- Name
- Anisole
- InChI
- InChI=1S/C7H8O/c1-8-7-5-3-2-4-6-7/h2-6H,1H3
- InChI Key
- RDOXTESZEPMUJZ-UHFFFAOYSA-N
- Formula
- C7H8O
- SMILES
- COc1ccccc1
- Mol. Weight (g/mol)
- 108.14
- CAS
- 100-66-3
- Name
- Dimethyl Sulfoxide
- InChI
- InChI=1S/C2H6OS/c1-4(2)3/h1-2H3
- InChI Key
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N
- Formula
- C2H6OS
- SMILES
- CS(C)=O
- Mol. Weight (g/mol)
- 78.13
- CAS
- 67-68-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0020 |
| 298.15 | 0.0938 | 0.0018 |
| 298.15 | 0.2016 | 0.0017 |
| 298.15 | 0.3025 | 0.0016 |
| 298.15 | 0.3987 | 0.0015 |
| 298.15 | 0.5074 | 0.0014 |
| 298.15 | 0.5940 | 0.0013 |
| 298.15 | 0.6956 | 0.0012 |
| 298.15 | 0.7988 | 0.0012 |
| 298.15 | 0.8933 | 0.0011 |
| 298.15 | 1.0000 | 0.0010 |
| 303.15 | 0.0000 | 0.0018 |
| 303.15 | 0.0938 | 0.0017 |
| 303.15 | 0.2016 | 0.0015 |
| 303.15 | 0.3025 | 0.0014 |
| 303.15 | 0.3987 | 0.0013 |
| 303.15 | 0.5074 | 0.0013 |
| 303.15 | 0.5940 | 0.0012 |
| 303.15 | 0.6956 | 0.0012 |
| 303.15 | 0.7988 | 0.0011 |
| 303.15 | 0.8933 | 0.0010 |
| 303.15 | 1.0000 | 0.0009 |
| 308.15 | 0.0000 | 0.0017 |
| 308.15 | 0.0938 | 0.0015 |
| 308.15 | 0.2016 | 0.0014 |
| 308.15 | 0.3025 | 0.0013 |
| 308.15 | 0.3987 | 0.0012 |
| 308.15 | 0.5074 | 0.0012 |
| 308.15 | 0.5940 | 0.0011 |
| 308.15 | 0.6956 | 0.0011 |
| 308.15 | 0.7988 | 0.0010 |
| 308.15 | 0.8933 | 0.0009 |
| 308.15 | 1.0000 | 0.0009 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0020 |
| 298.15 | 0.0938 | 0.0018 |
| 298.15 | 0.2016 | 0.0017 |
| 298.15 | 0.3025 | 0.0016 |
| 298.15 | 0.3987 | 0.0015 |
| 298.15 | 0.5074 | 0.0014 |
| 298.15 | 0.5940 | 0.0013 |
| 298.15 | 0.6956 | 0.0012 |
| 298.15 | 0.7988 | 0.0012 |
| 298.15 | 0.8933 | 0.0011 |
| 298.15 | 1.0000 | 0.0010 |
| 303.15 | 0.0000 | 0.0018 |
| 303.15 | 0.0938 | 0.0017 |
| 303.15 | 0.2016 | 0.0015 |
| 303.15 | 0.3025 | 0.0014 |
| 303.15 | 0.3987 | 0.0013 |
| 303.15 | 0.5074 | 0.0013 |
| 303.15 | 0.5940 | 0.0012 |
| 303.15 | 0.6956 | 0.0012 |
| 303.15 | 0.7988 | 0.0011 |
| 303.15 | 0.8933 | 0.0010 |
| 303.15 | 1.0000 | 0.0009 |
| 308.15 | 0.0000 | 0.0017 |
| 308.15 | 0.0938 | 0.0015 |
| 308.15 | 0.2016 | 0.0014 |
| 308.15 | 0.3025 | 0.0013 |
| 308.15 | 0.3987 | 0.0012 |
| 308.15 | 0.5074 | 0.0012 |
| 308.15 | 0.5940 | 0.0011 |
| 308.15 | 0.6956 | 0.0011 |
| 308.15 | 0.7988 | 0.0010 |
