- Name
- 1,4-Dioxane
- InChI
- InChI=1S/C4H8O2/c1-2-6-4-3-5-1/h1-4H2
- InChI Key
- RYHBNJHYFVUHQT-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- C1COCCO1
- Mol. Weight (g/mol)
- 88.11
- CAS
- 123-91-1
- Name
- Di-n-octyl phthalate
- InChI
- InChI=1S/C24H38O4/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3
- InChI Key
- MQIUGAXCHLFZKX-UHFFFAOYSA-N
- Formula
- C24H38O4
- SMILES
-
CCCCCCCCOC(=O)c1ccccc1C(=O)OCC
CCCCCC - Mol. Weight (g/mol)
- 390.56
- CAS
- 117-84-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0430 |
| 298.15 | 0.1337 | 0.0326 |
| 298.15 | 0.2243 | 0.0264 |
| 298.15 | 0.3207 | 0.0207 |
| 298.15 | 0.4226 | 0.0154 |
| 298.15 | 0.5169 | 0.0110 |
| 298.15 | 0.6054 | 0.0081 |
| 298.15 | 0.7161 | 0.0049 |
| 298.15 | 0.8031 | 0.0032 |
| 298.15 | 0.9017 | 0.0019 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0302 |
| 303.15 | 0.1337 | 0.0250 |
| 303.15 | 0.2243 | 0.0204 |
| 303.15 | 0.3207 | 0.0161 |
| 303.15 | 0.4226 | 0.0121 |
| 303.15 | 0.5169 | 0.0089 |
| 303.15 | 0.6054 | 0.0065 |
| 303.15 | 0.7161 | 0.0041 |
| 303.15 | 0.8031 | 0.0027 |
| 303.15 | 0.9017 | 0.0016 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0219 |
| 308.15 | 0.1337 | 0.0174 |
| 308.15 | 0.2243 | 0.0144 |
| 308.15 | 0.3207 | 0.0115 |
| 308.15 | 0.4226 | 0.0088 |
| 308.15 | 0.5169 | 0.0067 |
| 308.15 | 0.6054 | 0.0050 |
| 308.15 | 0.7161 | 0.0032 |
| 308.15 | 0.8031 | 0.0022 |
| 308.15 | 0.9017 | 0.0014 |
| 308.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0430 |
| 298.15 | 0.1337 | 0.0326 |
| 298.15 | 0.2243 | 0.0264 |
| 298.15 | 0.3207 | 0.0207 |
| 298.15 | 0.4226 | 0.0154 |
| 298.15 | 0.5169 | 0.0110 |
| 298.15 | 0.6054 | 0.0081 |
| 298.15 | 0.7161 | 0.0049 |
| 298.15 | 0.8031 | 0.0032 |
| 298.15 | 0.9017 | 0.0019 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0302 |
| 303.15 | 0.1337 | 0.0250 |
| 303.15 | 0.2243 | 0.0204 |
| 303.15 | 0.3207 | 0.0161 |
| 303.15 | 0.4226 | 0.0121 |
| 303.15 | 0.5169 | 0.0089 |
| 303.15 | 0.6054 | 0.0065 |
| 303.15 | 0.7161 | 0.0041 |
| 303.15 | 0.8031 | 0.0027 |
| 303.15 | 0.9017 | 0.0016 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0219 |
| 308.15 | 0.1337 | 0.0174 |
| 308.15 | 0.2243 | 0.0144 |
| 308.15 | 0.3207 | 0.0115 |
| 308.15 | 0.4226 | 0.0088 |
| 308.15 | 0.5169 | 0.0067 |
| 308.15 | 0.6054 | 0.0050 |
