- Name
- Diethyl malonate
- InChI
- InChI=1S/C7H12O4/c1-3-10-6(8)5-7(9)11-4-2/h3-5H2,1-2H3
- InChI Key
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N
- Formula
- C7H12O4
- SMILES
- CCOC(=O)CC(=O)OCC
- Mol. Weight (g/mol)
- 160.17
- CAS
- 105-53-3
- Name
- 1,4-Dioxane
- InChI
- InChI=1S/C4H8O2/c1-2-6-4-3-5-1/h1-4H2
- InChI Key
- RYHBNJHYFVUHQT-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- C1COCCO1
- Mol. Weight (g/mol)
- 88.11
- CAS
- 123-91-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0019 |
| 298.15 | 0.1005 | 0.0019 |
| 298.15 | 0.1982 | 0.0018 |
| 298.15 | 0.2959 | 0.0017 |
| 298.15 | 0.3959 | 0.0016 |
| 298.15 | 0.4959 | 0.0015 |
| 298.15 | 0.5951 | 0.0015 |
| 298.15 | 0.6944 | 0.0014 |
| 298.15 | 0.7960 | 0.0013 |
| 298.15 | 0.8977 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0018 |
| 303.15 | 0.1005 | 0.0017 |
| 303.15 | 0.1982 | 0.0016 |
| 303.15 | 0.2959 | 0.0016 |
| 303.15 | 0.3959 | 0.0015 |
| 303.15 | 0.4959 | 0.0014 |
| 303.15 | 0.5951 | 0.0013 |
| 303.15 | 0.6944 | 0.0013 |
| 303.15 | 0.7960 | 0.0012 |
| 303.15 | 0.8977 | 0.0012 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0016 |
| 308.15 | 0.1005 | 0.0015 |
| 308.15 | 0.1982 | 0.0015 |
| 308.15 | 0.2959 | 0.0014 |
| 308.15 | 0.3959 | 0.0013 |
| 308.15 | 0.4959 | 0.0013 |
| 308.15 | 0.5951 | 0.0012 |
| 308.15 | 0.6944 | 0.0012 |
| 308.15 | 0.7960 | 0.0011 |
| 308.15 | 0.8977 | 0.0011 |
| 308.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0019 |
| 298.15 | 0.1005 | 0.0019 |
| 298.15 | 0.1982 | 0.0018 |
| 298.15 | 0.2959 | 0.0017 |
| 298.15 | 0.3959 | 0.0016 |
| 298.15 | 0.4959 | 0.0015 |
| 298.15 | 0.5951 | 0.0015 |
| 298.15 | 0.6944 | 0.0014 |
| 298.15 | 0.7960 | 0.0013 |
| 298.15 | 0.8977 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0018 |
| 303.15 | 0.1005 | 0.0017 |
| 303.15 | 0.1982 | 0.0016 |
| 303.15 | 0.2959 | 0.0016 |
| 303.15 | 0.3959 | 0.0015 |
| 303.15 | 0.4959 | 0.0014 |
| 303.15 | 0.5951 | 0.0013 |
| 303.15 | 0.6944 | 0.0013 |
| 303.15 | 0.7960 | 0.0012 |
| 303.15 | 0.8977 | 0.0012 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0016 |
| 308.15 | 0.1005 | 0.0015 |
| 308.15 | 0.1982 | 0.0015 |
| 308.15 | 0.2959 | 0.0014 |
| 308.15 | 0.3959 | 0.0013 |
| 308.15 | 0.4959 | 0.0013 |
| 308.15 | 0.5951 | 0.0012 |