| 308.15 | 0.8933 | 0.0009 |
| 308.15 | 1.0000 | 0.0009 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4768 |
| 298.15 | 0.0938 | 1.4817 |
| 298.15 | 0.2016 | 1.4878 |
| 298.15 | 0.3025 | 1.4929 |
| 298.15 | 0.3987 | 1.4962 |
| 298.15 | 0.5074 | 1.4996 |
| 298.15 | 0.5940 | 1.5031 |
| 298.15 | 0.6956 | 1.5069 |
| 298.15 | 0.7988 | 1.5105 |
| 298.15 | 0.8933 | 1.5124 |
| 298.15 | 1.0000 | 1.5148 |
| 303.15 | 0.0000 | 1.4594 |
| 303.15 | 0.0938 | 1.4772 |
| 303.15 | 0.2016 | 1.4853 |
| 303.15 | 0.3025 | 1.4901 |
| 303.15 | 0.3987 | 1.4935 |
| 303.15 | 0.5074 | 1.4974 |
| 303.15 | 0.5940 | 1.5006 |
| 303.15 | 0.6956 | 1.5043 |
| 303.15 | 0.7988 | 1.5075 |
| 303.15 | 0.8933 | 1.5096 |
| 303.15 | 1.0000 | 1.5124 |
| 308.15 | 0.0000 | 1.4547 |
| 308.15 | 0.0938 | 1.4727 |
| 308.15 | 0.2016 | 1.4828 |
| 308.15 | 0.3025 | 1.4873 |
| 308.15 | 0.3987 | 1.4906 |
| 308.15 | 0.5074 | 1.4952 |
| 308.15 | 0.5940 | 1.498 |
| 308.15 | 0.6956 | 1.5017 |
| 308.15 | 0.7988 | 1.5046 |
| 308.15 | 0.8933 | 1.5069 |
| 308.15 | 1.0000 | 1.5092 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4768 |
| 298.15 | 0.0938 | 1.4817 |
| 298.15 | 0.2016 | 1.4878 |
| 298.15 | 0.3025 | 1.4929 |
| 298.15 | 0.3987 | 1.4962 |
| 298.15 | 0.5074 | 1.4996 |
| 298.15 | 0.5940 | 1.5031 |
| 298.15 | 0.6956 | 1.5069 |
| 298.15 | 0.7988 | 1.5105 |
| 298.15 | 0.8933 | 1.5124 |
| 298.15 | 1.0000 | 1.5148 |
| 303.15 | 0.0000 | 1.4594 |
| 303.15 | 0.0938 | 1.4772 |
| 303.15 | 0.2016 | 1.4853 |
| 303.15 | 0.3025 | 1.4901 |
| 303.15 | 0.3987 | 1.4935 |
| 303.15 | 0.5074 | 1.4974 |
| 303.15 | 0.5940 | 1.5006 |
| 303.15 | 0.6956 | 1.5043 |
| 303.15 | 0.7988 | 1.5075 |
| 303.15 | 0.8933 | 1.5096 |
| 303.15 | 1.0000 | 1.5124 |
| 308.15 | 0.0000 | 1.4547 |
| 308.15 | 0.0938 | 1.4727 |
| 308.15 | 0.2016 | 1.4828 |
| 308.15 | 0.3025 | 1.4873 |
| 308.15 | 0.3987 | 1.4906 |
| 308.15 | 0.5074 | 1.4952 |
| 308.15 | 0.5940 | 1.498 |
| 308.15 | 0.6956 | 1.5017 |
| 308.15 | 0.7988 | 1.5046 |
| 308.15 | 0.8933 | 1.5069 |
| 308.15 | 1.0000 | 1.5092 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1095.4 |
| 298.15 | 0.0938 | 1081.5 |
| 298.15 | 0.2016 | 1066.7 |
| 298.15 | 0.3025 | 1054.4 |
| 298.15 | 0.3987 | 1043.6 |
| 298.15 | 0.5074 | 1032.5 |
| 298.15 | 0.5940 | 1024.1 |
| 298.15 | 0.6956 | 1014.7 |
| 298.15 | 0.7988 | 1005.5 |
