- Name
- Ethanedioic acid, diethyl ester
- InChI
- InChI=1S/C6H10O4/c1-3-9-5(7)6(8)10-4-2/h3-4H2,1-2H3
- InChI Key
- WYACBZDAHNBPPB-UHFFFAOYSA-N
- Formula
- C6H10O4
- SMILES
- CCOC(=O)C(=O)OCC
- Mol. Weight (g/mol)
- 146.14
- CAS
- 95-92-1
- Name
- 1,4-Dioxane
- InChI
- InChI=1S/C4H8O2/c1-2-6-4-3-5-1/h1-4H2
- InChI Key
- RYHBNJHYFVUHQT-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- C1COCCO1
- Mol. Weight (g/mol)
- 88.11
- CAS
- 123-91-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0018 |
| 298.15 | 0.1094 | 0.0017 |
| 298.15 | 0.2069 | 0.0016 |
| 298.15 | 0.3098 | 0.0016 |
| 298.15 | 0.4009 | 0.0015 |
| 298.15 | 0.4975 | 0.0014 |
| 298.15 | 0.5978 | 0.0014 |
| 298.15 | 0.7008 | 0.0013 |
| 298.15 | 0.7971 | 0.0013 |
| 298.15 | 0.8976 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0016 |
| 303.15 | 0.1094 | 0.0015 |
| 303.15 | 0.2069 | 0.0015 |
| 303.15 | 0.3098 | 0.0014 |
| 303.15 | 0.4009 | 0.0014 |
| 303.15 | 0.4975 | 0.0013 |
| 303.15 | 0.5978 | 0.0013 |
| 303.15 | 0.7008 | 0.0012 |
| 303.15 | 0.7971 | 0.0012 |
| 303.15 | 0.8976 | 0.0011 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0014 |
| 308.15 | 0.1094 | 0.0014 |
| 308.15 | 0.2069 | 0.0013 |
| 308.15 | 0.3098 | 0.0013 |
| 308.15 | 0.4009 | 0.0012 |
| 308.15 | 0.4975 | 0.0012 |
| 308.15 | 0.5978 | 0.0011 |
| 308.15 | 0.7008 | 0.0011 |
| 308.15 | 0.7971 | 0.0011 |
| 308.15 | 0.8976 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0018 |
| 298.15 | 0.1094 | 0.0017 |
| 298.15 | 0.2069 | 0.0016 |
| 298.15 | 0.3098 | 0.0016 |
| 298.15 | 0.4009 | 0.0015 |
| 298.15 | 0.4975 | 0.0014 |
| 298.15 | 0.5978 | 0.0014 |
| 298.15 | 0.7008 | 0.0013 |
| 298.15 | 0.7971 | 0.0013 |
| 298.15 | 0.8976 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0016 |
| 303.15 | 0.1094 | 0.0015 |
| 303.15 | 0.2069 | 0.0015 |
| 303.15 | 0.3098 | 0.0014 |
| 303.15 | 0.4009 | 0.0014 |
| 303.15 | 0.4975 | 0.0013 |
| 303.15 | 0.5978 | 0.0013 |
| 303.15 | 0.7008 | 0.0012 |
| 303.15 | 0.7971 | 0.0012 |
| 303.15 | 0.8976 | 0.0011 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0014 |
| 308.15 | 0.1094 | 0.0014 |
| 308.15 | 0.2069 | 0.0013 |
| 308.15 | 0.3098 | 0.0013 |
| 308.15 | 0.4009 | 0.0012 |
| 308.15 | 0.4975 | 0.0012 |
| 308.15 | 0.5978 | 0.0011 |
