- Name
- Diisopropyl ether
- InChI
- InChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3
- InChI Key
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N
- Formula
- C6H14O
- SMILES
- CC(C)OC(C)C
- Mol. Weight (g/mol)
- 102.17
- CAS
- 108-20-3
- Name
- p-Xylene
- InChI
- InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3
- InChI Key
- URLKBWYHVLBVBO-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccc(C)cc1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 106-42-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Surface tension liquid-gas, N/m [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Mole fraction of Diisopropyl ether (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 0.0988 | 0.0263 |
| 0.2012 | 0.0248 |
| 0.2991 | 0.0237 |
| 0.4045 | 0.0227 |
| 0.5096 | 0.0217 |
| 0.6030 | 0.0208 |
| 0.7000 | 0.0199 |
| 0.7987 | 0.0190 |
| 0.8980 | 0.0182 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Mole fraction of Diisopropyl ether (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 0.0988 | 0.0263 |
| 0.2012 | 0.0248 |
| 0.2991 | 0.0237 |
| 0.4045 | 0.0227 |
| 0.5096 | 0.0217 |
| 0.6030 | 0.0208 |
| 0.7000 | 0.0199 |
| 0.7987 | 0.0190 |
| 0.8980 | 0.0182 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (1) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0527 | -1.3600e-07 |
| 0.1016 | -2.7900e-07 |
| 0.1500 | -3.9800e-07 |
| 0.2011 | -5.1000e-07 |
| 0.2527 | -5.8800e-07 |
| 0.3004 | -6.5800e-07 |
| 0.3509 | -7.3000e-07 |
| 0.4007 | -7.6100e-07 |
| 0.4506 | -7.8500e-07 |
| 0.5044 | -8.0200e-07 |
| 0.5507 | -7.9500e-07 |
| 0.6002 | -7.8700e-07 |
| 0.6498 | -7.5600e-07 |
| 0.7007 | -7.0200e-07 |
| 0.7497 | -6.2500e-07 |
| 0.7999 | -5.3700e-07 |
| 0.8512 | -4.3200e-07 |
| 0.9000 | -3.1800e-07 |
| 0.9507 | -1.7800e-07 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (1) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.0527 | -1.3600e-07 |
| 0.1016 | -2.7900e-07 |
| 0.1500 | -3.9800e-07 |
| 0.2011 | -5.1000e-07 |
| 0.2527 | -5.8800e-07 |
| 0.3004 | -6.5800e-07 |
| 0.3509 | -7.3000e-07 |
| 0.4007 | -7.6100e-07 |
| 0.4506 | -7.8500e-07 |
| 0.5044 | -8.0200e-07 |
| 0.5507 | -7.9500e-07 |
| 0.6002 | -7.8700e-07 |
| 0.6498 | -7.5600e-07 |
| 0.7007 | -7.0200e-07 |
| 0.7497 | -6.2500e-07 |
| 0.7999 | -5.3700e-07 |
| 0.8512 | -4.3200e-07 |
| 0.9000 | -3.1800e-07 |
| 0.9507 | -1.7800e-07 |