| 308.15 | 0.6944 | 0.0012 |
| 308.15 | 0.7960 | 0.0011 |
| 308.15 | 0.8977 | 0.0011 |
| 308.15 | 1.0000 | 0.0010 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4132 |
| 298.15 | 0.1005 | 1.4135 |
| 298.15 | 0.1982 | 1.4139 |
| 298.15 | 0.2959 | 1.4143 |
| 298.15 | 0.3959 | 1.4147 |
| 298.15 | 0.4959 | 1.415 |
| 298.15 | 0.5951 | 1.4161 |
| 298.15 | 0.6944 | 1.4171 |
| 298.15 | 0.7960 | 1.4181 |
| 298.15 | 0.8977 | 1.4192 |
| 298.15 | 1.0000 | 1.4203 |
| 303.15 | 0.0000 | 1.4108 |
| 303.15 | 0.1005 | 1.4113 |
| 303.15 | 0.1982 | 1.412 |
| 303.15 | 0.2959 | 1.4123 |
| 303.15 | 0.3959 | 1.4127 |
| 303.15 | 0.4959 | 1.4137 |
| 303.15 | 0.5951 | 1.4147 |
| 303.15 | 0.6944 | 1.4157 |
| 303.15 | 0.7960 | 1.4167 |
| 303.15 | 0.8977 | 1.4231 |
| 303.15 | 1.0000 | 1.4164 |
| 308.15 | 0.0000 | 1.4085 |
| 308.15 | 0.1005 | 1.409 |
| 308.15 | 0.1982 | 1.4093 |
| 308.15 | 0.2959 | 1.4095 |
| 308.15 | 0.3959 | 1.4099 |
| 308.15 | 0.4959 | 1.4103 |
| 308.15 | 0.5951 | 1.4113 |
| 308.15 | 0.6944 | 1.4122 |
| 308.15 | 0.7960 | 1.4132 |
| 308.15 | 0.8977 | 1.4141 |
| 308.15 | 1.0000 | 1.4145 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4132 |
| 298.15 | 0.1005 | 1.4135 |
| 298.15 | 0.1982 | 1.4139 |
| 298.15 | 0.2959 | 1.4143 |
| 298.15 | 0.3959 | 1.4147 |
| 298.15 | 0.4959 | 1.415 |
| 298.15 | 0.5951 | 1.4161 |
| 298.15 | 0.6944 | 1.4171 |
| 298.15 | 0.7960 | 1.4181 |
| 298.15 | 0.8977 | 1.4192 |
| 298.15 | 1.0000 | 1.4203 |
| 303.15 | 0.0000 | 1.4108 |
| 303.15 | 0.1005 | 1.4113 |
| 303.15 | 0.1982 | 1.412 |
| 303.15 | 0.2959 | 1.4123 |
| 303.15 | 0.3959 | 1.4127 |
| 303.15 | 0.4959 | 1.4137 |
| 303.15 | 0.5951 | 1.4147 |
| 303.15 | 0.6944 | 1.4157 |
| 303.15 | 0.7960 | 1.4167 |
| 303.15 | 0.8977 | 1.4231 |
| 303.15 | 1.0000 | 1.4164 |
| 308.15 | 0.0000 | 1.4085 |
| 308.15 | 0.1005 | 1.409 |
| 308.15 | 0.1982 | 1.4093 |
| 308.15 | 0.2959 | 1.4095 |
| 308.15 | 0.3959 | 1.4099 |
| 308.15 | 0.4959 | 1.4103 |
| 308.15 | 0.5951 | 1.4113 |
| 308.15 | 0.6944 | 1.4122 |
| 308.15 | 0.7960 | 1.4132 |
| 308.15 | 0.8977 | 1.4141 |
| 308.15 | 1.0000 | 1.4145 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1049.6 |
| 298.15 | 0.1005 | 1048.1 |
| 298.15 | 0.1982 | 1046.6 |
| 298.15 | 0.2959 | 1044.9 |
| 298.15 | 0.3959 | 1043.0 |
| 298.15 | 0.4959 | 1041.0 |
