- Name
- N,N-Dimethylacetamide
- InChI
- InChI=1S/C4H9NO/c1-4(6)5(2)3/h1-3H3
- InChI Key
- FXHOOIRPVKKKFG-UHFFFAOYSA-N
- Formula
- C4H9NO
- SMILES
- CC(=O)N(C)C
- Mol. Weight (g/mol)
- 87.12
- CAS
- 127-19-5
- Name
- 1,4-Dioxane
- InChI
- InChI=1S/C4H8O2/c1-2-6-4-3-5-1/h1-4H2
- InChI Key
- RYHBNJHYFVUHQT-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- C1COCCO1
- Mol. Weight (g/mol)
- 88.11
- CAS
- 123-91-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0013 |
| 298.15 | 0.1121 | 0.0013 |
| 298.15 | 0.2162 | 0.0012 |
| 298.15 | 0.3203 | 0.0012 |
| 298.15 | 0.4222 | 0.0012 |
| 298.15 | 0.5242 | 0.0012 |
| 298.15 | 0.6219 | 0.0012 |
| 298.15 | 0.7198 | 0.0012 |
| 298.15 | 0.8157 | 0.0012 |
| 298.15 | 0.9116 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0012 |
| 303.15 | 0.1121 | 0.0011 |
| 303.15 | 0.2162 | 0.0011 |
| 303.15 | 0.3203 | 0.0011 |
| 303.15 | 0.4222 | 0.0011 |
| 303.15 | 0.5242 | 0.0011 |
| 303.15 | 0.6219 | 0.0011 |
| 303.15 | 0.7198 | 0.0011 |
| 303.15 | 0.8157 | 0.0011 |
| 303.15 | 0.9116 | 0.0011 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0010 |
| 308.15 | 0.1121 | 0.0010 |
| 308.15 | 0.2162 | 0.0010 |
| 308.15 | 0.3203 | 0.0010 |
| 308.15 | 0.4222 | 0.0010 |
| 308.15 | 0.5242 | 0.0010 |
| 308.15 | 0.6219 | 0.0010 |
| 308.15 | 0.7198 | 0.0010 |
| 308.15 | 0.8157 | 0.0010 |
| 308.15 | 0.9116 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0013 |
| 298.15 | 0.1121 | 0.0013 |
| 298.15 | 0.2162 | 0.0012 |
| 298.15 | 0.3203 | 0.0012 |
| 298.15 | 0.4222 | 0.0012 |
| 298.15 | 0.5242 | 0.0012 |
| 298.15 | 0.6219 | 0.0012 |
| 298.15 | 0.7198 | 0.0012 |
| 298.15 | 0.8157 | 0.0012 |
| 298.15 | 0.9116 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0012 |
| 303.15 | 0.1121 | 0.0011 |
| 303.15 | 0.2162 | 0.0011 |
| 303.15 | 0.3203 | 0.0011 |
| 303.15 | 0.4222 | 0.0011 |
| 303.15 | 0.5242 | 0.0011 |
| 303.15 | 0.6219 | 0.0011 |
| 303.15 | 0.7198 | 0.0011 |
| 303.15 | 0.8157 | 0.0011 |
| 303.15 | 0.9116 | 0.0011 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0010 |
| 308.15 | 0.1121 | 0.0010 |
| 308.15 | 0.2162 | 0.0010 |
| 308.15 | 0.3203 | 0.0010 |
| 308.15 | 0.4222 | 0.0010 |
| 308.15 | 0.5242 | 0.0010 |
| 308.15 | 0.6219 | 0.0010 |
| 308.15 | 0.7198 | 0.0010 |
| 308.15 | 0.8157 | 0.0010 |
| 308.15 | 0.9116 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4363 |
| 298.15 | 0.1121 | 1.4346 |
| 298.15 | 0.2162 | 1.4328 |
| 298.15 | 0.3203 | 1.431 |
| 298.15 | 0.4222 | 1.4293 |
| 298.15 | 0.5242 | 1.4275 |
| 298.15 | 0.6219 | 1.4259 |
| 298.15 | 0.7198 | 1.4242 |
| 298.15 | 0.8157 | 1.4226 |
| 298.15 | 0.9116 | 1.421 |
| 298.15 | 1.0000 | 1.4203 |
| 303.15 | 0.0000 | 1.4342 |
| 303.15 | 0.1121 | 1.4324 |
| 303.15 | 0.2162 | 1.4306 |
| 303.15 | 0.3203 | 1.4287 |
| 303.15 | 0.4222 | 1.4269 |
| 303.15 | 0.5242 | 1.4252 |
| 303.15 | 0.6219 | 1.4234 |
| 303.15 | 0.7198 | 1.4226 |
| 303.15 | 0.8157 | 1.421 |
| 303.15 | 0.9116 | 1.4195 |
| 303.15 | 1.0000 | 1.4164 |
| 308.15 | 0.0000 | 1.432 |
| 308.15 | 0.1121 | 1.4302 |
| 308.15 | 0.2162 | 1.4284 |
| 308.15 | 0.3203 | 1.4264 |
| 308.15 | 0.4222 | 1.4246 |
| 308.15 | 0.5242 | 1.4228 |
| 308.15 | 0.6219 | 1.421 |
| 308.15 | 0.7198 | 1.4191 |
| 308.15 | 0.8157 | 1.4174 |
| 308.15 | 0.9116 | 1.4157 |
| 308.15 | 1.0000 | 1.4145 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4363 |
| 298.15 | 0.1121 | 1.4346 |
