- Name
- Ethanedioic acid, diethyl ester
- InChI
- InChI=1S/C6H10O4/c1-3-9-5(7)6(8)10-4-2/h3-4H2,1-2H3
- InChI Key
- WYACBZDAHNBPPB-UHFFFAOYSA-N
- Formula
- C6H10O4
- SMILES
- CCOC(=O)C(=O)OCC
- Mol. Weight (g/mol)
- 146.14
- CAS
- 95-92-1
- Name
- Anisole
- InChI
- InChI=1S/C7H8O/c1-8-7-5-3-2-4-6-7/h2-6H,1H3
- InChI Key
- RDOXTESZEPMUJZ-UHFFFAOYSA-N
- Formula
- C7H8O
- SMILES
- COc1ccccc1
- Mol. Weight (g/mol)
- 108.14
- CAS
- 100-66-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0018 |
| 298.15 | 0.1017 | 0.0017 |
| 298.15 | 0.1976 | 0.0016 |
| 298.15 | 0.2978 | 0.0015 |
| 298.15 | 0.3621 | 0.0015 |
| 298.15 | 0.4971 | 0.0014 |
| 298.15 | 0.5975 | 0.0013 |
| 298.15 | 0.6977 | 0.0012 |
| 298.15 | 0.8016 | 0.0011 |
| 298.15 | 0.9007 | 0.0011 |
| 298.15 | 1.0000 | 0.0010 |
| 303.15 | 0.0000 | 0.0017 |
| 303.15 | 0.1017 | 0.0016 |
| 303.15 | 0.1976 | 0.0015 |
| 303.15 | 0.2978 | 0.0014 |
| 303.15 | 0.3621 | 0.0014 |
| 303.15 | 0.4971 | 0.0013 |
| 303.15 | 0.5975 | 0.0012 |
| 303.15 | 0.6977 | 0.0011 |
| 303.15 | 0.8016 | 0.0011 |
| 303.15 | 0.9007 | 0.0010 |
| 303.15 | 1.0000 | 0.0009 |
| 308.15 | 0.0000 | 0.0015 |
| 308.15 | 0.1017 | 0.0014 |
| 308.15 | 0.1976 | 0.0014 |
| 308.15 | 0.2978 | 0.0013 |
| 308.15 | 0.3621 | 0.0012 |
| 308.15 | 0.4971 | 0.0011 |
| 308.15 | 0.5975 | 0.0011 |
| 308.15 | 0.6977 | 0.0010 |
| 308.15 | 0.8016 | 0.0010 |
| 308.15 | 0.9007 | 0.0009 |
| 308.15 | 1.0000 | 0.0009 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0018 |
| 298.15 | 0.1017 | 0.0017 |
| 298.15 | 0.1976 | 0.0016 |
| 298.15 | 0.2978 | 0.0015 |
| 298.15 | 0.3621 | 0.0015 |
| 298.15 | 0.4971 | 0.0014 |
| 298.15 | 0.5975 | 0.0013 |
| 298.15 | 0.6977 | 0.0012 |
| 298.15 | 0.8016 | 0.0011 |
| 298.15 | 0.9007 | 0.0011 |
| 298.15 | 1.0000 | 0.0010 |
| 303.15 | 0.0000 | 0.0017 |
| 303.15 | 0.1017 | 0.0016 |
| 303.15 | 0.1976 | 0.0015 |
| 303.15 | 0.2978 | 0.0014 |
| 303.15 | 0.3621 | 0.0014 |
| 303.15 | 0.4971 | 0.0013 |
| 303.15 | 0.5975 | 0.0012 |
| 303.15 | 0.6977 | 0.0011 |
| 303.15 | 0.8016 | 0.0011 |
| 303.15 | 0.9007 | 0.0010 |
| 303.15 | 1.0000 | 0.0009 |
| 308.15 | 0.0000 | 0.0015 |
| 308.15 | 0.1017 | 0.0014 |
| 308.15 | 0.1976 | 0.0014 |
| 308.15 | 0.2978 | 0.0013 |
| 308.15 | 0.3621 | 0.0012 |
| 308.15 | 0.4971 | 0.0011 |
| 308.15 | 0.5975 | 0.0011 |
| 308.15 | 0.6977 | 0.0010 |