| 308.15 | 0.7161 | 0.0032 |
| 308.15 | 0.8031 | 0.0022 |
| 308.15 | 0.9017 | 0.0014 |
| 308.15 | 1.0000 | 0.0010 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.485 |
| 298.15 | 0.1337 | 1.4836 |
| 298.15 | 0.2243 | 1.4822 |
| 298.15 | 0.3207 | 1.4812 |
| 298.15 | 0.4226 | 1.4781 |
| 298.15 | 0.5169 | 1.4733 |
| 298.15 | 0.6054 | 1.4692 |
| 298.15 | 0.7161 | 1.463 |
| 298.15 | 0.8031 | 1.4566 |
| 298.15 | 0.9017 | 1.4422 |
| 298.15 | 1.0000 | 1.4202 |
| 303.15 | 0.0000 | 1.4831 |
| 303.15 | 0.1337 | 1.4819 |
| 303.15 | 0.2243 | 1.4798 |
| 303.15 | 0.3207 | 1.4784 |
| 303.15 | 0.4226 | 1.4771 |
| 303.15 | 0.5169 | 1.4717 |
| 303.15 | 0.6054 | 1.4673 |
| 303.15 | 0.7161 | 1.461 |
| 303.15 | 0.8031 | 1.4541 |
| 303.15 | 0.9017 | 1.4401 |
| 303.15 | 1.0000 | 1.417 |
| 308.15 | 0.0000 | 1.481 |
| 308.15 | 0.1337 | 1.4804 |
| 308.15 | 0.2243 | 1.4775 |
| 308.15 | 0.3207 | 1.4756 |
| 308.15 | 0.4226 | 1.4762 |
| 308.15 | 0.5169 | 1.47 |
| 308.15 | 0.6054 | 1.4652 |
| 308.15 | 0.7161 | 1.46 |
| 308.15 | 0.8031 | 1.4516 |
| 308.15 | 0.9017 | 1.4379 |
| 308.15 | 1.0000 | 1.4144 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.485 |
| 298.15 | 0.1337 | 1.4836 |
| 298.15 | 0.2243 | 1.4822 |
| 298.15 | 0.3207 | 1.4812 |
| 298.15 | 0.4226 | 1.4781 |
| 298.15 | 0.5169 | 1.4733 |
| 298.15 | 0.6054 | 1.4692 |
| 298.15 | 0.7161 | 1.463 |
| 298.15 | 0.8031 | 1.4566 |
| 298.15 | 0.9017 | 1.4422 |
| 298.15 | 1.0000 | 1.4202 |
| 303.15 | 0.0000 | 1.4831 |
| 303.15 | 0.1337 | 1.4819 |
| 303.15 | 0.2243 | 1.4798 |
| 303.15 | 0.3207 | 1.4784 |
| 303.15 | 0.4226 | 1.4771 |
| 303.15 | 0.5169 | 1.4717 |
| 303.15 | 0.6054 | 1.4673 |
| 303.15 | 0.7161 | 1.461 |
| 303.15 | 0.8031 | 1.4541 |
| 303.15 | 0.9017 | 1.4401 |
| 303.15 | 1.0000 | 1.417 |
| 308.15 | 0.0000 | 1.481 |
| 308.15 | 0.1337 | 1.4804 |
| 308.15 | 0.2243 | 1.4775 |
| 308.15 | 0.3207 | 1.4756 |
| 308.15 | 0.4226 | 1.4762 |
| 308.15 | 0.5169 | 1.47 |
| 308.15 | 0.6054 | 1.4652 |
| 308.15 | 0.7161 | 1.46 |
| 308.15 | 0.8031 | 1.4516 |
| 308.15 | 0.9017 | 1.4379 |
| 308.15 | 1.0000 | 1.4144 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 980.7 |
| 298.15 | 0.1337 | 982.2 |
| 298.15 | 0.2243 | 983.4 |
| 298.15 | 0.3207 | 984.8 |
| 298.15 | 0.4226 | 986.5 |
| 298.15 | 0.5169 | 988.4 |
| 298.15 | 0.6054 | 990.7 |
| 298.15 | 0.7161 | 995.0 |
