- Name
- Ethyl Acetate
- InChI
- InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3
- InChI Key
- XEKOWRVHYACXOJ-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- CCOC(C)=O
- Mol. Weight (g/mol)
- 88.11
- CAS
- 141-78-6
- Name
- 1,4-Dioxane
- InChI
- InChI=1S/C4H8O2/c1-2-6-4-3-5-1/h1-4H2
- InChI Key
- RYHBNJHYFVUHQT-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- C1COCCO1
- Mol. Weight (g/mol)
- 88.11
- CAS
- 123-91-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0004 |
| 298.15 | 0.1004 | 0.0005 |
| 298.15 | 0.2001 | 0.0005 |
| 298.15 | 0.3021 | 0.0005 |
| 298.15 | 0.4002 | 0.0006 |
| 298.15 | 0.5071 | 0.0006 |
| 298.15 | 0.6001 | 0.0007 |
| 298.15 | 0.6972 | 0.0008 |
| 298.15 | 0.7990 | 0.0009 |
| 298.15 | 0.8991 | 0.0010 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0004 |
| 303.15 | 0.1004 | 0.0004 |
| 303.15 | 0.2001 | 0.0005 |
| 303.15 | 0.3021 | 0.0005 |
| 303.15 | 0.4002 | 0.0006 |
| 303.15 | 0.5071 | 0.0006 |
| 303.15 | 0.6001 | 0.0007 |
| 303.15 | 0.6972 | 0.0007 |
| 303.15 | 0.7990 | 0.0008 |
| 303.15 | 0.8991 | 0.0010 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0004 |
| 308.15 | 0.1004 | 0.0004 |
| 308.15 | 0.2001 | 0.0004 |
| 308.15 | 0.3021 | 0.0005 |
| 308.15 | 0.4002 | 0.0005 |
| 308.15 | 0.5071 | 0.0006 |
| 308.15 | 0.6001 | 0.0006 |
| 308.15 | 0.6972 | 0.0007 |
| 308.15 | 0.7990 | 0.0008 |
| 308.15 | 0.8991 | 0.0009 |
| 308.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0004 |
| 298.15 | 0.1004 | 0.0005 |
| 298.15 | 0.2001 | 0.0005 |
| 298.15 | 0.3021 | 0.0005 |
| 298.15 | 0.4002 | 0.0006 |
| 298.15 | 0.5071 | 0.0006 |
| 298.15 | 0.6001 | 0.0007 |
| 298.15 | 0.6972 | 0.0008 |
| 298.15 | 0.7990 | 0.0009 |
| 298.15 | 0.8991 | 0.0010 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0004 |
| 303.15 | 0.1004 | 0.0004 |
| 303.15 | 0.2001 | 0.0005 |
| 303.15 | 0.3021 | 0.0005 |
| 303.15 | 0.4002 | 0.0006 |
| 303.15 | 0.5071 | 0.0006 |
| 303.15 | 0.6001 | 0.0007 |
| 303.15 | 0.6972 | 0.0007 |
| 303.15 | 0.7990 | 0.0008 |
| 303.15 | 0.8991 | 0.0010 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0004 |
| 308.15 | 0.1004 | 0.0004 |
| 308.15 | 0.2001 | 0.0004 |
| 308.15 | 0.3021 | 0.0005 |
| 308.15 | 0.4002 | 0.0005 |
| 308.15 | 0.5071 | 0.0006 |
| 308.15 | 0.6001 | 0.0006 |
| 308.15 | 0.6972 | 0.0007 |
| 308.15 | 0.7990 | 0.0008 |
| 308.15 | 0.8991 | 0.0009 |
| 308.15 | 1.0000 | 0.0010 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3713 |
| 298.15 | 0.1004 | 1.3753 |
| 298.15 | 0.2001 | 1.3798 |
| 298.15 | 0.3021 | 1.3843 |
| 298.15 | 0.4002 | 1.389 |
| 298.15 | 0.5071 | 1.3942 |
| 298.15 | 0.6001 | 1.3991 |
| 298.15 | 0.6972 | 1.4041 |
| 298.15 | 0.7990 | 1.4094 |
| 298.15 | 0.8991 | 1.4148 |
| 298.15 | 1.0000 | 1.4203 |
| 303.15 | 0.0000 | 1.3673 |
| 303.15 | 0.1004 | 1.3716 |
| 303.15 | 0.2001 | 1.3764 |
| 303.15 | 0.3021 | 1.3813 |
| 303.15 | 0.4002 | 1.3862 |
| 303.15 | 0.5071 | 1.3915 |
| 303.15 | 0.6001 | 1.3964 |
| 303.15 | 0.6972 | 1.4015 |
| 303.15 | 0.7990 | 1.4069 |
| 303.15 | 0.8991 | 1.4122 |
| 303.15 | 1.0000 | 1.4164 |
| 308.15 | 0.0000 | 1.3631 |
| 308.15 | 0.1004 | 1.368 |
| 308.15 | 0.2001 | 1.373 |
| 308.15 | 0.3021 | 1.3782 |
| 308.15 | 0.4002 | 1.3834 |
| 308.15 | 0.5071 | 1.3889 |
| 308.15 | 0.6001 | 1.3938 |
| 308.15 | 0.6972 | 1.3989 |
| 308.15 | 0.7990 | 1.4044 |
| 308.15 | 0.8991 | 1.4097 |
| 308.15 | 1.0000 | 1.4145 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3713 |
