- Name
- Acetic acid
- InChI
- InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
- InChI Key
- QTBSBXVTEAMEQO-UHFFFAOYSA-N
- Formula
- C2H4O2
- SMILES
- CC(=O)O
- Mol. Weight (g/mol)
- 60.05
- CAS
- 64-19-7
- Name
- Methyl Alcohol
- InChI
- InChI=1S/CH4O/c1-2/h2H,1H3
- InChI Key
- OKKJLVBELUTLKV-UHFFFAOYSA-N
- Formula
- CH4O
- SMILES
- CO
- Mol. Weight (g/mol)
- 32.04
- CAS
- 67-56-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
- Tboil - Boiling temperature at pressure P, K (6)
- Vapor Liquid Equilibrium at Constant Pressure
- Vapor Liquid Equilibrium at Constant Temperature (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0006 |
| 293.15 | 0.0498 | 0.0006 |
| 293.15 | 0.1006 | 0.0007 |
| 293.15 | 0.2016 | 0.0008 |
| 293.15 | 0.2995 | 0.0009 |
| 293.15 | 0.4010 | 0.0010 |
| 293.15 | 0.4992 | 0.0012 |
| 293.15 | 0.5996 | 0.0013 |
| 293.15 | 0.6998 | 0.0014 |
| 293.15 | 0.7969 | 0.0014 |
| 293.15 | 0.9555 | 0.0013 |
| 293.15 | 1.0000 | 0.0012 |
| 298.15 | 0.0000 | 0.0005 |
| 298.15 | 0.0498 | 0.0006 |
| 298.15 | 0.1006 | 0.0006 |
| 298.15 | 0.2016 | 0.0007 |
| 298.15 | 0.2995 | 0.0008 |
| 298.15 | 0.4010 | 0.0010 |
| 298.15 | 0.4992 | 0.0011 |
| 298.15 | 0.5996 | 0.0012 |
| 298.15 | 0.6998 | 0.0012 |
| 298.15 | 0.7969 | 0.0013 |
| 298.15 | 0.9000 | 0.0012 |
| 298.15 | 0.9555 | 0.0012 |
| 298.15 | 1.0000 | 0.0011 |
| 303.15 | 0.0000 | 0.0005 |
| 303.15 | 0.0498 | 0.0005 |
| 303.15 | 0.1006 | 0.0006 |
| 303.15 | 0.2016 | 0.0007 |
| 303.15 | 0.2995 | 0.0008 |
| 303.15 | 0.4010 | 0.0009 |
| 303.15 | 0.4992 | 0.0010 |
| 303.15 | 0.5996 | 0.0011 |
| 303.15 | 0.6998 | 0.0011 |
| 303.15 | 0.7969 | 0.0012 |
| 303.15 | 0.9000 | 0.0011 |
| 303.15 | 0.9555 | 0.0011 |
| 303.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0006 |
| 293.15 | 0.0498 | 0.0006 |
| 293.15 | 0.1006 | 0.0007 |
| 293.15 | 0.2016 | 0.0008 |
| 293.15 | 0.2995 | 0.0009 |
| 293.15 | 0.4010 | 0.0010 |
| 293.15 | 0.4992 | 0.0012 |
| 293.15 | 0.5996 | 0.0013 |
| 293.15 | 0.6998 | 0.0014 |
| 293.15 | 0.7969 | 0.0014 |
| 293.15 | 0.9555 | 0.0013 |
| 293.15 | 1.0000 | 0.0012 |
| 298.15 | 0.0000 | 0.0005 |
| 298.15 | 0.0498 | 0.0006 |
| 298.15 | 0.1006 | 0.0006 |
| 298.15 | 0.2016 | 0.0007 |
| 298.15 | 0.2995 | 0.0008 |
| 298.15 | 0.4010 | 0.0010 |
| 298.15 | 0.4992 | 0.0011 |
| 298.15 | 0.5996 | 0.0012 |
| 298.15 | 0.6998 | 0.0012 |
| 298.15 | 0.7969 | 0.0013 |
| 298.15 | 0.9000 | 0.0012 |
| 298.15 | 0.9555 | 0.0012 |
| 298.15 | 1.0000 | 0.0011 |
| 303.15 | 0.0000 | 0.0005 |
| 303.15 | 0.0498 | 0.0005 |
| 303.15 | 0.1006 | 0.0006 |
| 303.15 | 0.2016 | 0.0007 |
| 303.15 | 0.2995 | 0.0008 |
| 303.15 | 0.4010 | 0.0009 |
| 303.15 | 0.4992 | 0.0010 |
| 303.15 | 0.5996 | 0.0011 |
| 303.15 | 0.6998 | 0.0011 |
| 303.15 | 0.7969 | 0.0012 |
| 303.15 | 0.9000 | 0.0011 |
| 303.15 | 0.9555 | 0.0011 |
| 303.15 | 1.0000 | 0.0010 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 791.9 |