| 298.15 | 0.8031 | 1000.2 |
| 298.15 | 0.9017 | 1009.9 |
| 298.15 | 1.0000 | 1027.6 |
| 303.15 | 0.0000 | 977.1 |
| 303.15 | 0.1337 | 978.3 |
| 303.15 | 0.2243 | 979.4 |
| 303.15 | 0.3207 | 980.5 |
| 303.15 | 0.4226 | 982.2 |
| 303.15 | 0.5169 | 983.9 |
| 303.15 | 0.6054 | 986.3 |
| 303.15 | 0.7161 | 990.5 |
| 303.15 | 0.8031 | 995.4 |
| 303.15 | 0.9017 | 1004.6 |
| 303.15 | 1.0000 | 1021.9 |
| 308.15 | 0.0000 | 973.1 |
| 308.15 | 0.1337 | 974.4 |
| 308.15 | 0.2243 | 975.2 |
| 308.15 | 0.3207 | 976.4 |
| 308.15 | 0.4226 | 977.8 |
| 308.15 | 0.5169 | 979.6 |
| 308.15 | 0.6054 | 981.9 |
| 308.15 | 0.7161 | 985.9 |
| 308.15 | 0.8031 | 990.6 |
| 308.15 | 0.9017 | 999.5 |
| 308.15 | 1.0000 | 1016.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 980.7 |
| 298.15 | 0.1337 | 982.2 |
| 298.15 | 0.2243 | 983.4 |
| 298.15 | 0.3207 | 984.8 |
| 298.15 | 0.4226 | 986.5 |
| 298.15 | 0.5169 | 988.4 |
| 298.15 | 0.6054 | 990.7 |
| 298.15 | 0.7161 | 995.0 |
| 298.15 | 0.8031 | 1000.2 |
| 298.15 | 0.9017 | 1009.9 |
| 298.15 | 1.0000 | 1027.6 |
| 303.15 | 0.0000 | 977.1 |
| 303.15 | 0.1337 | 978.3 |
| 303.15 | 0.2243 | 979.4 |
| 303.15 | 0.3207 | 980.5 |
| 303.15 | 0.4226 | 982.2 |
| 303.15 | 0.5169 | 983.9 |
| 303.15 | 0.6054 | 986.3 |
| 303.15 | 0.7161 | 990.5 |
| 303.15 | 0.8031 | 995.4 |
| 303.15 | 0.9017 | 1004.6 |
| 303.15 | 1.0000 | 1021.9 |
| 308.15 | 0.0000 | 973.1 |
| 308.15 | 0.1337 | 974.4 |
| 308.15 | 0.2243 | 975.2 |
| 308.15 | 0.3207 | 976.4 |
| 308.15 | 0.4226 | 977.8 |
| 308.15 | 0.5169 | 979.6 |
| 308.15 | 0.6054 | 981.9 |
| 308.15 | 0.7161 | 985.9 |
| 308.15 | 0.8031 | 990.6 |
| 308.15 | 0.9017 | 999.5 |
| 308.15 | 1.0000 | 1016.2 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of 1,4-Dioxane (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1421.0 |
| 0.1337 | 1416.0 |
| 0.2243 | 1412.0 |
| 0.3207 | 1406.0 |
| 0.4226 | 1400.0 |
| 0.5169 | 1394.0 |
| 0.6054 | 1388.0 |
| 0.7161 | 1379.0 |
| 0.8031 | 1372.0 |
| 0.9017 | 1361.0 |
| 1.0000 | 1348.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of 1,4-Dioxane (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1421.0 |
| 0.1337 | 1416.0 |
| 0.2243 | 1412.0 |
| 0.3207 | 1406.0 |
| 0.4226 | 1400.0 |
| 0.5169 | 1394.0 |
| 0.6054 | 1388.0 |
| 0.7161 | 1379.0 |
| 0.8031 | 1372.0 |
| 0.9017 | 1361.0 |
| 1.0000 | 1348.0 |