- Name
- Ethyl acetoacetate
- InChI
- InChI=1S/C6H10O3/c1-3-9-6(8)4-5(2)7/h3-4H2,1-2H3
- InChI Key
- XYIBRDXRRQCHLP-UHFFFAOYSA-N
- Formula
- C6H10O3
- SMILES
- CCOC(=O)CC(C)=O
- Mol. Weight (g/mol)
- 130.14
- CAS
- 141-97-9
- Name
- 1,4-Dioxane
- InChI
- InChI=1S/C4H8O2/c1-2-6-4-3-5-1/h1-4H2
- InChI Key
- RYHBNJHYFVUHQT-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- C1COCCO1
- Mol. Weight (g/mol)
- 88.11
- CAS
- 123-91-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0015 |
| 298.15 | 0.1134 | 0.0014 |
| 298.15 | 0.2058 | 0.0014 |
| 298.15 | 0.3054 | 0.0013 |
| 298.15 | 0.4008 | 0.0013 |
| 298.15 | 0.4986 | 0.0013 |
| 298.15 | 0.5955 | 0.0012 |
| 298.15 | 0.6972 | 0.0012 |
| 298.15 | 0.7971 | 0.0012 |
| 298.15 | 0.8964 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0013 |
| 303.15 | 0.1134 | 0.0013 |
| 303.15 | 0.2058 | 0.0013 |
| 303.15 | 0.3054 | 0.0012 |
| 303.15 | 0.4008 | 0.0012 |
| 303.15 | 0.4986 | 0.0012 |
| 303.15 | 0.5955 | 0.0011 |
| 303.15 | 0.6972 | 0.0011 |
| 303.15 | 0.7971 | 0.0011 |
| 303.15 | 0.8964 | 0.0011 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0012 |
| 308.15 | 0.1134 | 0.0012 |
| 308.15 | 0.2058 | 0.0012 |
| 308.15 | 0.3054 | 0.0011 |
| 308.15 | 0.4008 | 0.0011 |
| 308.15 | 0.4986 | 0.0011 |
| 308.15 | 0.5955 | 0.0010 |
| 308.15 | 0.6972 | 0.0010 |
| 308.15 | 0.7971 | 0.0010 |
| 308.15 | 0.8964 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0015 |
| 298.15 | 0.1134 | 0.0014 |
| 298.15 | 0.2058 | 0.0014 |
| 298.15 | 0.3054 | 0.0013 |
| 298.15 | 0.4008 | 0.0013 |
| 298.15 | 0.4986 | 0.0013 |
| 298.15 | 0.5955 | 0.0012 |
| 298.15 | 0.6972 | 0.0012 |
| 298.15 | 0.7971 | 0.0012 |
| 298.15 | 0.8964 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0013 |
| 303.15 | 0.1134 | 0.0013 |
| 303.15 | 0.2058 | 0.0013 |
| 303.15 | 0.3054 | 0.0012 |
| 303.15 | 0.4008 | 0.0012 |
| 303.15 | 0.4986 | 0.0012 |
| 303.15 | 0.5955 | 0.0011 |
| 303.15 | 0.6972 | 0.0011 |
| 303.15 | 0.7971 | 0.0011 |
| 303.15 | 0.8964 | 0.0011 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0012 |
| 308.15 | 0.1134 | 0.0012 |
| 308.15 | 0.2058 | 0.0012 |
| 308.15 | 0.3054 | 0.0011 |
| 308.15 | 0.4008 | 0.0011 |
| 308.15 | 0.4986 | 0.0011 |
| 308.15 | 0.5955 | 0.0010 |
| 308.15 | 0.6972 | 0.0010 |