| 293.15 | 0.0498 | 811.92 |
| 293.15 | 0.1006 | 831.39 |
| 293.15 | 0.2016 | 867.61 |
| 293.15 | 0.2995 | 899.77 |
| 293.15 | 0.4010 | 929.99 |
| 293.15 | 0.4992 | 956.37 |
| 293.15 | 0.5996 | 980.68 |
| 293.15 | 0.6998 | 1001.88 |
| 293.15 | 0.7969 | 1020.24 |
| 293.15 | 0.9555 | 1043.82 |
| 293.15 | 1.0000 | 1049.3 |
| 298.15 | 0.0000 | 787.2 |
| 298.15 | 0.0498 | 807.17 |
| 298.15 | 0.1006 | 826.6 |
| 298.15 | 0.2016 | 862.71 |
| 298.15 | 0.2995 | 894.77 |
| 298.15 | 0.4010 | 924.88 |
| 298.15 | 0.4992 | 951.16 |
| 298.15 | 0.5996 | 975.36 |
| 298.15 | 0.6998 | 996.46 |
| 298.15 | 0.7969 | 1014.72 |
| 298.15 | 0.9000 | 1031.06 |
| 298.15 | 0.9555 | 1038.2 |
| 298.15 | 1.0000 | 1043.65 |
| 303.15 | 0.0000 | 782.48 |
| 303.15 | 0.0498 | 802.41 |
| 303.15 | 0.1006 | 821.79 |
| 303.15 | 0.2016 | 857.79 |
| 303.15 | 0.2995 | 889.74 |
| 303.15 | 0.4010 | 919.75 |
| 303.15 | 0.4992 | 945.92 |
| 303.15 | 0.5996 | 970.01 |
| 303.15 | 0.6998 | 991.01 |
| 303.15 | 0.7969 | 1009.19 |
| 303.15 | 0.9000 | 1025.45 |
| 303.15 | 0.9555 | 1032.56 |
| 303.15 | 1.0000 | 1038.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 791.9 |
| 293.15 | 0.0498 | 811.92 |
| 293.15 | 0.1006 | 831.39 |
| 293.15 | 0.2016 | 867.61 |
| 293.15 | 0.2995 | 899.77 |
| 293.15 | 0.4010 | 929.99 |
| 293.15 | 0.4992 | 956.37 |
| 293.15 | 0.5996 | 980.68 |
| 293.15 | 0.6998 | 1001.88 |
| 293.15 | 0.7969 | 1020.24 |
| 293.15 | 0.9555 | 1043.82 |
| 293.15 | 1.0000 | 1049.3 |
| 298.15 | 0.0000 | 787.2 |
| 298.15 | 0.0498 | 807.17 |
| 298.15 | 0.1006 | 826.6 |
| 298.15 | 0.2016 | 862.71 |
| 298.15 | 0.2995 | 894.77 |
| 298.15 | 0.4010 | 924.88 |
| 298.15 | 0.4992 | 951.16 |
| 298.15 | 0.5996 | 975.36 |
| 298.15 | 0.6998 | 996.46 |
| 298.15 | 0.7969 | 1014.72 |
| 298.15 | 0.9000 | 1031.06 |
| 298.15 | 0.9555 | 1038.2 |
| 298.15 | 1.0000 | 1043.65 |
| 303.15 | 0.0000 | 782.48 |
| 303.15 | 0.0498 | 802.41 |
| 303.15 | 0.1006 | 821.79 |
| 303.15 | 0.2016 | 857.79 |
| 303.15 | 0.2995 | 889.74 |
| 303.15 | 0.4010 | 919.75 |
| 303.15 | 0.4992 | 945.92 |
| 303.15 | 0.5996 | 970.01 |
| 303.15 | 0.6998 | 991.01 |
| 303.15 | 0.7969 | 1009.19 |
| 303.15 | 0.9000 | 1025.45 |
| 303.15 | 0.9555 | 1032.56 |
| 303.15 | 1.0000 | 1038.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1121.0 |
| 293.15 | 0.0498 | 1133.0 |
| 293.15 | 0.1006 | 1143.0 |
| 293.15 | 0.2016 | 1162.0 |
| 293.15 | 0.2995 | 1178.0 |
| 293.15 | 0.4010 | 1189.0 |
| 293.15 | 0.4992 | 1196.0 |
| 293.15 | 0.5996 | 1198.0 |
| 293.15 | 0.6998 | 1195.0 |
| 293.15 | 0.7969 | 1187.0 |
| 293.15 | 0.9555 | 1162.0 |
| 293.15 | 1.0000 | 1149.0 |
| 298.15 | 0.0000 | 1104.0 |
| 298.15 | 0.0498 | 1116.0 |
| 298.15 | 0.1006 | 1127.0 |
| 298.15 | 0.2016 | 1146.0 |
| 298.15 | 0.2995 | 1161.0 |
| 298.15 | 0.4010 | 1172.0 |
| 298.15 | 0.4992 | 1179.0 |
| 298.15 | 0.5996 | 1181.0 |
| 298.15 | 0.6998 | 1178.0 |
| 298.15 | 0.7969 | 1170.0 |
