 303.15 | 0.7846 | 1.43 |
| 303.15 | 0.8869 | 1.4277 |
| 303.15 | 1.0000 | 1.4255 |
| 308.15 | 0.0000 | 1.5016 |
| 308.15 | 0.0977 | 1.4795 |
| 308.15 | 0.1951 | 1.4662 |
| 308.15 | 0.2949 | 1.4542 |
| 308.15 | 0.3938 | 1.447 |
| 308.15 | 0.4898 | 1.4392 |
| 308.15 | 0.5884 | 1.4348 |
| 308.15 | 0.6899 | 1.4311 |
| 308.15 | 0.7846 | 1.4268 |
| 308.15 | 0.8869 | 1.4252 |
| 308.15 | 1.0000 | 1.4228 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5062 |
| 298.15 | 0.0977 | 1.4866 |
| 298.15 | 0.1951 | 1.4708 |
| 298.15 | 0.2949 | 1.4606 |
| 298.15 | 0.3938 | 1.4513 |
| 298.15 | 0.4898 | 1.4464 |
| 298.15 | 0.5884 | 1.4403 |
| 298.15 | 0.6899 | 1.4359 |
| 298.15 | 0.7846 | 1.4333 |
| 298.15 | 0.8869 | 1.4303 |
| 298.15 | 1.0000 | 1.4276 |
| 303.15 | 0.0000 | 1.5025 |
| 303.15 | 0.0977 | 1.483 |
| 303.15 | 0.1951 | 1.4685 |
| 303.15 | 0.2949 | 1.4574 |
| 303.15 | 0.3938 | 1.4491 |
| 303.15 | 0.4898 | 1.4428 |
| 303.15 | 0.5884 | 1.4376 |
| 303.15 | 0.6899 | 1.4335 |
| 303.15 | 0.7846 | 1.43 |
| 303.15 | 0.8869 | 1.4277 |
| 303.15 | 1.0000 | 1.4255 |
| 308.15 | 0.0000 | 1.5016 |
| 308.15 | 0.0977 | 1.4795 |
| 308.15 | 0.1951 | 1.4662 |
| 308.15 | 0.2949 | 1.4542 |
| 308.15 | 0.3938 | 1.447 |
| 308.15 | 0.4898 | 1.4392 |
| 308.15 | 0.5884 | 1.4348 |
| 308.15 | 0.6899 | 1.4311 |
| 308.15 | 0.7846 | 1.4268 |
| 308.15 | 0.8869 | 1.4252 |
| 308.15 | 1.0000 | 1.4228 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 979.0 |
| 298.15 | 0.0977 | 927.2 |
| 298.15 | 0.1951 | 890.5 |
| 298.15 | 0.2949 | 862.6 |
| 298.15 | 0.3938 | 841.3 |
| 298.15 | 0.4898 | 824.7 |
| 298.15 | 0.5884 | 810.8 |
| 298.15 | 0.6899 | 799.0 |
| 298.15 | 0.7846 | 789.9 |
| 298.15 | 0.8869 | 781.6 |
| 298.15 | 1.0000 | 773.9 |
| 303.15 | 0.0000 | 973.7 |
| 303.15 | 0.0977 | 922.3 |
| 303.15 | 0.1951 | 885.6 |
| 303.15 | 0.2949 | 858.0 |
| 303.15 | 0.3938 | 836.8 |
| 303.15 | 0.4898 | 820.3 |
| 303.15 | 0.5884 | 806.5 |
| 303.15 | 0.6899 | 794.7 |
| 303.15 | 0.7846 | 785.7 |
| 303.15 | 0.8869 | 777.5 |
| 303.15 | 1.0000 | 769.2 |
| 308.15 | 0.0000 | 968.6 |
| 308.15 | 0.0977 | 917.4 |
| 308.15 | 0.1951 | 880.7 |
| 308.15 | 0.2949 | 853.3 |
| 308.15 | 0.3938 | 832.2 |
| 308.15 | 0.4898 | 815.9 |
| 308.15 | 0.5884 | 802.1 |
| 308.15 | 0.6899 | 790.5 |
| 308.15 | 0.7846 | 781.6 |
| 308.15 | 0.8869 | 773.3 |
| 308.15 | 1.0000 | 765.7 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 979.0 |
| 298.15 | 0.0977 | 927.2 |
| 298.15 | 0.1951 | 890.5 |
| 298.15 | 0.2949 | 862.6 |
| 298.15 | 0.3938 | 841.3 |
| 298.15 | 0.4898 | 824.7 |
| 298.15 | 0.5884 | 810.8 |
| 298.15 | 0.6899 | 799.0 |
| 298.15 | 0.7846 | 789.9 |
| 298.15 | 0.8869 | 781.6 |
| 298.15 | 1.0000 | 773.9 |
| 303.15 | 0.0000 | 973.7 |
| 303.15 | 0.0977 | 922.3 |
| 303.15 | 0.1951 | 885.6 |
| 303.15 | 0.2949 | 858.0 |
| 303.15 | 0.3938 | 836.8 |
| 303.15 | 0.4898 | 820.3 |
| 303.15 | 0.5884 | 806.5 |
| 303.15 | 0.6899 | 794.7 |
| 303.15 | 0.7846 | 785.7 |
| 303.15 | 0.8869 | 777.5 |
| 303.15 | 1.0000 | 769.2 |
| 308.15 | 0.0000 | 968.6 |
| 308.15 | 0.0977 | 917.4 |
| 308.15 | 0.1951 | 880.7 |
| 308.15 | 0.2949 | 853.3 |
| 308.15 | 0.3938 | 832.2 |
| 308.15 | 0.4898 | 815.9 |
| 308.15 | 0.5884 | 802.1 |
| 308.15 | 0.6899 | 790.5 |
| 308.15 | 0.7846 | 781.6 |
| 308.15 | 0.8869 | 773.3 |
| 308.15 | 1.0000 | 765.7 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Tributylamine (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1412.0 |
| 0.0977 | 1363.0 |
| 0.1951 | 1333.0 |
| 0.2949 | 1308.0 |
| 0.3938 | 1290.0 |
| 0.4898 | 1282.0 |
| 0.5884 | 1278.0 |
| 0.6899 | 1275.0 |
| 0.7846 | 1271.0 |
| 0.8869 | 1266.0 |
| 1.0000 | 1262.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Tributylamine (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1412.0 |
| 0.0977 | 1363.0 |
| 0.1951 | 1333.0 |
| 0.2949 | 1308.0 |
| 0.3938 | 1290.0 |
| 0.4898 | 1282.0 |
| 0.5884 | 1278.0 |
| 0.6899 | 1275.0 |
| 0.7846 | 1271.0 |
| 0.8869 | 1266.0 |
| 1.0000 | 1262.0 |