| 308.15 | 0.8016 | 0.0010 |
| 308.15 | 0.9007 | 0.0009 |
| 308.15 | 1.0000 | 0.0009 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4084 |
| 298.15 | 0.1017 | 1.4171 |
| 298.15 | 0.1976 | 1.4257 |
| 298.15 | 0.2978 | 1.435 |
| 298.15 | 0.3621 | 1.4412 |
| 298.15 | 0.4971 | 1.4551 |
| 298.15 | 0.5975 | 1.466 |
| 298.15 | 0.6977 | 1.4773 |
| 298.15 | 0.8016 | 1.4896 |
| 298.15 | 0.9007 | 1.5021 |
| 298.15 | 1.0000 | 1.5148 |
| 303.15 | 0.0000 | 1.4061 |
| 303.15 | 0.1017 | 1.4148 |
| 303.15 | 0.1976 | 1.4232 |
| 303.15 | 0.2978 | 1.4325 |
| 303.15 | 0.3621 | 1.4388 |
| 303.15 | 0.4971 | 1.4525 |
| 303.15 | 0.5975 | 1.4634 |
| 303.15 | 0.6977 | 1.4746 |
| 303.15 | 0.8016 | 1.4868 |
| 303.15 | 0.9007 | 1.4991 |
| 303.15 | 1.0000 | 1.5124 |
| 308.15 | 0.0000 | 1.4039 |
| 308.15 | 0.1017 | 1.4124 |
| 308.15 | 0.1976 | 1.4207 |
| 308.15 | 0.2978 | 1.43 |
| 308.15 | 0.3621 | 1.4362 |
| 308.15 | 0.4971 | 1.4499 |
| 308.15 | 0.5975 | 1.4607 |
| 308.15 | 0.6977 | 1.4718 |
| 308.15 | 0.8016 | 1.484 |
| 308.15 | 0.9007 | 1.4962 |
| 308.15 | 1.0000 | 1.5092 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4084 |
| 298.15 | 0.1017 | 1.4171 |
| 298.15 | 0.1976 | 1.4257 |
| 298.15 | 0.2978 | 1.435 |
| 298.15 | 0.3621 | 1.4412 |
| 298.15 | 0.4971 | 1.4551 |
| 298.15 | 0.5975 | 1.466 |
| 298.15 | 0.6977 | 1.4773 |
| 298.15 | 0.8016 | 1.4896 |
| 298.15 | 0.9007 | 1.5021 |
| 298.15 | 1.0000 | 1.5148 |
| 303.15 | 0.0000 | 1.4061 |
| 303.15 | 0.1017 | 1.4148 |
| 303.15 | 0.1976 | 1.4232 |
| 303.15 | 0.2978 | 1.4325 |
| 303.15 | 0.3621 | 1.4388 |
| 303.15 | 0.4971 | 1.4525 |
| 303.15 | 0.5975 | 1.4634 |
| 303.15 | 0.6977 | 1.4746 |
| 303.15 | 0.8016 | 1.4868 |
| 303.15 | 0.9007 | 1.4991 |
| 303.15 | 1.0000 | 1.5124 |
| 308.15 | 0.0000 | 1.4039 |
| 308.15 | 0.1017 | 1.4124 |
| 308.15 | 0.1976 | 1.4207 |
| 308.15 | 0.2978 | 1.43 |
| 308.15 | 0.3621 | 1.4362 |
| 308.15 | 0.4971 | 1.4499 |
| 308.15 | 0.5975 | 1.4607 |
| 308.15 | 0.6977 | 1.4718 |
| 308.15 | 0.8016 | 1.484 |
| 308.15 | 0.9007 | 1.4962 |
| 308.15 | 1.0000 | 1.5092 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1072.3 |
| 298.15 | 0.1017 | 1065.8 |
| 298.15 | 0.1976 | 1059.5 |
| 298.15 | 0.2978 | 1052.6 |
| 298.15 | 0.3621 | 1047.7 |
| 298.15 | 0.4971 | 1037.4 |
| 298.15 | 0.5975 | 1029.1 |
| 298.15 | 0.6977 | 1020.1 |
| 298.15 | 0.8016 | 1010.1 |