| 308.15 | 0.7971 | 0.0010 |
| 308.15 | 0.8964 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4166 |
| 298.15 | 0.1134 | 1.417 |
| 298.15 | 0.2058 | 1.4171 |
| 298.15 | 0.3054 | 1.4174 |
| 298.15 | 0.4008 | 1.4176 |
| 298.15 | 0.4986 | 1.4178 |
| 298.15 | 0.5955 | 1.418 |
| 298.15 | 0.6972 | 1.4186 |
| 298.15 | 0.7971 | 1.4192 |
| 298.15 | 0.8964 | 1.4195 |
| 298.15 | 1.0000 | 1.4201 |
| 303.15 | 0.0000 | 1.4145 |
| 303.15 | 0.1134 | 1.4146 |
| 303.15 | 0.2058 | 1.4148 |
| 303.15 | 0.3054 | 1.415 |
| 303.15 | 0.4008 | 1.4154 |
| 303.15 | 0.4986 | 1.4155 |
| 303.15 | 0.5955 | 1.416 |
| 303.15 | 0.6972 | 1.4162 |
| 303.15 | 0.7971 | 1.4166 |
| 303.15 | 0.8964 | 1.4169 |
| 303.15 | 1.0000 | 1.417 |
| 308.15 | 0.0000 | 1.412 |
| 308.15 | 0.1134 | 1.4122 |
| 308.15 | 0.2058 | 1.4124 |
| 308.15 | 0.3054 | 1.4126 |
| 308.15 | 0.4008 | 1.413 |
| 308.15 | 0.4986 | 1.413 |
| 308.15 | 0.5955 | 1.4132 |
| 308.15 | 0.6972 | 1.4137 |
| 308.15 | 0.7971 | 1.414 |
| 308.15 | 0.8964 | 1.4144 |
| 308.15 | 1.0000 | 1.4144 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4166 |
| 298.15 | 0.1134 | 1.417 |
| 298.15 | 0.2058 | 1.4171 |
| 298.15 | 0.3054 | 1.4174 |
| 298.15 | 0.4008 | 1.4176 |
| 298.15 | 0.4986 | 1.4178 |
| 298.15 | 0.5955 | 1.418 |
| 298.15 | 0.6972 | 1.4186 |
| 298.15 | 0.7971 | 1.4192 |
| 298.15 | 0.8964 | 1.4195 |
| 298.15 | 1.0000 | 1.4201 |
| 303.15 | 0.0000 | 1.4145 |
| 303.15 | 0.1134 | 1.4146 |
| 303.15 | 0.2058 | 1.4148 |
| 303.15 | 0.3054 | 1.415 |
| 303.15 | 0.4008 | 1.4154 |
| 303.15 | 0.4986 | 1.4155 |
| 303.15 | 0.5955 | 1.416 |
| 303.15 | 0.6972 | 1.4162 |
| 303.15 | 0.7971 | 1.4166 |
| 303.15 | 0.8964 | 1.4169 |
| 303.15 | 1.0000 | 1.417 |
| 308.15 | 0.0000 | 1.412 |
| 308.15 | 0.1134 | 1.4122 |
| 308.15 | 0.2058 | 1.4124 |
| 308.15 | 0.3054 | 1.4126 |
| 308.15 | 0.4008 | 1.413 |
| 308.15 | 0.4986 | 1.413 |
| 308.15 | 0.5955 | 1.4132 |
| 308.15 | 0.6972 | 1.4137 |
| 308.15 | 0.7971 | 1.414 |
| 308.15 | 0.8964 | 1.4144 |
| 308.15 | 1.0000 | 1.4144 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1020.9 |
| 298.15 | 0.1134 | 1021.5 |
| 298.15 | 0.2058 | 1022.1 |
| 298.15 | 0.3054 | 1022.7 |
| 298.15 | 0.4008 | 1023.3 |
| 298.15 | 0.4986 | 1024.0 |
| 298.15 | 0.5955 | 1024.7 |