| 308.15 | 0.7008 | 0.0011 |
| 308.15 | 0.7971 | 0.0011 |
| 308.15 | 0.8976 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4084 |
| 298.15 | 0.1094 | 1.4092 |
| 298.15 | 0.2069 | 1.4101 |
| 298.15 | 0.3098 | 1.4112 |
| 298.15 | 0.4009 | 1.4119 |
| 298.15 | 0.4975 | 1.4129 |
| 298.15 | 0.5978 | 1.4144 |
| 298.15 | 0.7008 | 1.4157 |
| 298.15 | 0.7971 | 1.417 |
| 298.15 | 0.8976 | 1.4183 |
| 298.15 | 1.0000 | 1.4202 |
| 303.15 | 0.0000 | 1.406 |
| 303.15 | 0.1094 | 1.4068 |
| 303.15 | 0.2069 | 1.4077 |
| 303.15 | 0.3098 | 1.4087 |
| 303.15 | 0.4009 | 1.4094 |
| 303.15 | 0.4975 | 1.4106 |
| 303.15 | 0.5978 | 1.4118 |
| 303.15 | 0.7008 | 1.4132 |
| 303.15 | 0.7971 | 1.4145 |
| 303.15 | 0.8976 | 1.4158 |
| 303.15 | 1.0000 | 1.417 |
| 308.15 | 0.0000 | 1.4034 |
| 308.15 | 0.1094 | 1.4043 |
| 308.15 | 0.2069 | 1.4052 |
| 308.15 | 0.3098 | 1.4062 |
| 308.15 | 0.4009 | 1.407 |
| 308.15 | 0.4975 | 1.4084 |
| 308.15 | 0.5978 | 1.409 |
| 308.15 | 0.7008 | 1.4106 |
| 308.15 | 0.7971 | 1.412 |
| 308.15 | 0.8976 | 1.4132 |
| 308.15 | 1.0000 | 1.4144 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4084 |
| 298.15 | 0.1094 | 1.4092 |
| 298.15 | 0.2069 | 1.4101 |
| 298.15 | 0.3098 | 1.4112 |
| 298.15 | 0.4009 | 1.4119 |
| 298.15 | 0.4975 | 1.4129 |
| 298.15 | 0.5978 | 1.4144 |
| 298.15 | 0.7008 | 1.4157 |
| 298.15 | 0.7971 | 1.417 |
| 298.15 | 0.8976 | 1.4183 |
| 298.15 | 1.0000 | 1.4202 |
| 303.15 | 0.0000 | 1.406 |
| 303.15 | 0.1094 | 1.4068 |
| 303.15 | 0.2069 | 1.4077 |
| 303.15 | 0.3098 | 1.4087 |
| 303.15 | 0.4009 | 1.4094 |
| 303.15 | 0.4975 | 1.4106 |
| 303.15 | 0.5978 | 1.4118 |
| 303.15 | 0.7008 | 1.4132 |
| 303.15 | 0.7971 | 1.4145 |
| 303.15 | 0.8976 | 1.4158 |
| 303.15 | 1.0000 | 1.417 |
| 308.15 | 0.0000 | 1.4034 |
| 308.15 | 0.1094 | 1.4043 |
| 308.15 | 0.2069 | 1.4052 |
| 308.15 | 0.3098 | 1.4062 |
| 308.15 | 0.4009 | 1.407 |
| 308.15 | 0.4975 | 1.4084 |
| 308.15 | 0.5978 | 1.409 |
| 308.15 | 0.7008 | 1.4106 |
| 308.15 | 0.7971 | 1.412 |
| 308.15 | 0.8976 | 1.4132 |
| 308.15 | 1.0000 | 1.4144 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1072.9 |
| 298.15 | 0.1094 | 1070.9 |
| 298.15 | 0.2069 | 1067.5 |
| 298.15 | 0.3098 | 1064.4 |
| 298.15 | 0.4009 | 1061.1 |
| 298.15 | 0.4975 | 1057.3 |
| 298.15 | 0.5978 | 1052.8 |
