- Name
- Diethyl Phthalate
- InChI
- InChI=1S/C12H14O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h5-8H,3-4H2,1-2H3
- InChI Key
- FLKPEMZONWLCSK-UHFFFAOYSA-N
- Formula
- C12H14O4
- SMILES
- CCOC(=O)c1ccccc1C(=O)OCC
- Mol. Weight (g/mol)
- 222.24
- CAS
- 84-66-2
- Name
- 1,4-Dioxane
- InChI
- InChI=1S/C4H8O2/c1-2-6-4-3-5-1/h1-4H2
- InChI Key
- RYHBNJHYFVUHQT-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- C1COCCO1
- Mol. Weight (g/mol)
- 88.11
- CAS
- 123-91-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0079 |
| 298.15 | 0.1133 | 0.0065 |
| 298.15 | 0.2083 | 0.0055 |
| 298.15 | 0.3086 | 0.0046 |
| 298.15 | 0.4090 | 0.0038 |
| 298.15 | 0.5026 | 0.0031 |
| 298.15 | 0.5985 | 0.0025 |
| 298.15 | 0.7020 | 0.0020 |
| 298.15 | 0.8001 | 0.0016 |
| 298.15 | 0.8975 | 0.0013 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0061 |
| 303.15 | 0.1133 | 0.0053 |
| 303.15 | 0.2083 | 0.0046 |
| 303.15 | 0.3086 | 0.0038 |
| 303.15 | 0.4090 | 0.0032 |
| 303.15 | 0.5026 | 0.0026 |
| 303.15 | 0.5985 | 0.0022 |
| 303.15 | 0.7020 | 0.0018 |
| 303.15 | 0.8001 | 0.0014 |
| 303.15 | 0.8975 | 0.0012 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0049 |
| 308.15 | 0.1133 | 0.0041 |
| 308.15 | 0.2083 | 0.0036 |
| 308.15 | 0.3086 | 0.0030 |
| 308.15 | 0.4090 | 0.0026 |
| 308.15 | 0.5026 | 0.0022 |
| 308.15 | 0.5985 | 0.0018 |
| 308.15 | 0.7020 | 0.0015 |
| 308.15 | 0.8001 | 0.0012 |
| 308.15 | 0.8975 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0079 |
| 298.15 | 0.1133 | 0.0065 |
| 298.15 | 0.2083 | 0.0055 |
| 298.15 | 0.3086 | 0.0046 |
| 298.15 | 0.4090 | 0.0038 |
| 298.15 | 0.5026 | 0.0031 |
| 298.15 | 0.5985 | 0.0025 |
| 298.15 | 0.7020 | 0.0020 |
| 298.15 | 0.8001 | 0.0016 |
| 298.15 | 0.8975 | 0.0013 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0061 |
| 303.15 | 0.1133 | 0.0053 |
| 303.15 | 0.2083 | 0.0046 |
| 303.15 | 0.3086 | 0.0038 |
| 303.15 | 0.4090 | 0.0032 |
| 303.15 | 0.5026 | 0.0026 |
| 303.15 | 0.5985 | 0.0022 |
| 303.15 | 0.7020 | 0.0018 |
| 303.15 | 0.8001 | 0.0014 |
| 303.15 | 0.8975 | 0.0012 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0049 |
| 308.15 | 0.1133 | 0.0041 |
| 308.15 | 0.2083 | 0.0036 |
| 308.15 | 0.3086 | 0.0030 |
| 308.15 | 0.4090 | 0.0026 |
| 308.15 | 0.5026 | 0.0022 |