| 298.15 | 0.8933 | 997.4 |
| 298.15 | 1.0000 | 988.9 |
| 303.15 | 0.0000 | 1090.8 |
| 303.15 | 0.0938 | 1077.0 |
| 303.15 | 0.2016 | 1062.1 |
| 303.15 | 0.3025 | 1049.9 |
| 303.15 | 0.3987 | 1039.2 |
| 303.15 | 0.5074 | 1027.9 |
| 303.15 | 0.5940 | 1019.7 |
| 303.15 | 0.6956 | 1010.3 |
| 303.15 | 0.7988 | 1001.4 |
| 303.15 | 0.8933 | 992.8 |
| 303.15 | 1.0000 | 984.1 |
| 308.15 | 0.0000 | 1086.2 |
| 308.15 | 0.0938 | 1072.3 |
| 308.15 | 0.2016 | 1057.6 |
| 308.15 | 0.3025 | 1045.3 |
| 308.15 | 0.3987 | 1034.7 |
| 308.15 | 0.5074 | 1023.6 |
| 308.15 | 0.5940 | 1015.1 |
| 308.15 | 0.6956 | 1005.7 |
| 308.15 | 0.7988 | 996.7 |
| 308.15 | 0.8933 | 988.5 |
| 308.15 | 1.0000 | 979.4 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1095.4 |
| 298.15 | 0.0938 | 1081.5 |
| 298.15 | 0.2016 | 1066.7 |
| 298.15 | 0.3025 | 1054.4 |
| 298.15 | 0.3987 | 1043.6 |
| 298.15 | 0.5074 | 1032.5 |
| 298.15 | 0.5940 | 1024.1 |
| 298.15 | 0.6956 | 1014.7 |
| 298.15 | 0.7988 | 1005.5 |
| 298.15 | 0.8933 | 997.4 |
| 298.15 | 1.0000 | 988.9 |
| 303.15 | 0.0000 | 1090.8 |
| 303.15 | 0.0938 | 1077.0 |
| 303.15 | 0.2016 | 1062.1 |
| 303.15 | 0.3025 | 1049.9 |
| 303.15 | 0.3987 | 1039.2 |
| 303.15 | 0.5074 | 1027.9 |
| 303.15 | 0.5940 | 1019.7 |
| 303.15 | 0.6956 | 1010.3 |
| 303.15 | 0.7988 | 1001.4 |
| 303.15 | 0.8933 | 992.8 |
| 303.15 | 1.0000 | 984.1 |
| 308.15 | 0.0000 | 1086.2 |
| 308.15 | 0.0938 | 1072.3 |
| 308.15 | 0.2016 | 1057.6 |
| 308.15 | 0.3025 | 1045.3 |
| 308.15 | 0.3987 | 1034.7 |
| 308.15 | 0.5074 | 1023.6 |
| 308.15 | 0.5940 | 1015.1 |
| 308.15 | 0.6956 | 1005.7 |
| 308.15 | 0.7988 | 996.7 |
| 308.15 | 0.8933 | 988.5 |
| 308.15 | 1.0000 | 979.4 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Anisole (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1493.0 |
| 0.0938 | 1487.0 |
| 0.2016 | 1477.0 |
| 0.3025 | 1468.0 |
| 0.3987 | 1462.0 |
| 0.5074 | 1454.0 |
| 0.5940 | 1445.0 |
| 0.6956 | 1437.0 |
| 0.7988 | 1428.0 |
| 0.8933 | 1421.0 |
| 1.0000 | 1410.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Anisole (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1493.0 |
| 0.0938 | 1487.0 |
| 0.2016 | 1477.0 |
| 0.3025 | 1468.0 |
| 0.3987 | 1462.0 |
| 0.5074 | 1454.0 |
| 0.5940 | 1445.0 |
| 0.6956 | 1437.0 |
| 0.7988 | 1428.0 |
| 0.8933 | 1421.0 |
| 1.0000 | 1410.0 |