| 298.15 | 0.7008 | 1047.7 |
| 298.15 | 0.7971 | 1042.1 |
| 298.15 | 0.8976 | 1035.5 |
| 298.15 | 1.0000 | 1027.6 |
| 303.15 | 0.0000 | 1066.2 |
| 303.15 | 0.1094 | 1064.2 |
| 303.15 | 0.2069 | 1061.4 |
| 303.15 | 0.3098 | 1058.3 |
| 303.15 | 0.4009 | 1055.0 |
| 303.15 | 0.4975 | 1051.1 |
| 303.15 | 0.5978 | 1046.7 |
| 303.15 | 0.7008 | 1041.5 |
| 303.15 | 0.7971 | 1036.1 |
| 303.15 | 0.8976 | 1029.5 |
| 303.15 | 1.0000 | 1021.9 |
| 308.15 | 0.0000 | 1060.8 |
| 308.15 | 0.1094 | 1058.1 |
| 308.15 | 0.2069 | 1055.3 |
| 308.15 | 0.3098 | 1052.1 |
| 308.15 | 0.4009 | 1048.9 |
| 308.15 | 0.4975 | 1045.0 |
| 308.15 | 0.5978 | 1040.6 |
| 308.15 | 0.7008 | 1035.4 |
| 308.15 | 0.7971 | 1029.9 |
| 308.15 | 0.8976 | 1023.6 |
| 308.15 | 1.0000 | 1016.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1072.9 |
| 298.15 | 0.1094 | 1070.9 |
| 298.15 | 0.2069 | 1067.5 |
| 298.15 | 0.3098 | 1064.4 |
| 298.15 | 0.4009 | 1061.1 |
| 298.15 | 0.4975 | 1057.3 |
| 298.15 | 0.5978 | 1052.8 |
| 298.15 | 0.7008 | 1047.7 |
| 298.15 | 0.7971 | 1042.1 |
| 298.15 | 0.8976 | 1035.5 |
| 298.15 | 1.0000 | 1027.6 |
| 303.15 | 0.0000 | 1066.2 |
| 303.15 | 0.1094 | 1064.2 |
| 303.15 | 0.2069 | 1061.4 |
| 303.15 | 0.3098 | 1058.3 |
| 303.15 | 0.4009 | 1055.0 |
| 303.15 | 0.4975 | 1051.1 |
| 303.15 | 0.5978 | 1046.7 |
| 303.15 | 0.7008 | 1041.5 |
| 303.15 | 0.7971 | 1036.1 |
| 303.15 | 0.8976 | 1029.5 |
| 303.15 | 1.0000 | 1021.9 |
| 308.15 | 0.0000 | 1060.8 |
| 308.15 | 0.1094 | 1058.1 |
| 308.15 | 0.2069 | 1055.3 |
| 308.15 | 0.3098 | 1052.1 |
| 308.15 | 0.4009 | 1048.9 |
| 308.15 | 0.4975 | 1045.0 |
| 308.15 | 0.5978 | 1040.6 |
| 308.15 | 0.7008 | 1035.4 |
| 308.15 | 0.7971 | 1029.9 |
| 308.15 | 0.8976 | 1023.6 |
| 308.15 | 1.0000 | 1016.2 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1276.0 |
| 0.1094 | 1284.0 |
| 0.2069 | 1292.0 |
| 0.3098 | 1301.0 |
| 0.4009 | 1310.0 |
| 0.4975 | 1320.0 |
| 0.5978 | 1329.0 |
| 0.7008 | 1337.0 |
| 0.7971 | 1343.0 |
| 0.8976 | 1347.0 |
| 1.0000 | 1348.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1276.0 |
| 0.1094 | 1284.0 |
| 0.2069 | 1292.0 |
| 0.3098 | 1301.0 |
| 0.4009 | 1310.0 |
| 0.4975 | 1320.0 |
| 0.5978 | 1329.0 |
| 0.7008 | 1337.0 |
| 0.7971 | 1343.0 |
| 0.8976 | 1347.0 |
| 1.0000 | 1348.0 |