| 308.15 | 0.5985 | 0.0018 |
| 308.15 | 0.7020 | 0.0015 |
| 308.15 | 0.8001 | 0.0012 |
| 308.15 | 0.8975 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5001 |
| 298.15 | 0.1133 | 1.4962 |
| 298.15 | 0.2083 | 1.4924 |
| 298.15 | 0.3086 | 1.4882 |
| 298.15 | 0.4090 | 1.4826 |
| 298.15 | 0.5026 | 1.4768 |
| 298.15 | 0.5985 | 1.47 |
| 298.15 | 0.7020 | 1.4608 |
| 298.15 | 0.8001 | 1.4504 |
| 298.15 | 0.8975 | 1.4376 |
| 298.15 | 1.0000 | 1.4202 |
| 303.15 | 0.0000 | 1.4978 |
| 303.15 | 0.1133 | 1.494 |
| 303.15 | 0.2083 | 1.4902 |
| 303.15 | 0.3086 | 1.486 |
| 303.15 | 0.4090 | 1.4805 |
| 303.15 | 0.5026 | 1.4747 |
| 303.15 | 0.5985 | 1.4676 |
| 303.15 | 0.7020 | 1.4585 |
| 303.15 | 0.8001 | 1.4481 |
| 303.15 | 0.8975 | 1.435 |
| 303.15 | 1.0000 | 1.417 |
| 308.15 | 0.0000 | 1.4958 |
| 308.15 | 0.1133 | 1.4917 |
| 308.15 | 0.2083 | 1.4882 |
| 308.15 | 0.3086 | 1.4837 |
| 308.15 | 0.4090 | 1.4783 |
| 308.15 | 0.5026 | 1.4724 |
| 308.15 | 0.5985 | 1.4653 |
| 308.15 | 0.7020 | 1.4564 |
| 308.15 | 0.8001 | 1.4457 |
| 308.15 | 0.8975 | 1.4326 |
| 308.15 | 1.0000 | 1.4144 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5001 |
| 298.15 | 0.1133 | 1.4962 |
| 298.15 | 0.2083 | 1.4924 |
| 298.15 | 0.3086 | 1.4882 |
| 298.15 | 0.4090 | 1.4826 |
| 298.15 | 0.5026 | 1.4768 |
| 298.15 | 0.5985 | 1.47 |
| 298.15 | 0.7020 | 1.4608 |
| 298.15 | 0.8001 | 1.4504 |
| 298.15 | 0.8975 | 1.4376 |
| 298.15 | 1.0000 | 1.4202 |
| 303.15 | 0.0000 | 1.4978 |
| 303.15 | 0.1133 | 1.494 |
| 303.15 | 0.2083 | 1.4902 |
| 303.15 | 0.3086 | 1.486 |
| 303.15 | 0.4090 | 1.4805 |
| 303.15 | 0.5026 | 1.4747 |
| 303.15 | 0.5985 | 1.4676 |
| 303.15 | 0.7020 | 1.4585 |
| 303.15 | 0.8001 | 1.4481 |
| 303.15 | 0.8975 | 1.435 |
| 303.15 | 1.0000 | 1.417 |
| 308.15 | 0.0000 | 1.4958 |
| 308.15 | 0.1133 | 1.4917 |
| 308.15 | 0.2083 | 1.4882 |
| 308.15 | 0.3086 | 1.4837 |
| 308.15 | 0.4090 | 1.4783 |
| 308.15 | 0.5026 | 1.4724 |
| 308.15 | 0.5985 | 1.4653 |
| 308.15 | 0.7020 | 1.4564 |
| 308.15 | 0.8001 | 1.4457 |
| 308.15 | 0.8975 | 1.4326 |
| 308.15 | 1.0000 | 1.4144 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1115.1 |
| 298.15 | 0.1133 | 1110.7 |
| 298.15 | 0.2083 | 1106.5 |
| 298.15 | 0.3086 | 1101.4 |
| 298.15 | 0.4090 | 1095.5 |
| 298.15 | 0.5026 | 1089.1 |