| 298.15 | 0.5951 | 1038.8 |
| 298.15 | 0.6944 | 1036.4 |
| 298.15 | 0.7960 | 1033.7 |
| 298.15 | 0.8977 | 1030.9 |
| 298.15 | 1.0000 | 1028.6 |
| 303.15 | 0.0000 | 1044.2 |
| 303.15 | 0.1005 | 1042.8 |
| 303.15 | 0.1982 | 1041.2 |
| 303.15 | 0.2959 | 1039.6 |
| 303.15 | 0.3959 | 1037.7 |
| 303.15 | 0.4959 | 1035.6 |
| 303.15 | 0.5951 | 1033.4 |
| 303.15 | 0.6944 | 1030.9 |
| 303.15 | 0.7960 | 1028.2 |
| 303.15 | 0.8977 | 1025.4 |
| 303.15 | 1.0000 | 1022.9 |
| 308.15 | 0.0000 | 1038.8 |
| 308.15 | 0.1005 | 1037.4 |
| 308.15 | 0.1982 | 1035.8 |
| 308.15 | 0.2959 | 1034.2 |
| 308.15 | 0.3959 | 1032.3 |
| 308.15 | 0.4959 | 1030.2 |
| 308.15 | 0.5951 | 1028.0 |
| 308.15 | 0.6944 | 1025.5 |
| 308.15 | 0.7960 | 1022.8 |
| 308.15 | 0.8977 | 1019.9 |
| 308.15 | 1.0000 | 1017.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1049.6 |
| 298.15 | 0.1005 | 1048.1 |
| 298.15 | 0.1982 | 1046.6 |
| 298.15 | 0.2959 | 1044.9 |
| 298.15 | 0.3959 | 1043.0 |
| 298.15 | 0.4959 | 1041.0 |
| 298.15 | 0.5951 | 1038.8 |
| 298.15 | 0.6944 | 1036.4 |
| 298.15 | 0.7960 | 1033.7 |
| 298.15 | 0.8977 | 1030.9 |
| 298.15 | 1.0000 | 1028.6 |
| 303.15 | 0.0000 | 1044.2 |
| 303.15 | 0.1005 | 1042.8 |
| 303.15 | 0.1982 | 1041.2 |
| 303.15 | 0.2959 | 1039.6 |
| 303.15 | 0.3959 | 1037.7 |
| 303.15 | 0.4959 | 1035.6 |
| 303.15 | 0.5951 | 1033.4 |
| 303.15 | 0.6944 | 1030.9 |
| 303.15 | 0.7960 | 1028.2 |
| 303.15 | 0.8977 | 1025.4 |
| 303.15 | 1.0000 | 1022.9 |
| 308.15 | 0.0000 | 1038.8 |
| 308.15 | 0.1005 | 1037.4 |
| 308.15 | 0.1982 | 1035.8 |
| 308.15 | 0.2959 | 1034.2 |
| 308.15 | 0.3959 | 1032.3 |
| 308.15 | 0.4959 | 1030.2 |
| 308.15 | 0.5951 | 1028.0 |
| 308.15 | 0.6944 | 1025.5 |
| 308.15 | 0.7960 | 1022.8 |
| 308.15 | 0.8977 | 1019.9 |
| 308.15 | 1.0000 | 1017.2 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1304.0 |
| 0.1005 | 1308.0 |
| 0.1982 | 1312.0 |
| 0.2959 | 1316.0 |
| 0.3959 | 1320.0 |
| 0.4959 | 1324.0 |
| 0.5951 | 1328.0 |
| 0.6944 | 1332.0 |
| 0.7960 | 1337.0 |
| 0.8977 | 1341.0 |
| 1.0000 | 1345.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1304.0 |
| 0.1005 | 1308.0 |
| 0.1982 | 1312.0 |
| 0.2959 | 1316.0 |
| 0.3959 | 1320.0 |
| 0.4959 | 1324.0 |
| 0.5951 | 1328.0 |
| 0.6944 | 1332.0 |
| 0.7960 | 1337.0 |
| 0.8977 | 1341.0 |
| 1.0000 | 1345.0 |