| 298.15 | 0.9000 | 1156.0 |
| 298.15 | 0.9555 | 1145.0 |
| 298.15 | 1.0000 | 1132.0 |
| 303.15 | 0.0000 | 1088.0 |
| 303.15 | 0.0498 | 1100.0 |
| 303.15 | 0.1006 | 1111.0 |
| 303.15 | 0.2016 | 1130.0 |
| 303.15 | 0.2995 | 1145.0 |
| 303.15 | 0.4010 | 1156.0 |
| 303.15 | 0.4992 | 1162.0 |
| 303.15 | 0.5996 | 1164.0 |
| 303.15 | 0.6998 | 1161.0 |
| 303.15 | 0.7969 | 1153.0 |
| 303.15 | 0.9000 | 1138.0 |
| 303.15 | 0.9555 | 1128.0 |
| 303.15 | 1.0000 | 1115.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetic acid (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1121.0 |
| 293.15 | 0.0498 | 1133.0 |
| 293.15 | 0.1006 | 1143.0 |
| 293.15 | 0.2016 | 1162.0 |
| 293.15 | 0.2995 | 1178.0 |
| 293.15 | 0.4010 | 1189.0 |
| 293.15 | 0.4992 | 1196.0 |
| 293.15 | 0.5996 | 1198.0 |
| 293.15 | 0.6998 | 1195.0 |
| 293.15 | 0.7969 | 1187.0 |
| 293.15 | 0.9555 | 1162.0 |
| 293.15 | 1.0000 | 1149.0 |
| 298.15 | 0.0000 | 1104.0 |
| 298.15 | 0.0498 | 1116.0 |
| 298.15 | 0.1006 | 1127.0 |
| 298.15 | 0.2016 | 1146.0 |
| 298.15 | 0.2995 | 1161.0 |
| 298.15 | 0.4010 | 1172.0 |
| 298.15 | 0.4992 | 1179.0 |
| 298.15 | 0.5996 | 1181.0 |
| 298.15 | 0.6998 | 1178.0 |
| 298.15 | 0.7969 | 1170.0 |
| 298.15 | 0.9000 | 1156.0 |
| 298.15 | 0.9555 | 1145.0 |
| 298.15 | 1.0000 | 1132.0 |
| 303.15 | 0.0000 | 1088.0 |
| 303.15 | 0.0498 | 1100.0 |
| 303.15 | 0.1006 | 1111.0 |
| 303.15 | 0.2016 | 1130.0 |
| 303.15 | 0.2995 | 1145.0 |
| 303.15 | 0.4010 | 1156.0 |
| 303.15 | 0.4992 | 1162.0 |
| 303.15 | 0.5996 | 1164.0 |
| 303.15 | 0.6998 | 1161.0 |
| 303.15 | 0.7969 | 1153.0 |
| 303.15 | 0.9000 | 1138.0 |
| 303.15 | 0.9555 | 1128.0 |
| 303.15 | 1.0000 | 1115.0 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 77.3 (Liquid)
| Mole fraction of Methyl Alcohol (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.1810 | 365.75 |
| 0.2250 | 361.95 |
| 0.5520 | 346.45 |
| 0.6470 | 343.35 |
| 0.7670 | 339.25 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 77.3 (Gas)
| Mole fraction of Methyl Alcohol (2) - Gas | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.3830 | 365.75 |
| 0.5070 | 361.95 |
| 0.8410 | 346.45 |
| 0.8790 | 343.35 |
| 0.9430 | 339.25 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Methyl Alcohol (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 390.15 |
| 0.0361 | 385.66 |
| 0.0408 | 385.40 |
| 0.0650 | 382.20 |
| 0.0739 | 380.80 |
| 0.0862 | 380.10 |
| 0.1035 | 378.36 |
| 0.1272 | 375.40 |
| 0.1626 | 372.86 |
| 0.1920 | 369.88 |
| 0.2505 | 366.80 |
| 0.3390 | 361.00 |
| 0.4400 | 356.33 |
| 0.5833 | 350.10 |
| 0.7043 | 346.20 |
| 0.7511 | 344.60 |
| 0.8106 | 342.55 |
| 0.8704 | 341.60 |
| 0.9156 | 340.48 |
| 1.0000 | 338.15 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 77.3 (Liquid)
| Mole fraction of Methyl Alcohol (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.1810 | 365.75 |
| 0.2250 | 361.95 |
| 0.5520 | 346.45 |