| 298.15 | 0.6972 | 1025.4 |
| 298.15 | 0.7971 | 1026.1 |
| 298.15 | 0.8964 | 1026.8 |
| 298.15 | 1.0000 | 1027.6 |
| 303.15 | 0.0000 | 1014.9 |
| 303.15 | 0.1134 | 1016.0 |
| 303.15 | 0.2058 | 1016.5 |
| 303.15 | 0.3054 | 1017.1 |
| 303.15 | 0.4008 | 1017.6 |
| 303.15 | 0.4986 | 1018.2 |
| 303.15 | 0.5955 | 1018.8 |
| 303.15 | 0.6972 | 1019.5 |
| 303.15 | 0.7971 | 1020.3 |
| 303.15 | 0.8964 | 1021.0 |
| 303.15 | 1.0000 | 1021.9 |
| 308.15 | 0.0000 | 1010.2 |
| 308.15 | 0.1134 | 1010.6 |
| 308.15 | 0.2058 | 1011.0 |
| 308.15 | 0.3054 | 1011.4 |
| 308.15 | 0.4008 | 1011.9 |
| 308.15 | 0.4986 | 1012.4 |
| 308.15 | 0.5955 | 1013.0 |
| 308.15 | 0.6972 | 1013.7 |
| 308.15 | 0.7971 | 1014.4 |
| 308.15 | 0.8964 | 1015.2 |
| 308.15 | 1.0000 | 1016.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1020.9 |
| 298.15 | 0.1134 | 1021.5 |
| 298.15 | 0.2058 | 1022.1 |
| 298.15 | 0.3054 | 1022.7 |
| 298.15 | 0.4008 | 1023.3 |
| 298.15 | 0.4986 | 1024.0 |
| 298.15 | 0.5955 | 1024.7 |
| 298.15 | 0.6972 | 1025.4 |
| 298.15 | 0.7971 | 1026.1 |
| 298.15 | 0.8964 | 1026.8 |
| 298.15 | 1.0000 | 1027.6 |
| 303.15 | 0.0000 | 1014.9 |
| 303.15 | 0.1134 | 1016.0 |
| 303.15 | 0.2058 | 1016.5 |
| 303.15 | 0.3054 | 1017.1 |
| 303.15 | 0.4008 | 1017.6 |
| 303.15 | 0.4986 | 1018.2 |
| 303.15 | 0.5955 | 1018.8 |
| 303.15 | 0.6972 | 1019.5 |
| 303.15 | 0.7971 | 1020.3 |
| 303.15 | 0.8964 | 1021.0 |
| 303.15 | 1.0000 | 1021.9 |
| 308.15 | 0.0000 | 1010.2 |
| 308.15 | 0.1134 | 1010.6 |
| 308.15 | 0.2058 | 1011.0 |
| 308.15 | 0.3054 | 1011.4 |
| 308.15 | 0.4008 | 1011.9 |
| 308.15 | 0.4986 | 1012.4 |
| 308.15 | 0.5955 | 1013.0 |
| 308.15 | 0.6972 | 1013.7 |
| 308.15 | 0.7971 | 1014.4 |
| 308.15 | 0.8964 | 1015.2 |
| 308.15 | 1.0000 | 1016.2 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1331.0 |
| 0.1134 | 1335.0 |
| 0.2058 | 1338.0 |
| 0.3054 | 1340.0 |
| 0.4008 | 1342.0 |
| 0.4986 | 1344.0 |
| 0.5955 | 1345.0 |
| 0.6972 | 1346.0 |
| 0.7971 | 1346.0 |
| 0.8964 | 1347.0 |
| 1.0000 | 1347.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1331.0 |
| 0.1134 | 1335.0 |
| 0.2058 | 1338.0 |
| 0.3054 | 1340.0 |
| 0.4008 | 1342.0 |
| 0.4986 | 1344.0 |
| 0.5955 | 1345.0 |
| 0.6972 | 1346.0 |
| 0.7971 | 1346.0 |
| 0.8964 | 1347.0 |
| 1.0000 | 1347.0 |