| 298.15 | 0.1004 | 1.3753 |
| 298.15 | 0.2001 | 1.3798 |
| 298.15 | 0.3021 | 1.3843 |
| 298.15 | 0.4002 | 1.389 |
| 298.15 | 0.5071 | 1.3942 |
| 298.15 | 0.6001 | 1.3991 |
| 298.15 | 0.6972 | 1.4041 |
| 298.15 | 0.7990 | 1.4094 |
| 298.15 | 0.8991 | 1.4148 |
| 298.15 | 1.0000 | 1.4203 |
| 303.15 | 0.0000 | 1.3673 |
| 303.15 | 0.1004 | 1.3716 |
| 303.15 | 0.2001 | 1.3764 |
| 303.15 | 0.3021 | 1.3813 |
| 303.15 | 0.4002 | 1.3862 |
| 303.15 | 0.5071 | 1.3915 |
| 303.15 | 0.6001 | 1.3964 |
| 303.15 | 0.6972 | 1.4015 |
| 303.15 | 0.7990 | 1.4069 |
| 303.15 | 0.8991 | 1.4122 |
| 303.15 | 1.0000 | 1.4164 |
| 308.15 | 0.0000 | 1.3631 |
| 308.15 | 0.1004 | 1.368 |
| 308.15 | 0.2001 | 1.373 |
| 308.15 | 0.3021 | 1.3782 |
| 308.15 | 0.4002 | 1.3834 |
| 308.15 | 0.5071 | 1.3889 |
| 308.15 | 0.6001 | 1.3938 |
| 308.15 | 0.6972 | 1.3989 |
| 308.15 | 0.7990 | 1.4044 |
| 308.15 | 0.8991 | 1.4097 |
| 308.15 | 1.0000 | 1.4145 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 894.2 |
| 298.15 | 0.1004 | 906.2 |
| 298.15 | 0.2001 | 918.8 |
| 298.15 | 0.3021 | 931.9 |
| 298.15 | 0.4002 | 944.7 |
| 298.15 | 0.5071 | 958.7 |
| 298.15 | 0.6001 | 971.1 |
| 298.15 | 0.6972 | 984.4 |
| 298.15 | 0.7990 | 998.7 |
| 298.15 | 0.8991 | 1013.3 |
| 298.15 | 1.0000 | 1028.6 |
| 303.15 | 0.0000 | 887.9 |
| 303.15 | 0.1004 | 900.0 |
| 303.15 | 0.2001 | 912.7 |
| 303.15 | 0.3021 | 925.8 |
| 303.15 | 0.4002 | 938.7 |
| 303.15 | 0.5071 | 952.8 |
| 303.15 | 0.6001 | 965.2 |
| 303.15 | 0.6972 | 978.6 |
| 303.15 | 0.7990 | 993.0 |
| 303.15 | 0.8991 | 1007.7 |
| 303.15 | 1.0000 | 1022.9 |
| 308.15 | 0.0000 | 881.6 |
| 308.15 | 0.1004 | 893.9 |
| 308.15 | 0.2001 | 906.6 |
| 308.15 | 0.3021 | 919.8 |
| 308.15 | 0.4002 | 932.7 |
| 308.15 | 0.5071 | 946.9 |
| 308.15 | 0.6001 | 959.5 |
| 308.15 | 0.6972 | 972.8 |
| 308.15 | 0.7990 | 987.2 |
| 308.15 | 0.8991 | 1001.9 |
| 308.15 | 1.0000 | 1017.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 894.2 |
| 298.15 | 0.1004 | 906.2 |
| 298.15 | 0.2001 | 918.8 |
| 298.15 | 0.3021 | 931.9 |
| 298.15 | 0.4002 | 944.7 |
| 298.15 | 0.5071 | 958.7 |
| 298.15 | 0.6001 | 971.1 |
| 298.15 | 0.6972 | 984.4 |
| 298.15 | 0.7990 | 998.7 |
| 298.15 | 0.8991 | 1013.3 |
| 298.15 | 1.0000 | 1028.6 |
| 303.15 | 0.0000 | 887.9 |
| 303.15 | 0.1004 | 900.0 |
| 303.15 | 0.2001 | 912.7 |
| 303.15 | 0.3021 | 925.8 |
| 303.15 | 0.4002 | 938.7 |
| 303.15 | 0.5071 | 952.8 |
| 303.15 | 0.6001 | 965.2 |
| 303.15 | 0.6972 | 978.6 |
| 303.15 | 0.7990 | 993.0 |
| 303.15 | 0.8991 | 1007.7 |
| 303.15 | 1.0000 | 1022.9 |
| 308.15 | 0.0000 | 881.6 |
| 308.15 | 0.1004 | 893.9 |
| 308.15 | 0.2001 | 906.6 |
| 308.15 | 0.3021 | 919.8 |
| 308.15 | 0.4002 | 932.7 |
| 308.15 | 0.5071 | 946.9 |
| 308.15 | 0.6001 | 959.5 |
| 308.15 | 0.6972 | 972.8 |
| 308.15 | 0.7990 | 987.2 |
| 308.15 | 0.8991 | 1001.9 |
| 308.15 | 1.0000 | 1017.2 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1155.0 |
| 0.1004 | 1174.0 |
| 0.2001 | 1193.0 |
| 0.3021 | 1212.0 |
| 0.4002 | 1231.0 |
| 0.5071 | 1250.0 |
| 0.6001 | 1269.0 |
| 0.6972 | 1288.0 |
| 0.7990 | 1307.0 |
| 0.8991 | 1327.0 |
| 1.0000 | 1345.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1155.0 |
| 0.1004 | 1174.0 |
| 0.2001 | 1193.0 |
| 0.3021 | 1212.0 |
| 0.4002 | 1231.0 |
| 0.5071 | 1250.0 |
| 0.6001 | 1269.0 |
| 0.6972 | 1288.0 |
| 0.7990 | 1307.0 |
| 0.8991 | 1327.0 |
| 1.0000 | 1345.0 |