| 0.6470 | 343.35 |
| 0.7670 | 339.25 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 77.3 (Gas)
| Mole fraction of Methyl Alcohol (2) - Gas | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.3830 | 365.75 |
| 0.5070 | 361.95 |
| 0.8410 | 346.45 |
| 0.8790 | 343.35 |
| 0.9430 | 339.25 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Methyl Alcohol (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 390.15 |
| 0.0361 | 385.66 |
| 0.0408 | 385.40 |
| 0.0650 | 382.20 |
| 0.0739 | 380.80 |
| 0.0862 | 380.10 |
| 0.1035 | 378.36 |
| 0.1272 | 375.40 |
| 0.1626 | 372.86 |
| 0.1920 | 369.88 |
| 0.2505 | 366.80 |
| 0.3390 | 361.00 |
| 0.4400 | 356.33 |
| 0.5833 | 350.10 |
| 0.7043 | 346.20 |
| 0.7511 | 344.60 |
| 0.8106 | 342.55 |
| 0.8704 | 341.60 |
| 0.9156 | 340.48 |
| 1.0000 | 338.15 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 94.13 (VLE)
| Fixed | Measured | |
|---|---|---|
| T [K] - VLE | x1[mol/mol] of Methyl Alcohol (2) - Liquid | y1[mol/mol] of Methyl Alcohol (2) - Vapour |
| 388.95 | 0.0000 | 0.0000 |
| 385.15 | 0.0370 | 0.1090 |
| 383.05 | 0.0580 | 0.1650 |
| 378.15 | 0.1070 | 0.3030 |
| 375.95 | 0.1370 | 0.3530 |
| 370.55 | 0.2080 | 0.4910 |
| 367.95 | 0.2500 | 0.5560 |
| 365.85 | 0.2800 | 0.6030 |
| 364.85 | 0.3060 | 0.6300 |
| 359.95 | 0.3870 | 0.7350 |
| 357.85 | 0.4270 | 0.7760 |
| 354.85 | 0.4920 | 0.8310 |
| 353.05 | 0.5170 | 0.8530 |
| 349.15 | 0.6010 | 0.9110 |
| 346.85 | 0.6570 | 0.9340 |
| 344.75 | 0.7130 | 0.9510 |
| 342.25 | 0.7850 | 0.9710 |
| 340.45 | 0.8390 | 0.9830 |
| 339.05 | 0.8820 | 0.9890 |
| 336.95 | 0.9590 | 0.9960 |
| 336.15 | 0.9950 | 0.9990 |
| 336.05 | 1.0000 | 1.0000 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 308.15 (VLE)
| P [kPa] - VLE | x1[mol/mol] of Methyl Alcohol (2) - Liquid |
|---|---|
| 3.5864 | 0.0000 |
| 5.3 | 0.1040 |
| 5.546 | 0.1200 |
| 7.379 | 0.2150 |
| 10.01 | 0.3500 |
| 10.89 | 0.3890 |
| 13.11 | 0.4600 |
| 16.16 | 0.5900 |
| 18.93 | 0.6910 |
| 20.64 | 0.7470 |
| 28.02 | 1.0000 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 318.15 (VLE)
| P [kPa] - VLE | x1[mol/mol] of Methyl Alcohol (2) - Liquid |
|---|---|
| 5.813 | 0.0000 |
| 8.546 | 0.1040 |
| 9.053 | 0.1200 |
| 11.84 | 0.2150 |
| 16.111 | 0.3500 |
| 17.771 | 0.3890 |
| 20.9 | 0.4600 |
| 26.82 | 0.5900 |
| 31.24 | 0.6910 |
| 33.891 | 0.7470 |
| 44.68 | 1.0000 |
Sources
- Dortmund Data Bank Vapor-Liquid Equilibrium Data
- Experimental measurements of vapor liquid equilibria at low pressure: Systems containing alcohols, esters and organic acids
- Dynamic Viscosities, Densities, and Speed of Sound and Derived Properties of the Binary Systems Acetic Acid with Water, Methanol, Ethanol, Ethyl Acetate and Methyl Acetate at T = (293.15, 298.15, and 303.15) K at Atmospheric Pressure
- Isobaric Vapor-Liquid Equilibria for Binary and Ternary Mixtures of Methanol, Ethanoic Acid, and Propanoic Acid