| 298.15 | 0.2162 | 1.4328 |
| 298.15 | 0.3203 | 1.431 |
| 298.15 | 0.4222 | 1.4293 |
| 298.15 | 0.5242 | 1.4275 |
| 298.15 | 0.6219 | 1.4259 |
| 298.15 | 0.7198 | 1.4242 |
| 298.15 | 0.8157 | 1.4226 |
| 298.15 | 0.9116 | 1.421 |
| 298.15 | 1.0000 | 1.4203 |
| 303.15 | 0.0000 | 1.4342 |
| 303.15 | 0.1121 | 1.4324 |
| 303.15 | 0.2162 | 1.4306 |
| 303.15 | 0.3203 | 1.4287 |
| 303.15 | 0.4222 | 1.4269 |
| 303.15 | 0.5242 | 1.4252 |
| 303.15 | 0.6219 | 1.4234 |
| 303.15 | 0.7198 | 1.4226 |
| 303.15 | 0.8157 | 1.421 |
| 303.15 | 0.9116 | 1.4195 |
| 303.15 | 1.0000 | 1.4164 |
| 308.15 | 0.0000 | 1.432 |
| 308.15 | 0.1121 | 1.4302 |
| 308.15 | 0.2162 | 1.4284 |
| 308.15 | 0.3203 | 1.4264 |
| 308.15 | 0.4222 | 1.4246 |
| 308.15 | 0.5242 | 1.4228 |
| 308.15 | 0.6219 | 1.421 |
| 308.15 | 0.7198 | 1.4191 |
| 308.15 | 0.8157 | 1.4174 |
| 308.15 | 0.9116 | 1.4157 |
| 308.15 | 1.0000 | 1.4145 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 946.8 |
| 298.15 | 0.1121 | 954.8 |
| 298.15 | 0.2162 | 962.4 |
| 298.15 | 0.3203 | 970.0 |
| 298.15 | 0.4222 | 977.9 |
| 298.15 | 0.5242 | 985.9 |
| 298.15 | 0.6219 | 993.9 |
| 298.15 | 0.7198 | 1002.1 |
| 298.15 | 0.8157 | 1010.5 |
| 298.15 | 0.9116 | 1019.2 |
| 298.15 | 1.0000 | 1028.6 |
| 303.15 | 0.0000 | 942.1 |
| 303.15 | 0.1121 | 950.1 |
| 303.15 | 0.2162 | 957.6 |
| 303.15 | 0.3203 | 965.2 |
| 303.15 | 0.4222 | 972.9 |
| 303.15 | 0.5242 | 980.9 |
| 303.15 | 0.6219 | 988.8 |
| 303.15 | 0.7198 | 996.8 |
| 303.15 | 0.8157 | 1005.3 |
| 303.15 | 0.9116 | 1013.7 |
| 303.15 | 1.0000 | 1022.9 |
| 308.15 | 0.0000 | 937.5 |
| 308.15 | 0.1121 | 945.4 |
| 308.15 | 0.2162 | 952.9 |
| 308.15 | 0.3203 | 960.3 |
| 308.15 | 0.4222 | 968.0 |
| 308.15 | 0.5242 | 975.9 |
| 308.15 | 0.6219 | 983.6 |
| 308.15 | 0.7198 | 991.6 |
| 308.15 | 0.8157 | 999.8 |
| 308.15 | 0.9116 | 1008.2 |
| 308.15 | 1.0000 | 1017.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 946.8 |
| 298.15 | 0.1121 | 954.8 |
| 298.15 | 0.2162 | 962.4 |
| 298.15 | 0.3203 | 970.0 |
| 298.15 | 0.4222 | 977.9 |
| 298.15 | 0.5242 | 985.9 |
| 298.15 | 0.6219 | 993.9 |
| 298.15 | 0.7198 | 1002.1 |
| 298.15 | 0.8157 | 1010.5 |
| 298.15 | 0.9116 | 1019.2 |
| 298.15 | 1.0000 | 1028.6 |
| 303.15 | 0.0000 | 942.1 |
| 303.15 | 0.1121 | 950.1 |
| 303.15 | 0.2162 | 957.6 |
| 303.15 | 0.3203 | 965.2 |
| 303.15 | 0.4222 | 972.9 |
| 303.15 | 0.5242 | 980.9 |
| 303.15 | 0.6219 | 988.8 |
| 303.15 | 0.7198 | 996.8 |
| 303.15 | 0.8157 | 1005.3 |
| 303.15 | 0.9116 | 1013.7 |
| 303.15 | 1.0000 | 1022.9 |
| 308.15 | 0.0000 | 937.5 |
| 308.15 | 0.1121 | 945.4 |
| 308.15 | 0.2162 | 952.9 |
| 308.15 | 0.3203 | 960.3 |
| 308.15 | 0.4222 | 968.0 |
| 308.15 | 0.5242 | 975.9 |
| 308.15 | 0.6219 | 983.6 |
| 308.15 | 0.7198 | 991.6 |
| 308.15 | 0.8157 | 999.8 |
| 308.15 | 0.9116 | 1008.2 |
| 308.15 | 1.0000 | 1017.2 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1458.0 |
| 0.1121 | 1447.0 |
| 0.2162 | 1436.0 |
| 0.3203 | 1424.0 |
| 0.4222 | 1413.0 |
| 0.5242 | 1401.0 |
| 0.6219 | 1390.0 |
| 0.7198 | 1379.0 |
| 0.8157 | 1367.0 |
| 0.9116 | 1356.0 |
| 1.0000 | 1345.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1458.0 |
| 0.1121 | 1447.0 |
| 0.2162 | 1436.0 |
| 0.3203 | 1424.0 |
| 0.4222 | 1413.0 |
| 0.5242 | 1401.0 |
| 0.6219 | 1390.0 |
| 0.7198 | 1379.0 |
| 0.8157 | 1367.0 |
| 0.9116 | 1356.0 |
| 1.0000 | 1345.0 |