| 298.15 | 0.5985 | 1081.4 |
| 298.15 | 0.7020 | 1071.6 |
| 298.15 | 0.8001 | 1060.2 |
| 298.15 | 0.8975 | 1046.3 |
| 298.15 | 1.0000 | 1027.6 |
| 303.15 | 0.0000 | 1110.2 |
| 303.15 | 0.1133 | 1105.8 |
| 303.15 | 0.2083 | 1101.5 |
| 303.15 | 0.3086 | 1096.3 |
| 303.15 | 0.4090 | 1090.4 |
| 303.15 | 0.5026 | 1084.0 |
| 303.15 | 0.5985 | 1076.1 |
| 303.15 | 0.7020 | 1066.1 |
| 303.15 | 0.8001 | 1054.7 |
| 303.15 | 0.8975 | 1040.7 |
| 303.15 | 1.0000 | 1021.9 |
| 308.15 | 0.0000 | 1105.6 |
| 308.15 | 0.1133 | 1101.0 |
| 308.15 | 0.2083 | 1096.6 |
| 308.15 | 0.3086 | 1091.4 |
| 308.15 | 0.4090 | 1085.3 |
| 308.15 | 0.5026 | 1078.7 |
| 308.15 | 0.5985 | 1070.9 |
| 308.15 | 0.7020 | 1060.8 |
| 308.15 | 0.8001 | 1049.2 |
| 308.15 | 0.8975 | 1035.0 |
| 308.15 | 1.0000 | 1016.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1115.1 |
| 298.15 | 0.1133 | 1110.7 |
| 298.15 | 0.2083 | 1106.5 |
| 298.15 | 0.3086 | 1101.4 |
| 298.15 | 0.4090 | 1095.5 |
| 298.15 | 0.5026 | 1089.1 |
| 298.15 | 0.5985 | 1081.4 |
| 298.15 | 0.7020 | 1071.6 |
| 298.15 | 0.8001 | 1060.2 |
| 298.15 | 0.8975 | 1046.3 |
| 298.15 | 1.0000 | 1027.6 |
| 303.15 | 0.0000 | 1110.2 |
| 303.15 | 0.1133 | 1105.8 |
| 303.15 | 0.2083 | 1101.5 |
| 303.15 | 0.3086 | 1096.3 |
| 303.15 | 0.4090 | 1090.4 |
| 303.15 | 0.5026 | 1084.0 |
| 303.15 | 0.5985 | 1076.1 |
| 303.15 | 0.7020 | 1066.1 |
| 303.15 | 0.8001 | 1054.7 |
| 303.15 | 0.8975 | 1040.7 |
| 303.15 | 1.0000 | 1021.9 |
| 308.15 | 0.0000 | 1105.6 |
| 308.15 | 0.1133 | 1101.0 |
| 308.15 | 0.2083 | 1096.6 |
| 308.15 | 0.3086 | 1091.4 |
| 308.15 | 0.4090 | 1085.3 |
| 308.15 | 0.5026 | 1078.7 |
| 308.15 | 0.5985 | 1070.9 |
| 308.15 | 0.7020 | 1060.8 |
| 308.15 | 0.8001 | 1049.2 |
| 308.15 | 0.8975 | 1035.0 |
| 308.15 | 1.0000 | 1016.2 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1446.0 |
| 0.1133 | 1435.0 |
| 0.2083 | 1427.0 |
| 0.3086 | 1418.0 |
| 0.4090 | 1408.0 |
| 0.5026 | 1399.0 |
| 0.5985 | 1390.0 |
| 0.7020 | 1380.0 |
| 0.8001 | 1370.0 |
| 0.8975 | 1359.0 |
| 1.0000 | 1347.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1446.0 |
| 0.1133 | 1435.0 |
| 0.2083 | 1427.0 |
| 0.3086 | 1418.0 |
| 0.4090 | 1408.0 |
| 0.5026 | 1399.0 |
| 0.5985 | 1390.0 |
| 0.7020 | 1380.0 |
| 0.8001 | 1370.0 |
| 0.8975 | 1359.0 |
| 1.0000 | 1347.0 |