| 298.15 | 0.9007 | 999.9 |
| 298.15 | 1.0000 | 988.9 |
| 303.15 | 0.0000 | 1066.6 |
| 303.15 | 0.1017 | 1060.1 |
| 303.15 | 0.1976 | 1053.8 |
| 303.15 | 0.2978 | 1047.1 |
| 303.15 | 0.3621 | 1042.3 |
| 303.15 | 0.4971 | 1031.9 |
| 303.15 | 0.5975 | 1023.8 |
| 303.15 | 0.6977 | 1014.9 |
| 303.15 | 0.8016 | 1005.3 |
| 303.15 | 0.9007 | 995.4 |
| 303.15 | 1.0000 | 984.1 |
| 308.15 | 0.0000 | 1060.7 |
| 308.15 | 0.1017 | 1054.3 |
| 308.15 | 0.1976 | 1048.1 |
| 308.15 | 0.2978 | 1041.4 |
| 308.15 | 0.3621 | 1036.7 |
| 308.15 | 0.4971 | 1026.5 |
| 308.15 | 0.5975 | 1018.5 |
| 308.15 | 0.6977 | 1009.7 |
| 308.15 | 0.8016 | 1000.0 |
| 308.15 | 0.9007 | 990.2 |
| 308.15 | 1.0000 | 979.4 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1072.3 |
| 298.15 | 0.1017 | 1065.8 |
| 298.15 | 0.1976 | 1059.5 |
| 298.15 | 0.2978 | 1052.6 |
| 298.15 | 0.3621 | 1047.7 |
| 298.15 | 0.4971 | 1037.4 |
| 298.15 | 0.5975 | 1029.1 |
| 298.15 | 0.6977 | 1020.1 |
| 298.15 | 0.8016 | 1010.1 |
| 298.15 | 0.9007 | 999.9 |
| 298.15 | 1.0000 | 988.9 |
| 303.15 | 0.0000 | 1066.6 |
| 303.15 | 0.1017 | 1060.1 |
| 303.15 | 0.1976 | 1053.8 |
| 303.15 | 0.2978 | 1047.1 |
| 303.15 | 0.3621 | 1042.3 |
| 303.15 | 0.4971 | 1031.9 |
| 303.15 | 0.5975 | 1023.8 |
| 303.15 | 0.6977 | 1014.9 |
| 303.15 | 0.8016 | 1005.3 |
| 303.15 | 0.9007 | 995.4 |
| 303.15 | 1.0000 | 984.1 |
| 308.15 | 0.0000 | 1060.7 |
| 308.15 | 0.1017 | 1054.3 |
| 308.15 | 0.1976 | 1048.1 |
| 308.15 | 0.2978 | 1041.4 |
| 308.15 | 0.3621 | 1036.7 |
| 308.15 | 0.4971 | 1026.5 |
| 308.15 | 0.5975 | 1018.5 |
| 308.15 | 0.6977 | 1009.7 |
| 308.15 | 0.8016 | 1000.0 |
| 308.15 | 0.9007 | 990.2 |
| 308.15 | 1.0000 | 979.4 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Anisole (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1267.0 |
| 0.1017 | 1280.0 |
| 0.1976 | 1293.0 |
| 0.2978 | 1307.0 |
| 0.3621 | 1316.0 |
| 0.4971 | 1334.0 |
| 0.5975 | 1348.0 |
| 0.6977 | 1362.0 |
| 0.8016 | 1377.0 |
| 0.9007 | 1393.0 |
| 1.0000 | 1410.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Anisole (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1267.0 |
| 0.1017 | 1280.0 |
| 0.1976 | 1293.0 |
| 0.2978 | 1307.0 |
| 0.3621 | 1316.0 |
| 0.4971 | 1334.0 |
| 0.5975 | 1348.0 |
| 0.6977 | 1362.0 |
| 0.8016 | 1377.0 |
| 0.9007 | 1393.0 |
| 1.0000 | 1410.0 |